HSPMDB001484 | 25299406 | Hsp100 | Hsp104 | Yeast | Cytosol | Inhibition of ATPase activity | NA | Hexachlorophene | 3,4,6-trichloro-2-[(2,3,5-trichloro-6-hydroxyphenyl)methyl]phenol | Oc1c(Cl)cc(Cl)c(Cl)c1Cc2c(O)c(Cl)cc(Cl)c2Cl | NIH, Spectrum, and Hit finder collection | 80.21% at 10 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | ATPase assay | NA | NA |
HSPMDB001485 | 25299406 | Hsp100 | Hsp104 | Yeast | Cytosol | Inhibition of ATPase activity | NA | Tannic acid | [2,3-dihydroxy-5-[[(2R,3R,4S,5R,6S)-3,4,5,6-tetrakis[[3,4-dihydroxy-5-(3,4,5-trihydroxybenzoyl)oxybenzoyl]oxy]oxan-2-yl]methoxycarbonyl]phenyl] 3,4,5 trihydroxybenzoate | Oc1cc(cc(O)c1O)C(=O)Oc2cc(cc(O)c2O)C(=O)OC[C@H]3O[C@@H](OC(=O)c4cc(O)c(O)c(OC(=O)c5cc(O)c(O)c(O)c5)c4)[C@H](OC(=O)c6cc(O)c(O)c(OC(=O)c7cc(O)c(O)c(O)c7)c6)[C@@H](OC(=O)c8cc(O)c(O)c(OC(=O)c9cc(O)c(O)c(O)c9)c8)[C@@H]3OC(=O)c%10cc(O)c(O)c(OC(=O)c%11cc(O)c(O)c(O)c%11)c%10 | NIH, Spectrum, and Hit finder collection | 79.79% at 10 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | ATPase assay | NA | NA |
HSPMDB001486 | 25299406 | Hsp100 | Hsp104 | Yeast | Cytosol | Inhibition of ATPase activity | NA | Cisplatin | dichloroplatinum | N.N.Cl[Pt]Cl | NIH, Spectrum, and Hit finder collection | 76.58% at 10 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | ATPase assay | NA | NA |
HSPMDB001487 | 25299406 | Hsp100 | Hsp104 | Yeast | Cytosol | Inhibition of ATPase activity | NA | carboplatin | cyclobutane-1,1-dicarboxylate platinum | C1CC(C1)(C(=O)O)C(=O)O.N.N.[Pt] | NIH, Spectrum, and Hit finder collection | 73.75% at 10 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | ATPase assay | NA | NA |
HSPMDB001488 | 25299406 | Hsp100 | Hsp104 | Yeast | Cytosol | Inhibition of ATPase activity | NA | Theaflavin monogallates | [(2R,3R)-5,7-dihydroxy-2-[3,4,5-trihydroxy-6-oxo-1-[(2R,3R)-3,5,7-trihydroxy-3,4-dihydro-2H-chromen-2-yl]benzo[7]annulen-8-yl]-3,4-dihydro-2H-chromen-3-yl] 3,4,5-trihydroxybenzoate | O[C@@H]1Cc2c(O)cc(O)cc2O[C@@H]1C3=CC(=C(O)C4=C(O)C(=O)C=C(C=C34)[C@H]5Oc6cc(O)cc(O)c6C[C@H]5OC(=O)c7cc(O)c(O)c(O)c7)O | NIH, Spectrum, and Hit finder collection | 57.25% at 10 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | ATPase assay | NA | NA |
HSPMDB001489 | 25299406 | Hsp100 | Hsp104 | Yeast | Cytosol | Inhibition of ATPase activity | NA | Suramin | 8-[[4-methyl-3-[[3-[[3-[[2-methyl-5-[(4,6,8-trisulfonatonaphthalen-1-yl)carbamoyl]phenyl]carbamoyl]phenyl]carbamoylamino]benzoyl]amino]benzoyl]amino]naphthalene-1,3,5-trisulfonate | CC1=C(C=C(C(=O)NC2=CC=C(C=3C=C(C=C(C23)S(=O)(=O)[O-])S(=O)(=O)[O-])S(=O)(=O)[O-])C=C1)NC(C1=CC(=CC=C1)NC(NC1=CC(=CC=C1)C(NC1=C(C=CC(=C1)C(NC1=CC=C(C2=CC(=CC(=C12)S(=O)(=O)[O-])S(=O)(=O)[O-])S(=O)(=O)[O-])=O)C)=O)=O)=O | NIH, Spectrum, and Hit finder collection | 50.83% at 10 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | ATPase assay | NA | NA |
HSPMDB001490 | 25299406 | Hsp100 | Hsp104 | Yeast | Cytosol | Inhibition of ATPase activity | NA | Gossypol-acetic acid complex | 7-(8-formyl-1,6,7-trihydroxy-3-methyl-5-propan-2-ylnaphthalen-2-yl)-2,3,8-trihydroxy-6-methyl-4-propan-2-ylnaphthalene-1-carbaldehyde | C(=O)C=1C(=C(C(=C2C=C(C(=C(C12)O)C1=C(C=C2C(=C(C(=C(C2=C1O)C=O)O)O)C(C)C)C)C)C(C)C)O)O | NIH, Spectrum, and Hit finder collection | 47.92%at 10 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | ATPase assay | NA | NA |
HSPMDB001491 | 25299406 | Hsp100 | Hsp104 | Yeast | Cytosol | Inhibition of ATPase activity | NA | Hematein | 4,6a,9,10-tetrahydroxy-6,7-dihydroindeno[2,1-c]chromen-3-one | Oc1cc2CC3(O)COC4=C(O)C(=O)C=CC4=C3c2cc1O | NIH, Spectrum, and Hit finder collection | 45.71% at 10 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | ATPase assay | NA | NA |
HSPMDB001492 | 25299406 | Hsp100 | Hsp104 | Yeast | Cytosol | Inhibition of ATPase activity | NA | Gossypol | 7-(8-formyl-1,6,7-trihydroxy-3-methyl-5-propan-2-ylnaphthalen-2-yl)-2,3,8-trihydroxy-6-methyl-4-propan-2-ylnaphthalene-1-carbaldehyde | CC(C)c1c(O)c(O)c(C=O)c2c(O)c(c(C)cc12)c3c(C)cc4c(C(C)C)c(O)c(O)c(C=O)c4c3O | NIH, Spectrum, and Hit finder collection | 42.33% at 10 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | ATPase assay | NA | NA |
HSPMDB001493 | 25299406 | Hsp100 | Hsp104 | Yeast | Cytosol | Inhibition of ATPase activity | NA | chlorophyllide Cu complex Na salt | 3-[20-(carboxylatomethyl)-18-(dioxidomethylidene)-8-ethenyl-13-ethyl-3,7,12,17-tetramethyl-2,3-dihydroporphyrin-2,3-id-2-yl]propanoate | CCC1=C2C=C3C(=C4C(=O)C(C(=C4[N-]3)C5=C(C(=C([N-]5)C=C6C(=C(C(=CC(=C1C)[N-]2)[N-]6)C=C)C)C)CCC(=O)[O-])C(=O)[O-])C.[Na+].[Na+].[Cu] | NIH, Spectrum, and Hit finder collection | 33.79% at 10 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | ATPase assay | NA | NA |
HSPMDB001494 | 25299406 | Hsp100 | Hsp104 | Yeast | Cytosol | Inhibition of ATPase activity | NA | Methacycline hydrochloride | 4-(dimethylamino)-1,5,10,11,12a-pentahydroxy-6-methylidene-3,12-dioxo-4,4a,5,5a-tetrahydrotetracene-2-carboxamide hydrochloride | Cl.CN(C1C(C(=C(C2(C(C3=C(C4=C(C=CC=C4C(C3C(C12)O)=C)O)O)=O)O)O)C(=O)N)=O)C | NIH, Spectrum, and Hit finder collection | 33.33% at 10 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | ATPase assay | NA | NA |
HSPMDB001495 | 25299406 | Hsp100 | Hsp104 | Yeast | Cytosol | Inhibition of ATPase activity | NA | Sucralfate sodium | [(2R,3R,4S,5R,6R)-2-[(2S,3S,4R,5R)-3,4-bis(?1-alumanyloxysulfonyloxy)-2,5-bis(?1-alumanyloxysulfonyloxymethyl)oxolan-2-yl]oxy-3,5-bis(?1-alumanyloxysulfonyloxy)-6-(?1-alumanyloxysulfonyloxymethyl)oxan-4-yl]oxysulfonyloxyaluminum;hexadecahydrate | O.O.O.O.O.O.O.O.O.O.O.O.O.O.O.O.[Al]OS(=O)(=O)O[C@@H]1[C@](O[C@@H]([C@H]1OS(=O)(=O)O[Al])COS(=O)(=O)O[Al])(COS(=O)(=O)O[Al])O[C@H]1O[C@@H]([C@H]([C@@H]([C@H]1OS(=O)(=O)O[Al])OS(=O)(=O)O[Al])OS(=O)(=O)O[Al])COS(=O)(=O)O[Al] | NIH, Spectrum, and Hit finder collection | 25.67% at 10 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | ATPase assay | NA | NA |
HSPMDB001496 | 25299406 | Hsp100 | Hsp104 | Yeast | Cytosol | Inhibition of ATPase activity | NA | Aurin tricarboxylic acid | 5-[(3-carboxy-4-hydroxyphenyl)-(3-carboxy-4-oxocyclohexa-2,5-dien-1-ylidene)methyl]-2-hydroxybenzoic acid | OC(=O)c1cc(ccc1O)C(c2ccc(O)c(c2)C(O)=O)=C3C=CC(=O)C(=C3)C(O)=O | NIH, Spectrum, and Hit finder collection | 24.25% at 10 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | ATPase assay | NA | NA |
HSPMDB001497 | 25299406 | Hsp100 | Hsp104 | Yeast | Cytosol | Inhibition of ATPase activity | NA | Epigallocatechin 3,5-digallate | (2R,3R)-7-hydroxy-5-(3,4,5-trihydroxybenzoyl)oxy-2-(3,4,5-trihydroxyphenyl)-3,4-dihydro-2H-chromen-3-yl] 3,4,5-trihydroxybenzoate | OC=1C=C(C(=O)O[C@H]2[C@H](OC3=CC(=CC(=C3C2)OC(C2=CC(=C(C(=C2)O)O)O)=O)O)C2=CC(=C(C(=C2)O)O)O)C=C(C1O)O | NIH, Spectrum, and Hit finder collection | 21.88% at 10 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | ATPase assay | NA | NA |
HSPMDB001498 | 25299406 | Hsp100 | Hsp104 | Yeast | Cytosol | Inhibition of ATPase activity | NA | Merbromin | (2',7'-dibromo-3',6'-dihydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-4'-yl)mercury(1+) | Oc1cc2Oc3c([Hg+])c(O)c(Br)cc3C4(OC(=O)c5ccccc45)c2cc1Br | NIH, Spectrum, and Hit finder collection | 21.17% at 10 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | ATPase assay | NA | NA |
HSPMDB001499 | 25299406 | Hsp100 | Hsp104 | Yeast | Cytosol | Inhibition of ATPase activity | NA | Sennoside a | (9R)-9-[(9R)-2-carboxy-4-hydroxy-10-oxo-5-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-9H-anthracen-9-yl]-4-hydroxy-10-oxo-5-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-9H-anthracene-2-carboxylic acid | OC[C@H]1O[C@@H](Oc2cccc3[C@@H]([C@@H]4c5cccc(O[C@@H]6O[C@H](CO)[C@@H](O)[C@H](O)[C@H]6O)c5C(=O)c7c(O)cc(cc47)C(O)=O)c8cc(cc(O)c8C(=O)c23)C(O)=O)[C@H](O)[C@@H](O)[C@@H]1O | NIH, Spectrum, and Hit finder collection | 19.92% at 10 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | ATPase assay | NA | NA |
HSPMDB001500 | 25299406 | Hsp100 | Hsp104 | Yeast | Cytosol | Inhibition of chaperone activity | NA | Suramin | 8-[[4-methyl-3-[[3-[[3-[[2-methyl-5-[(4,6,8-trisulfonatonaphthalen-1-yl)carbamoyl]phenyl]carbamoyl]phenyl]carbamoylamino]benzoyl]amino]benzoyl]amino]naphthalene-1,3,5-trisulfonate | CC1=C(C=C(C(=O)NC2=CC=C(C=3C=C(C=C(C23)S(=O)(=O)[O-])S(=O)(=O)[O-])S(=O)(=O)[O-])C=C1)NC(C1=CC(=CC=C1)NC(NC1=CC(=CC=C1)C(NC1=C(C=CC(=C1)C(NC1=CC=C(C2=CC(=CC(=C12)S(=O)(=O)[O-])S(=O)(=O)[O-])S(=O)(=O)[O-])=O)C)=O)=O)=O | NIH, Spectrum, and Hit finder collection | NA | NA | NA | 10.1 | NA | NA | NA | NA | Nucleotide binding domain | Luciferase aggregate reactivation assay | NA | NA |
HSPMDB001501 | 25212124 | Hsp100 | ClpP | Bacteria | Cytosol | NA | Antibacterial activity | 1 | (S)-2-(((benzyloxy)carbonyl)amino)-3-methoxy-3-oxopropyl acetyl-L-prolinate | COC(=O)[C@H](COC(=O)[C@@H]1CCCN1C(C)=O)NC(=O)OCc2ccccc2 | Fragments of a cyclic acyldepsipeptide | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA |
HSPMDB001502 | 25212124 | Hsp100 | ClpP | Bacteria | Cytosol | NA | Antibacterial activity | 2 | (2S,3S)-3-(((benzyloxy)carbonyl)amino)-4-methoxy-4-oxobutan-2-yl acetyl-L-prolinate | COC(=O)[C@@H](NC(=O)OCc1ccccc1)[C@H](C)OC(=O)[C@@H]2CCCN2C(C)=O | Fragments of a cyclic acyldepsipeptide | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA |
HSPMDB001503 | 25212124 | Hsp100 | ClpP | Bacteria | Cytosol | NA | Antibacterial activity | 3 | (2R,3S)-3-(((benzyloxy)carbonyl)amino)-4-methoxy-4-oxobutan-2-yl acetyl-L-prolinate | COC(=O)[C@@H](NC(=O)OCc1ccccc1)[C@@H](C)OC(=O)[C@@H]2CCCN2C(C)=O | Fragments of a cyclic acyldepsipeptide | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA |
HSPMDB001504 | 25212124 | Hsp100 | ClpP | Bacteria | Cytosol | NA | Antibacterial activity | 4 | (S)-2-((S)-3-(3,5-difluorophenyl)-2-((E)-hex-2-enamido)propanamido)-3-methoxy-3-oxopropyl acetyl-L-prolinate | CCC/C=C/C(=O)N[C@@H](Cc1cc(F)cc(F)c1)C(=O)N[C@@H](COC(=O)[C@@H]2CCCN2C(C)=O)C(=O)OC | Fragments of a cyclic acyldepsipeptide | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA |
HSPMDB001505 | 25212124 | Hsp100 | ClpP | Bacteria | Cytosol | NA | Antibacterial activity | 5 | Methyl (S,E)-3-(3,5-difluorophenyl)-2-(hept-2-enamido)propanoate | CCCC/C=C/C(=O)N[C@@H](Cc1cc(F)cc(F)c1)C(=O)OC | Fragments of a cyclic acyldepsipeptide | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA |
HSPMDB001506 | 25212124 | Hsp100 | ClpP | Bacteria | Cytosol | NA | Antibacterial activity | 4 | (S)-2-((S)-3-(3,5-difluorophenyl)-2-((E)-hex-2-enamido)propanamido)-3-methoxy-3-oxopropyl acetyl-L-prolinate | CCC/C=C/C(=O)N[C@@H](Cc1cc(F)cc(F)c1)C(=O)N[C@@H](COC(=O)[C@@H]2CCCN2C(C)=O)C(=O)OC | N-acyldifluorophenylalanine fragment analogue | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA |
HSPMDB001507 | 25212124 | Hsp100 | ClpP | Bacteria | Cytosol | NA | Antibacterial activity | 5 | Methyl (S,E)-3-(3,5-difluorophenyl)-2-(hept-2-enamido)propanoate | CCCC/C=C/C(=O)N[C@@H](Cc1cc(F)cc(F)c1)C(=O)OC | N-acyldifluorophenylalanine fragment analogue | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA |
HSPMDB001508 | 25212124 | Hsp100 | ClpP | Bacteria | Cytosol | NA | Antibacterial activity | 6 | (2S,3S)-3-((S)-3-(3,5-difluorophenyl)-2-((E)-hex-2-enamido)propanamido)-4-methoxy-4-oxobutan-2-yl acetyl-L-prolinate | CCC/C=C/C(=O)N[C@@H](Cc1cc(F)cc(F)c1)C(=O)N[C@@H]([C@H](C)OC(=O)[C@@H]2CCCN2C(C)=O)C(=O)OC | N-acyldifluorophenylalanine fragment analogue | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA |
HSPMDB001509 | 25212124 | Hsp100 | ClpP | Bacteria | Cytosol | NA | Antibacterial activity | 7 | (2R,3S)-3-((S)-3-(3,5-difluorophenyl)-2-((E)-hex-2-enamido)propanamido)-4-methoxy-4-oxobutan-2-yl acetyl?L-prolinate | CCC/C=C/C(=O)N[C@@H](Cc1cc(F)cc(F)c1)C(=O)N[C@@H]([C@@H](C)OC(=O)[C@@H]2CCCN2C(C)=O)C(=O)OC | N-acyldifluorophenylalanine fragment analogue | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA |
HSPMDB001510 | 25212124 | Hsp100 | ClpP | Bacteria | Cytosol | NA | Antibacterial activity | 8 | Methyl (S,E)-2-(3-cyclohexylacrylamido)-3-(3,5-difluorophenyl)propanoate | COC(=O)[C@H](Cc1cc(F)cc(F)c1)NC(=O)/C=C/C2CCCCC2 | N-acyldifluorophenylalanine fragment analogue | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA |
HSPMDB001511 | 25212124 | Hsp100 | ClpP | Bacteria | Cytosol | NA | Antibacterial activity | 9 | Methyl (S)-3-(3,5-difluorophenyl)-2-((2E,4E,6E)-octa-2,4,6-trienamido)propanoate | COC(=O)[C@H](Cc1cc(F)cc(F)c1)NC(=O)\C=C\C=C\C=C\C | N-acyldifluorophenylalanine fragment analogue | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA |
HSPMDB001512 | 25212124 | Hsp100 | ClpP | Bacteria | Cytosol | NA | Antibacterial activity | 10 | Methyl (2S)-3-(3,5-difluorophenyl)-2-((E)-5-methylhept-2-enamido)propanoate | CCC(C)C/C=C/C(=O)N[C@@H](Cc1cc(F)cc(F)c1)C(=O)OC | N-acyldifluorophenylalanine fragment analogue | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA |
HSPMDB001513 | 25212124 | Hsp100 | ClpP | Bacteria | Cytosol | NA | Antibacterial activity | 11 | Methyl (S,E)-3-(3,5-difluorophenyl)-2-(hept-2?enamido)propanoate | CCCC/C=C/C(=O)N[C@@H](Cc1cc(F)cc(F)c1)C(=O)OC | N-acyldifluorophenylalanine fragment analogue | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA |
HSPMDB001514 | 25212124 | Hsp100 | ClpP | Bacteria | Cytosol | NA | Antibacterial activity | 12 | Methyl (S)-2-(3-cyclohexylpropanamido)-3-(3,5-difluorophenyl)propanoate | COC(=O)[C@H](Cc1cc(F)cc(F)c1)NC(=O)CCC2CCCCC2 | N-acyldifluorophenylalanine fragment analogue | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA |
HSPMDB001515 | 25212124 | Hsp100 | ClpP | Bacteria | Cytosol | NA | Antibacterial activity | 13 | Methyl (E)-hept-2-enoyl-L-phenylalaninate | CCCC/C=C/C(=O)N[C@@H](Cc1ccccc1)C(=O)OC | N-acyldifluorophenylalanine fragment analogue | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA |
HSPMDB001516 | 25212124 | Hsp100 | ClpP | Bacteria | Cytosol | NA | Antibacterial activity | 14 | Methyl (E)-hept-2-enoyl-L-leucinate | CCCC/C=C/C(=O)N[C@@H](CC(C)C)C(=O)OC | N-acyldifluorophenylalanine fragment analogue | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA |
HSPMDB001517 | 25212124 | Hsp100 | ClpP | Bacteria | Cytosol | NA | Antibacterial activity | 15 | 3-(3,5-difluorophenyl)-2-[(2E)-hex-2-enamido]propanoic acid | CCC/C=C/C(=O)NC(Cc1cc(F)cc(F)c1)C(O)=O | N-acyldifluorophenylalanine fragment analogue | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA |
HSPMDB001518 | 25212124 | Hsp100 | ClpP | Bacteria | Cytosol | NA | Antibacterial activity | 16 | (S,E)-N-(1-amino-3-(3,5-difluorophenyl)-1-oxopropan-2-yl)hept-2-enamide | CCCC/C=C/C(=O)N[C@@H](Cc1cc(F)cc(F)c1)C(N)=O | N-acyldifluorophenylalanine fragment analogue | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA |
HSPMDB001519 | 25212124 | Hsp100 | ClpP | Bacteria | Cytosol | NA | Antibacterial activity | 17 | (S,E)-N-(3-(3,5-difluorophenyl)-1-(methylamino)-1-oxopropan-2-yl)hept-2-enamide | CCCC/C=C/C(=O)N[C@@H](Cc1cc(F)cc(F)c1)C(=O)NC | N-acyldifluorophenylalanine fragment analogue | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA |
HSPMDB001520 | 25212124 | Hsp100 | ClpP | Bacteria | Cytosol | NA | Antibacterial activity | 18 | (S,E)-N-(3-(3,5-difluorophenyl)-1-(dimethylamino)-1-oxopropan-2-yl)hept-2-enamide | CCCC/C=C/C(=O)N[C@@H](Cc1cc(F)cc(F)c1)C(=O)N(C)C | N-acyldifluorophenylalanine fragment analogue | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA |
HSPMDB001521 | 25212124 | Hsp100 | ClpP | Bacteria | Cytosol | NA | Antibacterial activity | 19 | (furan-2-yl)methyl (2S)-3-(3,5-difluorophenyl)-2-[(2E)-hex-2-enamido]propanoate | CCC/C=C/C(=O)N[C@@H](Cc1cc(F)cc(F)c1)C(=O)OCc2occc2 | N-acyldifluorophenylalanine fragment analogue | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA |
HSPMDB001522 | 25212124 | Hsp100 | ClpP | Bacteria | Cytosol | NA | Antibacterial activity | 20 | Benzyl (S,E)-3-(3,5-difluorophenyl)-2-(hept-2?enamido)propanoate | CCCC/C=C/C(=O)N[C@@H](Cc1cc(F)cc(F)c1)C(=O)OCc2ccccc2 | N-acyldifluorophenylalanine fragment analogue | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA |
HSPMDB001523 | 25212124 | Hsp100 | ClpP | Bacteria | Cytosol | NA | Antibacterial activity | 21 | Prop-2-yn-1-yl (S,E)-3-(3,5-difluorophenyl)-2-(hept-2-enamido)propanoate | CCCC/C=C/C(=O)N[C@@H](Cc1cc(F)cc(F)c1)C(=O)OCC#C | N-acyldifluorophenylalanine fragment analogue | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA |
HSPMDB001524 | 23961953 | Hsp100 | ClpB | Bacteria | Cytosol | Inhibition of chaperone activity | NA | 1 | (3Z)-3-[3-(4-Chlorophenyl)-4-oxo-2-thioxo-1,3-thiazolidin-5- ylidene]-5-nitro-1,3-dihydro-2H-indol-2-one | [O-][N+](=O)c1ccc2NC(=O)\C(=C3/SC(=S)N(C3=O)c4ccc(Cl)cc4)c2c1 | MyriaScreen diversity collection | NA | NA | NA | 10 | NA | NA | NA | NA | Nucleotide binding domain | Luciferase aggregate reactivation assay | NA | NA |
HSPMDB001525 | 23961953 | Hsp100 | ClpB | Bacteria | Cytosol | Inhibition of chaperone activity | NA | 2 | (5Z)-5-(5-Bromo-2-oxo-1,2-dihydro-3H-indol-3-ylidene)-3-phenyl1,3-thiazolidine-2,4-dione | Brc1ccc2NC(=O)C(=C/3SC(=O)N(C3=O)c4ccccc4)/c2c1 | MyriaScreen diversity collection | NA | NA | NA | 30 | NA | NA | NA | NA | Nucleotide binding domain | Luciferase aggregate reactivation assay | NA | NA |
HSPMDB001526 | 23961953 | Hsp100 | ClpB | Bacteria | Cytosol | Inhibition of chaperone activity | NA | 3 | 5-(2-Chlorobenzyl)-2-hydroxy-3-nitrobenzaldehyde | Oc1c(C=O)cc(Cc2ccccc2Cl)cc1[N+]([O-])=O | MyriaScreen diversity collection | NA | NA | NA | 7 | NA | NA | NA | NA | Nucleotide binding domain | Luciferase aggregate reactivation assay | NA | NA |
HSPMDB001527 | 23961953 | Hsp100 | ClpB | Bacteria | Cytosol | Inhibition of chaperone activity | NA | 4 | 3,4-Dichloro-N-(3-nitrophenyl)-1-benzothiophene-2-carboxamide | [O-][N+](=O)c1cccc(NC(=O)c2sc3cccc(Cl)c3c2Cl)c1 | MyriaScreen diversity collection | NA | NA | NA | 90 | NA | NA | NA | NA | Nucleotide binding domain | Luciferase aggregate reactivation assay | NA | NA |
HSPMDB001528 | 23961953 | Hsp100 | ClpB | Bacteria | Cytosol | Inhibition of chaperone activity | NA | 5 | (4Z)-1-(4-Chlorophenyl)-4-{4-[(4-fluorobenzyl)oxy]-3- methoxybenzylidene}-3,5-pyrazolidinedione | COc1cc(ccc1OCc2ccc(F)cc2)/C=C3/C(=O)NN(C3=O)c4ccc(Cl)cc4 | MyriaScreen diversity collection | NA | NA | NA | 7.5 | NA | NA | NA | NA | Nucleotide binding domain | Luciferase aggregate reactivation assay | NA | NA |
HSPMDB001529 | 23961953 | Hsp100 | ClpB | Bacteria | Cytosol | Inhibition of chaperone activity | NA | 6 | 2-{[(3,4-Dichlorophenyl)carbamothioyl]sulfanyl}ethyl phenylcarbamate | Clc1ccc(NC(=S)SCCOC(=O)Nc2ccccc2)cc1Cl | MyriaScreen diversity collection | NA | NA | NA | 20 | NA | NA | NA | NA | Nucleotide binding domain | Luciferase aggregate reactivation assay | NA | NA |
HSPMDB001530 | 23961953 | Hsp100 | ClpB | Bacteria | Cytosol | Inhibition of chaperone activity | NA | 7 | (3Z)-3-(3-Allyl-4-oxo-2-thioxo-1,3-thiazolidin-5-ylidene)-1,3- dihydro-2H-indol-2-one | C=CCN1C(=S)S\C(C1=O)=C2/C(=O)Nc3ccccc23 | MyriaScreen diversity collection | NA | NA | NA | >100 | NA | NA | NA | NA | Nucleotide binding domain | Luciferase aggregate reactivation assay | NA | NA |
HSPMDB001531 | 23961953 | Hsp100 | ClpB | Bacteria | Cytosol | Inhibition of chaperone activity | NA | 8 | 2-(4-Chloro-5-methyl-3-nitro-1H-pyrazol-1-yl)-N-[3-(2,4- dichlorophenoxy)-5-nitrophenyl]acetamide | Cc1n(CC(=O)Nc2cc(Oc3ccc(Cl)cc3Cl)cc(c2)[N+]([O-])=O)nc(c1Cl)[N+]([O-])=O | MyriaScreen diversity collection | NA | NA | NA | >100 | NA | NA | NA | NA | Nucleotide binding domain | Luciferase aggregate reactivation assay | NA | NA |
HSPMDB001532 | 23961953 | Hsp100 | ClpB | Bacteria | Cytosol | Inhibition of chaperone activity | NA | 9 | 2-[(5Z)-5-(5-Bromo-2-oxo-1,2-dihydro-3H-indol-3-ylidene)-4-oxo-2- thioxo-1,3-thiazolidin-3-yl]-3-methylbutanoic acid | CC(C)C(N1C(=S)SC(/C1=O)=C/2C(=O)Nc3ccc(Br)cc23)C(O)=O | MyriaScreen diversity collection | NA | NA | NA | >100 | NA | NA | NA | NA | Nucleotide binding domain | Luciferase aggregate reactivation assay | NA | NA |
HSPMDB001533 | 23961953 | Hsp100 | ClpB | Bacteria | Cytosol | Inhibition of chaperone activity | NA | 10 | 1-Ethyl-4-hydroxy-N-(3-hydroxyphenyl)-2-oxo-1,2-dihydro-3- quinolinecarboxamide | CCN1C(=O)C(=C(O)c2ccccc12)C(=O)Nc3cccc(O)c3 | MyriaScreen diversity collection | NA | NA | NA | 65 | NA | NA | NA | NA | Nucleotide binding domain | Luciferase aggregate reactivation assay | NA | NA |
HSPMDB001534 | 23961953 | Hsp100 | ClpB | Bacteria | Cytosol | Inhibition of chaperone activity | NA | 11 | (1E,3E,5E)-N,N'-Diphenyl-1,3,5-hexatriene-1,6-diamine hydrochloride (1:1) | Cl.N(\C=C\C=C\C=C\Nc1ccccc1)c2ccccc2 | MyriaScreen diversity collection | NA | NA | NA | >100 | NA | NA | NA | NA | Nucleotide binding domain | Luciferase aggregate reactivation assay | NA | NA |
HSPMDB001535 | 23961953 | Hsp100 | ClpB | Bacteria | Cytosol | Inhibition of chaperone activity | NA | 12 | (3Z)-5-Bromo-3-[3-(3-methoxypropyl)-4-oxo-2-thioxo-1,3- thiazolidin-5-ylidene]-1,3-dihydro-2H-indol-2-one | COCCCN1C(=S)SC(/C1=O)=C/2C(=O)Nc3ccc(Br)cc23 | MyriaScreen diversity collection | NA | NA | NA | >100 | NA | NA | NA | NA | Nucleotide binding domain | Luciferase aggregate reactivation assay | NA | NA |
HSPMDB001536 | 23961953 | Hsp100 | ClpB | Bacteria | Cytosol | NA | Antibacterial activity | 3 | 5-(2-Chlorobenzyl)-2-hydroxy-3-nitrobenzaldehyde | Oc1c(C=O)cc(Cc2ccccc2Cl)cc1[N+]([O-])=O | MyriaScreen diversity collection | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | Bacterial growth inhibition assay (OD based) |
HSPMDB001537 | 23961953 | Hsp100 | ClpB | Bacteria | Cytosol | NA | Antibacterial activity | 6 | 2-{[(3,4-Dichlorophenyl)carbamothioyl]sulfanyl}ethyl phenylcarbamate | Clc1ccc(NC(=S)SCCOC(=O)Nc2ccccc2)cc1Cl | MyriaScreen diversity collection | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | Bacterial growth inhibition assay (OD based) |
HSPMDB001538 | 23961953 | Hsp100 | NA | Human | NA | NA | Antiproliferative activity | 3 | 5-(2-Chlorobenzyl)-2-hydroxy-3-nitrobenzaldehyde | Oc1c(C=O)cc(Cc2ccccc2Cl)cc1[N+]([O-])=O | MyriaScreen diversity collection | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | 30-50% | MTT viability assay |
HSPMDB001539 | 23961953 | Hsp100 | NA | Human | NA | NA | Antiproliferative activity | 6 | 2-{[(3,4-Dichlorophenyl)carbamothioyl]sulfanyl}ethyl phenylcarbamate | Clc1ccc(NC(=S)SCCOC(=O)Nc2ccccc2)cc1Cl | MyriaScreen diversity collection | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | 30-50% | MTT viability assay |
HSPMDB001540 | 23961953 | Hsp100 | NA | Human | NA | NA | Antiproliferative activity | 3 | 5-(2-Chlorobenzyl)-2-hydroxy-3-nitrobenzaldehyde | Oc1c(C=O)cc(Cc2ccccc2Cl)cc1[N+]([O-])=O | MyriaScreen diversity collection | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | 30-50% | MTT viability assay |
HSPMDB001541 | 23961953 | Hsp100 | NA | Human | NA | NA | Antiproliferative activity | 6 | 2-{[(3,4-Dichlorophenyl)carbamothioyl]sulfanyl}ethyl phenylcarbamate | Clc1ccc(NC(=S)SCCOC(=O)Nc2ccccc2)cc1Cl | MyriaScreen diversity collection | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | 30-50% | MTT viability assay |
HSPMDB001542 | 23961953 | Hsp100 | ClpB | Bacteria | Cytosol | Binding affinity | NA | 3 | 5-(2-Chlorobenzyl)-2-hydroxy-3-nitrobenzaldehyde | Oc1c(C=O)cc(Cc2ccccc2Cl)cc1[N+]([O-])=O | MyriaScreen diversity collection | NA | 12.9 | NA | NA | NA | NA | NA | NA | NA | Surface plasmon resonance (SPR) | NA | NA |
HSPMDB001543 | 23961953 | Hsp100 | ClpB | Bacteria | Cytosol | Binding affinity | NA | 6 | 2-{[(3,4-Dichlorophenyl)carbamothioyl]sulfanyl}ethyl phenylcarbamate | Clc1ccc(NC(=S)SCCOC(=O)Nc2ccccc2)cc1Cl | MyriaScreen diversity collection | NA | 19 | NA | NA | NA | NA | NA | NA | NA | Surface plasmon resonance (SPR) | NA | NA |
HSPMDB001544 | 21944755 | Hsp100 | ClpP | Bacteria | Cytosol | NA | Antibacterial activity | ADEPA1 | (2E,4E,6E)-N-(2-phenyl-1-{[(13S,16S)-9,13,16,17-tetramethyl-2,6,12,15,18-pentaoxo-5-oxa-1,11,14,17-tetraazatricyclo[17.3.0.0?,¹¹]docosan-3-yl]carbamoyl}ethyl)octa-2,4,6-trienamide | [H]C12CCCN1C(=O)C(COC(=O)C1([H])CC(C)CN1C(=O)[C@H](C)NC(=O)[C@H](C)N(C)C2=O)NC(=O)C(CC1=CC=CC=C1)NC(=O)\C=C\C=C\C=C\C | LOPAC 1280 , Prestwick, SPECTRUM, Maybridge, and Chembridge DIVERSet | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA |
HSPMDB001545 | 21944755 | Hsp100 | ClpP | Bacteria | Cytosol | NA | Antibacterial activity | ADEPA1 | (2E,4E,6E)-N-(2-phenyl-1-{[(13S,16S)-9,13,16,17-tetramethyl-2,6,12,15,18-pentaoxo-5-oxa-1,11,14,17-tetraazatricyclo[17.3.0.0?,¹¹]docosan-3-yl]carbamoyl}ethyl)octa-2,4,6-trienamide | [H]C12CCCN1C(=O)C(COC(=O)C1([H])CC(C)CN1C(=O)[C@H](C)NC(=O)[C@H](C)N(C)C2=O)NC(=O)C(CC1=CC=CC=C1)NC(=O)\C=C\C=C\C=C\C | LOPAC 1280 , Prestwick, SPECTRUM, Maybridge, and Chembridge DIVERSet | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA |
HSPMDB001546 | 21944755 | Hsp100 | ClpP | Bacteria | Cytosol | NA | Antibacterial activity | ADEPA1 | (2E,4E,6E)-N-(2-phenyl-1-{[(13S,16S)-9,13,16,17-tetramethyl-2,6,12,15,18-pentaoxo-5-oxa-1,11,14,17-tetraazatricyclo[17.3.0.0?,¹¹]docosan-3-yl]carbamoyl}ethyl)octa-2,4,6-trienamide | [H]C12CCCN1C(=O)C(COC(=O)C1([H])CC(C)CN1C(=O)[C@H](C)NC(=O)[C@H](C)N(C)C2=O)NC(=O)C(CC1=CC=CC=C1)NC(=O)\C=C\C=C\C=C\C | LOPAC 1280 , Prestwick, SPECTRUM, Maybridge, and Chembridge DIVERSet | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA |
HSPMDB001547 | 21944755 | Hsp100 | ClpP | Bacteria | Cytosol | NA | Antibacterial activity | ADEPA1 | (2E,4E,6E)-N-(2-phenyl-1-{[(13S,16S)-9,13,16,17-tetramethyl-2,6,12,15,18-pentaoxo-5-oxa-1,11,14,17-tetraazatricyclo[17.3.0.0?,¹¹]docosan-3-yl]carbamoyl}ethyl)octa-2,4,6-trienamide | [H]C12CCCN1C(=O)C(COC(=O)C1([H])CC(C)CN1C(=O)[C@H](C)NC(=O)[C@H](C)N(C)C2=O)NC(=O)C(CC1=CC=CC=C1)NC(=O)\C=C\C=C\C=C\C | LOPAC 1280 , Prestwick, SPECTRUM, Maybridge, and Chembridge DIVERSet | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA |
HSPMDB001548 | 21944755 | Hsp100 | ClpP | Bacteria | Cytosol | NA | Antibacterial activity | ADEPA1 | (2E,4E,6E)-N-(2-phenyl-1-{[(13S,16S)-9,13,16,17-tetramethyl-2,6,12,15,18-pentaoxo-5-oxa-1,11,14,17-tetraazatricyclo[17.3.0.0?,¹¹]docosan-3-yl]carbamoyl}ethyl)octa-2,4,6-trienamide | [H]C12CCCN1C(=O)C(COC(=O)C1([H])CC(C)CN1C(=O)[C@H](C)NC(=O)[C@H](C)N(C)C2=O)NC(=O)C(CC1=CC=CC=C1)NC(=O)\C=C\C=C\C=C\C | LOPAC 1280 , Prestwick, SPECTRUM, Maybridge, and Chembridge DIVERSet | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA |
HSPMDB001549 | 21944755 | Hsp100 | ClpP | Bacteria | Cytosol | NA | Antibacterial activity | ADEPA1 | (2E,4E,6E)-N-(2-phenyl-1-{[(13S,16S)-9,13,16,17-tetramethyl-2,6,12,15,18-pentaoxo-5-oxa-1,11,14,17-tetraazatricyclo[17.3.0.0?,¹¹]docosan-3-yl]carbamoyl}ethyl)octa-2,4,6-trienamide | [H]C12CCCN1C(=O)C(COC(=O)C1([H])CC(C)CN1C(=O)[C@H](C)NC(=O)[C@H](C)N(C)C2=O)NC(=O)C(CC1=CC=CC=C1)NC(=O)\C=C\C=C\C=C\C | LOPAC 1280 , Prestwick, SPECTRUM, Maybridge, and Chembridge DIVERSet | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA |
HSPMDB001550 | 21944755 | Hsp100 | ClpP | Bacteria | Cytosol | NA | Antibacterial activity | ADEPA1 | (2E,4E,6E)-N-(2-phenyl-1-{[(13S,16S)-9,13,16,17-tetramethyl-2,6,12,15,18-pentaoxo-5-oxa-1,11,14,17-tetraazatricyclo[17.3.0.0?,¹¹]docosan-3-yl]carbamoyl}ethyl)octa-2,4,6-trienamide | [H]C12CCCN1C(=O)C(COC(=O)C1([H])CC(C)CN1C(=O)[C@H](C)NC(=O)[C@H](C)N(C)C2=O)NC(=O)C(CC1=CC=CC=C1)NC(=O)\C=C\C=C\C=C\C | LOPAC 1280 , Prestwick, SPECTRUM, Maybridge, and Chembridge DIVERSet | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA |
HSPMDB001551 | 21944755 | Hsp100 | ClpP | Bacteria | Cytosol | NA | Antibacterial activity | ADEPA1 | (2E,4E,6E)-N-(2-phenyl-1-{[(13S,16S)-9,13,16,17-tetramethyl-2,6,12,15,18-pentaoxo-5-oxa-1,11,14,17-tetraazatricyclo[17.3.0.0?,¹¹]docosan-3-yl]carbamoyl}ethyl)octa-2,4,6-trienamide | [H]C12CCCN1C(=O)C(COC(=O)C1([H])CC(C)CN1C(=O)[C@H](C)NC(=O)[C@H](C)N(C)C2=O)NC(=O)C(CC1=CC=CC=C1)NC(=O)\C=C\C=C\C=C\C | LOPAC 1280 , Prestwick, SPECTRUM, Maybridge, and Chembridge DIVERSet | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA |
HSPMDB001552 | 21944755 | Hsp100 | ClpP | Bacteria | Cytosol | NA | Antibacterial activity | ADEPA1 | (2E,4E,6E)-N-(2-phenyl-1-{[(13S,16S)-9,13,16,17-tetramethyl-2,6,12,15,18-pentaoxo-5-oxa-1,11,14,17-tetraazatricyclo[17.3.0.0?,¹¹]docosan-3-yl]carbamoyl}ethyl)octa-2,4,6-trienamide | [H]C12CCCN1C(=O)C(COC(=O)C1([H])CC(C)CN1C(=O)[C@H](C)NC(=O)[C@H](C)N(C)C2=O)NC(=O)C(CC1=CC=CC=C1)NC(=O)\C=C\C=C\C=C\C | LOPAC 1280 , Prestwick, SPECTRUM, Maybridge, and Chembridge DIVERSet | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA |
HSPMDB001553 | 21944755 | Hsp100 | ClpP | Bacteria | Cytosol | NA | Antibacterial activity | ADEPA1 | (2E,4E,6E)-N-(2-phenyl-1-{[(13S,16S)-9,13,16,17-tetramethyl-2,6,12,15,18-pentaoxo-5-oxa-1,11,14,17-tetraazatricyclo[17.3.0.0?,¹¹]docosan-3-yl]carbamoyl}ethyl)octa-2,4,6-trienamide | [H]C12CCCN1C(=O)C(COC(=O)C1([H])CC(C)CN1C(=O)[C@H](C)NC(=O)[C@H](C)N(C)C2=O)NC(=O)C(CC1=CC=CC=C1)NC(=O)\C=C\C=C\C=C\C | LOPAC 1280 , Prestwick, SPECTRUM, Maybridge, and Chembridge DIVERSet | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA |
HSPMDB001554 | 21944755 | Hsp100 | ClpP | Bacteria | Cytosol | NA | Antibacterial activity | ACP1 | N-1-[2-(phenylthio)ethyl]-2-methyl-2-{[5-(trifluoromethyl)-2-pyridyl]sulfonyl}propanamide | CC(C)(C(=O)NCCSC1=CC=CC=C1Cl)S(=O)(=O)C1=CC=C(C=N1)C(F)(F)F | LOPAC 1280 , Prestwick, SPECTRUM, Maybridge, and Chembridge DIVERSet | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA |
HSPMDB001555 | 21944755 | Hsp100 | ClpP | Bacteria | Cytosol | NA | Antibacterial activity | ACP1 | N-1-[2-(phenylthio)ethyl]-2-methyl-2-{[5-(trifluoromethyl)-2-pyridyl]sulfonyl}propanamide | CC(C)(C(=O)NCCSC1=CC=CC=C1Cl)S(=O)(=O)C1=CC=C(C=N1)C(F)(F)F | LOPAC 1280 , Prestwick, SPECTRUM, Maybridge, and Chembridge DIVERSet | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA |
HSPMDB001556 | 21944755 | Hsp100 | ClpP | Bacteria | Cytosol | NA | Antibacterial activity | ACP1 | N-1-[2-(phenylthio)ethyl]-2-methyl-2-{[5-(trifluoromethyl)-2-pyridyl]sulfonyl}propanamide | CC(C)(C(=O)NCCSC1=CC=CC=C1Cl)S(=O)(=O)C1=CC=C(C=N1)C(F)(F)F | LOPAC 1280 , Prestwick, SPECTRUM, Maybridge, and Chembridge DIVERSet | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA |
HSPMDB001557 | 21944755 | Hsp100 | ClpP | Bacteria | Cytosol | NA | Antibacterial activity | ACP1 | N-1-[2-(phenylthio)ethyl]-2-methyl-2-{[5-(trifluoromethyl)-2-pyridyl]sulfonyl}propanamide | CC(C)(C(=O)NCCSC1=CC=CC=C1Cl)S(=O)(=O)C1=CC=C(C=N1)C(F)(F)F | LOPAC 1280 , Prestwick, SPECTRUM, Maybridge, and Chembridge DIVERSet | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA |
HSPMDB001558 | 21944755 | Hsp100 | ClpP | Bacteria | Cytosol | NA | Antibacterial activity | ACP1 | N-1-[2-(phenylthio)ethyl]-2-methyl-2-{[5-(trifluoromethyl)-2-pyridyl]sulfonyl}propanamide | CC(C)(C(=O)NCCSC1=CC=CC=C1Cl)S(=O)(=O)C1=CC=C(C=N1)C(F)(F)F | LOPAC 1280 , Prestwick, SPECTRUM, Maybridge, and Chembridge DIVERSet | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA |
HSPMDB001559 | 21944755 | Hsp100 | ClpP | Bacteria | Cytosol | NA | Antibacterial activity | ACP1 | N-1-[2-(phenylthio)ethyl]-2-methyl-2-{[5-(trifluoromethyl)-2-pyridyl]sulfonyl}propanamide | CC(C)(C(=O)NCCSC1=CC=CC=C1Cl)S(=O)(=O)C1=CC=C(C=N1)C(F)(F)F | LOPAC 1280 , Prestwick, SPECTRUM, Maybridge, and Chembridge DIVERSet | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA |
HSPMDB001560 | 21944755 | Hsp100 | ClpP | Bacteria | Cytosol | NA | Antibacterial activity | ACP1 | N-1-[2-(phenylthio)ethyl]-2-methyl-2-{[5-(trifluoromethyl)-2-pyridyl]sulfonyl}propanamide | CC(C)(C(=O)NCCSC1=CC=CC=C1Cl)S(=O)(=O)C1=CC=C(C=N1)C(F)(F)F | LOPAC 1280 , Prestwick, SPECTRUM, Maybridge, and Chembridge DIVERSet | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA |
HSPMDB001561 | 21944755 | Hsp100 | ClpP | Bacteria | Cytosol | NA | Antibacterial activity | ACP1 | N-1-[2-(phenylthio)ethyl]-2-methyl-2-{[5-(trifluoromethyl)-2-pyridyl]sulfonyl}propanamide | CC(C)(C(=O)NCCSC1=CC=CC=C1Cl)S(=O)(=O)C1=CC=C(C=N1)C(F)(F)F | LOPAC 1280 , Prestwick, SPECTRUM, Maybridge, and Chembridge DIVERSet | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA |
HSPMDB001562 | 21944755 | Hsp100 | ClpP | Bacteria | Cytosol | NA | Antibacterial activity | ACP1 | N-1-[2-(phenylthio)ethyl]-2-methyl-2-{[5-(trifluoromethyl)-2-pyridyl]sulfonyl}propanamide | CC(C)(C(=O)NCCSC1=CC=CC=C1Cl)S(=O)(=O)C1=CC=C(C=N1)C(F)(F)F | LOPAC 1280 , Prestwick, SPECTRUM, Maybridge, and Chembridge DIVERSet | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA |
HSPMDB001563 | 21944755 | Hsp100 | ClpP | Bacteria | Cytosol | NA | Antibacterial activity | ACP1 | N-1-[2-(phenylthio)ethyl]-2-methyl-2-{[5-(trifluoromethyl)-2-pyridyl]sulfonyl}propanamide | CC(C)(C(=O)NCCSC1=CC=CC=C1Cl)S(=O)(=O)C1=CC=C(C=N1)C(F)(F)F | LOPAC 1280 , Prestwick, SPECTRUM, Maybridge, and Chembridge DIVERSet | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA |
HSPMDB001564 | 21944755 | Hsp100 | ClpP | Bacteria | Cytosol | NA | Antibacterial activity | ACP2 | 3-(tertbutoxy)-2-{[2-[(5-(tertbutoxy)-2-{[(9-H-9-fluorenylmethoxy)carbonyl]amino}-5-oxopentanoyl)amino]-3-(tertbutylsulfanyl)propanoyl]amino}butanoic acid | C[C@@H](OC(C)(C)C)[C@H](NC(=O)[C@H](CS(C)(C)C)NC(=O)[C@H](CCC(=O)OC(C)(C)C)NC(=O)OCC1C2=CC=CC=C2C2=C1C=CC=C2)C(O)=C | LOPAC 1280 , Prestwick, SPECTRUM, Maybridge, and Chembridge DIVERSet | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA |
HSPMDB001565 | 21944755 | Hsp100 | ClpP | Bacteria | Cytosol | NA | Antibacterial activity | ACP2 | 3-(tertbutoxy)-2-{[2-[(5-(tertbutoxy)-2-{[(9-H-9-fluorenylmethoxy)carbonyl]amino}-5-oxopentanoyl)amino]-3-(tertbutylsulfanyl)propanoyl]amino}butanoic acid | C[C@@H](OC(C)(C)C)[C@H](NC(=O)[C@H](CS(C)(C)C)NC(=O)[C@H](CCC(=O)OC(C)(C)C)NC(=O)OCC1C2=CC=CC=C2C2=C1C=CC=C2)C(O)=C | LOPAC 1280 , Prestwick, SPECTRUM, Maybridge, and Chembridge DIVERSet | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA |
HSPMDB001566 | 21944755 | Hsp100 | ClpP | Bacteria | Cytosol | NA | Antibacterial activity | ACP2 | 3-(tertbutoxy)-2-{[2-[(5-(tertbutoxy)-2-{[(9-H-9-fluorenylmethoxy)carbonyl]amino}-5-oxopentanoyl)amino]-3-(tertbutylsulfanyl)propanoyl]amino}butanoic acid | C[C@@H](OC(C)(C)C)[C@H](NC(=O)[C@H](CS(C)(C)C)NC(=O)[C@H](CCC(=O)OC(C)(C)C)NC(=O)OCC1C2=CC=CC=C2C2=C1C=CC=C2)C(O)=C | LOPAC 1280 , Prestwick, SPECTRUM, Maybridge, and Chembridge DIVERSet | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA |
HSPMDB001567 | 21944755 | Hsp100 | ClpP | Bacteria | Cytosol | NA | Antibacterial activity | ACP2 | 3-(tertbutoxy)-2-{[2-[(5-(tertbutoxy)-2-{[(9-H-9-fluorenylmethoxy)carbonyl]amino}-5-oxopentanoyl)amino]-3-(tertbutylsulfanyl)propanoyl]amino}butanoic acid | C[C@@H](OC(C)(C)C)[C@H](NC(=O)[C@H](CS(C)(C)C)NC(=O)[C@H](CCC(=O)OC(C)(C)C)NC(=O)OCC1C2=CC=CC=C2C2=C1C=CC=C2)C(O)=C | LOPAC 1280 , Prestwick, SPECTRUM, Maybridge, and Chembridge DIVERSet | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA |
HSPMDB001568 | 21944755 | Hsp100 | ClpP | Bacteria | Cytosol | NA | Antibacterial activity | ACP2 | 3-(tertbutoxy)-2-{[2-[(5-(tertbutoxy)-2-{[(9-H-9-fluorenylmethoxy)carbonyl]amino}-5-oxopentanoyl)amino]-3-(tertbutylsulfanyl)propanoyl]amino}butanoic acid | C[C@@H](OC(C)(C)C)[C@H](NC(=O)[C@H](CS(C)(C)C)NC(=O)[C@H](CCC(=O)OC(C)(C)C)NC(=O)OCC1C2=CC=CC=C2C2=C1C=CC=C2)C(O)=C | LOPAC 1280 , Prestwick, SPECTRUM, Maybridge, and Chembridge DIVERSet | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA |
HSPMDB001569 | 21944755 | Hsp100 | ClpP | Bacteria | Cytosol | NA | Antibacterial activity | ACP2 | 3-(tertbutoxy)-2-{[2-[(5-(tertbutoxy)-2-{[(9-H-9-fluorenylmethoxy)carbonyl]amino}-5-oxopentanoyl)amino]-3-(tertbutylsulfanyl)propanoyl]amino}butanoic acid | C[C@@H](OC(C)(C)C)[C@H](NC(=O)[C@H](CS(C)(C)C)NC(=O)[C@H](CCC(=O)OC(C)(C)C)NC(=O)OCC1C2=CC=CC=C2C2=C1C=CC=C2)C(O)=C | LOPAC 1280 , Prestwick, SPECTRUM, Maybridge, and Chembridge DIVERSet | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA |
HSPMDB001570 | 21944755 | Hsp100 | ClpP | Bacteria | Cytosol | NA | Antibacterial activity | ACP2 | 3-(tertbutoxy)-2-{[2-[(5-(tertbutoxy)-2-{[(9-H-9-fluorenylmethoxy)carbonyl]amino}-5-oxopentanoyl)amino]-3-(tertbutylsulfanyl)propanoyl]amino}butanoic acid | C[C@@H](OC(C)(C)C)[C@H](NC(=O)[C@H](CS(C)(C)C)NC(=O)[C@H](CCC(=O)OC(C)(C)C)NC(=O)OCC1C2=CC=CC=C2C2=C1C=CC=C2)C(O)=C | LOPAC 1280 , Prestwick, SPECTRUM, Maybridge, and Chembridge DIVERSet | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA |
HSPMDB001571 | 21944755 | Hsp100 | ClpP | Bacteria | Cytosol | NA | Antibacterial activity | ACP2 | 3-(tertbutoxy)-2-{[2-[(5-(tertbutoxy)-2-{[(9-H-9-fluorenylmethoxy)carbonyl]amino}-5-oxopentanoyl)amino]-3-(tertbutylsulfanyl)propanoyl]amino}butanoic acid | C[C@@H](OC(C)(C)C)[C@H](NC(=O)[C@H](CS(C)(C)C)NC(=O)[C@H](CCC(=O)OC(C)(C)C)NC(=O)OCC1C2=CC=CC=C2C2=C1C=CC=C2)C(O)=C | LOPAC 1280 , Prestwick, SPECTRUM, Maybridge, and Chembridge DIVERSet | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA |
HSPMDB001572 | 21944755 | Hsp100 | ClpP | Bacteria | Cytosol | NA | Antibacterial activity | ACP2 | 3-(tertbutoxy)-2-{[2-[(5-(tertbutoxy)-2-{[(9-H-9-fluorenylmethoxy)carbonyl]amino}-5-oxopentanoyl)amino]-3-(tertbutylsulfanyl)propanoyl]amino}butanoic acid | C[C@@H](OC(C)(C)C)[C@H](NC(=O)[C@H](CS(C)(C)C)NC(=O)[C@H](CCC(=O)OC(C)(C)C)NC(=O)OCC1C2=CC=CC=C2C2=C1C=CC=C2)C(O)=C | LOPAC 1280 , Prestwick, SPECTRUM, Maybridge, and Chembridge DIVERSet | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA |
HSPMDB001573 | 21944755 | Hsp100 | ClpP | Bacteria | Cytosol | NA | Antibacterial activity | ACP2 | 3-(tertbutoxy)-2-{[2-[(5-(tertbutoxy)-2-{[(9-H-9-fluorenylmethoxy)carbonyl]amino}-5-oxopentanoyl)amino]-3-(tertbutylsulfanyl)propanoyl]amino}butanoic acid | C[C@@H](OC(C)(C)C)[C@H](NC(=O)[C@H](CS(C)(C)C)NC(=O)[C@H](CCC(=O)OC(C)(C)C)NC(=O)OCC1C2=CC=CC=C2C2=C1C=CC=C2)C(O)=C | LOPAC 1280 , Prestwick, SPECTRUM, Maybridge, and Chembridge DIVERSet | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA |
HSPMDB001574 | 21944755 | Hsp100 | ClpP | Bacteria | Cytosol | NA | Antibacterial activity | ACP3 | [4-(7-chloroquinolin-4-yl)piperazino](cyclohexyl)methanone | ClC1=CC2=C(C=C1)C(=CC=N2)N1CCN(CC1)C(=O)C1CCCCC1 | LOPAC 1280 , Prestwick, SPECTRUM, Maybridge, and Chembridge DIVERSet | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA |
HSPMDB001575 | 21944755 | Hsp100 | ClpP | Bacteria | Cytosol | NA | Antibacterial activity | ACP3 | [4-(7-chloroquinolin-4-yl)piperazino](cyclohexyl)methanone | ClC1=CC2=C(C=C1)C(=CC=N2)N1CCN(CC1)C(=O)C1CCCCC1 | LOPAC 1280 , Prestwick, SPECTRUM, Maybridge, and Chembridge DIVERSet | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA |
HSPMDB001576 | 21944755 | Hsp100 | ClpP | Bacteria | Cytosol | NA | Antibacterial activity | ACP3 | [4-(7-chloroquinolin-4-yl)piperazino](cyclohexyl)methanone | ClC1=CC2=C(C=C1)C(=CC=N2)N1CCN(CC1)C(=O)C1CCCCC1 | LOPAC 1280 , Prestwick, SPECTRUM, Maybridge, and Chembridge DIVERSet | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA |
HSPMDB001577 | 21944755 | Hsp100 | ClpP | Bacteria | Cytosol | NA | Antibacterial activity | ACP3 | [4-(7-chloroquinolin-4-yl)piperazino](cyclohexyl)methanone | ClC1=CC2=C(C=C1)C(=CC=N2)N1CCN(CC1)C(=O)C1CCCCC1 | LOPAC 1280 , Prestwick, SPECTRUM, Maybridge, and Chembridge DIVERSet | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA |
HSPMDB001578 | 21944755 | Hsp100 | ClpP | Bacteria | Cytosol | NA | Antibacterial activity | ACP3 | [4-(7-chloroquinolin-4-yl)piperazino](cyclohexyl)methanone | ClC1=CC2=C(C=C1)C(=CC=N2)N1CCN(CC1)C(=O)C1CCCCC1 | LOPAC 1280 , Prestwick, SPECTRUM, Maybridge, and Chembridge DIVERSet | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA |
HSPMDB001579 | 21944755 | Hsp100 | ClpP | Bacteria | Cytosol | NA | Antibacterial activity | ACP3 | [4-(7-chloroquinolin-4-yl)piperazino](cyclohexyl)methanone | ClC1=CC2=C(C=C1)C(=CC=N2)N1CCN(CC1)C(=O)C1CCCCC1 | LOPAC 1280 , Prestwick, SPECTRUM, Maybridge, and Chembridge DIVERSet | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA |
HSPMDB001580 | 21944755 | Hsp100 | ClpP | Bacteria | Cytosol | NA | Antibacterial activity | ACP3 | [4-(7-chloroquinolin-4-yl)piperazino](cyclohexyl)methanone | ClC1=CC2=C(C=C1)C(=CC=N2)N1CCN(CC1)C(=O)C1CCCCC1 | LOPAC 1280 , Prestwick, SPECTRUM, Maybridge, and Chembridge DIVERSet | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA |
HSPMDB001581 | 21944755 | Hsp100 | ClpP | Bacteria | Cytosol | NA | Antibacterial activity | ACP3 | [4-(7-chloroquinolin-4-yl)piperazino](cyclohexyl)methanone | ClC1=CC2=C(C=C1)C(=CC=N2)N1CCN(CC1)C(=O)C1CCCCC1 | LOPAC 1280 , Prestwick, SPECTRUM, Maybridge, and Chembridge DIVERSet | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA |
HSPMDB001582 | 21944755 | Hsp100 | ClpP | Bacteria | Cytosol | NA | Antibacterial activity | ACP3 | [4-(7-chloroquinolin-4-yl)piperazino](cyclohexyl)methanone | ClC1=CC2=C(C=C1)C(=CC=N2)N1CCN(CC1)C(=O)C1CCCCC1 | LOPAC 1280 , Prestwick, SPECTRUM, Maybridge, and Chembridge DIVERSet | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA |
HSPMDB001583 | 21944755 | Hsp100 | ClpP | Bacteria | Cytosol | NA | Antibacterial activity | ACP3 | [4-(7-chloroquinolin-4-yl)piperazino](cyclohexyl)methanone | ClC1=CC2=C(C=C1)C(=CC=N2)N1CCN(CC1)C(=O)C1CCCCC1 | LOPAC 1280 , Prestwick, SPECTRUM, Maybridge, and Chembridge DIVERSet | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA |
HSPMDB001584 | 21944755 | Hsp100 | ClpP | Bacteria | Cytosol | NA | Antibacterial activity | ACP4 | ethyl 2-(2,2-dichlorovinyl)-4-hydroxy-4-(3-nitrophenyl)-6-oxocyclohexanecarboxylate | [H]COC(=O)C1C(C=C(Cl)Cl)C(O)C(CC1=O)C1=CC=C(C=C1)N(=O)=O | LOPAC 1280 , Prestwick, SPECTRUM, Maybridge, and Chembridge DIVERSet | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA |
HSPMDB001585 | 21944755 | Hsp100 | ClpP | Bacteria | Cytosol | NA | Antibacterial activity | ACP4 | ethyl 2-(2,2-dichlorovinyl)-4-hydroxy-4-(3-nitrophenyl)-6-oxocyclohexanecarboxylate | [H]COC(=O)C1C(C=C(Cl)Cl)C(O)C(CC1=O)C1=CC=C(C=C1)N(=O)=O | LOPAC 1280 , Prestwick, SPECTRUM, Maybridge, and Chembridge DIVERSet | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA |
HSPMDB001586 | 21944755 | Hsp100 | ClpP | Bacteria | Cytosol | NA | Antibacterial activity | ACP4 | ethyl 2-(2,2-dichlorovinyl)-4-hydroxy-4-(3-nitrophenyl)-6-oxocyclohexanecarboxylate | [H]COC(=O)C1C(C=C(Cl)Cl)C(O)C(CC1=O)C1=CC=C(C=C1)N(=O)=O | LOPAC 1280 , Prestwick, SPECTRUM, Maybridge, and Chembridge DIVERSet | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA |
HSPMDB001587 | 21944755 | Hsp100 | ClpP | Bacteria | Cytosol | NA | Antibacterial activity | ACP4 | ethyl 2-(2,2-dichlorovinyl)-4-hydroxy-4-(3-nitrophenyl)-6-oxocyclohexanecarboxylate | [H]COC(=O)C1C(C=C(Cl)Cl)C(O)C(CC1=O)C1=CC=C(C=C1)N(=O)=O | LOPAC 1280 , Prestwick, SPECTRUM, Maybridge, and Chembridge DIVERSet | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA |
HSPMDB001588 | 21944755 | Hsp100 | ClpP | Bacteria | Cytosol | NA | Antibacterial activity | ACP4 | ethyl 2-(2,2-dichlorovinyl)-4-hydroxy-4-(3-nitrophenyl)-6-oxocyclohexanecarboxylate | [H]COC(=O)C1C(C=C(Cl)Cl)C(O)C(CC1=O)C1=CC=C(C=C1)N(=O)=O | LOPAC 1280 , Prestwick, SPECTRUM, Maybridge, and Chembridge DIVERSet | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA |
HSPMDB001589 | 21944755 | Hsp100 | ClpP | Bacteria | Cytosol | NA | Antibacterial activity | ACP4 | ethyl 2-(2,2-dichlorovinyl)-4-hydroxy-4-(3-nitrophenyl)-6-oxocyclohexanecarboxylate | [H]COC(=O)C1C(C=C(Cl)Cl)C(O)C(CC1=O)C1=CC=C(C=C1)N(=O)=O | LOPAC 1280 , Prestwick, SPECTRUM, Maybridge, and Chembridge DIVERSet | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA |
HSPMDB001590 | 21944755 | Hsp100 | ClpP | Bacteria | Cytosol | NA | Antibacterial activity | ACP4 | ethyl 2-(2,2-dichlorovinyl)-4-hydroxy-4-(3-nitrophenyl)-6-oxocyclohexanecarboxylate | [H]COC(=O)C1C(C=C(Cl)Cl)C(O)C(CC1=O)C1=CC=C(C=C1)N(=O)=O | LOPAC 1280 , Prestwick, SPECTRUM, Maybridge, and Chembridge DIVERSet | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA |
HSPMDB001591 | 21944755 | Hsp100 | ClpP | Bacteria | Cytosol | NA | Antibacterial activity | ACP4 | ethyl 2-(2,2-dichlorovinyl)-4-hydroxy-4-(3-nitrophenyl)-6-oxocyclohexanecarboxylate | [H]COC(=O)C1C(C=C(Cl)Cl)C(O)C(CC1=O)C1=CC=C(C=C1)N(=O)=O | LOPAC 1280 , Prestwick, SPECTRUM, Maybridge, and Chembridge DIVERSet | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA |
HSPMDB001592 | 21944755 | Hsp100 | ClpP | Bacteria | Cytosol | NA | Antibacterial activity | ACP4 | ethyl 2-(2,2-dichlorovinyl)-4-hydroxy-4-(3-nitrophenyl)-6-oxocyclohexanecarboxylate | [H]COC(=O)C1C(C=C(Cl)Cl)C(O)C(CC1=O)C1=CC=C(C=C1)N(=O)=O | LOPAC 1280 , Prestwick, SPECTRUM, Maybridge, and Chembridge DIVERSet | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA |
HSPMDB001593 | 21944755 | Hsp100 | ClpP | Bacteria | Cytosol | NA | Antibacterial activity | ACP4 | ethyl 2-(2,2-dichlorovinyl)-4-hydroxy-4-(3-nitrophenyl)-6-oxocyclohexanecarboxylate | [H]COC(=O)C1C(C=C(Cl)Cl)C(O)C(CC1=O)C1=CC=C(C=C1)N(=O)=O | LOPAC 1280 , Prestwick, SPECTRUM, Maybridge, and Chembridge DIVERSet | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA |
HSPMDB001594 | 21944755 | Hsp100 | ClpP | Bacteria | Cytosol | NA | Antibacterial activity | ACP5 | ethyl 4-(4-bromophenyl)-2-(2,2-dichlorovinyl)-4-hydroxy-6-oxocyclohexanecarboxylate | [H]COC(=O)C1C(C=C(Cl)Cl)C(O)C(CC1=O)C1=CC=C(Br)C=C1 | LOPAC 1280 , Prestwick, SPECTRUM, Maybridge, and Chembridge DIVERSet | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA |
HSPMDB001595 | 21944755 | Hsp100 | ClpP | Bacteria | Cytosol | NA | Antibacterial activity | ACP5 | ethyl 4-(4-bromophenyl)-2-(2,2-dichlorovinyl)-4-hydroxy-6-oxocyclohexanecarboxylate | [H]COC(=O)C1C(C=C(Cl)Cl)C(O)C(CC1=O)C1=CC=C(Br)C=C1 | LOPAC 1280 , Prestwick, SPECTRUM, Maybridge, and Chembridge DIVERSet | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA |
HSPMDB001596 | 21944755 | Hsp100 | ClpP | Bacteria | Cytosol | NA | Antibacterial activity | ACP5 | ethyl 4-(4-bromophenyl)-2-(2,2-dichlorovinyl)-4-hydroxy-6-oxocyclohexanecarboxylate | [H]COC(=O)C1C(C=C(Cl)Cl)C(O)C(CC1=O)C1=CC=C(Br)C=C1 | LOPAC 1280 , Prestwick, SPECTRUM, Maybridge, and Chembridge DIVERSet | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA |
HSPMDB001597 | 21944755 | Hsp100 | ClpP | Bacteria | Cytosol | NA | Antibacterial activity | ACP5 | ethyl 4-(4-bromophenyl)-2-(2,2-dichlorovinyl)-4-hydroxy-6-oxocyclohexanecarboxylate | [H]COC(=O)C1C(C=C(Cl)Cl)C(O)C(CC1=O)C1=CC=C(Br)C=C1 | LOPAC 1280 , Prestwick, SPECTRUM, Maybridge, and Chembridge DIVERSet | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA |
HSPMDB001598 | 21944755 | Hsp100 | ClpP | Bacteria | Cytosol | NA | Antibacterial activity | ACP5 | ethyl 4-(4-bromophenyl)-2-(2,2-dichlorovinyl)-4-hydroxy-6-oxocyclohexanecarboxylate | [H]COC(=O)C1C(C=C(Cl)Cl)C(O)C(CC1=O)C1=CC=C(Br)C=C1 | LOPAC 1280 , Prestwick, SPECTRUM, Maybridge, and Chembridge DIVERSet | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA |
HSPMDB001599 | 21944755 | Hsp100 | ClpP | Bacteria | Cytosol | NA | Antibacterial activity | ACP5 | ethyl 4-(4-bromophenyl)-2-(2,2-dichlorovinyl)-4-hydroxy-6-oxocyclohexanecarboxylate | [H]COC(=O)C1C(C=C(Cl)Cl)C(O)C(CC1=O)C1=CC=C(Br)C=C1 | LOPAC 1280 , Prestwick, SPECTRUM, Maybridge, and Chembridge DIVERSet | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA |
HSPMDB001600 | 21944755 | Hsp100 | ClpP | Bacteria | Cytosol | NA | Antibacterial activity | ACP5 | ethyl 4-(4-bromophenyl)-2-(2,2-dichlorovinyl)-4-hydroxy-6-oxocyclohexanecarboxylate | [H]COC(=O)C1C(C=C(Cl)Cl)C(O)C(CC1=O)C1=CC=C(Br)C=C1 | LOPAC 1280 , Prestwick, SPECTRUM, Maybridge, and Chembridge DIVERSet | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA |
HSPMDB001601 | 21944755 | Hsp100 | ClpP | Bacteria | Cytosol | NA | Antibacterial activity | ACP5 | ethyl 4-(4-bromophenyl)-2-(2,2-dichlorovinyl)-4-hydroxy-6-oxocyclohexanecarboxylate | [H]COC(=O)C1C(C=C(Cl)Cl)C(O)C(CC1=O)C1=CC=C(Br)C=C1 | LOPAC 1280 , Prestwick, SPECTRUM, Maybridge, and Chembridge DIVERSet | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA |
HSPMDB001602 | 21944755 | Hsp100 | ClpP | Bacteria | Cytosol | NA | Antibacterial activity | ACP5 | ethyl 4-(4-bromophenyl)-2-(2,2-dichlorovinyl)-4-hydroxy-6-oxocyclohexanecarboxylate | [H]COC(=O)C1C(C=C(Cl)Cl)C(O)C(CC1=O)C1=CC=C(Br)C=C1 | LOPAC 1280 , Prestwick, SPECTRUM, Maybridge, and Chembridge DIVERSet | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA |
HSPMDB001603 | 21944755 | Hsp100 | ClpP | Bacteria | Cytosol | NA | Antibacterial activity | ACP5 | ethyl 4-(4-bromophenyl)-2-(2,2-dichlorovinyl)-4-hydroxy-6-oxocyclohexanecarboxylate | [H]COC(=O)C1C(C=C(Cl)Cl)C(O)C(CC1=O)C1=CC=C(Br)C=C1 | LOPAC 1280 , Prestwick, SPECTRUM, Maybridge, and Chembridge DIVERSet | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA |
HSPMDB001604 | 21944755 | Hsp100 | ClpP | Bacteria | Cytosol | NA | Antibacterial activity | ACP1a | 2-methyl-N-(4-phenylbutan-2-yl)-2-{[5-(trifluoromethyl)pyridin-2-yl]sulfonyl}propanamide | CC(CCC1=CC=CC=C1)NC(=O)C(C)(C)S(=O)(=O)C1=CC=C(C=N1)C(F)(F)F | LOPAC 1280 , Prestwick, SPECTRUM, Maybridge, and Chembridge DIVERSet | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA |
HSPMDB001605 | 21944755 | Hsp100 | ClpP | Bacteria | Cytosol | NA | Antibacterial activity | ACP1a | 2-methyl-N-(4-phenylbutan-2-yl)-2-{[5-(trifluoromethyl)pyridin-2-yl]sulfonyl}propanamide | CC(CCC1=CC=CC=C1)NC(=O)C(C)(C)S(=O)(=O)C1=CC=C(C=N1)C(F)(F)F | LOPAC 1280 , Prestwick, SPECTRUM, Maybridge, and Chembridge DIVERSet | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA |
HSPMDB001606 | 21944755 | Hsp100 | ClpP | Bacteria | Cytosol | NA | Antibacterial activity | ACP1a | 2-methyl-N-(4-phenylbutan-2-yl)-2-{[5-(trifluoromethyl)pyridin-2-yl]sulfonyl}propanamide | CC(CCC1=CC=CC=C1)NC(=O)C(C)(C)S(=O)(=O)C1=CC=C(C=N1)C(F)(F)F | LOPAC 1280 , Prestwick, SPECTRUM, Maybridge, and Chembridge DIVERSet | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA |
HSPMDB001607 | 21944755 | Hsp100 | ClpP | Bacteria | Cytosol | NA | Antibacterial activity | ACP1a | 2-methyl-N-(4-phenylbutan-2-yl)-2-{[5-(trifluoromethyl)pyridin-2-yl]sulfonyl}propanamide | CC(CCC1=CC=CC=C1)NC(=O)C(C)(C)S(=O)(=O)C1=CC=C(C=N1)C(F)(F)F | LOPAC 1280 , Prestwick, SPECTRUM, Maybridge, and Chembridge DIVERSet | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA |
HSPMDB001608 | 21944755 | Hsp100 | ClpP | Bacteria | Cytosol | NA | Antibacterial activity | ACP1a | 2-methyl-N-(4-phenylbutan-2-yl)-2-{[5-(trifluoromethyl)pyridin-2-yl]sulfonyl}propanamide | CC(CCC1=CC=CC=C1)NC(=O)C(C)(C)S(=O)(=O)C1=CC=C(C=N1)C(F)(F)F | LOPAC 1280 , Prestwick, SPECTRUM, Maybridge, and Chembridge DIVERSet | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA |
HSPMDB001609 | 21944755 | Hsp100 | ClpP | Bacteria | Cytosol | NA | Antibacterial activity | ACP1a | 2-methyl-N-(4-phenylbutan-2-yl)-2-{[5-(trifluoromethyl)pyridin-2-yl]sulfonyl}propanamide | CC(CCC1=CC=CC=C1)NC(=O)C(C)(C)S(=O)(=O)C1=CC=C(C=N1)C(F)(F)F | LOPAC 1280 , Prestwick, SPECTRUM, Maybridge, and Chembridge DIVERSet | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA |
HSPMDB001610 | 21944755 | Hsp100 | ClpP | Bacteria | Cytosol | NA | Antibacterial activity | ACP1a | 2-methyl-N-(4-phenylbutan-2-yl)-2-{[5-(trifluoromethyl)pyridin-2-yl]sulfonyl}propanamide | CC(CCC1=CC=CC=C1)NC(=O)C(C)(C)S(=O)(=O)C1=CC=C(C=N1)C(F)(F)F | LOPAC 1280 , Prestwick, SPECTRUM, Maybridge, and Chembridge DIVERSet | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA |
HSPMDB001611 | 21944755 | Hsp100 | ClpP | Bacteria | Cytosol | NA | Antibacterial activity | ACP1a | 2-methyl-N-(4-phenylbutan-2-yl)-2-{[5-(trifluoromethyl)pyridin-2-yl]sulfonyl}propanamide | CC(CCC1=CC=CC=C1)NC(=O)C(C)(C)S(=O)(=O)C1=CC=C(C=N1)C(F)(F)F | LOPAC 1280 , Prestwick, SPECTRUM, Maybridge, and Chembridge DIVERSet | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA |
HSPMDB001612 | 21944755 | Hsp100 | ClpP | Bacteria | Cytosol | NA | Antibacterial activity | ACP1b | N-{1-[(2-chlorophenyl)sulfanyl]propan-2-yl}-2-methyl-2-{[5-(trifluoromethyl)pyridin-2-yl]sulfonyl}propanamide | CC(CSC1=CC=CC=C1Cl)NC(=O)C(C)(C)S(=O)(=O)C1=CC=C(C=N1)C(F)(F)F | LOPAC 1280 , Prestwick, SPECTRUM, Maybridge, and Chembridge DIVERSet | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA |
HSPMDB001613 | 21944755 | Hsp100 | ClpP | Bacteria | Cytosol | NA | Antibacterial activity | ACP1b | N-{1-[(2-chlorophenyl)sulfanyl]propan-2-yl}-2-methyl-2-{[5-(trifluoromethyl)pyridin-2-yl]sulfonyl}propanamide | CC(CSC1=CC=CC=C1Cl)NC(=O)C(C)(C)S(=O)(=O)C1=CC=C(C=N1)C(F)(F)F | LOPAC 1280 , Prestwick, SPECTRUM, Maybridge, and Chembridge DIVERSet | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA |
HSPMDB001614 | 21944755 | Hsp100 | ClpP | Bacteria | Cytosol | NA | Antibacterial activity | ACP1b | N-{1-[(2-chlorophenyl)sulfanyl]propan-2-yl}-2-methyl-2-{[5-(trifluoromethyl)pyridin-2-yl]sulfonyl}propanamide | CC(CSC1=CC=CC=C1Cl)NC(=O)C(C)(C)S(=O)(=O)C1=CC=C(C=N1)C(F)(F)F | LOPAC 1280 , Prestwick, SPECTRUM, Maybridge, and Chembridge DIVERSet | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA |
HSPMDB001615 | 21944755 | Hsp100 | ClpP | Bacteria | Cytosol | NA | Antibacterial activity | ACP1b | N-{1-[(2-chlorophenyl)sulfanyl]propan-2-yl}-2-methyl-2-{[5-(trifluoromethyl)pyridin-2-yl]sulfonyl}propanamide | CC(CSC1=CC=CC=C1Cl)NC(=O)C(C)(C)S(=O)(=O)C1=CC=C(C=N1)C(F)(F)F | LOPAC 1280 , Prestwick, SPECTRUM, Maybridge, and Chembridge DIVERSet | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA |
HSPMDB001616 | 21944755 | Hsp100 | ClpP | Bacteria | Cytosol | NA | Antibacterial activity | ACP1b | N-{1-[(2-chlorophenyl)sulfanyl]propan-2-yl}-2-methyl-2-{[5-(trifluoromethyl)pyridin-2-yl]sulfonyl}propanamide | CC(CSC1=CC=CC=C1Cl)NC(=O)C(C)(C)S(=O)(=O)C1=CC=C(C=N1)C(F)(F)F | LOPAC 1280 , Prestwick, SPECTRUM, Maybridge, and Chembridge DIVERSet | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA |
HSPMDB001617 | 21944755 | Hsp100 | ClpP | Bacteria | Cytosol | NA | Antibacterial activity | ACP1b | N-{1-[(2-chlorophenyl)sulfanyl]propan-2-yl}-2-methyl-2-{[5-(trifluoromethyl)pyridin-2-yl]sulfonyl}propanamide | CC(CSC1=CC=CC=C1Cl)NC(=O)C(C)(C)S(=O)(=O)C1=CC=C(C=N1)C(F)(F)F | LOPAC 1280 , Prestwick, SPECTRUM, Maybridge, and Chembridge DIVERSet | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA |
HSPMDB001618 | 21944755 | Hsp100 | ClpP | Bacteria | Cytosol | NA | Antibacterial activity | ACP1b | N-{1-[(2-chlorophenyl)sulfanyl]propan-2-yl}-2-methyl-2-{[5-(trifluoromethyl)pyridin-2-yl]sulfonyl}propanamide | CC(CSC1=CC=CC=C1Cl)NC(=O)C(C)(C)S(=O)(=O)C1=CC=C(C=N1)C(F)(F)F | LOPAC 1280 , Prestwick, SPECTRUM, Maybridge, and Chembridge DIVERSet | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA |
HSPMDB001619 | 21944755 | Hsp100 | ClpP | Bacteria | Cytosol | NA | Antibacterial activity | ACP1b | N-{1-[(2-chlorophenyl)sulfanyl]propan-2-yl}-2-methyl-2-{[5-(trifluoromethyl)pyridin-2-yl]sulfonyl}propanamide | CC(CSC1=CC=CC=C1Cl)NC(=O)C(C)(C)S(=O)(=O)C1=CC=C(C=N1)C(F)(F)F | LOPAC 1280 , Prestwick, SPECTRUM, Maybridge, and Chembridge DIVERSet | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA |
HSPMDB001620 | 21944755 | Hsp100 | ClpP | Bacteria | Cytosol | Binding affinity | NA | ADEP1A | (2E,4E,6E)-N-(2-phenyl-1-{[(13S,16S)-9,13,16,17-tetramethyl-2,6,12,15,18-pentaoxo-5-oxa-1,11,14,17-tetraazatricyclo[17.3.0.0?,¹¹]docosan-3-yl]carbamoyl}ethyl)octa-2,4,6-trienamide | [H]C12CCCN1C(=O)C(COC(=O)C1([H])CC(C)CN1C(=O)[C@H](C)NC(=O)[C@H](C)N(C)C2=O)NC(=O)C(CC1=CC=CC=C1)NC(=O)\C=C\C=C\C=C\C | LOPAC 1280 , Prestwick, SPECTRUM, Maybridge, and Chembridge DIVERSet | NA | 0.3,n=14.6 | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Isothermal titration calorimetry (ITC) | NA | NA |
HSPMDB001621 | 21944755 | Hsp100 | ClpP | Bacteria | Cytosol | Binding affinity | NA | ADEP1B | (2E,4E,6E)-N-(2-phenyl-1-{[(13S,16S)-13,16,17-trimethyl-2,6,12,15,18-pentaoxo-5-oxa-1,11,14,17-tetraazatricyclo[17.3.0.0?,¹¹]docosan-3-yl]carbamoyl}ethyl)octa-2,4,6-trienamide | [H]C1CN2C(=O)[C@H](C)NC(=O)[C@H](C)N(C)C(=O)C3([H])CCCN3C(=O)C(COC(=O)C2([H])C1)NC(=O)C(CC1=CC=CC=C1)NC(=O)\C=C\C=C\C=C\C | LOPAC 1280 , Prestwick, SPECTRUM, Maybridge, and Chembridge DIVERSet | NA | 0.7, n=11.0 | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Isothermal titration calorimetry (ITC) | NA | NA |
HSPMDB001622 | 21944755 | Hsp100 | ClpP | Bacteria | Cytosol | Binding affinity | NA | ACP1b | N-{1-[(2-chlorophenyl)sulfanyl]propan-2-yl}-2-methyl-2-{[5-(trifluoromethyl)pyridin-2-yl]sulfonyl}propanamide | CC(CSC1=CC=CC=C1Cl)NC(=O)C(C)(C)S(=O)(=O)C1=CC=C(C=N1)C(F)(F)F | LOPAC 1280 , Prestwick, SPECTRUM, Maybridge, and Chembridge DIVERSet | NA | 3.2, n=16.1 | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Isothermal titration calorimetry (ITC) | NA | NA |
HSPMDB001623 | 21944755 | Hsp100 | ClpP | Bacteria | Cytosol | Binding affinity | NA | ADEP1A | (2E,4E,6E)-N-(2-phenyl-1-{[(13S,16S)-9,13,16,17-tetramethyl-2,6,12,15,18-pentaoxo-5-oxa-1,11,14,17-tetraazatricyclo[17.3.0.0?,¹¹]docosan-3-yl]carbamoyl}ethyl)octa-2,4,6-trienamide | [H]C12CCCN1C(=O)C(COC(=O)C1([H])CC(C)CN1C(=O)[C@H](C)NC(=O)[C@H](C)N(C)C2=O)NC(=O)C(CC1=CC=CC=C1)NC(=O)\C=C\C=C\C=C\C | LOPAC 1280 , Prestwick, SPECTRUM, Maybridge, and Chembridge DIVERSet | NA | 0.3, n=15.0 | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Isothermal titration calorimetry (ITC) | NA | NA |
HSPMDB001624 | 21944755 | Hsp100 | ClpP | Bacteria | Cytosol | Binding affinity | NA | ADEP1B | (2E,4E,6E)-N-(2-phenyl-1-{[(13S,16S)-13,16,17-trimethyl-2,6,12,15,18-pentaoxo-5-oxa-1,11,14,17-tetraazatricyclo[17.3.0.0?,¹¹]docosan-3-yl]carbamoyl}ethyl)octa-2,4,6-trienamide | [H]C1CN2C(=O)[C@H](C)NC(=O)[C@H](C)N(C)C(=O)C3([H])CCCN3C(=O)C(COC(=O)C2([H])C1)NC(=O)C(CC1=CC=CC=C1)NC(=O)\C=C\C=C\C=C\C | LOPAC 1280 , Prestwick, SPECTRUM, Maybridge, and Chembridge DIVERSet | NA | 0.7, n=11.0 | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Isothermal titration calorimetry (ITC) | NA | NA |
HSPMDB001625 | 21944755 | Hsp100 | ClpP | Bacteria | Cytosol | Binding affinity | NA | ACP1b | N-{1-[(2-chlorophenyl)sulfanyl]propan-2-yl}-2-methyl-2-{[5-(trifluoromethyl)pyridin-2-yl]sulfonyl}propanamide | CC(CSC1=CC=CC=C1Cl)NC(=O)C(C)(C)S(=O)(=O)C1=CC=C(C=N1)C(F)(F)F | LOPAC 1280 , Prestwick, SPECTRUM, Maybridge, and Chembridge DIVERSet | NA | 3.3, n=16.0 | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Isothermal titration calorimetry (ITC) | NA | NA |
HSPMDB001626 | 21944755 | Hsp100 | ClpP | Bacteria | Cytosol | Binding affinity | NA | ADEP1A | (2E,4E,6E)-N-(2-phenyl-1-{[(13S,16S)-9,13,16,17-tetramethyl-2,6,12,15,18-pentaoxo-5-oxa-1,11,14,17-tetraazatricyclo[17.3.0.0?,¹¹]docosan-3-yl]carbamoyl}ethyl)octa-2,4,6-trienamide | [H]C12CCCN1C(=O)C(COC(=O)C1([H])CC(C)CN1C(=O)[C@H](C)NC(=O)[C@H](C)N(C)C2=O)NC(=O)C(CC1=CC=CC=C1)NC(=O)\C=C\C=C\C=C\C | LOPAC 1280 , Prestwick, SPECTRUM, Maybridge, and Chembridge DIVERSet | NA | 0.4, n=14.0 | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Isothermal titration calorimetry (ITC) | NA | NA |
HSPMDB001627 | 21944755 | Hsp100 | ClpP | Bacteria | Cytosol | Binding affinity | NA | ADEP1B | (2E,4E,6E)-N-(2-phenyl-1-{[(13S,16S)-13,16,17-trimethyl-2,6,12,15,18-pentaoxo-5-oxa-1,11,14,17-tetraazatricyclo[17.3.0.0?,¹¹]docosan-3-yl]carbamoyl}ethyl)octa-2,4,6-trienamide | [H]C1CN2C(=O)[C@H](C)NC(=O)[C@H](C)N(C)C(=O)C3([H])CCCN3C(=O)C(COC(=O)C2([H])C1)NC(=O)C(CC1=CC=CC=C1)NC(=O)\C=C\C=C\C=C\C | LOPAC 1280 , Prestwick, SPECTRUM, Maybridge, and Chembridge DIVERSet | NA | 0.7, n=14.0 | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Isothermal titration calorimetry (ITC) | NA | NA |
HSPMDB001628 | 21944755 | Hsp100 | ClpP | Bacteria | Cytosol | Binding affinity | NA | ACP1b | N-{1-[(2-chlorophenyl)sulfanyl]propan-2-yl}-2-methyl-2-{[5-(trifluoromethyl)pyridin-2-yl]sulfonyl}propanamide | CC(CSC1=CC=CC=C1Cl)NC(=O)C(C)(C)S(=O)(=O)C1=CC=C(C=N1)C(F)(F)F | LOPAC 1280 , Prestwick, SPECTRUM, Maybridge, and Chembridge DIVERSet | NA | 4.1, n=14.0 | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Isothermal titration calorimetry (ITC) | NA | NA |
HSPMDB001629 | 21944755 | Hsp100 | ClpP | Bacteria | Cytosol | Binding affinity | NA | ADEP1A | (2E,4E,6E)-N-(2-phenyl-1-{[(13S,16S)-9,13,16,17-tetramethyl-2,6,12,15,18-pentaoxo-5-oxa-1,11,14,17-tetraazatricyclo[17.3.0.0?,¹¹]docosan-3-yl]carbamoyl}ethyl)octa-2,4,6-trienamide | [H]C12CCCN1C(=O)C(COC(=O)C1([H])CC(C)CN1C(=O)[C@H](C)NC(=O)[C@H](C)N(C)C2=O)NC(=O)C(CC1=CC=CC=C1)NC(=O)\C=C\C=C\C=C\C | LOPAC 1280 , Prestwick, SPECTRUM, Maybridge, and Chembridge DIVERSet | NA | 1.1 | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Surface plasmon resonance (SPR) | NA | NA |
HSPMDB001630 | 21944755 | Hsp100 | ClpP | Bacteria | Cytosol | Binding affinity | NA | ADEP1B | (2E,4E,6E)-N-(2-phenyl-1-{[(13S,16S)-13,16,17-trimethyl-2,6,12,15,18-pentaoxo-5-oxa-1,11,14,17-tetraazatricyclo[17.3.0.0?,¹¹]docosan-3-yl]carbamoyl}ethyl)octa-2,4,6-trienamide | [H]C1CN2C(=O)[C@H](C)NC(=O)[C@H](C)N(C)C(=O)C3([H])CCCN3C(=O)C(COC(=O)C2([H])C1)NC(=O)C(CC1=CC=CC=C1)NC(=O)\C=C\C=C\C=C\C | LOPAC 1280 , Prestwick, SPECTRUM, Maybridge, and Chembridge DIVERSet | NA | 1.4 | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Surface plasmon resonance (SPR) | NA | NA |
HSPMDB001631 | 21944755 | Hsp100 | ClpP | Bacteria | Cytosol | Binding affinity | NA | ACP1 | N-1-[2-(phenylthio)ethyl]-2-methyl-2-{[5-(trifluoromethyl)-2-pyridyl]sulfonyl}propanamide | CC(C)(C(=O)NCCSC1=CC=CC=C1Cl)S(=O)(=O)C1=CC=C(C=N1)C(F)(F)F | LOPAC 1280 , Prestwick, SPECTRUM, Maybridge, and Chembridge DIVERSet | NA | 128 | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Surface plasmon resonance (SPR) | NA | NA |
HSPMDB001632 | 28906057 | Hsp100 | ClpX | Bacteria | Cytosol | Inhibition of protease activity | NA | 334 | 5,11-Dihydro-11-(3-hydroxyphenyl)-12H-benzo[b]indeno[1,2-e][1,4]thiazepin-12-one | Oc1cccc(c1)C2Sc3ccccc3NC4=C2C(=O)c5ccccc45 | Synthetic chemical compounds | NA | NA | NA | <50 | NA | NA | NA | NA | Nucleotide binding domain | Substrate degradation assay (GFP) | NA | NA |
HSPMDB001633 | 28906057 | Hsp100 | ClpX | Bacteria | Cytosol | Inhibition of protease activity | NA | 358 | 5,11-Dihydro-11-(3-bromo-5-hydroxyphenyl)-12H-benzo[b]indeno[1,2-e][1,4]thiazepin12-one | Oc1cc(Br)cc(c1)C2Sc3ccccc3NC4=C2C(=O)c5ccccc45 | Synthetic chemical compounds | NA | NA | NA | <50 | NA | NA | NA | NA | Nucleotide binding domain | Substrate degradation assay (GFP) | NA | NA |
HSPMDB001634 | 28906057 | Hsp100 | ClpX | Bacteria | Cytosol | Inhibition of protease activity | NA | 369 | 2-(3-hydroxyphenyl)-17-oxo-N-(prop-2-yn-1-yl)-2?³-thia-9-azatetracyclo[8.7.0.0³,?.0¹¹,¹?]heptadeca-1(10),3(8),4,6,11,13,15-heptaene-14-carboxamide | OC=1C=C(C=CC1)[S]1C=2C(C3=CC(=CC=C3C2NC=2C=CC=CC12)C(=O)NCC#C)=O | Synthetic chemical compounds | NA | NA | NA | <50 | NA | NA | NA | NA | Nucleotide binding domain | Substrate degradation assay (GFP) | NA | NA |
HSPMDB001635 | 28906057 | Hsp100 | ClpX | Bacteria | Cytosol | Inhibition of protease activity | NA | 344 | 5,11-Dihydro-11-(3-hydroxy-5-methoxyphenyl)-12H-benzo[b]indeno[1,2- e][1,4]thiazepin-12-one | COc1cc(O)cc(c1)C2Sc3ccccc3NC4=C2C(=O)c5ccccc45 | Synthetic chemical compounds | NA | NA | NA | <50 | NA | NA | NA | NA | Nucleotide binding domain | Substrate degradation assay (GFP) | NA | NA |
HSPMDB001636 | 28906057 | Hsp100 | ClpX | Bacteria | Cytosol | Inhibition of protease activity | NA | 347 | 5,11-Dihydro-11-(3,5-dihydroxyphenyl)-12H-benzo[b]indeno[1,2-e][1,4]thiazepin-12-one | Oc1cc(O)cc(c1)C2Sc3ccccc3NC4=C2C(=O)c5ccccc45 | Synthetic chemical compounds | NA | NA | NA | <50 | NA | NA | NA | NA | Nucleotide binding domain | Substrate degradation assay (GFP) | NA | NA |
HSPMDB001637 | 28906057 | Hsp100 | ClpX | Bacteria | Cytosol | Inhibition of protease activity | NA | 336 | 10-(thiophen-2-yl)-9-thia-2-azatetracyclo[9.7.0.0³,?.0¹³,¹?]octadeca-1(11),3(8),4,6,13(18),14,16-heptaen-12-one | O=C1c2ccccc2C3=C1C(Sc4ccccc4N3)c5sccc5 | Synthetic chemical compounds | NA | NA | NA | <50 | NA | NA | NA | NA | Nucleotide binding domain | Substrate degradation assay (GFP) | NA | NA |
HSPMDB001638 | 28906057 | Hsp100 | ClpX | Bacteria | Cytosol | Inhibition of protease activity | NA | 376 | N-{2-[3-(but-3-yn-1-yl)-3H-diazirin-3-yl]ethyl}-2-(3-hydroxyphenyl)-17-oxo-2?³-thia-9-azatetracyclo[8.7.0.0³,?.0¹¹,¹?]heptadeca-1(10),3(8),4,6,11,13,15-heptaene-14-carboxamide | C(CC#C)C1(N=N1)CCNC(=O)C1=CC=C2C=3NC=4C=CC=CC4[S](C3C(C2=C1)=O)C1=CC(=CC=C1)O | Synthetic chemical compounds | NA | NA | NA | <50 | NA | NA | NA | NA | Nucleotide binding domain | Substrate degradation assay (GFP) | NA | NA |
HSPMDB001639 | 28906057 | Hsp100 | ClpX | Bacteria | Cytosol | Inhibition of protease activity | NA | 348 | 11-(3-Fluorophenyl)-5,11-dihydro-12H-benzo[b]indeno[1,2-e][1,4]thiazepin-12-one | Fc1cccc(c1)C2Sc3ccccc3NC4=C2C(=O)c5ccccc45 | Synthetic chemical compounds | NA | NA | NA | <50 | NA | NA | NA | NA | Nucleotide binding domain | Substrate degradation assay (GFP) | NA | NA |
HSPMDB001640 | 28906057 | Hsp100 | ClpX | Bacteria | Cytosol | Inhibition of protease activity | NA | 366 | 2,3-Dichloro-5,11-dihydro-11-(3-hydroxyphenyl)-12H-benzo[b]indeno[1,2- e][1,4]thiazepin-12-one | Oc1cccc(c1)C2Sc3ccccc3NC4=C2C(=O)c5cc(Cl)c(Cl)cc45 | Synthetic chemical compounds | NA | NA | NA | <50 | NA | NA | NA | NA | Nucleotide binding domain | Substrate degradation assay (GFP) | NA | NA |
HSPMDB001641 | 28906057 | Hsp100 | ClpX | Bacteria | Cytosol | Inhibition of protease activity | NA | 350 | 5,11-Dihydro-11-(3-hydroxy-5-(hex-5-ynyloxy)-phenyl)-12H-benzo[b]indeno[1,2- e][1,4]thiazepin-12-one | Oc1cc(OCCCCC#C)cc(c1)C2Sc3ccccc3NC4=C2C(=O)c5ccccc45 | Synthetic chemical compounds | NA | NA | NA | <50 | NA | NA | NA | NA | Nucleotide binding domain | Substrate degradation assay (GFP) | NA | NA |
HSPMDB001642 | 28906057 | Hsp100 | ClpX | Bacteria | Cytosol | Inhibition of protease activity | NA | 353 | 4-{12-oxo-9-thia-2-azatetracyclo[9.7.0.0³,?.0¹³,¹?]octadeca-1(11),3(8),4,6,13(18),14,16-heptaen-10-yl}phenyl formate | O=COc1ccc(cc1)C2Sc3ccccc3NC4=C2C(=O)c5ccccc45 | Synthetic chemical compounds | NA | NA | NA | <50 | NA | NA | NA | NA | Nucleotide binding domain | Substrate degradation assay (GFP) | NA | NA |
HSPMDB001643 | 28906057 | Hsp100 | ClpX | Bacteria | Cytosol | Inhibition of protease activity | NA | 356 | 2-Ethynyl-5,11-dihydro-11-(3-hydroxyphenyl)-12H-benzo[b]indeno[1,2- e][1,4]thiazepin-12-one | Oc1cccc(c1)C2Sc3ccccc3NC4=C2C(=O)c5cc(ccc45)C#C | Synthetic chemical compounds | NA | NA | NA | <50 | NA | NA | NA | NA | Nucleotide binding domain | Substrate degradation assay (GFP) | NA | NA |
HSPMDB001644 | 28906057 | Hsp100 | ClpX | Bacteria | Cytosol | Inhibition of protease activity | NA | 340 | 5,11-Dihydro-11-phenyl-12H-benzo[b]indeno[1,2-e][1,4]thiazepin-12-one | O=C1c2ccccc2C3=C1C(Sc4ccccc4N3)c5ccccc5 | Synthetic chemical compounds | NA | NA | NA | <50 | NA | NA | NA | NA | Nucleotide binding domain | Substrate degradation assay (GFP) | NA | NA |
HSPMDB001645 | 28906057 | Hsp100 | ClpX | Bacteria | Cytosol | Inhibition of protease activity | NA | 343 | 5,11-Dihydro-11-(4-hydroxyphenyl)-12H-benzo[b]indeno[1,2-e][1,4]thiazepin-12-one | Oc1ccc(cc1)C2Sc3ccccc3NC4=C2C(=O)c5ccccc45 | Synthetic chemical compounds | NA | NA | NA | <50 | NA | NA | NA | NA | Nucleotide binding domain | Substrate degradation assay (GFP) | NA | NA |
HSPMDB001646 | 28906057 | Hsp100 | ClpX | Bacteria | Cytosol | Inhibition of protease activity | NA | 341 | 5,11-Dihydro-11-(3-methoxyphenyl)-12H-benzo[b]indeno[1,2-e][1,4]thiazepin-12-one | COc1cccc(c1)C2Sc3ccccc3NC4=C2C(=O)c5ccccc45 | Synthetic chemical compounds | NA | NA | NA | <50 | NA | NA | NA | NA | Nucleotide binding domain | Substrate degradation assay (GFP) | NA | NA |
HSPMDB001647 | 28906057 | Hsp100 | ClpX | Bacteria | Cytosol | Inhibition of protease activity | NA | 368 | 2-(3-hydroxyphenyl)-17-oxo-N-(prop-2-yn-1-yl)-2?³-thia-9-azatetracyclo[8.7.0.0³,?.0¹¹,¹?]heptadeca-1(10),3(8),4,6,11,13,15-heptaene-13-carboxamide | OC=1C=C(C=CC1)[S]1C=2C(C3=CC=C(C=C3C2NC=2C=CC=CC12)C(=O)NCC#C)=O | Synthetic chemical compounds | NA | NA | NA | <50 | NA | NA | NA | NA | Nucleotide binding domain | Substrate degradation assay (GFP) | NA | NA |
HSPMDB001648 | 28906057 | Hsp100 | ClpX | Bacteria | Cytosol | Inhibition of protease activity | NA | 359 | 5,11-Dihydro-11-(3-aminophenyl)-12H-benzo[b]indeno[1,2-e][1,4]thiazepin-12-one | Nc1cccc(c1)C2Sc3ccccc3NC4=C2C(=O)c5ccccc45 | Synthetic chemical compounds | NA | NA | NA | <50 | NA | NA | NA | NA | Nucleotide binding domain | Substrate degradation assay (GFP) | NA | NA |
HSPMDB001649 | 28906057 | Hsp100 | ClpX | Bacteria | Cytosol | Inhibition of protease activity | NA | 370 | 2-(3-hydroxyphenyl)-17-oxo-N-(prop-2-yn-1-yl)-2?³-thia-9-azatetracyclo[8.7.0.0³,?.0¹¹,¹?]heptadeca-1(10),3(8),4,6,11,13,15-heptaene-13-carboxamide | OC=1C=C(C=CC1)[S]1C=2C(C3=CC=C(C=C3C2NC=2C=CC=CC12)C(=O)NCC#C)=O | Synthetic chemical compounds | NA | NA | NA | <50 | NA | NA | NA | NA | Nucleotide binding domain | Substrate degradation assay (GFP) | NA | NA |
HSPMDB001650 | 28906057 | Hsp100 | ClpX | Bacteria | Cytosol | Inhibition of protease activity | NA | 351 | 5,11-Dihydro-11-(2-hydroxyphenyl)-12H-benzo[b]indeno[1,2-e][1,4]thiazepin-12-one | Oc1ccccc1C2Sc3ccccc3NC4=C2C(=O)c5ccccc45 | Synthetic chemical compounds | NA | NA | NA | <50 | NA | NA | NA | NA | Nucleotide binding domain | Substrate degradation assay (GFP) | NA | NA |
HSPMDB001651 | 28906057 | Hsp100 | ClpX | Bacteria | Cytosol | Inhibition of protease activity | NA | 367 | 5,11-Dihydro-11-(3-(hydroxymethyl)phenyl)-12H-benzo[b]indeno[1,2-e][1,4]thiazepin12-one | OCc1cccc(c1)C2Sc3ccccc3NC4=C2C(=O)c5ccccc45 | Synthetic chemical compounds | NA | NA | NA | <50 | NA | NA | NA | NA | Nucleotide binding domain | Substrate degradation assay (GFP) | NA | NA |
HSPMDB001652 | 28906057 | Hsp100 | ClpX | Bacteria | Cytosol | Inhibition of protease activity | NA | 355 | 11-(3-hydroxyphenyl)-5H-benzo[b]indeno[1,2-e][1,4]thiazepin-12(11H)-one 10,10- dioxide | Oc1cccc(c1)C2C3=C(Nc4ccccc4[S]2(=O)=O)c5ccccc5C3=O | Synthetic chemical compounds | NA | NA | NA | <50 | NA | NA | NA | NA | Nucleotide binding domain | Substrate degradation assay (GFP) | NA | NA |
HSPMDB001653 | 28906057 | Hsp100 | ClpX | Bacteria | Cytosol | Inhibition of protease activity | NA | 352 | 10-(pyridin-2-yl)-9-thia-2-azatetracyclo[9.7.0.0³,?.0¹³,¹?]octadeca-1(11),3(8),4,6,13(18),14,16-heptaen-12-one | O=C1c2ccccc2C3=C1C(Sc4ccccc4N3)c5ccccn5 | Synthetic chemical compounds | NA | NA | NA | <50 | NA | NA | NA | NA | Nucleotide binding domain | Substrate degradation assay (GFP) | NA | NA |
HSPMDB001654 | 28906057 | Hsp100 | ClpX | Bacteria | Cytosol | Inhibition of protease activity | NA | 345 | 5,11-Dihydro-11-(3-hydroxyphenyl)-8-methoxy-12H-benzo[b]indeno[1,2- e][1,4]thiazepin-12-one | COc1ccc2NC3=C(C(Sc2c1)c4cccc(O)c4)C(=O)c5ccccc35 | Synthetic chemical compounds | NA | NA | NA | <50 | NA | NA | NA | NA | Nucleotide binding domain | Substrate degradation assay (GFP) | NA | NA |
HSPMDB001655 | 28906057 | Hsp100 | ClpX | Bacteria | Cytosol | Inhibition of protease activity | NA | 346 | 11-(4-Fluorophenyl)-5,11-dihydro-12H-benzo[b]indeno[1,2-e][1,4]thiazepin-12-one | Fc1ccc(cc1)C2Sc3ccccc3NC4=C2C(=O)c5ccccc45 | Synthetic chemical compounds | NA | NA | NA | <50 | NA | NA | NA | NA | Nucleotide binding domain | Substrate degradation assay (GFP) | NA | NA |
HSPMDB001656 | 28906057 | Hsp100 | ClpX | Bacteria | Cytosol | Inhibition of protease activity | NA | 349 | 11-(4-Carboxyphenyl)-5,11-dihydro-12H-benzo[b]indeno[1,2-e][1,4]thiazepin-12-one | OC(=O)c1ccc(cc1)C2Sc3ccccc3NC4=C2C(=O)c5ccccc45 | Synthetic chemical compounds | NA | NA | NA | <50 | NA | NA | NA | NA | Nucleotide binding domain | Substrate degradation assay (GFP) | NA | NA |
HSPMDB001657 | 28906057 | Hsp100 | ClpX | Bacteria | Cytosol | Inhibition of protease activity | NA | 360 | 11-(4-(trifluoromethyl)phenyl)-5H-benzo[b]indeno[1,2-e][1,4]thiazepin-12(11H)-one | FC(F)(F)c1ccc(cc1)C2Sc3ccccc3NC4=C2C(=O)c5ccccc45 | Synthetic chemical compounds | NA | NA | NA | <50 | NA | NA | NA | NA | Nucleotide binding domain | Substrate degradation assay (GFP) | NA | NA |
HSPMDB001658 | 28906057 | Hsp100 | ClpX | Bacteria | Cytosol | Inhibition of protease activity | NA | 354 | 11-(4-fluorophenyl)-5H-benzo[b]indeno[1,2-e][1,4]thiazepin-12(11H)-one 10,10-dioxide | Fc1ccc(cc1)C2C3=C(Nc4ccccc4[S]2(=O)=O)c5ccccc5C3=O | Synthetic chemical compounds | NA | NA | NA | <50 | NA | NA | NA | NA | Nucleotide binding domain | Substrate degradation assay (GFP) | NA | NA |
HSPMDB001659 | 28906057 | Hsp100 | ClpX | Bacteria | Cytosol | Inhibition of protease activity | NA | 374 | N-{2-[3-(but-3-yn-1-yl)-3H-diazirin-3-yl]ethyl}-2-(3-methoxyphenyl)-17-oxo-2?³-thia-9-azatetracyclo[8.7.0.0³,?.0¹¹,¹?]heptadeca-1(10),3(8),4,6,11,13,15-heptaene-14-carboxamide | [H]C1=C(C=C2C(=O)C3=C(NC4=C(C=CC=C4)[S]3C3=CC=CC(OC)=C3)C2=C1)C(=O)NCCC1(CCC#C)N=N1 | Synthetic chemical compounds | NA | NA | NA | <50 | NA | NA | NA | NA | Nucleotide binding domain | Substrate degradation assay (GFP) | NA | NA |
HSPMDB001660 | 28906057 | Hsp100 | ClpX | Bacteria | Cytosol | Inhibition of protease activity | NA | 362 | 11-(3-methoxyphenyl)-5H-benzo[b]indeno[1,2-e][1,4]thiazepin-12(11H)-one 10,10- dioxide | COc1cccc(c1)C2C3=C(Nc4ccccc4[S]2(=O)=O)c5ccccc5C3=O | Synthetic chemical compounds | NA | NA | NA | <50 | NA | NA | NA | NA | Nucleotide binding domain | Substrate degradation assay (GFP) | NA | NA |
HSPMDB001661 | 28906057 | Hsp100 | ClpX | Bacteria | Cytosol | Inhibition of protease activity | NA | 364 | 11-(4-(trifluoromethyl)phenyl)-5H-benzo[b]indeno[1,2-e][1,4]thiazepin-12(11H)-one 10,10-dioxide | FC(F)(F)c1ccc(cc1)C2C3=C(Nc4ccccc4[S]2(=O)=O)c5ccccc5C3=O | Synthetic chemical compounds | NA | NA | NA | <50 | NA | NA | NA | NA | Nucleotide binding domain | Substrate degradation assay (GFP) | NA | NA |
HSPMDB001662 | 28906057 | Hsp100 | ClpX | Bacteria | Cytosol | Inhibition of protease activity | NA | 363 | 11-([1,1'-biphenyl]-4-yl)-5H-benzo[b]indeno[1,2-e][1,4]thiazepin-12(11H)-one 10,10- dioxide | O=C1c2ccccc2C3=C1C(c4ccc(cc4)c5ccccc5)[S](=O)(=O)c6ccccc6N3 | Synthetic chemical compounds | NA | NA | NA | <50 | NA | NA | NA | NA | Nucleotide binding domain | Substrate degradation assay (GFP) | NA | NA |
HSPMDB001663 | 28906057 | Hsp100 | ClpX | Bacteria | Cytosol | Inhibition of protease activity | NA | 365 | 11-([1,1'-biphenyl]-4-yl)-5H-benzo[b]indeno[1,2-e][1,4]thiazepin-12(11H)-one | O=C1c2ccccc2C3=C1C(Sc4ccccc4N3)c5ccc(cc5)c6ccccc6 | Synthetic chemical compounds | NA | NA | NA | <50 | NA | NA | NA | NA | Nucleotide binding domain | Substrate degradation assay (GFP) | NA | NA |
HSPMDB001664 | 28906057 | Hsp100 | ClpX | Bacteria | Cytosol | Inhibition of protease activity | NA | 375 | N-{2-[3-(but-3-yn-1-yl)-3H-diazirin-3-yl]ethyl}-2-(3-methoxyphenyl)-17-oxo-2?³-thia-9-azatetracyclo[8.7.0.0³,?.0¹¹,¹?]heptadeca-1(10),3(8),4,6,11,13,15-heptaene-14-carboxamide | [H]C1=C(C=C2C(=O)C3=C(NC4=C(C=CC=C4)[S]3C3=CC=CC(OC)=C3)C2=C1)C(=O)NCCC1(CCC#C)N=N1 | Synthetic chemical compounds | NA | NA | NA | <50 | NA | NA | NA | NA | Nucleotide binding domain | Substrate degradation assay (GFP) | NA | NA |
HSPMDB001665 | 24047344 | Hsp100 | ClpP | Bacteria | Cytosol | NA | Antibacterial activity | 2 | Trans 4-butyl 3-pentyloxetan-2-one | CCCCC[C@H]1[C@H](CCCC)OC1=O | Beta lactone analogue | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | Bacterial growth inhibition assay (OD based) |
HSPMDB001666 | 24047344 | Hsp100 | ClpP | Bacteria | Cytosol | NA | Antibacterial activity | 3 | Trans-4-butyl 3-heptyloxetan-2-one | CCCCCCC[C@H]1[C@H](CCCC)OC1=O | Beta lactone analogue | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | Bacterial growth inhibition assay (OD based) |
HSPMDB001667 | 24047344 | Hsp100 | ClpP | Bacteria | Cytosol | NA | Antibacterial activity | 4 | Trans-4-butyl-3-(non-8-en-1-yl)oxetan-2-one | CCCC[C@@H]1OC(=O)[C@H]1CCCCCCCC=C | Beta lactone analogue | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | Bacterial growth inhibition assay (OD based) |
HSPMDB001668 | 24047344 | Hsp100 | ClpP | Bacteria | Cytosol | NA | Antibacterial activity | 7 | Trans-3-benzyl-4-propyloxetan-2-one | CCC[C@@H]1OC(=O)[C@H]1Cc2ccccc2 | Beta lactone analogue | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | Bacterial growth inhibition assay (OD based) |
HSPMDB001669 | 24047344 | Hsp100 | ClpP | Bacteria | Cytosol | NA | Antibacterial activity | 4 | Trans-4-butyl-3-(non-8-en-1-yl)oxetan-2-one | CCCC[C@@H]1OC(=O)[C@H]1CCCCCCCC=C | Beta lactone analogue | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | Bacterial growth inhibition assay (OD based) |
HSPMDB001670 | 24047344 | Hsp100 | ClpP | Bacteria | Cytosol | NA | Antibacterial activity | 7 | Trans-3-benzyl-4-propyloxetan-2-one | CCC[C@@H]1OC(=O)[C@H]1Cc2ccccc2 | Beta lactone analogue | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | Bacterial growth inhibition assay (OD based) |
HSPMDB001671 | 24047344 | Hsp100 | ClpP | Bacteria | Cytosol | NA | Antibacterial activity | 3 | Trans-4-butyl 3-heptyloxetan-2-one | CCCCCCC[C@H]1[C@H](CCCC)OC1=O | Beta lactone analogue | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | Bacterial growth inhibition assay (OD based) |
HSPMDB001672 | 24047344 | Hsp100 | ClpP | Bacteria | Cytosol | NA | Antibacterial activity | 4 | Trans-4-butyl-3-(non-8-en-1-yl)oxetan-2-one | CCCC[C@@H]1OC(=O)[C@H]1CCCCCCCC=C | Beta lactone analogue | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | Bacterial growth inhibition assay (OD based) |
HSPMDB001673 | 24047344 | Hsp100 | ClpP | Bacteria | Cytosol | NA | Antibacterial activity | 7 | Trans-3-benzyl-4-propyloxetan-2-one | CCC[C@@H]1OC(=O)[C@H]1Cc2ccccc2 | Beta lactone analogue | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | Bacterial growth inhibition assay (OD based) |
HSPMDB001674 | 24047344 | Hsp100 | ClpP | Bacteria | Cytosol | NA | Antibacterial activity | 3 | Trans-4-butyl 3-heptyloxetan-2-one | CCCCCCC[C@H]1[C@H](CCCC)OC1=O | Beta lactone analogue | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | Bacterial growth inhibition assay (OD based) |
HSPMDB001675 | 24047344 | Hsp100 | ClpP | Bacteria | Cytosol | NA | Antibacterial activity | 4 | Trans-4-butyl-3-(non-8-en-1-yl)oxetan-2-one | CCCC[C@@H]1OC(=O)[C@H]1CCCCCCCC=C | Beta lactone analogue | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | Bacterial growth inhibition assay (OD based) |
HSPMDB001676 | 24047344 | Hsp100 | ClpP | Bacteria | Cytosol | NA | Antibacterial activity | 7 | Trans-3-benzyl-4-propyloxetan-2-one | CCC[C@@H]1OC(=O)[C@H]1Cc2ccccc2 | Beta lactone analogue | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | Bacterial growth inhibition assay (OD based) |
HSPMDB001677 | 25759383 | Hsp100 | ClpP1P2 | Human | Mitochondria | Inhibition of peptidase activity | NA | Ac-Pro-Lys-boroMet | NA | NA | Boronate compounds | NA | NA | 2.4 | NA | NA | NA | NA | NA | NA | Peptide specific clevage assay | NA | NA |
HSPMDB001678 | 25759383 | Hsp100 | ClpP1P2 | Human | Mitochondria | Inhibition of peptidase activity | NA | Ac-His-Lys-boroMet | NA | NA | Boronate compounds | NA | NA | 6.8 | NA | NA | NA | NA | NA | NA | Peptide specific clevage assay | NA | NA |
HSPMDB001679 | 25759383 | Hsp100 | ClpP1P2 | Human | Mitochondria | Inhibition of peptidase activity | NA | Ac-Ala-Lys-boroMet | NA | NA | Boronate compounds | NA | NA | 2.1 | NA | NA | NA | NA | NA | NA | Peptide specific clevage assay | NA | NA |
HSPMDB001680 | 25759383 | Hsp100 | ClpP1P2 | Human | Mitochondria | Inhibition of peptidase activity | NA | Ala(1-naphtyl)-Lys-boroLeu | NA | NA | Boronate compounds | NA | NA | 1.46 | NA | NA | NA | NA | NA | NA | Peptide specific clevage assay | NA | NA |
HSPMDB001681 | 25759383 | Hsp100 | ClpP1P2 | Human | Mitochondria | Inhibition of peptidase activity | NA | N-(Picolinoyl)-Trp-Lys-boroMet | NA | NA | Boronate compounds | NA | NA | 0.96 | NA | NA | NA | NA | NA | NA | Peptide specific clevage assay | NA | NA |
HSPMDB001682 | 25759383 | Hsp100 | ClpP1P2 | Human | Mitochondria | Inhibition of peptidase activity | NA | N-(Picolinoyl)-Ala-Lys-boroMet | NA | NA | Boronate compounds | NA | NA | 1.7 | NA | NA | NA | NA | NA | NA | Peptide specific clevage assay | NA | NA |
HSPMDB001683 | 25759383 | Hsp100 | ClpP1P2 | Human | Mitochondria | Inhibition of peptidase activity | NA | N-(Picolinoyl)-Pro-Lys-boroMet | NA | NA | Boronate compounds | NA | NA | 4.2 | NA | NA | NA | NA | NA | NA | Peptide specific clevage assay | NA | NA |
HSPMDB001684 | 25759383 | Hsp100 | ClpP1P2 | Human | Mitochondria | Inhibition of peptidase activity | NA | N-(Picolinoyl)-Lys-boroMet | NA | NA | Boronate compounds | NA | NA | 5.8 | NA | NA | NA | NA | NA | NA | Peptide specific clevage assay | NA | NA |
HSPMDB001685 | 25759383 | Hsp100 | ClpP1P2 | Human | Mitochondria | Inhibition of peptidase activity | NA | N-(3-Phenyl)propanoyl)-Lys-boroMet | NA | NA | Boronate compounds | NA | NA | 0.9 | NA | NA | NA | NA | NA | NA | Peptide specific clevage assay | NA | NA |
HSPMDB001686 | 25759383 | Hsp100 | ClpP1P2 | Human | Mitochondria | Inhibition of peptidase activity | NA | N-(Benzyl)-Lys-boroMet | NA | NA | Boronate compounds | NA | NA | 2.4 | NA | NA | NA | NA | NA | NA | Peptide specific clevage assay | NA | NA |
HSPMDB001687 | 25759383 | Hsp100 | ClpP1P2 | Human | Mitochondria | Inhibition of peptidase activity | NA | N-(2-(3,5-Difluorophenyl)acetyl)-Lys-boroMet | NA | NA | Boronate compounds | NA | NA | 0.75 | NA | NA | NA | NA | NA | NA | Peptide specific clevage assay | NA | NA |
HSPMDB001688 | 25759383 | Hsp100 | ClpP1P2 | Human | Mitochondria | Inhibition of peptidase activity | NA | N-(2-(3,5-Difluorophenyl)acetyl-Trp-boroMet | NA | NA | Boronate compounds | NA | NA | 0.34 | NA | NA | NA | NA | NA | NA | Peptide specific clevage assay | NA | NA |
HSPMDB001689 | 25759383 | Hsp100 | ClpP1P2 | Human | Mitochondria | Inhibition of peptidase activity | NA | N-(1H-benzo(b)thiophene-7-carbonyl-Lys-boroMet | NA | NA | Boronate compounds | NA | NA | 0.4 | NA | NA | NA | NA | NA | NA | Peptide specific clevage assay | NA | NA |
HSPMDB001690 | 25759383 | Hsp100 | ClpP1P2 | Human | Mitochondria | Inhibition of peptidase activity | NA | N-(Phenylmetanesulfonyl)-Lys-boroMet | NA | NA | Boronate compounds | NA | NA | 11.6 | NA | NA | NA | NA | NA | NA | Peptide specific clevage assay | NA | NA |
HSPMDB001691 | 25759383 | Hsp100 | ClpP1P2 | Bacteria | Cytosol | Inhibition of peptidase activity | NA | Ac-Pro-Lys-boroMet | NA | NA | Boronate compounds | NA | NA | 0.46 | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptide specific clevage assay | NA | NA |
HSPMDB001692 | 25759383 | Hsp100 | ClpP1P2 | Bacteria | Cytosol | Inhibition of peptidase activity | NA | Ac-His-Lys-boroMet | NA | NA | Boronate compounds | NA | NA | 0.78 | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptide specific clevage assay | NA | NA |
HSPMDB001693 | 25759383 | Hsp100 | ClpP1P2 | Bacteria | Cytosol | Inhibition of peptidase activity | NA | Ac-Ala-Lys-boroMet | NA | NA | Boronate compounds | NA | NA | 0.8 | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptide specific clevage assay | NA | NA |
HSPMDB001694 | 25759383 | Hsp100 | ClpP1P2 | Bacteria | Cytosol | Inhibition of peptidase activity | NA | Ala(1-naphtyl)-Lys-boroLeu | NA | NA | Boronate compounds | NA | NA | 3.2 | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptide specific clevage assay | NA | NA |
HSPMDB001695 | 25759383 | Hsp100 | ClpP1P2 | Bacteria | Cytosol | Inhibition of peptidase activity | NA | N-(Picolinoyl)-Trp-Lys-boroMet | NA | NA | Boronate compounds | NA | NA | 0.18 | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptide specific clevage assay | NA | NA |
HSPMDB001696 | 25759383 | Hsp100 | ClpP1P2 | Bacteria | Cytosol | Inhibition of peptidase activity | NA | N-(Picolinoyl)-Ala-Lys-boroMet | NA | NA | Boronate compounds | NA | NA | 0.24 | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptide specific clevage assay | NA | NA |
HSPMDB001697 | 25759383 | Hsp100 | ClpP1P2 | Bacteria | Cytosol | Inhibition of peptidase activity | NA | N-(Picolinoyl)-Pro-Lys-boroMet | NA | NA | Boronate compounds | NA | NA | 0.82 | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptide specific clevage assay | NA | NA |
HSPMDB001698 | 25759383 | Hsp100 | ClpP1P2 | Bacteria | Cytosol | Inhibition of peptidase activity | NA | N-(Picolinoyl)-Lys-boroMet | NA | NA | Boronate compounds | NA | NA | 0..34 | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptide specific clevage assay | NA | NA |
HSPMDB001699 | 25759383 | Hsp100 | ClpP1P2 | Bacteria | Cytosol | Inhibition of peptidase activity | NA | N-(3-Phenyl)propanoyl)-Lys-boroMet | NA | NA | Boronate compounds | NA | NA | 0.23 | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptide specific clevage assay | NA | NA |
HSPMDB001700 | 25759383 | Hsp100 | ClpP1P2 | Bacteria | Cytosol | Inhibition of peptidase activity | NA | N-(Benzyl)-Lys-boroMet | NA | NA | Boronate compounds | NA | NA | 0.18 | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptide specific clevage assay | NA | NA |
HSPMDB001701 | 25759383 | Hsp100 | ClpP1P2 | Bacteria | Cytosol | Inhibition of peptidase activity | NA | N-(2-(3,5-Difluorophenyl)acetyl)-Lys-boroMet | NA | NA | Boronate compounds | NA | NA | 0.0625 | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptide specific clevage assay | NA | NA |
HSPMDB001702 | 25759383 | Hsp100 | ClpP1P2 | Bacteria | Cytosol | Inhibition of peptidase activity | NA | N-(2-(3,5-Difluorophenyl)acetyl-Trp-boroMet | NA | NA | Boronate compounds | NA | NA | 0.29 | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptide specific clevage assay | NA | NA |
HSPMDB001703 | 25759383 | Hsp100 | ClpP1P2 | Bacteria | Cytosol | Inhibition of peptidase activity | NA | N-(1H-benzo(b)thiophene-7-carbonyl-Lys-boroMet | NA | NA | Boronate compounds | NA | NA | 0.12 | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptide specific clevage assay | NA | NA |
HSPMDB001704 | 25759383 | Hsp100 | ClpP1P2 | Bacteria | Cytosol | Inhibition of peptidase activity | NA | N-(Phenylmetanesulfonyl)-Lys-boroMet | NA | NA | Boronate compounds | NA | NA | 13 | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptide specific clevage assay | NA | NA |
HSPMDB001705 | 25759383 | Hsp100 | ClpP1P2 | Bacteria | Cytosol | NA | Antibacterial activity | Ac-Pro-Lys-boroMet | NA | NA | Boronate compounds | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | Resazurin based viability assay |
HSPMDB001706 | 25759383 | Hsp100 | ClpP1P2 | Bacteria | Cytosol | NA | Antibacterial activity | Ac-His-Lys-boroMet | NA | NA | Boronate compounds | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | Resazurin based viability assay |
HSPMDB001707 | 25759383 | Hsp100 | ClpP1P2 | Bacteria | Cytosol | NA | Antibacterial activity | Ac-Ala-Lys-boroMet | NA | NA | Boronate compounds | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | Resazurin based viability assay |
HSPMDB001708 | 25759383 | Hsp100 | ClpP1P2 | Bacteria | Cytosol | NA | Antibacterial activity | Ala(1-naphtyl)-Lys-boroLeu | NA | NA | Boronate compounds | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | Resazurin based viability assay |
HSPMDB001709 | 25759383 | Hsp100 | ClpP1P2 | Bacteria | Cytosol | NA | Antibacterial activity | N-(Picolinoyl)-Trp-Lys-boroMet | NA | NA | Boronate compounds | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | Resazurin based viability assay |
HSPMDB001710 | 25759383 | Hsp100 | ClpP1P2 | Bacteria | Cytosol | NA | Antibacterial activity | N-(Picolinoyl)-Ala-Lys-boroMet | NA | NA | Boronate compounds | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | Resazurin based viability assay |
HSPMDB001711 | 25759383 | Hsp100 | ClpP1P2 | Bacteria | Cytosol | NA | Antibacterial activity | N-(Picolinoyl)-Pro-Lys-boroMet | NA | NA | Boronate compounds | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | Resazurin based viability assay |
HSPMDB001712 | 25759383 | Hsp100 | ClpP1P2 | Bacteria | Cytosol | NA | Antibacterial activity | N-(Picolinoyl)-Lys-boroMet | NA | NA | Boronate compounds | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | Resazurin based viability assay |
HSPMDB001713 | 25759383 | Hsp100 | ClpP1P2 | Bacteria | Cytosol | NA | Antibacterial activity | N-(3-Phenyl)propanoyl)-Lys-boroMet | NA | NA | Boronate compounds | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | Resazurin based viability assay |
HSPMDB001714 | 25759383 | Hsp100 | ClpP1P2 | Bacteria | Cytosol | NA | Antibacterial activity | N-(Benzyl)-Lys-boroMet | NA | NA | Boronate compounds | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | Resazurin based viability assay |
HSPMDB001715 | 25759383 | Hsp100 | ClpP1P2 | Bacteria | Cytosol | NA | Antibacterial activity | N-(2-(3,5-Difluorophenyl)acetyl)-Lys-boroMet | NA | NA | Boronate compounds | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | Resazurin based viability assay |
HSPMDB001716 | 25759383 | Hsp100 | ClpP1P2 | Bacteria | Cytosol | NA | Antibacterial activity | N-(2-(3,5-Difluorophenyl)acetyl-Trp-boroMet | NA | NA | Boronate compounds | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | Resazurin based viability assay |
HSPMDB001717 | 25759383 | Hsp100 | ClpP1P2 | Bacteria | Cytosol | NA | Antibacterial activity | N-(1H-benzo(b)thiophene-7-carbonyl-Lys-boroMet | NA | NA | Boronate compounds | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | Resazurin based viability assay |
HSPMDB001718 | 25759383 | Hsp100 | ClpP1P2 | Bacteria | Cytosol | NA | Antibacterial activity | N-(Phenylmetanesulfonyl)-Lys-boroMet | NA | NA | Boronate compounds | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | Resazurin based viability assay |
HSPMDB001719 | 25759383 | Hsp100 | ClpP1P2 | Bacteria | Cytosol | NA | Antibacterial activity | Ac-Pro-Lys-boroMet | NA | NA | Boronate compounds | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | Resazurin based viability assay |
HSPMDB001720 | 25759383 | Hsp100 | ClpP1P2 | Bacteria | Cytosol | NA | Antibacterial activity | Ac-His-Lys-boroMet | NA | NA | Boronate compounds | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | Resazurin based viability assay |
HSPMDB001721 | 25759383 | Hsp100 | ClpP1P2 | Bacteria | Cytosol | NA | Antibacterial activity | Ac-Ala-Lys-boroMet | NA | NA | Boronate compounds | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | Resazurin based viability assay |
HSPMDB001722 | 25759383 | Hsp100 | ClpP1P2 | Bacteria | Cytosol | NA | Antibacterial activity | Ala(1-naphtyl)-Lys-boroLeu | NA | NA | Boronate compounds | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | Resazurin based viability assay |
HSPMDB001723 | 25759383 | Hsp100 | ClpP1P2 | Bacteria | Cytosol | NA | Antibacterial activity | N-(Picolinoyl)-Trp-Lys-boroMet | NA | NA | Boronate compounds | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | Resazurin based viability assay |
HSPMDB001724 | 25759383 | Hsp100 | ClpP1P2 | Bacteria | Cytosol | NA | Antibacterial activity | N-(Picolinoyl)-Ala-Lys-boroMet | NA | NA | Boronate compounds | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | Resazurin based viability assay |
HSPMDB001725 | 25759383 | Hsp100 | ClpP1P2 | Bacteria | Cytosol | NA | Antibacterial activity | N-(Picolinoyl)-Pro-Lys-boroMet | NA | NA | Boronate compounds | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | Resazurin based viability assay |
HSPMDB001726 | 25759383 | Hsp100 | ClpP1P2 | Bacteria | Cytosol | NA | Antibacterial activity | N-(Picolinoyl)-Lys-boroMet | NA | NA | Boronate compounds | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | Resazurin based viability assay |
HSPMDB001727 | 25759383 | Hsp100 | ClpP1P2 | Bacteria | Cytosol | NA | Antibacterial activity | N-(3-Phenyl)propanoyl)-Lys-boroMet | NA | NA | Boronate compounds | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | Resazurin based viability assay |
HSPMDB001728 | 25759383 | Hsp100 | ClpP1P2 | Bacteria | Cytosol | NA | Antibacterial activity | N-(Benzyl)-Lys-boroMet | NA | NA | Boronate compounds | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | Resazurin based viability assay |
HSPMDB001729 | 25759383 | Hsp100 | ClpP1P2 | Bacteria | Cytosol | NA | Antibacterial activity | N-(2-(3,5-Difluorophenyl)acetyl)-Lys-boroMet | NA | NA | Boronate compounds | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | Resazurin based viability assay |
HSPMDB001730 | 25759383 | Hsp100 | ClpP1P2 | Bacteria | Cytosol | NA | Antibacterial activity | N-(2-(3,5-Difluorophenyl)acetyl-Trp-boroMet | NA | NA | Boronate compounds | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | Resazurin based viability assay |
HSPMDB001731 | 25759383 | Hsp100 | ClpP1P2 | Bacteria | Cytosol | NA | Antibacterial activity | N-(1H-benzo(b)thiophene-7-carbonyl-Lys-boroMet | NA | NA | Boronate compounds | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | Resazurin based viability assay |
HSPMDB001732 | 25759383 | Hsp100 | ClpP1P2 | Bacteria | Cytosol | NA | Antibacterial activity | N-(Phenylmetanesulfonyl)-Lys-boroMet | NA | NA | Boronate compounds | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | Resazurin based viability assay |
HSPMDB001733 | 25759383 | Hsp100 | ClpP1P2 | Bacteria | Cytosol | NA | Antibacterial activity | Ac-Pro-Lys-boroMet | NA | NA | Boronate compounds | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | Resazurin based viability assay |
HSPMDB001734 | 25759383 | Hsp100 | ClpP1P2 | Bacteria | Cytosol | NA | Antibacterial activity | Ac-His-Lys-boroMet | NA | NA | Boronate compounds | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | Resazurin based viability assay |
HSPMDB001735 | 25759383 | Hsp100 | ClpP1P2 | Bacteria | Cytosol | NA | Antibacterial activity | Ac-Ala-Lys-boroMet | NA | NA | Boronate compounds | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | Resazurin based viability assay |
HSPMDB001736 | 25759383 | Hsp100 | ClpP1P2 | Bacteria | Cytosol | NA | Antibacterial activity | Ala(1-naphtyl)-Lys-boroLeu | NA | NA | Boronate compounds | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | Resazurin based viability assay |
HSPMDB001737 | 25759383 | Hsp100 | ClpP1P2 | Bacteria | Cytosol | NA | Antibacterial activity | N-(Picolinoyl)-Trp-Lys-boroMet | NA | NA | Boronate compounds | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | Resazurin based viability assay |
HSPMDB001738 | 25759383 | Hsp100 | ClpP1P2 | Bacteria | Cytosol | NA | Antibacterial activity | N-(Picolinoyl)-Ala-Lys-boroMet | NA | NA | Boronate compounds | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | Resazurin based viability assay |
HSPMDB001739 | 25759383 | Hsp100 | ClpP1P2 | Bacteria | Cytosol | NA | Antibacterial activity | N-(Picolinoyl)-Pro-Lys-boroMet | NA | NA | Boronate compounds | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | Resazurin based viability assay |
HSPMDB001740 | 25759383 | Hsp100 | ClpP1P2 | Bacteria | Cytosol | NA | Antibacterial activity | N-(Picolinoyl)-Lys-boroMet | NA | NA | Boronate compounds | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | Resazurin based viability assay |
HSPMDB001741 | 25759383 | Hsp100 | ClpP1P2 | Bacteria | Cytosol | NA | Antibacterial activity | N-(3-Phenyl)propanoyl)-Lys-boroMet | NA | NA | Boronate compounds | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | Resazurin based viability assay |
HSPMDB001742 | 25759383 | Hsp100 | ClpP1P2 | Bacteria | Cytosol | NA | Antibacterial activity | N-(Benzyl)-Lys-boroMet | NA | NA | Boronate compounds | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | Resazurin based viability assay |
HSPMDB001743 | 25759383 | Hsp100 | ClpP1P2 | Bacteria | Cytosol | NA | Antibacterial activity | N-(2-(3,5-Difluorophenyl)acetyl)-Lys-boroMet | NA | NA | Boronate compounds | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | Resazurin based viability assay |
HSPMDB001744 | 25759383 | Hsp100 | ClpP1P2 | Bacteria | Cytosol | NA | Antibacterial activity | N-(2-(3,5-Difluorophenyl)acetyl-Trp-boroMet | NA | NA | Boronate compounds | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | Resazurin based viability assay |
HSPMDB001745 | 25759383 | Hsp100 | ClpP1P2 | Bacteria | Cytosol | NA | Antibacterial activity | N-(1H-benzo(b)thiophene-7-carbonyl-Lys-boroMet | NA | NA | Boronate compounds | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | Resazurin based viability assay |
HSPMDB001746 | 25759383 | Hsp100 | ClpP1P2 | Bacteria | Cytosol | NA | Antibacterial activity | N-(Phenylmetanesulfonyl)-Lys-boroMet | NA | NA | Boronate compounds | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | Resazurin based viability assay |
HSPMDB001747 | 25759383 | Hsp100 | ClpP1P2 | Bacteria | Cytosol | Inhibition of protease activity | NA | N-(1H-benzo(b)thiophene-7-carbonyl-Lys-boroMet | NA | NA | Boronate compounds | NA | NA | NA | 0.14 | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (Ac-PKM-amc) | NA | NA |
HSPMDB001748 | 25759383 | Hsp100 | ClpP1P2 | Bacteria | Cytosol | Inhibition of protease activity | NA | N-(1H-benzo(b)thiophene-7-carbonyl-Lys-boroMet | NA | NA | Boronate compounds | NA | NA | NA | 5.8 | NA | NA | NA | NA | Nucleotide binding domain | Substrate degradation assay (GFP-ssrA) | NA | NA |
HSPMDB001749 | 25759383 | Hsp100 | ClpP1P2 | Bacteria | Cytosol | Inhibition of protease activity | NA | N-(1H-benzo(b)thiophene-7-carbonyl-Lys-boroMet | NA | NA | Boronate compounds | NA | NA | NA | 3.2 | NA | NA | NA | NA | Nucleotide binding domain | Substrate degradation assay (FITC-casein) | NA | NA |
HSPMDB001750 | 30109319 | Hsp100 | hClpP | Human | Mitochondria | Inhibition of peptidase activity | NA | D3 | 3-(non-8-en-1-yl)-4-(pent-4-yn-1-yl)oxetan-2-one | C=CCCCCCCCC1C(CCCC#C)OC1=O | Naphthofuran derivative with 8-methoxynaphthofuran moiety | NA | NA | NA | 6.99 | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB001751 | 30109319 | Hsp100 | hClpP | Human | Mitochondria | Inhibition of peptidase activity | NA | AV176 | 4-(1,3,4-oxadiazol-2-yl)phenyl 2-{naphtho[2,1-b]furan-1-yl}acetate | O=C(CC1=COC2=C1C1=C(C=CC=C1)C=C2)OC1=CC=C(C=C1)C1=NN=CO1 | Naphthofuran derivative with 8-methoxynaphthofuran moiety | NA | NA | NA | 1.54 | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB001752 | 30109319 | Hsp100 | hClpP | Human | Mitochondria | Inhibition of peptidase activity | NA | TG42 | 4-(1,3,4-Oxadiazol-2-yl)phenyl 2-(2-ethynylnaphtho[2,1-b]furan-1-yl)acetate | O=C(Cc1c(oc2ccc3ccccc3c12)C#C)Oc4ccc(cc4)c5ocnn5 | Naphthofuran derivative with 8-methoxynaphthofuran moiety | NA | NA | NA | 0.39 | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB001753 | 30109319 | Hsp100 | hClpP | Human | Mitochondria | Inhibition of peptidase activity | NA | TG43 | 4-(1,3,4-Oxadiazol-2-yl)phenyl 2-(2-ethynylnaphtho[2,1-b]furan-1-yl)acetate | O=C(Cc1c(oc2ccc3ccccc3c12)C#C)Oc4ccc(cc4)c5ocnn5 | Naphthofuran derivative with 8-methoxynaphthofuran moiety | NA | NA | NA | 0.57 | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB001754 | 30109319 | Hsp100 | hClpP | Human | Mitochondria | Inhibition of peptidase activity | NA | TG53 | 4-(1,3,4-Oxadiazol-2-yl)phenyl 2-(2-ethynylnaphtho[2,1-b]furan-1-yl)acetate | O=C(Cc1c(oc2ccc3ccccc3c12)C#C)Oc4ccc(cc4)c5ocnn5 | Naphthofuran derivative with 8-methoxynaphthofuran moiety | NA | NA | NA | 0.33 | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB001755 | 30109319 | Hsp100 | hClpP | Human | Mitochondria | Inhibition of peptidase activity | NA | TG54 | 4-(1,3,4-Oxadiazol-2-yl)phenyl 2-(2-ethynylnaphtho[2,1-b]furan-1-yl)acetate | O=C(Cc1c(oc2ccc3ccccc3c12)C#C)Oc4ccc(cc4)c5ocnn5 | Naphthofuran derivative with 8-methoxynaphthofuran moiety | NA | NA | NA | 1.49 | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB001756 | 30109319 | Hsp100 | hClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | D3 | 3-(non-8-en-1-yl)-4-(pent-4-yn-1-yl)oxetan-2-one | C=CCCCCCCCC1C(CCCC#C)OC1=O | Naphthofuran derivative with 8-methoxynaphthofuran moiety | NA | NA | NA | 4.01 | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB001757 | 30109319 | Hsp100 | hClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | AV167 | 4-(1,3,4-oxadiazol-2-yl)phenyl 2-{naphtho[2,1-b]furan-1-yl}acetate | O=C(CC1=COC2=C1C1=C(C=CC=C1)C=C2)OC1=CC=C(C=C1)C1=NN=CO1 | Naphthofuran derivative with 8-methoxynaphthofuran moiety | NA | NA | NA | 1.44 | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB001758 | 30109319 | Hsp100 | hClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | TG42 | 4-(1,3,4-Oxadiazol-2-yl)phenyl 2-(2-ethynylnaphtho[2,1-b]furan-1-yl)acetate | O=C(Cc1c(oc2ccc3ccccc3c12)C#C)Oc4ccc(cc4)c5ocnn5 | Naphthofuran derivative with 8-methoxynaphthofuran moiety | NA | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB001759 | 30109319 | Hsp100 | hClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | TG43 | 4-(1,3,4-Oxadiazol-2-yl)phenyl 2-(2-ethynylnaphtho[2,1-b]furan-1-yl)acetate | O=C(Cc1c(oc2ccc3ccccc3c12)C#C)Oc4ccc(cc4)c5ocnn5 | Naphthofuran derivative with 8-methoxynaphthofuran moiety | NA | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB001760 | 30109319 | Hsp100 | hClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | TG53 | 4-(1,3,4-Oxadiazol-2-yl)phenyl 2-(2-ethynylnaphtho[2,1-b]furan-1-yl)acetate | O=C(Cc1c(oc2ccc3ccccc3c12)C#C)Oc4ccc(cc4)c5ocnn5 | Naphthofuran derivative with 8-methoxynaphthofuran moiety | NA | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB001761 | 30109319 | Hsp100 | hClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | TG54 | 4-(1,3,4-Oxadiazol-2-yl)phenyl 2-(2-ethynylnaphtho[2,1-b]furan-1-yl)acetate | O=C(Cc1c(oc2ccc3ccccc3c12)C#C)Oc4ccc(cc4)c5ocnn5 | Naphthofuran derivative with 8-methoxynaphthofuran moiety | NA | NA | NA | 2.74 | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB001762 | 24022489 | Hsp100 | ClpC1 | Bacteria | Cytosol | Binding affinity | NA | CymA1 | (3S,6S,9S,12S,15S,18S,21S)-3-[(R)-[1-[(3S)-4-(3-aminopropylamino)-3-hydroxy-2-methylbutan-2-yl]indol-3-yl]-hydroxymethyl]-21-[(2R)-3-hydroxy-2-methylpropyl]-15-[(R)-methoxy(phenyl)methyl]-1,10,18-trimethyl-6-[(2R)-4-methylpent-3-en-2-yl]-9-(2-methylpropyl)-12-propan-2-yl-1,4,7,10,13,16,19-heptazacyclohenicosane-2,5,8,11,14,17,20-heptone | CC1C(=O)NC(C(=O)NC(C(=O)N(C(C(=O)NC(C(=O)NC(C(=O)N(C(C(=O)N1)CC(C)CO)C)C(C2=CN(C3=CC=CC=C32)C(C)(C)C(CNCCCN)O)O)C(C)C=C(C)C)CC(C)C)C)C(C)C)C(C4=CC=CC=C4)OC | Cyclomarine A (CymA) derivative | NA | 0.012 | NA | NA | NA | NA | NA | NA | NA | Isothermal titration calorimetry (ITC) | NA | NA |
HSPMDB001763 | 24022489 | Hsp100 | ClpC1 | Bacteria | Cytosol | NA | Antibacterial activity | CymA1 | (3S,6S,9S,12S,15S,18S,21S)-3-[(R)-[1-[(3S)-4-(3-aminopropylamino)-3-hydroxy-2-methylbutan-2-yl]indol-3-yl]-hydroxymethyl]-21-[(2R)-3-hydroxy-2-methylpropyl]-15-[(R)-methoxy(phenyl)methyl]-1,10,18-trimethyl-6-[(2R)-4-methylpent-3-en-2-yl]-9-(2-methylpropyl)-12-propan-2-yl-1,4,7,10,13,16,19-heptazacyclohenicosane-2,5,8,11,14,17,20-heptone | CC1C(=O)NC(C(=O)NC(C(=O)N(C(C(=O)NC(C(=O)NC(C(=O)N(C(C(=O)N1)CC(C)CO)C)C(C2=CN(C3=CC=CC=C32)C(C)(C)C(CNCCCN)O)O)C(C)C=C(C)C)CC(C)C)C)C(C)C)C(C4=CC=CC=C4)OC | Cyclomarine A (CymA) derivative | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | 50% | Bacterial growth inhibition assay (OD based) |
HSPMDB001764 | 24022489 | Hsp100 | ClpC1 | Bacteria | Cytosol | NA | Antibacterial activity | CymA1 | (3S,6S,9S,12S,15S,18S,21S)-3-[(R)-[1-[(3S)-4-(3-aminopropylamino)-3-hydroxy-2-methylbutan-2-yl]indol-3-yl]-hydroxymethyl]-21-[(2R)-3-hydroxy-2-methylpropyl]-15-[(R)-methoxy(phenyl)methyl]-1,10,18-trimethyl-6-[(2R)-4-methylpent-3-en-2-yl]-9-(2-methylpropyl)-12-propan-2-yl-1,4,7,10,13,16,19-heptazacyclohenicosane-2,5,8,11,14,17,20-heptone | CC1C(=O)NC(C(=O)NC(C(=O)N(C(C(=O)NC(C(=O)NC(C(=O)N(C(C(=O)N1)CC(C)CO)C)C(C2=CN(C3=CC=CC=C32)C(C)(C)C(CNCCCN)O)O)C(C)C=C(C)C)CC(C)C)C)C(C)C)C(C4=CC=CC=C4)OC | Cyclomarine A (CymA) derivative | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | 50% | Bacterial growth inhibition assay (OD based) |
HSPMDB001765 | 30571121 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | 10 | Benzyl (1-(Diphenoxyphosphoryl)-2-phenylethyl)carbamate | O=C(OCC1=CC=CC=C1)NC(P(OC2=CC=CC=C2)(OC3=CC=CC=C3)=O)CC4=CC=CC=C4 | Serine protease inhibitor library | 7% at 200 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB001766 | 30571121 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | 11 | Benzyl (1-(Diphenoxyphosphoryl)-2-(p-tolyl)ethyl)carbamate | O=C(OCC1=CC=CC=C1)NC(P(OC2=CC=CC=C2)(OC3=CC=CC=C3)=O)CC4=CC=C(C)C=C4 | Serine protease inhibitor library | 7% at 200 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB001767 | 30571121 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | 12 | Benzyl (1-(Diphenoxyphosphoryl)-2-(4-methoxyphenyl)ethyl)-carbamate | O=C(OCC1=CC=CC=C1)NC(P(OC2=CC=CC=C2)(OC3=CC=CC=C3)=O)CC4=CC=C(OC)C=C4 | Serine protease inhibitor library | 6% at 200 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB001768 | 30571121 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | 13 | Benzyl (Benzofuran-5-yl(diphenoxyphosphoryl)methyl)-carbamate | O=C(OCC1=CC=CC=C1)NC(C2=CC=C3OC=CC3=C2)P(OC4=CC=CC=C4)(OC5=CC=CC=C5)=O | Serine protease inhibitor library | 6% at 200uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB001769 | 30571121 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | 14 | Benzyl (1-(Diphenoxyphosphoryl)-2-(naphthalen-2-yl)ethyl)-carbamate | O=C(OCC1=CC=CC=C1)NC(P(OC2=CC=CC=C2)(OC3=CC=CC=C3)=O)CC4=CC=C5C=CC=CC5=C4 | Serine protease inhibitor library | <1% at 200 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB001770 | 30571121 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | 15 | Benzyl (1-(Diphenoxyphosphoryl)-2-(4-fluorophenyl)ethyl)-carbamate | O=C(OCC1=CC=CC=C1)NC(P(OC2=CC=CC=C2)(OC3=CC=CC=C3)=O)CC4=CC=C(F)C=C4 | Serine protease inhibitor library | 13% at 200 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB001771 | 30571121 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | 16 | Benzyl (1-(Diphenoxyphosphoryl)-2-(4-(trifluoromethyl)phenyl)-ethyl) carbamate | O=C(OC(P(OC1=CC=CC=C1)(OC2=CC=CC=C2)=O)CC3=CC=C(C(F)(F)F)C=C3)NCC4=CC=CC=C4 | Serine protease inhibitor library | 100% at 200 uM | NA | NA | 14.2 | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB001772 | 30571121 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | 17 | Benzyl (1-(Diphenoxyphosphoryl)-3-(methylthio)propyl)-carbamate | O=C(OCC1=CC=CC=C1)NC(P(OC2=CC=CC=C2)(OC3=CC=CC=C3)=O)CCSC | Serine protease inhibitor library | 9% at 200 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB001773 | 30571121 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | 18 | Benzyl ((Diphenoxyphosphoryl)(6-hydroxynaphthalen-2-yl)-methyl)carbamate | O=C(OCC1=CC=CC=C1)NC(P(OC2=CC=CC=C2)(OC3=CC=CC=C3)=O)C4=CC=C5C=C(O)C=CC5=C4 | Serine protease inhibitor library | <1% at 200 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB001774 | 30571121 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | 21 | Benzyl (1-(Diphenoxyphosphoryl)-2-(4-hydroxyphenyl)ethyl)-carbamate | O=C(OCC1=CC=CC=C1)NC(P(OC2=CC=CC=C2)(OC3=CC=CC=C3)=O)CC4=CC=C(O)C=C4 | Serine protease inhibitor library | <1% at 200 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB001775 | 30571121 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | 22 | Benzyl (1-(Diphenoxyphosphoryl)-2-(3-hydroxyphenyl)ethyl)-carbamate | O=C(OCC1=CC=CC=C1)NC(P(OC2=CC=CC=C2)(OC3=CC=CC=C3)=O)CC4=CC=CC(O)=C4 | Serine protease inhibitor library | 3% at 200 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB001776 | 30571121 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | 23 | Benzyl (1-((4-Acetamidobenzyl)(4-acetamidophenoxy)-phosphoryl)-2-phenylethyl)carbamate | O=C(OC(P(OC1=CC=C(NC(C)=O)C=C1)(CC2=CC=C(NC(C)=O)C=C2)=O)CC3=CC=CC=C3)NCC4=CC=CC=C4 | Serine protease inhibitor library | 9% at 200 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB001777 | 30571121 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | 24 | Benzyl (1-(Hydroxy(phenoxy)phosphoryl)-2-(4-hydroxyphenyl)-ethyl)carbamate | O=C(OCC1=CC=CC=C1)NC(P(OC2=CC=CC=C2)(O)=O)CC3=CC=C(O)C=C3 | Serine protease inhibitor library | 11% at 200 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB001778 | 30571121 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | 25 | Benzyl (2-(4-Hydroxyphenyl)-1-(methoxy(phenoxy)phosphoryl)-ethyl)carbamate | O=C(OCC1=CC=CC=C1)NC(P(OC2=CC=CC=C2)(OC)=O)CC3=CC=C(O)C=C3 | Serine protease inhibitor library | 14% at 200 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB001779 | 30571121 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | 29 | Benzyl (S)-(1-Cyano-2-(4-hydroxyphenyl)ethyl)carbamate | O=C(OCC1=CC=CC=C1)N[C@H](C#N)CC2=CC=C(O)C=C2 | Serine protease inhibitor library | <1% at 200 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB001780 | 30571121 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | 30 | Benzyl (S)-(1-Cyano-2-phenylethyl)carbamate | O=C(OCC1=CC=CC=C1)N[C@H](C#N)CC2=CC=CC=C2 | Serine protease inhibitor library | <1% at 200 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB001781 | 30571121 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | 32 | Benzyl ((2S)-1-((1-(Diphenoxyphosphoryl)-2-(4-hydroxyphenyl)-ethyl)amino)-4-methyl-1-oxopentan-2-yl)carbamate | O=C(OCC1=CC=CC=C1)N[C@@H](CC(C)C)C(NC(P(OC2=CC=CC=C2)(OC3=CC=CC=C3)=O)CC4=CC=C(O)C=C4)=O | Serine protease inhibitor library | <1% at 200 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB001782 | 30571121 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | 36 | Benzyl ((2S)-6-Amino-1-((1-(diphenoxyphosphoryl)-3-(methylthio)propyl)amino)-1-oxohexan-2-yl)carbamate Hydrochloride | O=C(OCC1=CC=CC=C1)N[C@@H](CCCCN)C(NC(P(OC2=CC=CC=C2)(OC3=CC=CC=C3)=O)CCSC)=O.[H]Cl | Serine protease inhibitor library | 4% at 200 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB001783 | 30571121 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | 41 | Benzyl ((S)-1-(((S)-1-Cyano-2-(4-hydroxyphenyl)ethyl)amino)-4-methyl-1-oxopentan-2-yl)carbamate | O=C(OCC1=CC=CC=C1)N[C@@H](CC(C)C)C(N[C@H](C#N)CC2=CC=C(O)C=C2)=O | Serine protease inhibitor library | 13% at 200 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB001784 | 30571121 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | 42 | Diphenyl ((1-Carbamimidoy l p i p e r i d i n - 4 - y l ) ( 2 - ( 4 -methoxyphenyl)acetamido)methyl)phosphonate 2,2,2-trifluoroacetate | O=C(NC(P(OC1=CC=CC=C1)(OC2=CC=CC=C2)=O)C3CCN(C(N)=N)CC3)CC4=CC=C(OC)C=C4.O=C(O)C(F)(F)F | Serine protease inhibitor library | 13% at 200 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB001785 | 30571121 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | 43 | Diphenyl ((1-Carbamimidoylpiperidin-4-yl)(nicotinamido)-methyl)phosphonate 2,2,2-trifluoroacetate | O=C(NC(P(OC1=CC=CC=C1)(OC2=CC=CC=C2)=O)C3CCN(C(N)=N)CC3)C4=CN=CC=C4.O=C(O)C(F)(F)F | Serine protease inhibitor library | 13% at 200 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB001786 | 30571121 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | 44 | Diphenyl ((1-Carbamimidoylpiperidin-4-yl)(furan-2-carboxamido)methyl)phosphonate 2,2,2-trifluoroacetate | O=C(C1=CC=CO1)NC(P(OC2=CC=CC=C2)(OC3=CC=CC=C3)=O)C4CCN(C(N)=N)CC4.O=C(O)C(F)(F)F | Serine protease inhibitor library | 24% at 200 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB001787 | 30571121 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | 45 | Diphenyl ((1-Carbamimidoylpiperidin-4-yl)(cinnamamido)-methyl)phosphonate Bis(2,2,2-trifluoroacetate) | O=C(NC(P(OC1=CC=CC=C1)(OC2=CC=CC=C2)=O)C3CCN(C(N)=N)CC3)/C=C/C4=CC=CC=C4.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F | Serine protease inhibitor library | 18% at 200 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB001788 | 30571121 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | 46 | D i p h e n y l ( ( 1 - C a rbami m i d o y l p i p e r i d i n - 4 - y l ) ( 2 -phenoxyethylsulfonamido)methyl)phosphonate 2,2,2-trifluoroacetate | O=S(NC(P(OC1=CC=CC=C1)(OC2=CC=CC=C2)=O)C3CCN(C(N)=N)CC3)(CCOC4=CC=CC=C4)=O.O=C(O)C(F)(F)F | Serine protease inhibitor library | 27% at 200 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB001789 | 30571121 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | 47 | Diphenyl ((1-Carbamimidoylpiperidin-4-yl)(3-(piperidin-4-yl)-propanamido)methyl)phosphonate bis(2,2,2-trifluoroacetate) | O=C(NC(P(OC1=CC=CC=C1)(OC2=CC=CC=C2)=O)C3CCN(C(N)=N)CC3)CCC4CCNCC4.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F | Serine protease inhibitor library | 6% at 200 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB001790 | 30571121 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | 48 | Diphenyl (E)-Diphenyl ((3-(Benzo[d][1,3]dioxol-5-yl)acrylamido)-(1-carbamimidoylpiperidin-4-yl)methyl)phosphonate 2,2,2-Trifluoroacetate | NC(N1CCC(C(P(OC2=CC=CC=C2)(OC3=CC=CC=C3)=O)NC(/C=C/C4=CC=C(OCO5)C5=C4)=O)CC1)=N.O=C(O)C(F)(F)F | Serine protease inhibitor library | 4% at 200 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB001791 | 30571121 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | 49 | Diphenyl ((3-(Benzo[d][1,3]dioxol-5-yl)propiolamido)(1-carbamimidoylpiperidin-4-yl)methyl)phosphonate | NC(N1CCC(C(P(OC2=CC=CC=C2)(OC3=CC=CC=C3)=O)NC(C#CC4=CC=C(OCO5)C5=C4)=O)CC1)=N | Serine protease inhibitor library | 24% at 200 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB001792 | 30571121 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | 50 | Diphenyl ((1-Carbamimidoylpiperidin-4-yl)((5-phenylpyrimidin-2-yl)amino)methyl)phosphonate 2,2,2-trifluoroacetate | NC(N1CCC(C(P(OC2=CC=CC=C2)(OC3=CC=CC=C3)=O)NC4=NC=C(C5=CC=CC=C5)C=N4)CC1)=N.O=C(O)C(F)(F)F | Serine protease inhibitor library | 12% at 200 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB001793 | 30571121 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | 51 | (Z)-Diphenyl ((1-Carbamimidoylpiperidin - 4 - y l ) ( 3 -phenylacrylamido)methyl)phosphonate 2,2,2-Trifluoroacetate | O=C(NC(P(OC1=CC=CC=C1)(OC2=CC=CC=C2)=O)C3CCN(C(N)=N)CC3)/C=C\C4=CC=CC=C4.O=C(O)C(F)(F)F | Serine protease inhibitor library | 11% at 200 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB001794 | 30571121 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | 52 | Methyl (1-(Diphenoxyphosphoryl)-2-(4-guanidinophenyl)ethyl)-carbamate | O=C(OC)NC(P(OC1=CC=CC=C1)(OC2=CC=CC=C2)=O)CC3=CC=C(NC(N)=N)C=C3 | Serine protease inhibitor library | 27% at 200 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB001795 | 30571121 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | 53 | Diphenyl (2-(4-Guanidinophenyl)-1-((S)-2-((S)-3-hydroxy-2-(thiophene-2-carboxamido)propanamido)propanamido)ethyl)-phosphonate | C[C@H](NC([C@@H](NC(C1=CC=CS1)=O)CO)=O)C(NC(P(OC2=CC=CC=C2)(OC3=CC=CC=C3)=O)CC4=CC=C(NC(N)=N)C=C4)=O | Serine protease inhibitor library | 90% at 200 uM | NA | NA | 49.5 | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB001796 | 30571121 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | 54 | P e n t - 4 - y n - 1 - y l ( 1 - ( d i p h e n o x y p h o s p h o r y l ) - 2 - ( 4 -guanidinophenyl)ethyl)carbamate | O=C(OCCCC#C)NC(P(OC1=CC=CC=C1)(OC2=CC=CC=C2)=O)CC3=CC=C(NC(N)=N)C=C3 | Serine protease inhibitor library | 23% at 200 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB001797 | 30571121 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | 55 | 2-(2-Azidoethoxy)ethyl (1-(diphenoxyphosphoryl)-2-(4-guanidinophenyl)ethyl)carbamate | O=C(OCCOCCN=[N+]=[N-])NC(P(OC1=CC=CC=C1)(OC2=CC=CC=C2)=O)CC3=CC=C(NC(N)=N)C=C3 | Serine protease inhibitor library | 68% at 200 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB001798 | 30571121 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | 56 | (Perfluorophenyl)methyl (1-(Diphenoxyphosphoryl)-2-(4-guanidinophenyl)ethyl)carbamate 2,2,2-Trifluoroacetate | O=C(OCC1=C(F)C(F)=C(F)C(F)=C1F)NC(P(OC2=CC=CC=C2)(OC3=CC=CC=C3)=O)CC4=CC=C(NC(N)=N)C=C4 | Serine protease inhibitor library | 25% at 200 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB001799 | 30571121 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | 57 | 3,3,4,4,5,5,6,6,7,8,8,8-Dodecafluoro-7-(trifluoromethyl)octyl 1-(Diphenoxyphosphoryl)-2-(4-guanidinophenyl)ethylcarbamate2,2,2-Trifluoroacetate | O=C(OCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(C(F)(F)F)(F)C(F)(F)F)NC(P(OC1=CC=CC=C1)(OC2=CC=CC=C2)=O)CC3=CC=C(NC(N)=N)C=C3.O=C(O)C(F)(F)F | Serine protease inhibitor library | 55% at 200 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB001800 | 30571121 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | 58 | Benzyl ((4-Aminophenyl)(diphenoxyphosphoryl)methyl)-carbamate | O=C(OCC1=CC=CC=C1)NC(C2=CC=C(N)C=C2)P(OC3=CC=CC=C3)(OC4=CC=CC=C4)=O | Serine protease inhibitor library | 96% at 200 uM | NA | NA | 39.8 | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB001801 | 30571121 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | 59 | 2-Phenoxyethyl ((4-Aminophenyl)(diphenoxyphosphoryl)-methyl)carbamate | O=C(OCCOC1=CC=CC=C1)NC(C2=CC=C(N)C=C2)P(OC3=CC=CC=C3)(OC4=CC=CC=C4)=O | Serine protease inhibitor library | 1% at 200 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB001802 | 30571121 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | 60 | 4,4,4-Trifluorobutyl ((4-Aminophenyl)(diphenoxyphosphoryl)-methyl)carbamate | O=C(OCCCC(F)(F)F)NC(C1=CC=C(N)C=C1)P(OC2=CC=CC=C2)(OC3=CC=CC=C3)=O | Serine protease inhibitor library | <1% at 200 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB001803 | 30571121 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | 61 | ( P e r fl u o r o p h e n y l ) m e t h y l ( ( 4 - A m i n o p h e n y l ) -(diphenoxyphosphoryl)methyl)carbamate | O=C(OCC1=C(F)C(F)=C(F)C(F)=C1F)NC(C2=CC=C(N)C=C2)P(OC3=CC=CC=C3)(OC4=CC=CC=C4)=O | Serine protease inhibitor library | 28% at 200 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB001804 | 30571121 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | 62 | Diphenyl ((4-Guanidinophenyl)((4-(trifluoromethyl)phenyl)-sulfonamido)methyl)phosphonate | O=S(NC(P(OC1=CC=CC=C1)(OC2=CC=CC=C2)=O)C3=CC=C(NC(N)=N)C=C3)(C4=CC=C(C(F)(F)F)C=C4)=O | Serine protease inhibitor library | 27% at 200 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB001805 | 30571121 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | 63 | Diphenyl ((4-Guanidinophenyl)(phenylsulfonamido)methyl)-phosphonate | O=S(NC(P(OC1=CC=CC=C1)(OC2=CC=CC=C2)=O)C3=CC=C(NC(N)=N)C=C3)(C4=CC=CC=C4)=O | Serine protease inhibitor library | 29% at 200 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB001806 | 30571121 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | 64 | (Perfluorophenyl)methyl ((Diphenoxyphosphoryl)(4-guanidinophenyl)methyl)carbamate | O=C(OCC1=C(F)C(F)=C(F)C(F)=C1F)NC(P(OC2=CC=CC=C2)(OC3=CC=CC=C3)=O)C4=CC=C(NC(N)=N)C=C4 | Serine protease inhibitor library | 48% at 200 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB001807 | 30571121 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | 65 | Methyl ((Diphenoxyphosphoryl)(4-(2,2,2-trifluoroacetamido)-phenyl)methyl)carbamate | O=C(OC)NC(P(OC1=CC=CC=C1)(OC2=CC=CC=C2)=O)C3=CC=C(NC(C(F)(F)F)=O)C=C3 | Serine protease inhibitor library | 64% at 200 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB001808 | 30571121 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | 66 | Benzo[d][1,3]dioxol-5-ylmethyl ((Diphenoxyphosphoryl)(4-(2,2,2-trifluoroacetamido)phenyl)methyl)carbamate | O=C(OCC1=CC=C(OCO2)C2=C1)NC(P(OC3=CC=CC=C3)(OC4=CC=CC=C4)=O)C5=CC=C(NC(C(F)(F)F)=O)C=C5 | Serine protease inhibitor library | 93% at 200 uM | NA | NA | 8.2 | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB001809 | 30571121 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | 67 | 2-Ami n o e t h y l ((Diphenoxyphosph o r y l ) ( 4 - ( 2 , 2 , 2 -trifluoroacetamido)phenyl)methyl)carbamate 2,2,2-Trifluoroacetate | O=C(OCCN)NC(P(OC1=CC=CC=C1)(OC2=CC=CC=C2)=O)C3=CC=C(NC(C(F)(F)F)=O)C=C3.O=C(O)C(F)(F)F | Serine protease inhibitor library | 73% at 200 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB001810 | 30571121 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | 68 | B e n z y l 2 - ( 4 - ( 3 , 3 - D i m e t h y l u r e i d o ) p h e n y l ) - 1 -(diphenoxyphosphoryl)ethylcarbamate | O=C(OCC1=CC=CC=C1)NC(P(OC2=CC=CC=C2)(OC3=CC=CC=C3)=O)CC4=CC=C(NC(N(C)C)=O)C=C4 | Serine protease inhibitor library | 9% at 200 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB001811 | 30571121 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | 69 | Benzyl ((4-(2-Aminoethoxy)phenyl)(diphenoxyphosphoryl)-methyl)carbamate 2,2,2-trifluoroacetate | O=C(OCC1=CC=CC=C1)NC(C2=CC=C(OCCN)C=C2)P(OC3=CC=CC=C3)(OC4=CC=CC=C4)=O.O=C(O)C(F)(F)F | Serine protease inhibitor library | 15% at 200 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB001812 | 30571121 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | 70 | Benzyl (1-(Diphenoxyphosphoryl)-3-(4-nitrophenyl)propyl)-carbamate | O=C(OCC1=CC=CC=C1)NC(P(OC2=CC=CC=C2)(OC3=CC=CC=C3)=O)CCC4=CC=C([N+]([O-])=O)C=C4 | Serine protease inhibitor library | 100% at 200 uM | NA | NA | 13.1 | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB001813 | 30571121 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | 71 | Methyl ((4-Carbamimidoylphenyl)(diphenoxyphosphoryl)-methyl)carbamate | O=C(OC)NC(C1=CC=C(C(N)=N)C=C1)P(OC2=CC=CC=C2)(OC3=CC=CC=C3)=O | Serine protease inhibitor library | 93% at 200 uM | NA | NA | 48.1 | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB001814 | 30571121 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | 72 | Methyl ((Diphenoxyphosphoryl)(5-nitronaphthalen-1-yl)-methyl)carbamate | O=C(OC)NC(P(OC1=CC=CC=C1)(OC2=CC=CC=C2)=O)C3=C4C=CC=C([N+]([O-])=O)C4=CC=C3 | Serine protease inhibitor library | 17% at 200 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB001815 | 30571121 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | 73 | Diphenyl ((1-Carbamimidoylazetidin-3-yl)(pyrimidin-2-ylamino)methyl)phosphonate 2,2,2-trifluoroacetate | NC(N1CC(C(P(OC2=CC=CC=C2)(OC3=CC=CC=C3)=O)NC4=NC=CC=N4)C1)=N.O=C(O)C(F)(F)F | Serine protease inhibitor library | 12% at 200 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB001816 | 30571121 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | 74 | Diphenyl ((3-(N-Hydroxycarbamimidoyl)phenyl)(pyrimidin-2-ylamino)methyl)phosphonate | N=C(C1=CC(C(P(OC2=CC=CC=C2)(OC3=CC=CC=C3)=O)NC4=NC=CC=N4)=CC=C1)NO | Serine protease inhibitor library | 23% at 200 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB001817 | 30571121 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | 75 | 2-(2-(Prop-2-yn-1-yloxy)ethoxy)ethyl (Diphenoxyphosphoryl)(4-(piperazin-1-yl)phenyl)methylcarbamate 2,2,2-Trifluoroacetate | O=C(O)C(F)(F)F.O=C(OCCOCCOCC#C)NC(P(OC1=CC=CC=C1)(OC2=CC=CC=C2)=O)C3=CC=C(N4CCNCC4)C=C3 | Serine protease inhibitor library | 25% at 200 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB001818 | 30571121 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | 76 | Benzyl (1-(Diphenoxyphosphoryl)-4-guanidinobutyl)carbamate | O=C(OCC1=CC=CC=C1)NC(P(OC2=CC=CC=C2)(OC3=CC=CC=C3)=O)CCCNC(N)=N | Serine protease inhibitor library | 15% at 200 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB001819 | 30571121 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | 77 | Benzyl (Benzo[d][1,3]dioxol-5-yl(diphenoxyphosphoryl)methyl)-carbamate | O=C(OCC1=CC=CC=C1)NC(C2=CC=C(OCO3)C3=C2)P(OC4=CC=CC=C4)(OC5=CC=CC=C5)=O | Serine protease inhibitor library | 6% at 200 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB001820 | 30571121 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | 78 | Benzyl ((4-(Dimethylamino)phenyl)(diphenoxyphosphoryl)-methyl)carbamate | O=C(OCC1=CC=CC=C1)NC(C2=CC=C(N(C)C)C=C2)P(OC3=CC=CC=C3)(OC4=CC=CC=C4)=O | Serine protease inhibitor library | 100% at 200 uM | NA | NA | 0.6 | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB001821 | 30571121 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | 79 | Benzyl ((Diphenoxyphosphoryl)(pyridin-3-yl)methyl)carbamate | O=C(OCC1=CC=CC=C1)NC(P(OC2=CC=CC=C2)(OC3=CC=CC=C3)=O)C4=CC=CN=C4 | Serine protease inhibitor library | 27% at 200 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB001822 | 30571121 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | 80 | Benzyl ((Diphenoxyphosphoryl)(3-nitrophenyl)methyl)-carbamate | O=C(OCC1=CC=CC=C1)NC(P(OC2=CC=CC=C2)(OC3=CC=CC=C3)=O)C4=CC=CC([N+]([O-])=O)=C4 | Serine protease inhibitor library | 6% at 200 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB001823 | 30571121 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | 81 | Benzyl (1-(Diphenoxyphosphoryl)ethyl)carbamate | O=C(OCC1=CC=CC=C1)NC(P(OC2=CC=CC=C2)(OC3=CC=CC=C3)=O)C | Serine protease inhibitor library | 3% at 200 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB001824 | 30571121 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | 82 | Benzyl (1-(Diphenoxyphosphoryl)-3-methylbutyl)carbamate | O=C(OCC1=CC=CC=C1)NC(P(OC2=CC=CC=C2)(OC3=CC=CC=C3)=O)CC(C)C | Serine protease inhibitor library | 4% at 200 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB001825 | 30571121 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | 83 | Benzyl ((Diphenoxyphosphoryl)(4-guanidinophenyl)methyl)-carbamate | O=C(OCC1=CC=CC=C1)NC(P(OC2=CC=CC=C2)(OC3=CC=CC=C3)=O)C4=CC=C(NC(N)=N)C=C4 | Serine protease inhibitor library | 29% at 200 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB001826 | 30571121 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | 84 | Benzyl (2-(Benzyloxy)-1-(diphenoxyphosphoryl)ethyl)carbamate | O=C(OCC1=CC=CC=C1)NC(P(OC2=CC=CC=C2)(OC3=CC=CC=C3)=O)COCC4=CC=CC=C4 | Serine protease inhibitor library | 4% at 200 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB001827 | 30571121 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | 85 | Benzyl ((3-Aminophenyl)(diphenoxyphosphoryl)methyl)-carbamate | O=C(OCC1=CC=CC=C1)NC(C2=CC=CC(N)=C2)P(OC3=CC=CC=C3)(OC4=CC=CC=C4)=O | Serine protease inhibitor library | 100% at 200 uM | NA | NA | 0.5 | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB001828 | 30571121 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | 86 | Benzyl ((Diphenoxyphosphoryl)(6-methoxypyridin-2-yl)methyl)-carbamate | O=C(OCC1=CC=CC=C1)NC(P(OC2=CC=CC=C2)(OC3=CC=CC=C3)=O)C4=NC(OC)=CC=C4 | Serine protease inhibitor library | 100% at 200 uM | NA | NA | 38 | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB001829 | 30571121 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | 87 | Benzyl ((2-Chloro-5-nitrophenyl)(diphenoxyphosphoryl)methyl)-carbamate | O=C(OCC1=CC=CC=C1)NC(C2=CC([N+]([O-])=O)=CC=C2Cl)P(OC3=CC=CC=C3)(OC4=CC=CC=C4)=O | Serine protease inhibitor library | 6% at 200 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB001830 | 30571121 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | 88 | Benzyl ((4-Carbamimidoylphenyl)(diphenoxyphosphoryl)-methyl)carbamate | O=C(OCC1=CC=CC=C1)NC(C2=CC=C(C(N)=N)C=C2)P(OC3=CC=CC=C3)(OC4=CC=CC=C4)=O | Serine protease inhibitor library | 30% at 200 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB001831 | 30571121 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | 89 | Benzyl ((5-Chloro-1H-indol-3-yl)(diphenoxyphosphoryl)methyl)-carbamate | O=C(OCC1=CC=CC=C1)NC(C2=CNC3=C2C=C(Cl)C=C3)P(OC4=CC=CC=C4)(OC5=CC=CC=C5)=O | Serine protease inhibitor library | 88% at 200 uM | NA | NA | 100.5 | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB001832 | 30571121 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | 90 | B e n z y l ( ( 6 - C a r b a m i m i d o y l n a p h t h a l e n - 2 - y l ) -(diphenoxyphosphoryl)methyl)carbamate | O=C(OCC1=CC=CC=C1)NC(C2=CC=C3C=C(C(N)=N)C=CC3=C2)P(OC4=CC=CC=C4)(OC5=CC=CC=C5)=O | Serine protease inhibitor library | 81% at 200 uM | NA | NA | 79.7 | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB001833 | 30571121 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | 91 | Benzyl ((Diphenoxyphosphoryl)(4-nitrophenyl)methyl)-carbamate | O=C(OCC1=CC=CC=C1)NC(P(OC2=CC=CC=C2)(OC3=CC=CC=C3)=O)C4=CC=C([N+]([O-])=O)C=C4 | Serine protease inhibitor library | 71% at 200 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB001834 | 30571121 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | 92 | Benzyl ((3-Carbamimidoylphenyl)(diphenoxyphosphoryl)-methyl)carbamate | O=C(OCC1=CC=CC=C1)NC(C2=CC=CC(C(N)=N)=C2)P(OC3=CC=CC=C3)(OC4=CC=CC=C4)=O | Serine protease inhibitor library | 100% at 200 uM | NA | NA | 0.5 | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB001835 | 30571121 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | 93 | Benzyl (1-(Diphenoxyphosphoryl)-3-phenylpropyl)carbamate | O=C(OCC1=CC=CC=C1)NC(P(OC2=CC=CC=C2)(OC3=CC=CC=C3)=O)CCC4=CC=CC=C4 | Serine protease inhibitor library | <1% at 200 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB001836 | 30571121 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | 94 | Benzyl ((Diphenoxyphosphoryl)(naphthalen-1-yl)methyl)-carbamate | O=C(OCC1=CC=CC=C1)NC(P(OC2=CC=CC=C2)(OC3=CC=CC=C3)=O)C4=C5C=CC=CC5=CC=C4 | Serine protease inhibitor library | 6% at 200 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB001837 | 30571121 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | 95 | Benzyl ((Diphenoxyphosphoryl)(naphthalen-2-yl)methyl)-carbamate | O=C(OCC1=CC=CC=C1)NC(P(OC2=CC=CC=C2)(OC3=CC=CC=C3)=O)C4=CC=C5C=CC=CC5=C4 | Serine protease inhibitor library | 51% at 200 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB001838 | 30571121 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | 96 | Benzyl ((3-Cyanophenyl)(diphenoxyphosphoryl)methyl)-carbamate | O=C(OCC1=CC=CC=C1)NC(C2=CC=CC(C#N)=C2)P(OC3=CC=CC=C3)(OC4=CC=CC=C4)=O | Serine protease inhibitor library | 15% at 200 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB001839 | 30571121 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | 97 | B e n z y l ( ( 4 - ( D i m e t h y l a m i n o) n a p h t h a l e n - 1 - y l ) -(diphenoxyphosphoryl)methyl)carbamate | O=C(OCC1=CC=CC=C1)NC(C2=C3C=CC=CC3=C(N(C)C)C=C2)P(OC4=CC=CC=C4)(OC5=CC=CC=C5)=O | Serine protease inhibitor library | <1% at 200 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB001840 | 30571121 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | 98 | Benzyl ((Diphenoxyphosphoryl)(4-(2,2,2-trifluoroacetamido)-phenyl)methyl)carbamate | O=C(OCC1=CC=CC=C1)NC(P(OC2=CC=CC=C2)(OC3=CC=CC=C3)=O)C4=CC=C(NC(C(F)(F)F)=O)C=C4 | Serine protease inhibitor library | 15% at 200 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB001841 | 30571121 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | 107 | Benzyl ((Diphenoxyphosphoryl)(4-(piperazin-1-yl)phenyl)-methyl)carbamate 2,2,2-trifluoroacetate | O=C(OCC1=CC=CC=C1)NC(P(OC2=CC=CC=C2)(OC3=CC=CC=C3)=O)C4=CC=C(N5CCNCC5)C=C4.O=C(O)C(F)(F)F | Serine protease inhibitor library | 100% at 200 uM | NA | NA | 0.6 | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB001842 | 30571121 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | 108 | B e n z y l ( ( 3 - C y a n o - 4 - ( p i p e r a z i n - 1 - y l ) p h e n y l ) -(diphenoxyphosphoryl)methyl)carbamate 2,2,2-trifluoroacetate | O=C(OCC1=CC=CC=C1)NC(C2=CC=C(N3CCNCC3)C(C#N)=C2)P(OC4=CC=CC=C4)(OC5=CC=CC=C5)=O.O=C(O)C(F)(F)F | Serine protease inhibitor library | 10% at 200 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB001843 | 30571121 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | 109 | Benzyl ((Diphenoxyphosphoryl)(piperidin-4-yl)methyl)-carbamate 2,2,2-Trifluoroacetate | O=C(OCC1=CC=CC=C1)NC(P(OC2=CC=CC=C2)(OC3=CC=CC=C3)=O)C4CCNCC4.O=C(O)C(F)(F)F | Serine protease inhibitor library | 30% at 200 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB001844 | 30571121 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | 110 | Benzyl 1-(Diphenoxyphosphoryl)-2-(piperidin-4-yl)-ethylcarbamate 2,2,2-Trifluoroacetate | O=C(OCC1=CC=CC=C1)NC(P(OC2=CC=CC=C2)(OC3=CC=CC=C3)=O)CC4CCNCC4.O=C(O)C(F)(F)F | Serine protease inhibitor library | 16% at 200 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB001845 | 30571121 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | 111 | Benzyl ((4-(Aminomethyl)cyclohexyl)(diphenoxyphosphoryl)-methyl)carbamate 2,2,2-Trifluoroacetate | O=C(OCC1=CC=CC=C1)NC(C2CCC(CN)CC2)P(OC3=CC=CC=C3)(OC4=CC=CC=C4)=O.O=C(O)C(F)(F)F | Serine protease inhibitor library | 15% at 200 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB001846 | 30571121 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | 114 | Benzyl ((6-Aminonaphthalen-2-yl)(diphenoxyphosphoryl)-methyl)carbamate | O=C(OCC1=CC=CC=C1)NC(C2=CC=C3C=C(N)C=CC3=C2)P(OC4=CC=CC=C4)(OC5=CC=CC=C5)=O | Serine protease inhibitor library | <1% at 200 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB001847 | 30571121 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | 115 | Benzyl ((1-Carbamimidoylazetidin-3-yl)(diphenoxyphosphoryl)-methyl)carbamate 2,2,2-trifluoroacetate | O=C(OCC1=CC=CC=C1)NC(C2CN(C(N)=N)C2)P(OC3=CC=CC=C3)(OC4=CC=CC=C4)=O.O=C(O)C(F)(F)F | Serine protease inhibitor library | 100% at 200 uM | NA | NA | 71.3 | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB001848 | 30571121 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | 116 | Benzyl 2-(4-Acetamidophenyl)-1-(diphenoxyphosphoryl)-ethylcarbamate | O=C(OCC1=CC=CC=C1)NC(P(OC2=CC=CC=C2)(OC3=CC=CC=C3)=O)CC4=CC=C(NC(C)=O)C=C4 | Serine protease inhibitor library | 18% at 200 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB001849 | 30571121 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | 117 | Benzyl ((Diphenoxyphosphoryl)(5-nitronaphthalen-1-yl)methyl)-carbamate | O=C(OCC1=CC=CC=C1)NC(P(OC2=CC=CC=C2)(OC3=CC=CC=C3)=O)C4=C5C=CC=C([N+]([O-])=O)C5=CC=C4 | Serine protease inhibitor library | 49% at 200 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB001850 | 30571121 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | 118 | B e n z y l ( ( 4 - ( D i m e t h y l a m i n o ) - 3 - n i t r o p h e n y l ) -(diphenoxyphosphoryl)methyl)carbamate | O=C(OCC1=CC=CC=C1)NC(C2=CC=C(N(C)C)C([N+]([O-])=O)=C2)P(OC3=CC=CC=C3)(OC4=CC=CC=C4)=O | Serine protease inhibitor library | 39% at 200 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB001851 | 30571121 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | 120 | Benzyl (3-(4-Aminophenyl)-1-(diphenoxyphosphoryl)propyl)-carbamate | O=C(OCC1=CC=CC=C1)NC(P(OC2=CC=CC=C2)(OC3=CC=CC=C3)=O)CCC4=CC=C(N)C=C4 | Serine protease inhibitor library | 13% at 200 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB001852 | 30571121 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | 121 | B e n z y l ( ( 3 - A m i n o - 4 - ( d i m e t h y l a m i n o ) p h e n y l ) -(diphenoxyphosphoryl)methyl)carbamate | O=C(OCC1=CC=CC=C1)NC(C2=CC=C(N(C)C)C(N)=C2)P(OC3=CC=CC=C3)(OC4=CC=CC=C4)=O | Serine protease inhibitor library | 22% at 200 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB001853 | 30571121 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | 122 | Benzyl ((4-Acetamidophenyl)(diphenoxyphosphoryl)methyl)-carbamate | O=C(OCC1=CC=CC=C1)NC(C2=CC=C(NC(C)=O)C=C2)P(OC3=CC=CC=C3)(OC4=CC=CC=C4)=O | Serine protease inhibitor library | 8% at 200 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB001854 | 30571121 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | 123 | Benzyl ((4-(3,3-Dimethylureido)phenyl)(diphenoxyphosphoryl)-methyl)carbamate | O=C(OCC1=CC=CC=C1)NC(C2=CC=C(NC(N(C)C)=O)C=C2)P(OC3=CC=CC=C3)(OC4=CC=CC=C4)=O | Serine protease inhibitor library | 22% at 200 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB001855 | 30571121 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | 124 | Benzyl ((Diphenoxyphosphoryl)(3-guanidinophenyl)methyl)-carbamate 2,2,2-trifluoroacetate | O=C(OCC1=CC=CC=C1)NC(P(OC2=CC=CC=C2)(OC3=CC=CC=C3)=O)C4=CC=CC(NC(N)=N)=C4.O=C(O)C(F)(F)F | Serine protease inhibitor library | 15% at 200 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB001856 | 30571121 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | 125 | Benzyl ((Diphenoxyphosphoryl)(5-guanidinonaphthalen-1-yl)-methyl)carbamate 2,2,2-trifluoroacetate | O=C(OCC1=CC=CC=C1)NC(P(OC2=CC=CC=C2)(OC3=CC=CC=C3)=O)C4=C5C=CC=C(NC(N)=N)C5=CC=C4.O=C(O)C(F)(F)F | Serine protease inhibitor library | 38% at 200 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB001857 | 30571121 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | 126 | Benzyl (1-(Diphenoxyphosphoryl)-3-(4-(methylsulfonamido)-phenyl)propyl)carbamate | O=C(OCC1=CC=CC=C1)NC(P(OC2=CC=CC=C2)(OC3=CC=CC=C3)=O)CCC4=CC=C(NS(=O)(C)=O)C=C4 | Serine protease inhibitor library | 10% at 200 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB001858 | 30571121 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | 127 | Benzyl ((4-(Dimethylamino)-3-(methylsulfonamido)phenyl)-(diphenoxyphosphoryl)methyl)carbamate | O=C(OCC1=CC=CC=C1)NC(C2=CC=C(N(C)C)C(NS(=O)(C)=O)=C2)P(OC3=CC=CC=C3)(OC4=CC=CC=C4)=O | Serine protease inhibitor library | 46% at 200 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB001859 | 30571121 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | 128 | Methyl ((Diphenoxyphosphoryl)(3-(trifluoromethyl)phenyl)-methyl)carbamate | O=C(OC)NC(P(OC1=CC=CC=C1)(OC2=CC=CC=C2)=O)C3=CC=CC(C(F)(F)F)=C3 | Serine protease inhibitor library | 4% at 200 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB001860 | 30571121 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | 129 | Benzyl (1-(Bis(4-acetamidophenoxy)phosphoryl)-2-(4-(trifluoromethyl)phenyl)ethyl)carbamate | O=C(OC(P(OC1=CC=C(NC(C)=O)C=C1)(OC2=CC=C(NC(C)=O)C=C2)=O)CC3=CC=C(C(F)(F)F)C=C3)NCC4=CC=CC=C4 | Serine protease inhibitor library | 1% at 200 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB001861 | 30571121 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | 130 | Methyl (1-(Bis(4-acetamidophenoxy)phosphoryl)-2-(4-(trifluoromethyl)phenyl)ethyl)carbamate | O=C(OC)NC(P(OC1=CC=C(NC(C)=O)C=C1)(OC2=CC=C(NC(C)=O)C=C2)=O)CC3=CC=C(C(F)(F)F)C=C3 | Serine protease inhibitor library | 20% at 200 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB001862 | 30571121 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | 135 | Methyl ((3-Aminophenyl)(diphenoxyphosphoryl)methyl)-carbamate | O=C(OC)NC(C1=CC=CC(N)=C1)P(OC2=CC=CC=C2)(OC3=CC=CC=C3)=O | Serine protease inhibitor library | 7% at 200 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB001863 | 30571121 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | 136 | Benzo[d][1,3]dioxol-5-ylmethyl ((3-Aminophenyl)-(diphenoxyphosphoryl)methyl)carbamate | O=C(OCC1=CC=C(OCO2)C2=C1)NC(C3=CC=CC(N)=C3)P(OC4=CC=CC=C4)(OC5=CC=CC=C5)=O | Serine protease inhibitor library | 20% at 200 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB001864 | 30571121 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | 137 | Benzyl ((3-Aminophenyl)(bis(4-acetamidophenoxy)phosphoryl)-methyl)carbamate | O=C(OCC1=CC=CC=C1)NC(C2=CC=CC(N)=C2)P(OC3=CC=C(NC(C)=O)C=C3)(OC4=CC=C(NC(C)=O)C=C4)=O | Serine protease inhibitor library | 21% at 200 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB001865 | 30571121 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | 138 | Methyl ((3-Aminophenyl)(bis(4-acetamidophenoxy)phosphoryl)-methyl)carbamate | O=C(OC)NC(C1=CC=CC(N)=C1)P(OC2=CC=C(NC(C)=O)C=C2)(OC3=CC=C(NC(C)=O)C=C3)=O | Serine protease inhibitor library | 12% at 200 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB001866 | 30571121 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | 145 | Methyl ((3-Carbamimidoylphenyl)(diphenoxyphosphoryl)-methyl)carbamate | O=C(OC)NC(C1=CC=CC(C(N)=N)=C1)P(OC2=CC=CC=C2)(OC3=CC=CC=C3)=O | Serine protease inhibitor library | 30% at 200 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB001867 | 30571121 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | 146 | Benzyl ( ( B is(4-acetamidophenoxy)phosphoryl)( 3-carbamimidoylphenyl)methyl)carbamate | O=C(OC(P(OC1=CC=C(NC(C)=O)C=C1)(OC2=CC=C(NC(C)=O)C=C2)=O)C3=CC=CC(C(N)=N)=C3)NCC4=CC=CC=C4 | Serine protease inhibitor library | 29% at 200 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB001868 | 30571121 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | 147 | Methyl ((Bis(4-acetamidophenoxy)phosphoryl)(3-carbamimidoylphenyl)methyl)carbamate | O=C(OC(P(OC1=CC=C(NC(C)=O)C=C1)(OC2=CC=C(NC(C)=O)C=C2)=O)C3=CC=CC(C(N)=N)=C3)NC | Serine protease inhibitor library | 12% at 200 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB001869 | 30571121 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | 151 | (S)-Benzyl ((3-Aminophenyl)(cyano)methyl)carbamate | O=C(OCC1=CC=CC=C1)N[C@@H](C2=CC=CC(N)=C2)C#N | Serine protease inhibitor library | 8% at 200 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB001870 | 30571121 | Hsp100 | NA | Human | NA | NA | Antiproliferative activity | 16 | Benzyl (1-(Diphenoxyphosphoryl)-2-(4-(trifluoromethyl)phenyl)-ethyl) carbamate | O=C(OC(P(OC1=CC=CC=C1)(OC2=CC=CC=C2)=O)CC3=CC=C(C(F)(F)F)C=C3)NCC4=CC=CC=C4 | Serine protease inhibitor library | NA | NA | NA | NA | 100 | NA | NA | NA | NA | NA | NA | Luminescence based viability assay |
HSPMDB001871 | 30571121 | Hsp100 | NA | Human | NA | NA | Antiproliferative activity | 53 | Diphenyl (2-(4-Guanidinophenyl)-1-((S)-2-((S)-3-hydroxy-2-(thiophene-2-carboxamido)propanamido)propanamido)ethyl)-phosphonate | C[C@H](NC([C@@H](NC(C1=CC=CS1)=O)CO)=O)C(NC(P(OC2=CC=CC=C2)(OC3=CC=CC=C3)=O)CC4=CC=C(NC(N)=N)C=C4)=O | Serine protease inhibitor library | NA | NA | NA | NA | 100 | NA | NA | NA | NA | NA | NA | Luminescence based viability assay |
HSPMDB001872 | 30571121 | Hsp100 | NA | Human | NA | NA | Antiproliferative activity | 58 | Benzyl ((4-Aminophenyl)(diphenoxyphosphoryl)methyl)-carbamate | O=C(OCC1=CC=CC=C1)NC(C2=CC=C(N)C=C2)P(OC3=CC=CC=C3)(OC4=CC=CC=C4)=O | Serine protease inhibitor library | NA | NA | NA | NA | 100 | NA | NA | NA | NA | NA | NA | Luminescence based viability assay |
HSPMDB001873 | 30571121 | Hsp100 | NA | Human | NA | NA | Antiproliferative activity | 66 | Benzo[d][1,3]dioxol-5-ylmethyl ((Diphenoxyphosphoryl)(4-(2,2,2-trifluoroacetamido)phenyl)methyl)carbamate | O=C(OCC1=CC=C(OCO2)C2=C1)NC(P(OC3=CC=CC=C3)(OC4=CC=CC=C4)=O)C5=CC=C(NC(C(F)(F)F)=O)C=C5 | Serine protease inhibitor library | NA | NA | NA | NA | 100 | NA | NA | NA | NA | NA | NA | Luminescence based viability assay |
HSPMDB001874 | 30571121 | Hsp100 | NA | Human | NA | NA | Antiproliferative activity | 70 | Benzyl (1-(Diphenoxyphosphoryl)-3-(4-nitrophenyl)propyl)-carbamate | O=C(OCC1=CC=CC=C1)NC(P(OC2=CC=CC=C2)(OC3=CC=CC=C3)=O)CCC4=CC=C([N+]([O-])=O)C=C4 | Serine protease inhibitor library | NA | NA | NA | NA | 100 | NA | NA | NA | NA | NA | NA | Luminescence based viability assay |
HSPMDB001875 | 30571121 | Hsp100 | NA | Human | NA | NA | Antiproliferative activity | 71 | Methyl ((4-Carbamimidoylphenyl)(diphenoxyphosphoryl)-methyl)carbamate | O=C(OC)NC(C1=CC=C(C(N)=N)C=C1)P(OC2=CC=CC=C2)(OC3=CC=CC=C3)=O | Serine protease inhibitor library | NA | NA | NA | NA | 100 | NA | NA | NA | NA | NA | NA | Luminescence based viability assay |
HSPMDB001876 | 30571121 | Hsp100 | NA | Human | NA | NA | Antiproliferative activity | 78 | Benzyl ((4-(Dimethylamino)phenyl)(diphenoxyphosphoryl)-methyl)carbamate | O=C(OCC1=CC=CC=C1)NC(C2=CC=C(N(C)C)C=C2)P(OC3=CC=CC=C3)(OC4=CC=CC=C4)=O | Serine protease inhibitor library | NA | NA | NA | NA | 100 | NA | NA | NA | NA | NA | NA | Luminescence based viability assay |
HSPMDB001877 | 30571121 | Hsp100 | NA | Human | NA | NA | Antiproliferative activity | 85 | Benzyl ((3-Aminophenyl)(diphenoxyphosphoryl)methyl)-carbamate | O=C(OCC1=CC=CC=C1)NC(C2=CC=CC(N)=C2)P(OC3=CC=CC=C3)(OC4=CC=CC=C4)=O | Serine protease inhibitor library | NA | NA | NA | NA | 100 | NA | NA | NA | NA | NA | NA | Luminescence based viability assay |
HSPMDB001878 | 30571121 | Hsp100 | NA | Human | NA | NA | Antiproliferative activity | 86 | Benzyl ((Diphenoxyphosphoryl)(6-methoxypyridin-2-yl)methyl)-carbamate | O=C(OCC1=CC=CC=C1)NC(P(OC2=CC=CC=C2)(OC3=CC=CC=C3)=O)C4=NC(OC)=CC=C4 | Serine protease inhibitor library | NA | NA | NA | NA | 100 | NA | NA | NA | NA | NA | NA | Luminescence based viability assay |
HSPMDB001879 | 30571121 | Hsp100 | NA | Human | NA | NA | Antiproliferative activity | 89 | Benzyl ((5-Chloro-1H-indol-3-yl)(diphenoxyphosphoryl)methyl)-carbamate | O=C(OCC1=CC=CC=C1)NC(C2=CNC3=C2C=C(Cl)C=C3)P(OC4=CC=CC=C4)(OC5=CC=CC=C5)=O | Serine protease inhibitor library | NA | NA | NA | NA | 19.9 | NA | NA | NA | NA | NA | NA | Luminescence based viability assay |
HSPMDB001880 | 30571121 | Hsp100 | NA | Human | NA | NA | Antiproliferative activity | 90 | B e n z y l ( ( 6 - C a r b a m i m i d o y l n a p h t h a l e n - 2 - y l ) -(diphenoxyphosphoryl)methyl)carbamate | O=C(OCC1=CC=CC=C1)NC(C2=CC=C3C=C(C(N)=N)C=CC3=C2)P(OC4=CC=CC=C4)(OC5=CC=CC=C5)=O | Serine protease inhibitor library | NA | NA | NA | NA | 19.9 | NA | NA | NA | NA | NA | NA | Luminescence based viability assay |
HSPMDB001881 | 30571121 | Hsp100 | NA | Human | NA | NA | Antiproliferative activity | 92 | Benzyl ((3-Carbamimidoylphenyl)(diphenoxyphosphoryl)-methyl)carbamate | O=C(OCC1=CC=CC=C1)NC(C2=CC=CC(C(N)=N)=C2)P(OC3=CC=CC=C3)(OC4=CC=CC=C4)=O | Serine protease inhibitor library | NA | NA | NA | NA | 100 | NA | NA | NA | NA | NA | NA | Luminescence based viability assay |
HSPMDB001882 | 30571121 | Hsp100 | NA | Human | NA | NA | Antiproliferative activity | 107 | B e n z y l ( ( 3 - C y a n o - 4 - ( p i p e r a z i n - 1 - y l ) p h e n y l ) -(diphenoxyphosphoryl)methyl)carbamate 2,2,2-trifluoroacetate | O=C(OCC1=CC=CC=C1)NC(P(OC2=CC=CC=C2)(OC3=CC=CC=C3)=O)C4=CC=C(N5CCNCC5)C=C4.O=C(O)C(F)(F)F | Serine protease inhibitor library | NA | NA | NA | NA | 8.6 | NA | NA | NA | NA | NA | NA | Luminescence based viability assay |
HSPMDB001883 | 30571121 | Hsp100 | NA | Human | NA | NA | Antiproliferative activity | 115 | Benzyl ((1-Carbamimidoylazetidin-3-yl)(diphenoxyphosphoryl)-methyl)carbamate 2,2,2-trifluoroacetate | O=C(OCC1=CC=CC=C1)NC(C2CN(C(N)=N)C2)P(OC3=CC=CC=C3)(OC4=CC=CC=C4)=O.O=C(O)C(F)(F)F | Serine protease inhibitor library | NA | NA | NA | NA | 100 | NA | NA | NA | NA | NA | NA | Luminescence based viability assay |
HSPMDB001884 | 30571121 | Hsp100 | NA | Human | NA | NA | Antiproliferative activity | 16 | Benzyl (1-(Diphenoxyphosphoryl)-2-(4-(trifluoromethyl)phenyl)-ethyl) carbamate | O=C(OC(P(OC1=CC=CC=C1)(OC2=CC=CC=C2)=O)CC3=CC=C(C(F)(F)F)C=C3)NCC4=CC=CC=C4 | Serine protease inhibitor library | NA | NA | NA | NA | 100 | NA | NA | NA | NA | NA | NA | Luminescence based viability assay |
HSPMDB001885 | 30571121 | Hsp100 | NA | Human | NA | NA | Antiproliferative activity | 53 | Diphenyl (2-(4-Guanidinophenyl)-1-((S)-2-((S)-3-hydroxy-2-(thiophene-2-carboxamido)propanamido)propanamido)ethyl)-phosphonate | C[C@H](NC([C@@H](NC(C1=CC=CS1)=O)CO)=O)C(NC(P(OC2=CC=CC=C2)(OC3=CC=CC=C3)=O)CC4=CC=C(NC(N)=N)C=C4)=O | Serine protease inhibitor library | NA | NA | NA | NA | 100 | NA | NA | NA | NA | NA | NA | Luminescence based viability assay |
HSPMDB001886 | 30571121 | Hsp100 | NA | Human | NA | NA | Antiproliferative activity | 58 | Benzyl ((4-Aminophenyl)(diphenoxyphosphoryl)methyl)-carbamate | O=C(OCC1=CC=CC=C1)NC(C2=CC=C(N)C=C2)P(OC3=CC=CC=C3)(OC4=CC=CC=C4)=O | Serine protease inhibitor library | NA | NA | NA | NA | 100 | NA | NA | NA | NA | NA | NA | Luminescence based viability assay |
HSPMDB001887 | 30571121 | Hsp100 | NA | Human | NA | NA | Antiproliferative activity | 66 | Benzo[d][1,3]dioxol-5-ylmethyl ((Diphenoxyphosphoryl)(4-(2,2,2-trifluoroacetamido)phenyl)methyl)carbamate | O=C(OCC1=CC=C(OCO2)C2=C1)NC(P(OC3=CC=CC=C3)(OC4=CC=CC=C4)=O)C5=CC=C(NC(C(F)(F)F)=O)C=C5 | Serine protease inhibitor library | NA | NA | NA | NA | 100 | NA | NA | NA | NA | NA | NA | Luminescence based viability assay |
HSPMDB001888 | 30571121 | Hsp100 | NA | Human | NA | NA | Antiproliferative activity | 70 | Benzyl (1-(Diphenoxyphosphoryl)-3-(4-nitrophenyl)propyl)-carbamate | O=C(OCC1=CC=CC=C1)NC(P(OC2=CC=CC=C2)(OC3=CC=CC=C3)=O)CCC4=CC=C([N+]([O-])=O)C=C4 | Serine protease inhibitor library | NA | NA | NA | NA | 100 | NA | NA | NA | NA | NA | NA | Luminescence based viability assay |
HSPMDB001889 | 30571121 | Hsp100 | NA | Human | NA | NA | Antiproliferative activity | 71 | Methyl ((4-Carbamimidoylphenyl)(diphenoxyphosphoryl)-methyl)carbamate | O=C(OC)NC(C1=CC=C(C(N)=N)C=C1)P(OC2=CC=CC=C2)(OC3=CC=CC=C3)=O | Serine protease inhibitor library | NA | NA | NA | NA | 100 | NA | NA | NA | NA | NA | NA | Luminescence based viability assay |
HSPMDB001890 | 30571121 | Hsp100 | NA | Human | NA | NA | Antiproliferative activity | 78 | Benzyl ((4-(Dimethylamino)phenyl)(diphenoxyphosphoryl)-methyl)carbamate | O=C(OCC1=CC=CC=C1)NC(C2=CC=C(N(C)C)C=C2)P(OC3=CC=CC=C3)(OC4=CC=CC=C4)=O | Serine protease inhibitor library | NA | NA | NA | NA | 28.4 | NA | NA | NA | NA | NA | NA | Luminescence based viability assay |
HSPMDB001891 | 30571121 | Hsp100 | NA | Human | NA | NA | Antiproliferative activity | 85 | Benzyl ((3-Aminophenyl)(diphenoxyphosphoryl)methyl)-carbamate | O=C(OCC1=CC=CC=C1)NC(C2=CC=CC(N)=C2)P(OC3=CC=CC=C3)(OC4=CC=CC=C4)=O | Serine protease inhibitor library | NA | NA | NA | NA | 23.8 | NA | NA | NA | NA | NA | NA | Luminescence based viability assay |
HSPMDB001892 | 30571121 | Hsp100 | NA | Human | NA | NA | Antiproliferative activity | 86 | Benzyl ((Diphenoxyphosphoryl)(6-methoxypyridin-2-yl)methyl)-carbamate | O=C(OCC1=CC=CC=C1)NC(P(OC2=CC=CC=C2)(OC3=CC=CC=C3)=O)C4=NC(OC)=CC=C4 | Serine protease inhibitor library | NA | NA | NA | NA | 100 | NA | NA | NA | NA | NA | NA | Luminescence based viability assay |
HSPMDB001893 | 30571121 | Hsp100 | NA | Human | NA | NA | Antiproliferative activity | 89 | Benzyl ((5-Chloro-1H-indol-3-yl)(diphenoxyphosphoryl)methyl)-carbamate | O=C(OCC1=CC=CC=C1)NC(C2=CNC3=C2C=C(Cl)C=C3)P(OC4=CC=CC=C4)(OC5=CC=CC=C5)=O | Serine protease inhibitor library | NA | NA | NA | NA | 10.5 | NA | NA | NA | NA | NA | NA | Luminescence based viability assay |
HSPMDB001894 | 30571121 | Hsp100 | NA | Human | NA | NA | Antiproliferative activity | 90 | B e n z y l ( ( 6 - C a r b a m i m i d o y l n a p h t h a l e n - 2 - y l ) -(diphenoxyphosphoryl)methyl)carbamate | O=C(OCC1=CC=CC=C1)NC(C2=CC=C3C=C(C(N)=N)C=CC3=C2)P(OC4=CC=CC=C4)(OC5=CC=CC=C5)=O | Serine protease inhibitor library | NA | NA | NA | NA | 28.3 | NA | NA | NA | NA | NA | NA | Luminescence based viability assay |
HSPMDB001895 | 30571121 | Hsp100 | NA | Human | NA | NA | Antiproliferative activity | 92 | Benzyl ((3-Carbamimidoylphenyl)(diphenoxyphosphoryl)-methyl)carbamate | O=C(OCC1=CC=CC=C1)NC(C2=CC=CC(C(N)=N)=C2)P(OC3=CC=CC=C3)(OC4=CC=CC=C4)=O | Serine protease inhibitor library | NA | NA | NA | NA | 100 | NA | NA | NA | NA | NA | NA | Luminescence based viability assay |
HSPMDB001896 | 30571121 | Hsp100 | NA | Human | NA | NA | Antiproliferative activity | 107 | B e n z y l ( ( 3 - C y a n o - 4 - ( p i p e r a z i n - 1 - y l ) p h e n y l ) -(diphenoxyphosphoryl)methyl)carbamate 2,2,2-trifluoroacetate | O=C(OCC1=CC=CC=C1)NC(P(OC2=CC=CC=C2)(OC3=CC=CC=C3)=O)C4=CC=C(N5CCNCC5)C=C4.O=C(O)C(F)(F)F | Serine protease inhibitor library | NA | NA | NA | NA | 1.1 | NA | NA | NA | NA | NA | NA | Luminescence based viability assay |
HSPMDB001897 | 30571121 | Hsp100 | NA | Human | NA | NA | Antiproliferative activity | 115 | Benzyl ((1-Carbamimidoylazetidin-3-yl)(diphenoxyphosphoryl)-methyl)carbamate 2,2,2-trifluoroacetate | O=C(OCC1=CC=CC=C1)NC(C2CN(C(N)=N)C2)P(OC3=CC=CC=C3)(OC4=CC=CC=C4)=O.O=C(O)C(F)(F)F | Serine protease inhibitor library | NA | NA | NA | NA | 100 | NA | NA | NA | NA | NA | NA | Luminescence based viability assay |
HSPMDB001898 | 30571121 | Hsp100 | NA | Human | NA | NA | Antiproliferative activity | 16 | Benzyl (1-(Diphenoxyphosphoryl)-2-(4-(trifluoromethyl)phenyl)-ethyl) carbamate | O=C(OC(P(OC1=CC=CC=C1)(OC2=CC=CC=C2)=O)CC3=CC=C(C(F)(F)F)C=C3)NCC4=CC=CC=C4 | Serine protease inhibitor library | NA | NA | NA | NA | 100 | NA | NA | NA | NA | NA | NA | Luminescence based viability assay |
HSPMDB001899 | 30571121 | Hsp100 | NA | Human | NA | NA | Antiproliferative activity | 53 | Diphenyl (2-(4-Guanidinophenyl)-1-((S)-2-((S)-3-hydroxy-2-(thiophene-2-carboxamido)propanamido)propanamido)ethyl)-phosphonate | C[C@H](NC([C@@H](NC(C1=CC=CS1)=O)CO)=O)C(NC(P(OC2=CC=CC=C2)(OC3=CC=CC=C3)=O)CC4=CC=C(NC(N)=N)C=C4)=O | Serine protease inhibitor library | NA | NA | NA | NA | 100 | NA | NA | NA | NA | NA | NA | Luminescence based viability assay |
HSPMDB001900 | 30571121 | Hsp100 | NA | Human | NA | NA | Antiproliferative activity | 58 | Benzyl ((4-Aminophenyl)(diphenoxyphosphoryl)methyl)-carbamate | O=C(OCC1=CC=CC=C1)NC(C2=CC=C(N)C=C2)P(OC3=CC=CC=C3)(OC4=CC=CC=C4)=O | Serine protease inhibitor library | NA | NA | NA | NA | 57.8 | NA | NA | NA | NA | NA | NA | Luminescence based viability assay |
HSPMDB001901 | 30571121 | Hsp100 | NA | Human | NA | NA | Antiproliferative activity | 66 | Benzo[d][1,3]dioxol-5-ylmethyl ((Diphenoxyphosphoryl)(4-(2,2,2-trifluoroacetamido)phenyl)methyl)carbamate | O=C(OCC1=CC=C(OCO2)C2=C1)NC(P(OC3=CC=CC=C3)(OC4=CC=CC=C4)=O)C5=CC=C(NC(C(F)(F)F)=O)C=C5 | Serine protease inhibitor library | NA | NA | NA | NA | 41.5 | NA | NA | NA | NA | NA | NA | Luminescence based viability assay |
HSPMDB001902 | 30571121 | Hsp100 | NA | Human | NA | NA | Antiproliferative activity | 70 | Benzyl (1-(Diphenoxyphosphoryl)-3-(4-nitrophenyl)propyl)-carbamate | O=C(OCC1=CC=CC=C1)NC(P(OC2=CC=CC=C2)(OC3=CC=CC=C3)=O)CCC4=CC=C([N+]([O-])=O)C=C4 | Serine protease inhibitor library | NA | NA | NA | NA | 100 | NA | NA | NA | NA | NA | NA | Luminescence based viability assay |
HSPMDB001903 | 30571121 | Hsp100 | NA | Human | NA | NA | Antiproliferative activity | 71 | Methyl ((4-Carbamimidoylphenyl)(diphenoxyphosphoryl)-methyl)carbamate | O=C(OC)NC(C1=CC=C(C(N)=N)C=C1)P(OC2=CC=CC=C2)(OC3=CC=CC=C3)=O | Serine protease inhibitor library | NA | NA | NA | NA | 100 | NA | NA | NA | NA | NA | NA | Luminescence based viability assay |
HSPMDB001904 | 30571121 | Hsp100 | NA | Human | NA | NA | Antiproliferative activity | 78 | Benzyl ((4-(Dimethylamino)phenyl)(diphenoxyphosphoryl)-methyl)carbamate | O=C(OCC1=CC=CC=C1)NC(C2=CC=C(N(C)C)C=C2)P(OC3=CC=CC=C3)(OC4=CC=CC=C4)=O | Serine protease inhibitor library | NA | NA | NA | NA | 65.6 | NA | NA | NA | NA | NA | NA | Luminescence based viability assay |
HSPMDB001905 | 30571121 | Hsp100 | NA | Human | NA | NA | Antiproliferative activity | 85 | Benzyl ((3-Aminophenyl)(diphenoxyphosphoryl)methyl)-carbamate | O=C(OCC1=CC=CC=C1)NC(C2=CC=CC(N)=C2)P(OC3=CC=CC=C3)(OC4=CC=CC=C4)=O | Serine protease inhibitor library | NA | NA | NA | NA | 27.5 | NA | NA | NA | NA | NA | NA | Luminescence based viability assay |
HSPMDB001906 | 30571121 | Hsp100 | NA | Human | NA | NA | Antiproliferative activity | 86 | Benzyl ((Diphenoxyphosphoryl)(6-methoxypyridin-2-yl)methyl)-carbamate | O=C(OCC1=CC=CC=C1)NC(P(OC2=CC=CC=C2)(OC3=CC=CC=C3)=O)C4=NC(OC)=CC=C4 | Serine protease inhibitor library | NA | NA | NA | NA | 100 | NA | NA | NA | NA | NA | NA | Luminescence based viability assay |
HSPMDB001907 | 30571121 | Hsp100 | NA | Human | NA | NA | Antiproliferative activity | 89 | Benzyl ((5-Chloro-1H-indol-3-yl)(diphenoxyphosphoryl)methyl)-carbamate | O=C(OCC1=CC=CC=C1)NC(C2=CNC3=C2C=C(Cl)C=C3)P(OC4=CC=CC=C4)(OC5=CC=CC=C5)=O | Serine protease inhibitor library | NA | NA | NA | NA | 5.9 | NA | NA | NA | NA | NA | NA | Luminescence based viability assay |
HSPMDB001908 | 30571121 | Hsp100 | NA | Human | NA | NA | Antiproliferative activity | 90 | B e n z y l ( ( 6 - C a r b a m i m i d o y l n a p h t h a l e n - 2 - y l ) -(diphenoxyphosphoryl)methyl)carbamate | O=C(OCC1=CC=CC=C1)NC(C2=CC=C3C=C(C(N)=N)C=CC3=C2)P(OC4=CC=CC=C4)(OC5=CC=CC=C5)=O | Serine protease inhibitor library | NA | NA | NA | NA | 25.6 | NA | NA | NA | NA | NA | NA | Luminescence based viability assay |
HSPMDB001909 | 30571121 | Hsp100 | NA | Human | NA | NA | Antiproliferative activity | 92 | Benzyl ((3-Carbamimidoylphenyl)(diphenoxyphosphoryl)-methyl)carbamate | O=C(OCC1=CC=CC=C1)NC(C2=CC=CC(C(N)=N)=C2)P(OC3=CC=CC=C3)(OC4=CC=CC=C4)=O | Serine protease inhibitor library | NA | NA | NA | NA | 100 | NA | NA | NA | NA | NA | NA | Luminescence based viability assay |
HSPMDB001910 | 30571121 | Hsp100 | NA | Human | NA | NA | Antiproliferative activity | 107 | B e n z y l ( ( 3 - C y a n o - 4 - ( p i p e r a z i n - 1 - y l ) p h e n y l ) -(diphenoxyphosphoryl)methyl)carbamate 2,2,2-trifluoroacetate | O=C(OCC1=CC=CC=C1)NC(P(OC2=CC=CC=C2)(OC3=CC=CC=C3)=O)C4=CC=C(N5CCNCC5)C=C4.O=C(O)C(F)(F)F | Serine protease inhibitor library | NA | NA | NA | NA | 0.4 | NA | NA | NA | NA | NA | NA | Luminescence based viability assay |
HSPMDB001911 | 30571121 | Hsp100 | NA | Human | NA | NA | Antiproliferative activity | 115 | Benzyl ((1-Carbamimidoylazetidin-3-yl)(diphenoxyphosphoryl)-methyl)carbamate 2,2,2-trifluoroacetate | O=C(OCC1=CC=CC=C1)NC(C2CN(C(N)=N)C2)P(OC3=CC=CC=C3)(OC4=CC=CC=C4)=O.O=C(O)C(F)(F)F | Serine protease inhibitor library | NA | NA | NA | NA | 100 | NA | NA | NA | NA | NA | NA | Luminescence based viability assay |
HSPMDB001912 | 30571121 | Hsp100 | NA | Bacteria | NA | NA | Antibacterial activity | 115 | Benzyl ((1-Carbamimidoylazetidin-3-yl)(diphenoxyphosphoryl)-methyl)carbamate 2,2,2-trifluoroacetate | O=C(OCC1=CC=CC=C1)NC(C2CN(C(N)=N)C2)P(OC3=CC=CC=C3)(OC4=CC=CC=C4)=O.O=C(O)C(F)(F)F | Serine protease inhibitor library | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | 99.90% | Bacterial growth inhibition assay (OD based) |
HSPMDB001913 | 30571121 | Hsp100 | NA | Bacteria | NA | NA | Antibacterial activity | 90 | B e n z y l ( ( 6 - C a r b a m i m i d o y l n a p h t h a l e n - 2 - y l ) -(diphenoxyphosphoryl)methyl)carbamate | O=C(OCC1=CC=CC=C1)NC(C2=CC=C3C=C(C(N)=N)C=CC3=C2)P(OC4=CC=CC=C4)(OC5=CC=CC=C5)=O | Serine protease inhibitor library | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | 98.90% | Bacterial growth inhibition assay (OD based) |
HSPMDB001914 | 30571121 | Hsp100 | NA | Bacteria | NA | NA | Antibacterial activity | 107 | B e n z y l ( ( 3 - C y a n o - 4 - ( p i p e r a z i n - 1 - y l ) p h e n y l ) -(diphenoxyphosphoryl)methyl)carbamate 2,2,2-trifluoroacetate | O=C(OCC1=CC=CC=C1)NC(P(OC2=CC=CC=C2)(OC3=CC=CC=C3)=O)C4=CC=C(N5CCNCC5)C=C4.O=C(O)C(F)(F)F | Serine protease inhibitor library | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | 69.90% | Bacterial growth inhibition assay (OD based) |
HSPMDB001915 | 30571121 | Hsp100 | NA | Bacteria | NA | NA | Antibacterial activity | 115 | Benzyl ((1-Carbamimidoylazetidin-3-yl)(diphenoxyphosphoryl)-methyl)carbamate 2,2,2-trifluoroacetate | O=C(OCC1=CC=CC=C1)NC(C2CN(C(N)=N)C2)P(OC3=CC=CC=C3)(OC4=CC=CC=C4)=O.O=C(O)C(F)(F)F | Serine protease inhibitor library | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | 99% | Bacterial growth inhibition assay (OD based) |
HSPMDB001916 | 30571121 | Hsp100 | NA | Bacteria | NA | NA | Antibacterial activity | 90 | B e n z y l ( ( 6 - C a r b a m i m i d o y l n a p h t h a l e n - 2 - y l ) -(diphenoxyphosphoryl)methyl)carbamate | O=C(OCC1=CC=CC=C1)NC(C2=CC=C3C=C(C(N)=N)C=CC3=C2)P(OC4=CC=CC=C4)(OC5=CC=CC=C5)=O | Serine protease inhibitor library | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | 98.50% | Bacterial growth inhibition assay (OD based) |
HSPMDB001917 | 30571121 | Hsp100 | NA | Bacteria | NA | NA | Antibacterial activity | 90 | B e n z y l ( ( 6 - C a r b a m i m i d o y l n a p h t h a l e n - 2 - y l ) -(diphenoxyphosphoryl)methyl)carbamate | O=C(OCC1=CC=CC=C1)NC(C2=CC=C3C=C(C(N)=N)C=CC3=C2)P(OC4=CC=CC=C4)(OC5=CC=CC=C5)=O | Serine protease inhibitor library | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | 99.40% | Bacterial growth inhibition assay (OD based) |
HSPMDB001918 | 30571121 | Hsp100 | NA | Bacteria | NA | NA | Antibacterial activity | 85 | Benzyl ((3-Aminophenyl)(diphenoxyphosphoryl)methyl)-carbamate | O=C(OCC1=CC=CC=C1)NC(C2=CC=CC(N)=C2)P(OC3=CC=CC=C3)(OC4=CC=CC=C4)=O | Serine protease inhibitor library | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | Bacterial growth inhibition assay (OD based) |
HSPMDB001919 | 21383145 | Hsp100 | p97 | Human | Cytosol | Inhibition of ATPase activity | NA | CID16472035/CID676352 | 2-N,4-N-dibenzylquinazoline-2,4-diamine;hydrochloride | Cl.C(Nc1nc(NCc2ccccc2)c3ccccc3n1)c4ccccc4 | Maybridge, Hitfinder, and NIH molecular libraries | NA | NA | NA | 50 | NA | NA | NA | NA | Nucleotide binding domain | ATPase assay | NA | NA |
HSPMDB001920 | 21383145 | Hsp100 | p97 | Human | Cytosol | Inhibition of ATPase activity | NA | KSC-1-150/CID886813 | 2-N,4-N-dibenzylquinazoline-2,4-diamine;hydrochloride | Cl.C(Nc1nc(NCc2ccccc2)c3ccccc3n1)c4ccccc4 | Maybridge, Hitfinder, and NIH molecular libraries | NA | NA | NA | 50 | NA | NA | NA | NA | Nucleotide binding domain | ATPase assay | NA | NA |
HSPMDB001921 | 21383145 | Hsp100 | p97 | Human | Cytosol | Inhibition of ATPase activity | NA | JFD03665 | (10E)-10-(hydroxymethylidene)-9,10-dihydrophenanthren-9-one | O\C=C1\C(=O)C2=C(C=CC=C2)C2=C1C=CC=C2 | Maybridge, Hitfinder, and NIH molecular libraries | NA | NA | NA | >50 | NA | NA | NA | NA | Nucleotide binding domain | ATPase assay | NA | NA |
HSPMDB001922 | 21383145 | Hsp100 | p97 | Human | Cytosol | Inhibition of ATPase activity | NA | KSC-1-127/CID6763 | phenanthrene-9,10-dione | C1=CC=C2C(=C1)C3=CC=CC=C3C(=O)C2=O | Maybridge, Hitfinder, and NIH molecular libraries | NA | NA | NA | 50 | NA | NA | NA | NA | Nucleotide binding domain | ATPase assay | NA | NA |
HSPMDB001923 | 21383145 | Hsp100 | p97 | Human | Cytosol | Inhibition of ATPase activity | NA | JFD02342 | 1-(4-Methylphenyl)-3-phenyl-2-propyn-1-one | CC1=CC=C(C=C1)C(=O)C#CC2=CC=CC=C2 | Maybridge, Hitfinder, and NIH molecular libraries | NA | NA | NA | 47 | NA | NA | NA | NA | Nucleotide binding domain | ATPase assay | NA | NA |
HSPMDB001924 | 21383145 | Hsp100 | p97 | Human | Cytosol | Inhibition of ATPase activity | NA | CID934321 | 2-chloro-1-(1-methylindol-3-yl)ethanone | CN1C=C(C2=CC=CC=C21)C(=O)CCl | Maybridge, Hitfinder, and NIH molecular libraries | NA | NA | NA | 50 | NA | NA | NA | NA | Nucleotide binding domain | ATPase assay | NA | NA |
HSPMDB001925 | 21383145 | Hsp100 | p97 | Human | Cytosol | Inhibition of ATPase activity | NA | S09756 | 9-[(E)-2-nitroethenyl]anthracene | [O-][N+](=O)\C=C\C1=C2C=CC=CC2=CC2=C1C=CC=C2 | Maybridge, Hitfinder, and NIH molecular libraries | NA | NA | NA | 0.28 | NA | NA | NA | NA | Nucleotide binding domain | ATPase assay | NA | NA |
HSPMDB001926 | 21383145 | Hsp100 | p97 | Human | Cytosol | Inhibition of ATPase activity | NA | JFD00597 | 3-(1,3-benzoxazol-2-ylthio)-5,5-dimethylcyclohex-2-en-1-one | O1C(=NC2=C1C=CC=C2)SC2=CC(CC(C2)(C)C)=O | Maybridge, Hitfinder, and NIH molecular libraries | NA | NA | NA | >50 | NA | NA | NA | NA | Nucleotide binding domain | ATPase assay | NA | NA |
HSPMDB001927 | 21383145 | Hsp100 | p97 | Human | Cytosol | Inhibition of ATPase activity | NA | SEW05182 | 5-({5-[2-chloro-5-(trifluoromethyl)phenyl]furan-2-yl}methylidene)-2,2-dimethyl-1,3-dioxane-4,6-dione | CC1(C)OC(=O)C(=CC2=CC=C(O2)C2=C(Cl)C=CC(=C2)C(F)(F)F)C(=O)O1 | Maybridge, Hitfinder, and NIH molecular libraries | NA | NA | NA | 10 | NA | NA | NA | NA | Nucleotide binding domain | ATPase assay | NA | NA |
HSPMDB001928 | 21383145 | Hsp100 | p97 | Human | Cytosol | Inhibition of ATPase activity | NA | CID1109468 | 5-amino-4-cyano-N-[(2-methoxynaphthalen-1-yl)methylideneamino]-3-methylthiophene-2-carboxamide | CC1=C(SC(=C1C#N)N)C(=O)NN=CC2=C(C=CC3=CC=CC=C32)OC | Maybridge, Hitfinder, and NIH molecular libraries | NA | NA | NA | 2.6 | NA | NA | NA | NA | Nucleotide binding domain | ATPase assay | NA | NA |
HSPMDB001929 | 21383145 | Hsp100 | p97 | Human | Cytosol | Inhibition of ATPase activity | NA | KSC-1-132/CID2939678 | 2-[1-hydroxy-4-[(3-nitrophenyl)sulfonylamino]naphthalen-2-yl]sulfanylacetic acid | C1=CC=C2C(=C1)C(=CC(=C2O)SCC(=O)O)NS(=O)(=O)C3=CC=CC(=C3)[N+](=O)[O-] | Maybridge, Hitfinder, and NIH molecular libraries | NA | NA | NA | 50 | NA | NA | NA | NA | Nucleotide binding domain | ATPase assay | NA | NA |
HSPMDB001930 | 21383145 | Hsp100 | p97 | Human | Cytosol | Inhibition of ATPase activity | NA | KSC-1-130/CID9586497 | 2-[(E)-[4-[(2,4-dichlorophenyl)methoxy]phenyl]methylideneamino]guanidine | C1=CC(=CC=C1C=NN=C(N)N)OCC2=C(C=C(C=C2)Cl)Cl | Maybridge, Hitfinder, and NIH molecular libraries | NA | NA | NA | 51 | NA | NA | NA | NA | Nucleotide binding domain | ATPase assay | NA | NA |
HSPMDB001931 | 21383145 | Hsp100 | p97 | Human | Cytosol | Inhibition of ATPase activity | NA | KSC-1-204/CID3500086 | 2-(5-chloro-1-ethyl-3-nitro-6-oxopyridazin-4-yl)-2-[5-(trifluoromethyl)-1,3-benzothiazol-2-yl]acetonitrile | CCN1C(=O)C(=C(C(=N1)[N+](=O)[O-])C(C#N)C2=NC3=C(S2)C=CC(=C3)C(F)(F)F)Cl | Maybridge, Hitfinder, and NIH molecular libraries | NA | NA | NA | 52 | NA | NA | NA | NA | Nucleotide binding domain | ATPase assay | NA | NA |
HSPMDB001932 | 21383145 | Hsp100 | p97 | Human | Cytosol | Inhibition of ATPase activity | NA | CID5413643 | 2-[4-methyl-6-(phenylamino)pyrimidin-2-yl]phenol | CC1=CC(NC2=CC=CC=C2)=NC(=N1)C1=C(O)C=CC=C1 | Maybridge, Hitfinder, and NIH molecular libraries | NA | NA | NA | 53 | NA | NA | NA | NA | Nucleotide binding domain | ATPase assay | NA | NA |
HSPMDB001933 | 21383145 | Hsp100 | p97 | Human | Cytosol | Inhibition of ATPase activity | NA | KSC-1-131/CID2867539/CID/9567210 | 3-[(2E)-2-[(4-methoxyphenyl)methylidene]hydrazinyl]-6-phenyl-4H-1,2,4-triazin-5-one | COC1=CC=C(C=C1)C=NNC2=NN=C(C(=O)N2)C3=CC=CC=C3 | Maybridge, Hitfinder, and NIH molecular libraries | NA | NA | NA | 54 | NA | NA | NA | NA | Nucleotide binding domain | ATPase assay | NA | NA |
HSPMDB001934 | 21383145 | Hsp100 | p97 | Human | Cytosol | Inhibition of ATPase activity | NA | KSC-1-128/CID987585 | N-(1-benzyl-3-cyanopyrrolo[3,2-b]quinoxalin-2-yl)-2-chlorobenzamide | C1=CC=C(C=C1)CN2C(=C(C3=NC4=CC=CC=C4N=C32)C#N)NC(=O)C5=CC=CC=C5Cl | Maybridge, Hitfinder, and NIH molecular libraries | NA | NA | NA | 55 | NA | NA | NA | NA | Nucleotide binding domain | ATPase assay | NA | NA |
HSPMDB001935 | 21383145 | Hsp100 | p97 | Human | Cytosol | Inhibition of ATPase activity | NA | CID6524677 | (4Z)-4-[[2-(7-chloroquinolin-4-yl)hydrazinyl]methylidene]-2-hydroxycyclohexa-2,5-dien-1-one | C1=CC2=C(C=CN=C2C=C1Cl)NNC=C3C=CC(=O)C(=C3)O | Maybridge, Hitfinder, and NIH molecular libraries | NA | NA | NA | 36 | NA | NA | NA | NA | Nucleotide binding domain | ATPase assay | NA | NA |
HSPMDB001936 | 21383145 | Hsp100 | p97 | Human | Cytosol | Inhibition of ATPase activity | NA | SPB01017 | [1-(1,3-dithiolan-2-yl)naphthalen-2-yl] thiophene-2-carboxylate | C1CSC(S1)C2=C(C=CC3=CC=CC=C32)OC(=O)C4=CC=CS4 | Maybridge, Hitfinder, and NIH molecular libraries | NA | NA | NA | >50 | NA | NA | NA | NA | Nucleotide binding domain | ATPase assay | NA | NA |
HSPMDB001937 | 21383145 | Hsp100 | p97 | Human | Cytosol | Inhibition of ATPase activity | NA | HTS01888 | N-[4-(3-Chloro-4-methylphenyl)-5-methyl-1,3-thiazol-2-yl]-2,1,3-benzoxadiazole-4-sulfonamide | Cc1ccc(cc1Cl)c2nc(NS(=O)(=O)c3cccc4nonc34)sc2C | Maybridge, Hitfinder, and NIH molecular libraries | NA | NA | NA | 14.5 | NA | NA | NA | NA | Nucleotide binding domain | ATPase assay | NA | NA |
HSPMDB001938 | 21383145 | Hsp100 | p97 | Human | Cytosol | Inhibition of ATPase activity | NA | KSC-1-129/CID801956 | methyl 2-[(2-methylbenzoyl)carbamothioylamino]benzoate | CC1=CC=CC=C1C(=O)NC(=S)NC2=CC=CC=C2C(=O)OC | Maybridge, Hitfinder, and NIH molecular libraries | NA | NA | NA | 50 | NA | NA | NA | NA | Nucleotide binding domain | ATPase assay | NA | NA |
HSPMDB001939 | 21383145 | Hsp100 | p97 | Human | Cytosol | Inhibition of ATPase activity | NA | CID5756550 | (5Z)-5-[(2-phenyl-1H-indol-3-yl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one | C1=CC=C(C=C1)C2=C(C3=CC=CC=C3N2)C=C4C(=O)NC(=S)S4 | Maybridge, Hitfinder, and NIH molecular libraries | NA | NA | NA | 50 | NA | NA | NA | NA | Nucleotide binding domain | ATPase assay | NA | NA |
HSPMDB001940 | 21383145 | Hsp100 | p97 | Human | Cytosol | Inhibition of ATPase activity | NA | CD07581 | 6-[(2-chlorophenyl)amino]-2-(2,6-dichlorophenyl)-4-oxo-3,4-dihydro-2H-1,3-thiazine-5-carbonitrile | ClC1=CC=CC=C1NC1=C(C#N)C(=O)NC(S1)C1=C(Cl)C=CC=C1Cl | Maybridge, Hitfinder, and NIH molecular libraries | NA | NA | NA | 5.9 | NA | NA | NA | NA | Nucleotide binding domain | ATPase assay | NA | NA |
HSPMDB001941 | 21383145 | Hsp100 | p97 | Human | Cytosol | Inhibition of ATPase activity | NA | CD02660 | methyl 3-[(E)-[(3,5-dichloro-2-hydroxyphenyl)methylidene]amino]-4-oxo-3,4-dihydroquinazoline-2-carboxylate | [H]COC(=O)C1=NC2=C(C=CC=C2)C(=O)N1\N=C\C1=C(O)C(Cl)=CC(Cl)=C1 | Maybridge, Hitfinder, and NIH molecular libraries | NA | NA | NA | 2.5 | NA | NA | NA | NA | Nucleotide binding domain | ATPase assay | NA | NA |
HSPMDB001942 | 21383145 | Hsp100 | p97 | Human | Cytosol | Inhibition of ATPase activity | NA | SP01086 | 3-(5-tert-butyl-2-methylfuran-3-yl)-4-methyl-5-(methylsulfanyl)-1H-pyrazole | CSC1=C(C)C(=NN1)C1=C(C)OC(=C1)C(C)(C)C | Maybridge, Hitfinder, and NIH molecular libraries | NA | NA | NA | 25 | NA | NA | NA | NA | Nucleotide binding domain | ATPase assay | NA | NA |
HSPMDB001943 | 21383145 | Hsp100 | p97 | Human | Cytosol | Inhibition of ATPase activity | NA | CID3598 | 3,4,6-trichloro-2-[(2,3,5-trichloro-6-hydroxyphenyl)methyl]phenol | C1=C(C(=C(C(=C1Cl)Cl)CC2=C(C(=CC(=C2Cl)Cl)Cl)O)O)Cl | Maybridge, Hitfinder, and NIH molecular libraries | NA | NA | NA | 5.5 | NA | NA | NA | NA | Nucleotide binding domain | ATPase assay | NA | NA |
HSPMDB001944 | 21383145 | Hsp100 | p97 | Human | Cytosol | Inhibition of ATPase activity | NA | CID2884885 | 2,2-dichloro-N-(4-fluorophenyl)-3-phenylcyclopropane-1-carboxamide | C1=CC=C(C=C1)C2C(C2(Cl)Cl)C(=O)NC3=CC=C(C=C3)F | Maybridge, Hitfinder, and NIH molecular libraries | NA | NA | NA | 50 | NA | NA | NA | NA | Nucleotide binding domain | ATPase assay | NA | NA |
HSPMDB001945 | 21383145 | Hsp100 | p97 | Human | Cytosol | Inhibition of ATPase activity | NA | CID409928 | 2-[3-(dibutylamino)propyl]isoindole-1,3-dione | CCCCN(CCCC)CCCN1C(=O)C2=CC=CC=C2C1=O | Maybridge, Hitfinder, and NIH molecular libraries | NA | NA | NA | 50 | NA | NA | NA | NA | Nucleotide binding domain | ATPase assay | NA | NA |
HSPMDB001946 | 21383145 | Hsp100 | p97 | Human | Cytosol | Inhibition of ATPase activity | NA | CID5875182 | 5-amino-6-[(Z)-(2-methylindol-3-ylidene)methyl]-3-methylsulfanyl-[1,2,4]thiadiazolo[4,5-a]pyrimidin-7-one | CC1=NC2=CC=CC=C2C1=CC3=C(N4C(=NC3=O)SN=C4SC)N | Maybridge, Hitfinder, and NIH molecular libraries | NA | NA | NA | 22 | NA | NA | NA | NA | Nucleotide binding domain | ATPase assay | NA | NA |
HSPMDB001947 | 21383145 | Hsp100 | p97 | Human | Cytosol | Inhibition of ATPase activity | NA | CID16194309 | 5-amino-6-[(Z)-(2-methylindol-3-ylidene)methyl]-3-(2-methylpropylsulfonyl)-[1,2,4]thiadiazolo[4,5-a]pyrimidin-7-one | CC1=NC2=CC=CC=C2C1=CC3=C(N4C(=NC3=O)SN=C4S(=O)(=O)CC(C)C)N | Maybridge, Hitfinder, and NIH molecular libraries | NA | NA | NA | 12 | NA | NA | NA | NA | Nucleotide binding domain | ATPase assay | NA | NA |
HSPMDB001948 | 21383145 | Hsp100 | p97 | Human | Cytosol | Inhibition of ATPase activity | NA | CID5691857 | 2-[(6,7-dihydroxy-2-oxochromen-4-yl)methylsulfanyl]-3-(3-methoxyphenyl)quinazolin-4-one | COC1=CC=CC(=C1)N2C(=O)C3=CC=CC=C3N=C2SCC4=CC(=O)OC5=CC(=C(C=C45)O)O | Maybridge, Hitfinder, and NIH molecular libraries | NA | NA | NA | 21 | NA | NA | NA | NA | Nucleotide binding domain | ATPase assay | NA | NA |
HSPMDB001949 | 21383145 | Hsp100 | p97 | Human | Cytosol | Inhibition of ATPase activity | NA | KSC-1-1206/CID2384538 | 2-(chloromethyl)-1H-pyrimido[1,2-a]benzimidazol-4-one | C1=CC=C2C(=C1)N=C3N2C(=O)C=C(N3)CCl | Maybridge, Hitfinder, and NIH molecular libraries | NA | NA | NA | 50 | NA | NA | NA | NA | Nucleotide binding domain | ATPase assay | NA | NA |
HSPMDB001950 | 21383145 | Hsp100 | p97 | Human | Cytosol | Inhibition of ATPase activity | NA | KSC-1-202/CID2810445 | 2,6-dichloro-N-(2-hydroxy-1,3-dioxoinden-2-yl)benzamide | C1=CC=C2C(=C1)C(=O)C(C2=O)(NC(=O)C3=C(C=CC=C3Cl)Cl)O | Maybridge, Hitfinder, and NIH molecular libraries | NA | NA | NA | 50 | NA | NA | NA | NA | Nucleotide binding domain | ATPase assay | NA | NA |
HSPMDB001951 | 21383145 | Hsp100 | p97 | Human | Cytosol | Inhibition of ATPase activity | NA | CID2175556 | 4-[[4-(2,4-dihydroxyphenyl)-1,3-thiazol-2-yl]amino]benzenesulfonamide | C1=CC(=CC=C1NC2=NC(=CS2)C3=C(C=C(C=C3)O)O)S(=O)(=O)N | Maybridge, Hitfinder, and NIH molecular libraries | NA | NA | NA | 24 | NA | NA | NA | NA | Nucleotide binding domain | ATPase assay | NA | NA |
HSPMDB001952 | 21383145 | Hsp100 | p97 | Human | Cytosol | Inhibition of ATPase activity | NA | KSC-1-201/CID2810155 | 2-methyl-N-(7-methyl-4-oxothieno[3,2-d][1,3]thiazin-2-yl)benzamide | CC1=CC=CC=C1C(=O)NC2=NC3=C(C(=O)S2)SC=C3C | Maybridge, Hitfinder, and NIH molecular libraries | NA | NA | NA | 50 | NA | NA | NA | NA | Nucleotide binding domain | ATPase assay | NA | NA |
HSPMDB001953 | 21383145 | Hsp100 | p97 | Human | Cytosol | Inhibition of ATPase activity | NA | KSC-1-209/CID2472581 | [2-(1H-indol-3-yl)-2-oxoethyl] 5-nitrothiophene-2-carboxylate | C1=CC=C2C(=C1)C(=CN2)C(=O)COC(=O)C3=CC=C(S3)[N+](=O)[O-] | Maybridge, Hitfinder, and NIH molecular libraries | NA | NA | NA | 51 | NA | NA | NA | NA | Nucleotide binding domain | ATPase assay | NA | NA |
HSPMDB001954 | 21383145 | Hsp100 | p97 | Human | Cytosol | Inhibition of ATPase activity | NA | KSC-1-199/CID4072379 | N'-acridin-9-yl-2,4-dihydroxybenzohydrazide | C1=CC=C2C(=C1)C(=C3C=CC=CC3=N2)NNC(=O)C4=C(C=C(C=C4)O)O | Maybridge, Hitfinder, and NIH molecular libraries | NA | NA | NA | 52 | NA | NA | NA | NA | Nucleotide binding domain | ATPase assay | NA | NA |
HSPMDB001955 | 21383145 | Hsp100 | p97 | Human | Cytosol | Inhibition of ATPase activity | NA | CID1625680 | 4-[5-[(Z)-2-carboxy-2-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]ethenyl]furan-2-yl]-2-chlorobenzoic acid | CC1=NC(=NN1)SC(=CC2=CC=C(O2)C3=CC(=C(C=C3)C(=O)O)Cl)C(=O)O | Maybridge, Hitfinder, and NIH molecular libraries | NA | NA | NA | 53 | NA | NA | NA | NA | Nucleotide binding domain | ATPase assay | NA | NA |
HSPMDB001956 | 21383145 | Hsp100 | p97 | Human | Cytosol | Inhibition of ATPase activity | NA | KM08995 | 3-(5-acetylthiophen-2-yl)prop-2-ynyl N-phenylcarbamate | CC(=O)C1=CC=C(S1)C#CCOC(=O)NC2=CC=CC=C2 | Maybridge, Hitfinder, and NIH molecular libraries | NA | NA | NA | 7.5 | NA | NA | NA | NA | Nucleotide binding domain | ATPase assay | NA | NA |
HSPMDB001957 | 21383145 | Hsp100 | p97 | Human | Cytosol | Inhibition of ATPase activity | NA | CID1976446 | (6E)-5-imino-6-[(4-oxochromen-3-yl)methylidene]-2-pyridin-4-yl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one | C1=CC=C2C(=C1)C(=O)C(=CO2)C=C3C(=N)N4C(=NC3=O)SC(=N4)C5=CC=NC=C5 | Maybridge, Hitfinder, and NIH molecular libraries | NA | NA | NA | 11 | NA | NA | NA | NA | Nucleotide binding domain | ATPase assay | NA | NA |
HSPMDB001958 | 21383145 | Hsp100 | p97 | Human | Cytosol | Inhibition of ATPase activity | NA | CID930238 | 7-propan-2-yl-10-thia-8,13,15-triazatetracyclo[7.7.0.02,6.011,16]hexadeca-1,6,8,11(16),13-pentaene-12-thione | CC(C)C1=C2CCCC2=C3C4=C(C(=S)N=CN4)SC3=N1 | Maybridge, Hitfinder, and NIH molecular libraries | NA | NA | NA | 42 | NA | NA | NA | NA | Nucleotide binding domain | ATPase assay | NA | NA |
HSPMDB001959 | 21383145 | Hsp100 | p97 | Human | Cytosol | Inhibition of ATPase activity | NA | CID2978460 | 4-[[4-(2-fluorophenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-8-yl]sulfonylamino]benzoic acid | C1C=CC2C1C(NC3=C2C=C(C=C3)S(=O)(=O)NC4=CC=C(C=C4)C(=O)O)C5=CC=CC=C5F | Maybridge, Hitfinder, and NIH molecular libraries | NA | NA | NA | 19 | NA | NA | NA | NA | Nucleotide binding domain | ATPase assay | NA | NA |
HSPMDB001960 | 21383145 | Hsp100 | p97 | Human | Cytosol | Inhibition of ATPase activity | NA | CD00823 | 3-(1H-indol-3-ylmethylidene)indolin-2-one | O=c1nc2ccccc2c1=Cc1cnc2ccccc21 | Maybridge, Hitfinder, and NIH molecular libraries | NA | NA | NA | >50 | NA | NA | NA | NA | Nucleotide binding domain | ATPase assay | NA | NA |
HSPMDB001961 | 21383145 | Hsp100 | p97 | Human | Cytosol | Inhibition of ATPase activity | NA | JFD01560 | 4-pyren-1-ylbutanoic acid | C1=CC2=C3C(=C1)C=CC4=C(C=CC(=C43)C=C2)CCCC(=O)O | Maybridge, Hitfinder, and NIH molecular libraries | NA | NA | NA | 10 | NA | NA | NA | NA | Nucleotide binding domain | ATPase assay | NA | NA |
HSPMDB001962 | 21383145 | Hsp100 | p97 | Human | Cytosol | Inhibition of ATPase activity | NA | KSC-1-133/CID5559718 | (Z)-2-(1,3-benzothiazol-2-yl)-3-hydroxy-4-(4-methylphenyl)sulfanylbut-2-enenitrile | CC1=CC=C(C=C1)SCC(=C(C#N)C2=NC3=CC=CC=C3S2)O | Maybridge, Hitfinder, and NIH molecular libraries | NA | NA | NA | 50 | NA | NA | NA | NA | Nucleotide binding domain | ATPase assay | NA | NA |
HSPMDB001963 | 21383145 | Hsp100 | p97 | Human | Cytosol | Inhibition of ATPase activity | NA | KSC-1-205/CID5982653 | 3-nitro-4-[(2E)-2-[(2,3,4-trihydroxyphenyl)methylidene]hydrazinyl]benzenesulfonamide | C1=CC(=C(C=C1S(=O)(=O)N)[N+](=O)[O-])NN=CC2=C(C(=C(C=C2)O)O)O | Maybridge, Hitfinder, and NIH molecular libraries | NA | NA | NA | 50 | NA | NA | NA | NA | Nucleotide binding domain | ATPase assay | NA | NA |
HSPMDB001964 | 21383145 | Hsp100 | p97 | Human | Cytosol | Inhibition of ATPase activity | NA | KSC-1-232/CID3787408 | N-[3-(benzenesulfonyl)-1-butylpyrrolo[3,2-b]quinoxalin-2-yl]-4-methylbenzenesulfonamide | CCCCN1C(=C(C2=NC3=CC=CC=C3N=C21)S(=O)(=O)C4=CC=CC=C4)NS(=O)(=O)C5=CC=C(C=C5)C | Maybridge, Hitfinder, and NIH molecular libraries | NA | NA | NA | 50 | NA | NA | NA | NA | Nucleotide binding domain | ATPase assay | NA | NA |
HSPMDB001965 | 21383145 | Hsp100 | p97 | Human | Cytosol | Inhibition of ATPase activity | NA | KSC-1-233/CID2044030 | N-(1-benzylpyrrolo[3,2-b]quinoxalin-2-yl)-4-chlorobenzenesulfonamide | C1=CC=C(C=C1)CN2C(=CC3=NC4=CC=CC=C4N=C32)NS(=O)(=O)C5=CC=C(C=C5)Cl | Maybridge, Hitfinder, and NIH molecular libraries | NA | NA | NA | 50 | NA | NA | NA | NA | Nucleotide binding domain | ATPase assay | NA | NA |
HSPMDB001966 | 21383145 | Hsp100 | p97 | Human | Cytosol | Inhibition of ATPase activity | NA | CD02506 | 3-{bicyclo[2.2.1]hept-5-en-2-yl}-1-{[(4-bromo-3-chlorophenyl)carbamothioyl]amino}thiourea | ClC1=CC(NC(=S)NNC(=S)NC2CC3CC2C=C3)=CC=C1Br | Maybridge, Hitfinder, and NIH molecular libraries | NA | NA | NA | 3.2 | NA | NA | NA | NA | Nucleotide binding domain | ATPase assay | NA | NA |
HSPMDB001967 | 21383145 | Hsp100 | p97 | Human | Cytosol | Inhibition of ATPase activity | NA | CD06082 | N-{[(2,5-dichlorophenyl)carbamothioyl]amino}-2-{[(E)-[(2,4-dichlorophenyl)methylidene]amino]oxy}acetamide | ClC1=CC(Cl)=C(\C=N\OCC(=O)NNC(=S)NC2=C(Cl)C=CC(Cl)=C2)C=C1 | Maybridge, Hitfinder, and NIH molecular libraries | NA | NA | NA | 2.2 | NA | NA | NA | NA | Nucleotide binding domain | ATPase assay | NA | NA |
HSPMDB001968 | 21383145 | Hsp100 | p97 | Human | Cytosol | Inhibition of ATPase activity | NA | CID160115 | 5,6,8-trihydroxy-2-methyl-9-(5,6,8-trihydroxy-2-methyl-4-oxo-2,3-dihydrobenzo[g]chromen-9-yl)-2,3-dihydrobenzo[g]chromen-4-one | CC1CC(=O)C2=C(O1)C=C3C(=C2O)C(=CC(=C3C4=C(C=C(C5=C(C6=C(C=C54)OC(CC6=O)C)O)O)O)O)O | Maybridge, Hitfinder, and NIH molecular libraries | NA | NA | NA | 44 | NA | NA | NA | NA | Nucleotide binding domain | ATPase assay | NA | NA |
HSPMDB001969 | 21383145 | Hsp100 | p97 | Human | Cytosol | Inhibition of ATPase activity | NA | CID16472035/CID676352 | 2-N,4-N-dibenzylquinazoline-2,4-diamine;hydrochloride | C1=CC=C(C=C1)CNC2=NC(=NC3=CC=CC=C32)NCC4=CC=CC=C4.Cl | Maybridge, Hitfinder, and NIH molecular libraries | NA | NA | NA | 1.5 | NA | NA | NA | NA | Nucleotide binding domain | ATPase assay | NA | NA |
HSPMDB001970 | 21383145 | Hsp100 | p97 | Human | Cytosol | Inhibition of ATPase activity | NA | KSC-1-150/CID886813 | N-benzyl-2-(2-fluorophenyl)quinazolin-4-amine | Fc1ccccc1c2nc(NCc3ccccc3)c4ccccc4n2 | Maybridge, Hitfinder, and NIH molecular libraries | NA | NA | NA | 3 | NA | NA | NA | NA | Nucleotide binding domain | ATPase assay | NA | NA |
HSPMDB001971 | 21383145 | Hsp100 | p97 | Human | Cytosol | Inhibition of ATPase activity | NA | JFD03665 | (10E)-10-(hydroxymethylidene)-9,10-dihydrophenanthren-9-one | O\C=C1\C(=O)C2=C(C=CC=C2)C2=C1C=CC=C2 | Maybridge, Hitfinder, and NIH molecular libraries | NA | NA | NA | 0.26 | NA | NA | NA | NA | Nucleotide binding domain | ATPase assay | NA | NA |
HSPMDB001972 | 21383145 | Hsp100 | p97 | Human | Cytosol | Inhibition of ATPase activity | NA | KSC-1-127/CID6763 | phenanthrene-9,10-dione | C1=CC=C2C(=C1)C3=CC=CC=C3C(=O)C2=O | Maybridge, Hitfinder, and NIH molecular libraries | NA | NA | NA | 3.5 | NA | NA | NA | NA | Nucleotide binding domain | ATPase assay | NA | NA |
HSPMDB001973 | 21383145 | Hsp100 | p97 | Human | Cytosol | Inhibition of ATPase activity | NA | JFD02342 | 1-(4-Methylphenyl)-3-phenyl-2-propyn-1-one | CC1=CC=C(C=C1)C(=O)C#CC2=CC=CC=C2 | Maybridge, Hitfinder, and NIH molecular libraries | NA | NA | NA | 0.2 | NA | NA | NA | NA | Nucleotide binding domain | ATPase assay | NA | NA |
HSPMDB001974 | 21383145 | Hsp100 | p97 | Human | Cytosol | Inhibition of ATPase activity | NA | CID934321 | 2-chloro-1-(1-methylindol-3-yl)ethanone | CN1C=C(C2=CC=CC=C21)C(=O)CCl | Maybridge, Hitfinder, and NIH molecular libraries | NA | NA | NA | 1.3 | NA | NA | NA | NA | Nucleotide binding domain | ATPase assay | NA | NA |
HSPMDB001975 | 21383145 | Hsp100 | p97 | Human | Cytosol | Inhibition of ATPase activity | NA | S09756 | 9-[(E)-2-nitroethenyl]anthracene | [O-][N+](=O)\C=C\C1=C2C=CC=CC2=CC2=C1C=CC=C2 | Maybridge, Hitfinder, and NIH molecular libraries | NA | NA | NA | 0.8 | NA | NA | NA | NA | Nucleotide binding domain | ATPase assay | NA | NA |
HSPMDB001976 | 21383145 | Hsp100 | p97 | Human | Cytosol | Inhibition of ATPase activity | NA | JFD00597 | 3-(1,3-benzoxazol-2-ylthio)-5,5-dimethylcyclohex-2-en-1-one | O1C(=NC2=C1C=CC=C2)SC2=CC(CC(C2)(C)C)=O | Maybridge, Hitfinder, and NIH molecular libraries | NA | NA | NA | 6.1 | NA | NA | NA | NA | Nucleotide binding domain | ATPase assay | NA | NA |
HSPMDB001977 | 21383145 | Hsp100 | p97 | Human | Cytosol | Inhibition of ATPase activity | NA | SEW05182 | 5-({5-[2-chloro-5-(trifluoromethyl)phenyl]furan-2-yl}methylidene)-2,2-dimethyl-1,3-dioxane-4,6-dione | CC1(C)OC(=O)C(=CC2=CC=C(O2)C2=C(Cl)C=CC(=C2)C(F)(F)F)C(=O)O1 | Maybridge, Hitfinder, and NIH molecular libraries | NA | NA | NA | 13 | NA | NA | NA | NA | Nucleotide binding domain | ATPase assay | NA | NA |
HSPMDB001978 | 21383145 | Hsp100 | p97 | Human | Cytosol | Inhibition of ATPase activity | NA | CID1109468 | 5-amino-4-cyano-N-[(2-methoxynaphthalen-1-yl)methylideneamino]-3-methylthiophene-2-carboxamide | CC1=C(SC(=C1C#N)N)C(=O)NN=CC2=C(C=CC3=CC=CC=C32)OC | Maybridge, Hitfinder, and NIH molecular libraries | NA | NA | NA | 2 | NA | NA | NA | NA | Nucleotide binding domain | ATPase assay | NA | NA |
HSPMDB001979 | 21383145 | Hsp100 | p97 | Human | Cytosol | Inhibition of ATPase activity | NA | KSC-1-132/CID2939678 | 2-[1-hydroxy-4-[(3-nitrophenyl)sulfonylamino]naphthalen-2-yl]sulfanylacetic acid | C1=CC=C2C(=C1)C(=CC(=C2O)SCC(=O)O)NS(=O)(=O)C3=CC=CC(=C3)[N+](=O)[O-] | Maybridge, Hitfinder, and NIH molecular libraries | NA | NA | NA | 24 | NA | NA | NA | NA | Nucleotide binding domain | ATPase assay | NA | NA |
HSPMDB001980 | 21383145 | Hsp100 | p97 | Human | Cytosol | Inhibition of ATPase activity | NA | KSC-1-130/CID9586497 | 2-[(E)-[4-[(2,4-dichlorophenyl)methoxy]phenyl]methylideneamino]guanidine | C1=CC(=CC=C1C=NN=C(N)N)OCC2=C(C=C(C=C2)Cl)Cl | Maybridge, Hitfinder, and NIH molecular libraries | NA | NA | NA | 24 | NA | NA | NA | NA | Nucleotide binding domain | ATPase assay | NA | NA |
HSPMDB001981 | 21383145 | Hsp100 | p97 | Human | Cytosol | Inhibition of ATPase activity | NA | KSC-1-204/CID3500086 | 2-(5-chloro-1-ethyl-3-nitro-6-oxopyridazin-4-yl)-2-[5-(trifluoromethyl)-1,3-benzothiazol-2-yl]acetonitrile | CCN1C(=O)C(=C(C(=N1)[N+](=O)[O-])C(C#N)C2=NC3=C(S2)C=CC(=C3)C(F)(F)F)Cl | Maybridge, Hitfinder, and NIH molecular libraries | NA | NA | NA | 14 | NA | NA | NA | NA | Nucleotide binding domain | ATPase assay | NA | NA |
HSPMDB001982 | 21383145 | Hsp100 | p97 | Human | Cytosol | Inhibition of ATPase activity | NA | CID5413643 | 2-[4-methyl-6-(phenylamino)pyrimidin-2-yl]phenol | CC1=CC(NC2=CC=CC=C2)=NC(=N1)C1=C(O)C=CC=C1 | Maybridge, Hitfinder, and NIH molecular libraries | NA | NA | NA | 10 | NA | NA | NA | NA | Nucleotide binding domain | ATPase assay | NA | NA |
HSPMDB001983 | 21383145 | Hsp100 | p97 | Human | Cytosol | Inhibition of ATPase activity | NA | KSC-1-131/CID2867539/CID/9567210 | 3-[(2E)-2-[(4-methoxyphenyl)methylidene]hydrazinyl]-6-phenyl-4H-1,2,4-triazin-5-one | COC1=CC=C(C=C1)C=NNC2=NN=C(C(=O)N2)C3=CC=CC=C3 | Maybridge, Hitfinder, and NIH molecular libraries | NA | NA | NA | >30 | NA | NA | NA | NA | Nucleotide binding domain | ATPase assay | NA | NA |
HSPMDB001984 | 21383145 | Hsp100 | p97 | Human | Cytosol | Inhibition of ATPase activity | NA | KSC-1-128/CID987585 | N-(1-benzyl-3-cyanopyrrolo[3,2-b]quinoxalin-2-yl)-2-chlorobenzamide | C1=CC=C(C=C1)CN2C(=C(C3=NC4=CC=CC=C4N=C32)C#N)NC(=O)C5=CC=CC=C5Cl | Maybridge, Hitfinder, and NIH molecular libraries | NA | NA | NA | 147 | NA | NA | NA | NA | Nucleotide binding domain | ATPase assay | NA | NA |
HSPMDB001985 | 21383145 | Hsp100 | p97 | Human | Cytosol | Inhibition of ATPase activity | NA | CID6524677 | (4Z)-4-[[2-(7-chloroquinolin-4-yl)hydrazinyl]methylidene]-2-hydroxycyclohexa-2,5-dien-1-one | C1=CC2=C(C=CN=C2C=C1Cl)NNC=C3C=CC(=O)C(=C3)O | Maybridge, Hitfinder, and NIH molecular libraries | NA | NA | NA | 4.9 | NA | NA | NA | NA | Nucleotide binding domain | ATPase assay | NA | NA |
HSPMDB001986 | 21383145 | Hsp100 | p97 | Human | Cytosol | Inhibition of ATPase activity | NA | SPB01017 | [1-(1,3-dithiolan-2-yl)naphthalen-2-yl] thiophene-2-carboxylate | C1CSC(S1)C2=C(C=CC3=CC=CC=C32)OC(=O)C4=CC=CS4 | Maybridge, Hitfinder, and NIH molecular libraries | NA | NA | NA | 6.4 | NA | NA | NA | NA | Nucleotide binding domain | ATPase assay | NA | NA |
HSPMDB001987 | 21383145 | Hsp100 | p97 | Human | Cytosol | Inhibition of ATPase activity | NA | HTS01888 | N-[4-(3-Chloro-4-methylphenyl)-5-methyl-1,3-thiazol-2-yl]-2,1,3-benzoxadiazole-4-sulfonamide | Cc1ccc(cc1Cl)c2nc(NS(=O)(=O)c3cccc4nonc34)sc2C | Maybridge, Hitfinder, and NIH molecular libraries | NA | NA | NA | 19 | NA | NA | NA | NA | Nucleotide binding domain | ATPase assay | NA | NA |
HSPMDB001988 | 21383145 | Hsp100 | p97 | Human | Cytosol | Inhibition of ATPase activity | NA | KSC-1-129/CID801956 | methyl 2-[(2-methylbenzoyl)carbamothioylamino]benzoate | CC1=CC=CC=C1C(=O)NC(=S)NC2=CC=CC=C2C(=O)OC | Maybridge, Hitfinder, and NIH molecular libraries | NA | NA | NA | 1.1 | NA | NA | NA | NA | Nucleotide binding domain | ATPase assay | NA | NA |
HSPMDB001989 | 21383145 | Hsp100 | p97 | Human | Cytosol | Inhibition of ATPase activity | NA | CID5756550 | (5Z)-5-[(2-phenyl-1H-indol-3-yl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one | C1=CC=C(C=C1)C2=C(C3=CC=CC=C3N2)C=C4C(=O)NC(=S)S4 | Maybridge, Hitfinder, and NIH molecular libraries | NA | NA | NA | 34 | NA | NA | NA | NA | Nucleotide binding domain | ATPase assay | NA | NA |
HSPMDB001990 | 21383145 | Hsp100 | p97 | Human | Cytosol | Inhibition of ATPase activity | NA | CD07581 | 6-[(2-chlorophenyl)amino]-2-(2,6-dichlorophenyl)-4-oxo-3,4-dihydro-2H-1,3-thiazine-5-carbonitrile | ClC1=CC=CC=C1NC1=C(C#N)C(=O)NC(S1)C1=C(Cl)C=CC=C1Cl | Maybridge, Hitfinder, and NIH molecular libraries | NA | NA | NA | 4 | NA | NA | NA | NA | Nucleotide binding domain | ATPase assay | NA | NA |
HSPMDB001991 | 21383145 | Hsp100 | p97 | Human | Cytosol | Inhibition of ATPase activity | NA | CD02660 | ethyl 3-[(E)-[(3,5-dichloro-2-hydroxyphenyl)methylidene]amino]-4-oxo-3,4-dihydroquinazoline-2-carboxylate | CCOC(=O)C1=NC2=C(C=CC=C2)C(=O)N1\N=C\C1=C(O)C(Cl)=CC(Cl)=C1 | Maybridge, Hitfinder, and NIH molecular libraries | NA | NA | NA | >50 | NA | NA | NA | NA | Nucleotide binding domain | ATPase assay | NA | NA |
HSPMDB001992 | 21383145 | Hsp100 | p97 | Human | Cytosol | Inhibition of ATPase activity | NA | SP01086 | 3-(5-tert-butyl-2-methylfuran-3-yl)-4-methyl-5-(methylsulfanyl)-1H-pyrazole | CSC1=C(C)C(=NN1)C1=C(C)OC(=C1)C(C)(C)C | Maybridge, Hitfinder, and NIH molecular libraries | NA | NA | NA | >50 | NA | NA | NA | NA | Nucleotide binding domain | ATPase assay | NA | NA |
HSPMDB001993 | 21383145 | Hsp100 | p97 | Human | Cytosol | Inhibition of ATPase activity | NA | CID3598 | 3,4,6-trichloro-2-[(2,3,5-trichloro-6-hydroxyphenyl)methyl]phenol | C1=C(C(=C(C(=C1Cl)Cl)CC2=C(C(=CC(=C2Cl)Cl)Cl)O)O)Cl | Maybridge, Hitfinder, and NIH molecular libraries | NA | NA | NA | 2.7 | NA | NA | NA | NA | Nucleotide binding domain | ATPase assay | NA | NA |
HSPMDB001994 | 21383145 | Hsp100 | p97 | Human | Cytosol | Inhibition of ATPase activity | NA | CID2884885 | 2,2-dichloro-N-(4-fluorophenyl)-3-phenylcyclopropane-1-carboxamide | C1=CC=C(C=C1)C2C(C2(Cl)Cl)C(=O)NC3=CC=C(C=C3)F | Maybridge, Hitfinder, and NIH molecular libraries | NA | NA | NA | 0.15 | NA | NA | NA | NA | Nucleotide binding domain | ATPase assay | NA | NA |
HSPMDB001995 | 21383145 | Hsp100 | p97 | Human | Cytosol | Inhibition of ATPase activity | NA | CID409928 | 2-[3-(dibutylamino)propyl]isoindole-1,3-dione | CCCCN(CCCC)CCCN1C(=O)C2=CC=CC=C2C1=O | Maybridge, Hitfinder, and NIH molecular libraries | NA | NA | NA | 2.6 | NA | NA | NA | NA | Nucleotide binding domain | ATPase assay | NA | NA |
HSPMDB001996 | 21383145 | Hsp100 | p97 | Human | Cytosol | Inhibition of ATPase activity | NA | CID5875182 | 5-amino-6-[(Z)-(2-methylindol-3-ylidene)methyl]-3-methylsulfanyl-[1,2,4]thiadiazolo[4,5-a]pyrimidin-7-one | CC1=NC2=CC=CC=C2C1=CC3=C(N4C(=NC3=O)SN=C4SC)N | Maybridge, Hitfinder, and NIH molecular libraries | NA | NA | NA | 8.3 | NA | NA | NA | NA | Nucleotide binding domain | ATPase assay | NA | NA |
HSPMDB001997 | 21383145 | Hsp100 | p97 | Human | Cytosol | Inhibition of ATPase activity | NA | CID16194309 | 5-amino-6-[(Z)-(2-methylindol-3-ylidene)methyl]-3-(2-methylpropylsulfonyl)-[1,2,4]thiadiazolo[4,5-a]pyrimidin-7-one | CC1=NC2=CC=CC=C2C1=CC3=C(N4C(=NC3=O)SN=C4S(=O)(=O)CC(C)C)N | Maybridge, Hitfinder, and NIH molecular libraries | NA | NA | NA | 7.8 | NA | NA | NA | NA | Nucleotide binding domain | ATPase assay | NA | NA |
HSPMDB001998 | 21383145 | Hsp100 | p97 | Human | Cytosol | Inhibition of ATPase activity | NA | CID5691857 | 2-[(6,7-dihydroxy-2-oxochromen-4-yl)methylsulfanyl]-3-(3-methoxyphenyl)quinazolin-4-one | COC1=CC=CC(=C1)N2C(=O)C3=CC=CC=C3N=C2SCC4=CC(=O)OC5=CC(=C(C=C45)O)O | Maybridge, Hitfinder, and NIH molecular libraries | NA | NA | NA | 4.1 | NA | NA | NA | NA | Nucleotide binding domain | ATPase assay | NA | NA |
HSPMDB001999 | 21383145 | Hsp100 | p97 | Human | Cytosol | Inhibition of ATPase activity | NA | KSC-1-1206/CID2384538 | 2-(chloromethyl)-1H-pyrimido[1,2-a]benzimidazol-4-one | C1=CC=C2C(=C1)N=C3N2C(=O)C=C(N3)CCl | Maybridge, Hitfinder, and NIH molecular libraries | NA | NA | NA | 3.9 | NA | NA | NA | NA | Nucleotide binding domain | ATPase assay | NA | NA |
HSPMDB002000 | 21383145 | Hsp100 | p97 | Human | Cytosol | Inhibition of ATPase activity | NA | KSC-1-202/CID2810445 | 2,6-dichloro-N-(2-hydroxy-1,3-dioxoinden-2-yl)benzamide | C1=CC=C2C(=C1)C(=O)C(C2=O)(NC(=O)C3=C(C=CC=C3Cl)Cl)O | Maybridge, Hitfinder, and NIH molecular libraries | NA | NA | NA | >30 | NA | NA | NA | NA | Nucleotide binding domain | ATPase assay | NA | NA |
HSPMDB002001 | 21383145 | Hsp100 | p97 | Human | Cytosol | Inhibition of ATPase activity | NA | CID2175556 | 4-[[4-(2,4-dihydroxyphenyl)-1,3-thiazol-2-yl]amino]benzenesulfonamide | C1=CC(=CC=C1NC2=NC(=CS2)C3=C(C=C(C=C3)O)O)S(=O)(=O)N | Maybridge, Hitfinder, and NIH molecular libraries | NA | NA | NA | 3.7 | NA | NA | NA | NA | Nucleotide binding domain | ATPase assay | NA | NA |
HSPMDB002002 | 21383145 | Hsp100 | p97 | Human | Cytosol | Inhibition of ATPase activity | NA | KSC-1-201/CID2810155 | 2-methyl-N-(7-methyl-4-oxothieno[3,2-d][1,3]thiazin-2-yl)benzamide | CC1=CC=CC=C1C(=O)NC2=NC3=C(C(=O)S2)SC=C3C | Maybridge, Hitfinder, and NIH molecular libraries | NA | NA | NA | 104 | NA | NA | NA | NA | Nucleotide binding domain | ATPase assay | NA | NA |
HSPMDB002003 | 21383145 | Hsp100 | p97 | Human | Cytosol | Inhibition of ATPase activity | NA | KSC-1-209/CID2472581 | [2-(1H-indol-3-yl)-2-oxoethyl] 5-nitrothiophene-2-carboxylate | C1=CC=C2C(=C1)C(=CN2)C(=O)COC(=O)C3=CC=C(S3)[N+](=O)[O-] | Maybridge, Hitfinder, and NIH molecular libraries | NA | NA | NA | 92 | NA | NA | NA | NA | Nucleotide binding domain | ATPase assay | NA | NA |
HSPMDB002004 | 21383145 | Hsp100 | p97 | Human | Cytosol | Inhibition of ATPase activity | NA | KSC-1-199/CID4072379 | N'-acridin-9-yl-2,4-dihydroxybenzohydrazide | C1=CC=C2C(=C1)C(=C3C=CC=CC3=N2)NNC(=O)C4=C(C=C(C=C4)O)O | Maybridge, Hitfinder, and NIH molecular libraries | NA | NA | NA | 18 | NA | NA | NA | NA | Nucleotide binding domain | ATPase assay | NA | NA |
HSPMDB002005 | 21383145 | Hsp100 | p97 | Human | Cytosol | Inhibition of ATPase activity | NA | CID1625680 | 4-[5-[(Z)-2-carboxy-2-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]ethenyl]furan-2-yl]-2-chlorobenzoic acid | CC1=NC(=NN1)SC(=CC2=CC=C(O2)C3=CC(=C(C=C3)C(=O)O)Cl)C(=O)O | Maybridge, Hitfinder, and NIH molecular libraries | NA | NA | NA | 0.85 | NA | NA | NA | NA | Nucleotide binding domain | ATPase assay | NA | NA |
HSPMDB002006 | 21383145 | Hsp100 | p97 | Human | Cytosol | Inhibition of ATPase activity | NA | KM08995 | 3-(5-acetylthiophen-2-yl)prop-2-ynyl N-phenylcarbamate | CC(=O)C1=CC=C(S1)C#CCOC(=O)NC2=CC=CC=C2 | Maybridge, Hitfinder, and NIH molecular libraries | NA | NA | NA | 1.4 | NA | NA | NA | NA | Nucleotide binding domain | ATPase assay | NA | NA |
HSPMDB002007 | 21383145 | Hsp100 | p97 | Human | Cytosol | Inhibition of ATPase activity | NA | CID1976446 | (6E)-5-imino-6-[(4-oxochromen-3-yl)methylidene]-2-pyridin-4-yl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one | C1=CC=C2C(=C1)C(=O)C(=CO2)C=C3C(=N)N4C(=NC3=O)SC(=N4)C5=CC=NC=C5 | Maybridge, Hitfinder, and NIH molecular libraries | NA | NA | NA | 3.6 | NA | NA | NA | NA | Nucleotide binding domain | ATPase assay | NA | NA |
HSPMDB002008 | 21383145 | Hsp100 | p97 | Human | Cytosol | Inhibition of ATPase activity | NA | CID930238 | 7-propan-2-yl-10-thia-8,13,15-triazatetracyclo[7.7.0.02,6.011,16]hexadeca-1,6,8,11(16),13-pentaene-12-thione | CC(C)C1=C2CCCC2=C3C4=C(C(=S)N=CN4)SC3=N1 | Maybridge, Hitfinder, and NIH molecular libraries | NA | NA | NA | 5.2 | NA | NA | NA | NA | Nucleotide binding domain | ATPase assay | NA | NA |
HSPMDB002009 | 21383145 | Hsp100 | p97 | Human | Cytosol | Inhibition of ATPase activity | NA | CID2978460 | 4-[[4-(2-fluorophenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-8-yl]sulfonylamino]benzoic acid | C1C=CC2C1C(NC3=C2C=C(C=C3)S(=O)(=O)NC4=CC=C(C=C4)C(=O)O)C5=CC=CC=C5F | Maybridge, Hitfinder, and NIH molecular libraries | NA | NA | NA | 9 | NA | NA | NA | NA | Nucleotide binding domain | ATPase assay | NA | NA |
HSPMDB002010 | 21383145 | Hsp100 | p97 | Human | Cytosol | Inhibition of ATPase activity | NA | CD00823 | 3-(1H-indol-3-ylmethylidene)indolin-2-one | O=c1nc2ccccc2c1=Cc1cnc2ccccc21 | Maybridge, Hitfinder, and NIH molecular libraries | NA | NA | NA | 9.2 | NA | NA | NA | NA | Nucleotide binding domain | ATPase assay | NA | NA |
HSPMDB002011 | 21383145 | Hsp100 | p97 | Human | Cytosol | Inhibition of ATPase activity | NA | JFD01560 | 4-pyren-1-ylbutanoic acid | C1=CC2=C3C(=C1)C=CC4=C(C=CC(=C43)C=C2)CCCC(=O)O | Maybridge, Hitfinder, and NIH molecular libraries | NA | NA | NA | 12 | NA | NA | NA | NA | Nucleotide binding domain | ATPase assay | NA | NA |
HSPMDB002012 | 21383145 | Hsp100 | p97 | Human | Cytosol | Inhibition of ATPase activity | NA | KSC-1-133/CID5559718 | (Z)-2-(1,3-benzothiazol-2-yl)-3-hydroxy-4-(4-methylphenyl)sulfanylbut-2-enenitrile | CC1=CC=C(C=C1)SCC(=C(C#N)C2=NC3=CC=CC=C3S2)O | Maybridge, Hitfinder, and NIH molecular libraries | NA | NA | NA | 8.8 | NA | NA | NA | NA | Nucleotide binding domain | ATPase assay | NA | NA |
HSPMDB002013 | 21383145 | Hsp100 | p97 | Human | Cytosol | Inhibition of ATPase activity | NA | KSC-1-205/CID5982653 | 3-nitro-4-[(2E)-2-[(2,3,4-trihydroxyphenyl)methylidene]hydrazinyl]benzenesulfonamide | C1=CC(=C(C=C1S(=O)(=O)N)[N+](=O)[O-])NN=CC2=C(C(=C(C=C2)O)O)O | Maybridge, Hitfinder, and NIH molecular libraries | NA | NA | NA | >30 | NA | NA | NA | NA | Nucleotide binding domain | ATPase assay | NA | NA |
HSPMDB002014 | 21383145 | Hsp100 | p97 | Human | Cytosol | Inhibition of ATPase activity | NA | KSC-1-232/CID3787408 | N-[3-(benzenesulfonyl)-1-butylpyrrolo[3,2-b]quinoxalin-2-yl]-4-methylbenzenesulfonamide | CCCCN1C(=C(C2=NC3=CC=CC=C3N=C21)S(=O)(=O)C4=CC=CC=C4)NS(=O)(=O)C5=CC=C(C=C5)C | Maybridge, Hitfinder, and NIH molecular libraries | NA | NA | NA | >30 | NA | NA | NA | NA | Nucleotide binding domain | ATPase assay | NA | NA |
HSPMDB002015 | 21383145 | Hsp100 | p97 | Human | Cytosol | Inhibition of ATPase activity | NA | KSC-1-233/CID2044030 | N-(1-benzylpyrrolo[3,2-b]quinoxalin-2-yl)-4-chlorobenzenesulfonamide | C1=CC=C(C=C1)CN2C(=CC3=NC4=CC=CC=C4N=C32)NS(=O)(=O)C5=CC=C(C=C5)Cl | Maybridge, Hitfinder, and NIH molecular libraries | NA | NA | NA | 80 | NA | NA | NA | NA | Nucleotide binding domain | ATPase assay | NA | NA |
HSPMDB002016 | 21383145 | Hsp100 | p97 | Human | Cytosol | Inhibition of ATPase activity | NA | CD02506 | 3-{bicyclo[2.2.1]hept-5-en-2-yl}-1-{[(4-bromo-3-chlorophenyl)carbamothioyl]amino}thiourea | ClC1=CC(NC(=S)NNC(=S)NC2CC3CC2C=C3)=CC=C1Br | Maybridge, Hitfinder, and NIH molecular libraries | NA | NA | NA | >30 | NA | NA | NA | NA | Nucleotide binding domain | ATPase assay | NA | NA |
HSPMDB002017 | 21383145 | Hsp100 | p97 | Human | Cytosol | Inhibition of ATPase activity | NA | CD06082 | N-{[(2,5-dichlorophenyl)carbamothioyl]amino}-2-{[(E)-[(2,4-dichlorophenyl)methylidene]amino]oxy}acetamide | ClC1=CC(Cl)=C(\C=N\OCC(=O)NNC(=S)NC2=C(Cl)C=CC(Cl)=C2)C=C1 | Maybridge, Hitfinder, and NIH molecular libraries | NA | NA | NA | 20 | NA | NA | NA | NA | Nucleotide binding domain | ATPase assay | NA | NA |
HSPMDB002018 | 21383145 | Hsp100 | p97 | Human | Cytosol | Inhibition of ATPase activity | NA | CID160115 | 5,6,8-trihydroxy-2-methyl-9-(5,6,8-trihydroxy-2-methyl-4-oxo-2,3-dihydrobenzo[g]chromen-9-yl)-2,3-dihydrobenzo[g]chromen-4-one | CC1CC(=O)C2=C(O1)C=C3C(=C2O)C(=CC(=C3C4=C(C=C(C5=C(C6=C(C=C54)OC(CC6=O)C)O)O)O)O)O | Maybridge, Hitfinder, and NIH molecular libraries | NA | NA | NA | >30 | NA | NA | NA | NA | Nucleotide binding domain | ATPase assay | NA | NA |
HSPMDB002019 | 21383145 | Hsp100 | p97 | Human | Cytosol | Inhibition of ATPase activity | NA | Eeyarestatin I (Eerl) | 2-[3-(4-chlorophenyl)-4-[(4-chlorophenyl)carbamoyl-hydroxyamino]-5,5-dimethyl-2-oxoimidazolidin-1-yl]-N-[(E)-[(E)-3-(5-nitrofuran-2-yl)prop-2-enylidene]amino]acetamide | CC1(C(N(C(=O)N1CC(=O)NN=CC=CC2=CC=C(O2)[N+](=O)[O-])C3=CC=C(C=C3)Cl)N(C(=O)NC4=CC=C(C=C4)Cl)O)C | Maybridge, Hitfinder, and NIH molecular libraries | NA | NA | NA | >30 | NA | NA | NA | NA | Nucleotide binding domain | ATPase assay | NA | NA |
HSPMDB002020 | 21383145 | Hsp100 | p97 | Human | Cytosol | Inhibition of ATPase activity | NA | Myriad 19/KSC-1-275 | 4-[(4-phenyl-1,3-thiazol-2-yl)amino]phenol | C1=CC=C(C=C1)C2=CSC(=N2)NC3=CC=C(C=C3)O | Maybridge, Hitfinder, and NIH molecular libraries | NA | NA | NA | 21 | NA | NA | NA | NA | Nucleotide binding domain | ATPase assay | NA | NA |
HSPMDB002021 | 21383145 | Hsp100 | p97 | Human | Cytosol | Inhibition of ATPase activity | NA | Myriad 12/KSC-1-277 | 4-[[4-(4-chlorophenyl)-1,3-thiazol-2-yl]amino]phenol | C1=CC(=CC=C1C2=CSC(=N2)NC3=CC=C(C=C3)O)Cl | Maybridge, Hitfinder, and NIH molecular libraries | NA | NA | NA | 20 | NA | NA | NA | NA | Nucleotide binding domain | ATPase assay | NA | NA |
HSPMDB002022 | 21383145 | Hsp100 | p97 | Human | Cytosol | Inhibition of ATPase activity | NA | KSC-16-5 | 4-[[4-(4-chlorophenyl)-1,3-thiazol-2-yl]imino]cyclohexa-2,5-dien-1-one | C1=CC(=O)C=CC1=NC2=NC(=CS2)C3=CC=C(C=C3)Cl | Maybridge, Hitfinder, and NIH molecular libraries | NA | NA | NA | 68 | NA | NA | NA | NA | Nucleotide binding domain | ATPase assay | NA | NA |
HSPMDB002023 | 21383145 | Hsp100 | p97 | Human | Cytosol | NA | Substrate degradation activity | CID16472035/CID676352 | 2-N,4-N-dibenzylquinazoline-2,4-diamine;hydrochloride | C1=CC=C(C=C1)CNC2=NC(=NC3=CC=CC=C32)NCC4=CC=CC=C4.Cl | Maybridge, Hitfinder, and NIH molecular libraries | NA | NA | NA | 2.6 | NA | NA | NA | NA | Nucleotide binding domain | NA | NA | Reporter degradation assay (UbG76V-GFP) |
HSPMDB002024 | 21383145 | Hsp100 | p97 | Human | Cytosol | NA | Substrate degradation activity | KSC-1-150/CID886813 | N-benzyl-2-(2-fluorophenyl)quinazolin-4-amine | Fc1ccccc1c2nc(NCc3ccccc3)c4ccccc4n2 | Maybridge, Hitfinder, and NIH molecular libraries | NA | NA | NA | 9 | NA | NA | NA | NA | Nucleotide binding domain | NA | NA | Reporter degradation assay (UbG76V-GFP) |
HSPMDB002025 | 21383145 | Hsp100 | p97 | Human | Cytosol | NA | Substrate degradation activity | JFD03665 | (10E)-10-(hydroxymethylidene)-9,10-dihydrophenanthren-9-one | O\C=C1\C(=O)C2=C(C=CC=C2)C2=C1C=CC=C2 | Maybridge, Hitfinder, and NIH molecular libraries | NA | NA | NA | 1.1 | NA | NA | NA | NA | Nucleotide binding domain | NA | NA | Reporter degradation assay (UbG76V-GFP) |
HSPMDB002026 | 21383145 | Hsp100 | p97 | Human | Cytosol | NA | Substrate degradation activity | KSC-1-127/CID6763 | phenanthrene-9,10-dione | C1=CC=C2C(=C1)C3=CC=CC=C3C(=O)C2=O | Maybridge, Hitfinder, and NIH molecular libraries | NA | NA | NA | 1.3 | NA | NA | NA | NA | Nucleotide binding domain | NA | NA | Reporter degradation assay (UbG76V-GFP) |
HSPMDB002027 | 21383145 | Hsp100 | p97 | Human | Cytosol | NA | Substrate degradation activity | JFD02342 | 1-(4-Methylphenyl)-3-phenyl-2-propyn-1-one | CC1=CC=C(C=C1)C(=O)C#CC2=CC=CC=C2 | Maybridge, Hitfinder, and NIH molecular libraries | NA | NA | NA | 3.4 | NA | NA | NA | NA | Nucleotide binding domain | NA | NA | Reporter degradation assay (UbG76V-GFP) |
HSPMDB002028 | 21383145 | Hsp100 | p97 | Human | Cytosol | NA | Substrate degradation activity | CID934321 | 2-chloro-1-(1-methylindol-3-yl)ethanone | CN1C=C(C2=CC=CC=C21)C(=O)CCl | Maybridge, Hitfinder, and NIH molecular libraries | NA | NA | NA | 3.6 | NA | NA | NA | NA | Nucleotide binding domain | NA | NA | Reporter degradation assay (UbG76V-GFP) |
HSPMDB002029 | 21383145 | Hsp100 | p97 | Human | Cytosol | NA | Substrate degradation activity | S09756 | 9-[(E)-2-nitroethenyl]anthracene | [O-][N+](=O)\C=C\C1=C2C=CC=CC2=CC2=C1C=CC=C2 | Maybridge, Hitfinder, and NIH molecular libraries | NA | NA | NA | 5 | NA | NA | NA | NA | Nucleotide binding domain | NA | NA | Reporter degradation assay (UbG76V-GFP) |
HSPMDB002030 | 21383145 | Hsp100 | p97 | Human | Cytosol | NA | Substrate degradation activity | JFD00597 | 3-(1,3-benzoxazol-2-ylthio)-5,5-dimethylcyclohex-2-en-1-one | O1C(=NC2=C1C=CC=C2)SC2=CC(CC(C2)(C)C)=O | Maybridge, Hitfinder, and NIH molecular libraries | NA | NA | NA | 6.6 | NA | NA | NA | NA | Nucleotide binding domain | NA | NA | Reporter degradation assay (UbG76V-GFP) |
HSPMDB002031 | 21383145 | Hsp100 | p97 | Human | Cytosol | NA | Substrate degradation activity | SEW05182 | 5-({5-[2-chloro-5-(trifluoromethyl)phenyl]furan-2-yl}methylidene)-2,2-dimethyl-1,3-dioxane-4,6-dione | CC1(C)OC(=O)C(=CC2=CC=C(O2)C2=C(Cl)C=CC(=C2)C(F)(F)F)C(=O)O1 | Maybridge, Hitfinder, and NIH molecular libraries | NA | NA | NA | 7.5 | NA | NA | NA | NA | Nucleotide binding domain | NA | NA | Reporter degradation assay (UbG76V-GFP) |
HSPMDB002032 | 21383145 | Hsp100 | p97 | Human | Cytosol | NA | Substrate degradation activity | CID1109468 | 5-amino-4-cyano-N-[(2-methoxynaphthalen-1-yl)methylideneamino]-3-methylthiophene-2-carboxamide | CC1=C(SC(=C1C#N)N)C(=O)NN=CC2=C(C=CC3=CC=CC=C32)OC | Maybridge, Hitfinder, and NIH molecular libraries | NA | NA | NA | 10 | NA | NA | NA | NA | Nucleotide binding domain | NA | NA | Reporter degradation assay (UbG76V-GFP) |
HSPMDB002033 | 21383145 | Hsp100 | p97 | Human | Cytosol | NA | Substrate degradation activity | KSC-1-132/CID2939678 | 2-[1-hydroxy-4-[(3-nitrophenyl)sulfonylamino]naphthalen-2-yl]sulfanylacetic acid | C1=CC=C2C(=C1)C(=CC(=C2O)SCC(=O)O)NS(=O)(=O)C3=CC=CC(=C3)[N+](=O)[O-] | Maybridge, Hitfinder, and NIH molecular libraries | NA | NA | NA | 8.4 | NA | NA | NA | NA | Nucleotide binding domain | NA | NA | Reporter degradation assay (UbG76V-GFP) |
HSPMDB002034 | 21383145 | Hsp100 | p97 | Human | Cytosol | NA | Substrate degradation activity | KSC-1-130/CID9586497 | 2-[(E)-[4-[(2,4-dichlorophenyl)methoxy]phenyl]methylideneamino]guanidine | C1=CC(=CC=C1C=NN=C(N)N)OCC2=C(C=C(C=C2)Cl)Cl | Maybridge, Hitfinder, and NIH molecular libraries | NA | NA | NA | 11 | NA | NA | NA | NA | Nucleotide binding domain | NA | NA | Reporter degradation assay (UbG76V-GFP) |
HSPMDB002035 | 21383145 | Hsp100 | p97 | Human | Cytosol | NA | Substrate degradation activity | KSC-1-204/cid3500086 | 2-(5-chloro-1-ethyl-3-nitro-6-oxopyridazin-4-yl)-2-[5-(trifluoromethyl)-1,3-benzothiazol-2-yl]acetonitrile | CCN1C(=O)C(=C(C(=N1)[N+](=O)[O-])C(C#N)C2=NC3=C(S2)C=CC(=C3)C(F)(F)F)Cl | Maybridge, Hitfinder, and NIH molecular libraries | NA | NA | NA | 13 | NA | NA | NA | NA | Nucleotide binding domain | NA | NA | Reporter degradation assay (UbG76V-GFP) |
HSPMDB002036 | 21383145 | Hsp100 | p97 | Human | Cytosol | NA | Substrate degradation activity | CID5413643 | 2-[4-methyl-6-(phenylamino)pyrimidin-2-yl]phenol | CC1=CC(NC2=CC=CC=C2)=NC(=N1)C1=C(O)C=CC=C1 | Maybridge, Hitfinder, and NIH molecular libraries | NA | NA | NA | 16 | NA | NA | NA | NA | Nucleotide binding domain | NA | NA | Reporter degradation assay (UbG76V-GFP) |
HSPMDB002037 | 21383145 | Hsp100 | p97 | Human | Cytosol | NA | Substrate degradation activity | KSC-1-131/CID2867539/CID/9567210 | 3-[(2E)-2-[(4-methoxyphenyl)methylidene]hydrazinyl]-6-phenyl-4H-1,2,4-triazin-5-one | COC1=CC=C(C=C1)C=NNC2=NN=C(C(=O)N2)C3=CC=CC=C3 | Maybridge, Hitfinder, and NIH molecular libraries | NA | NA | NA | 16 | NA | NA | NA | NA | Nucleotide binding domain | NA | NA | Reporter degradation assay (UbG76V-GFP) |
HSPMDB002038 | 21383145 | Hsp100 | p97 | Human | Cytosol | NA | Substrate degradation activity | KSC-1-128/CID987585 | N-(1-benzyl-3-cyanopyrrolo[3,2-b]quinoxalin-2-yl)-2-chlorobenzamide | C1=CC=C(C=C1)CN2C(=C(C3=NC4=CC=CC=C4N=C32)C#N)NC(=O)C5=CC=CC=C5Cl | Maybridge, Hitfinder, and NIH molecular libraries | NA | NA | NA | 17 | NA | NA | NA | NA | Nucleotide binding domain | NA | NA | Reporter degradation assay (UbG76V-GFP) |
HSPMDB002039 | 21383145 | Hsp100 | p97 | Human | Cytosol | NA | Substrate degradation activity | CID6524677 | (4Z)-4-[[2-(7-chloroquinolin-4-yl)hydrazinyl]methylidene]-2-hydroxycyclohexa-2,5-dien-1-one | C1=CC2=C(C=CN=C2C=C1Cl)NNC=C3C=CC(=O)C(=C3)O | Maybridge, Hitfinder, and NIH molecular libraries | NA | NA | NA | 15 | NA | NA | NA | NA | Nucleotide binding domain | NA | NA | Reporter degradation assay (UbG76V-GFP) |
HSPMDB002040 | 21383145 | Hsp100 | p97 | Human | Cytosol | NA | Substrate degradation activity | SPB01017 | [1-(1,3-dithiolan-2-yl)naphthalen-2-yl] thiophene-2-carboxylate | C1CSC(S1)C2=C(C=CC3=CC=CC=C32)OC(=O)C4=CC=CS4 | Maybridge, Hitfinder, and NIH molecular libraries | NA | NA | NA | 19 | NA | NA | NA | NA | Nucleotide binding domain | NA | NA | Reporter degradation assay (UbG76V-GFP) |
HSPMDB002041 | 21383145 | Hsp100 | p97 | Human | Cytosol | NA | Substrate degradation activity | HTS01888 | N-[4-(3-Chloro-4-methylphenyl)-5-methyl-1,3-thiazol-2-yl]-2,1,3-benzoxadiazole-4-sulfonamide | Cc1ccc(cc1Cl)c2nc(NS(=O)(=O)c3cccc4nonc34)sc2C | Maybridge, Hitfinder, and NIH molecular libraries | NA | NA | NA | 19 | NA | NA | NA | NA | Nucleotide binding domain | NA | NA | Reporter degradation assay (UbG76V-GFP) |
HSPMDB002042 | 21383145 | Hsp100 | p97 | Human | Cytosol | NA | Substrate degradation activity | KSC-1-129/CID801956 | methyl 2-[(2-methylbenzoyl)carbamothioylamino]benzoate | CC1=CC=CC=C1C(=O)NC(=S)NC2=CC=CC=C2C(=O)OC | Maybridge, Hitfinder, and NIH molecular libraries | NA | NA | NA | 21 | NA | NA | NA | NA | Nucleotide binding domain | NA | NA | Reporter degradation assay (UbG76V-GFP) |
HSPMDB002043 | 21383145 | Hsp100 | p97 | Human | Cytosol | NA | Substrate degradation activity | CID5756550 | (5Z)-5-[(2-phenyl-1H-indol-3-yl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one | C1=CC=C(C=C1)C2=C(C3=CC=CC=C3N2)C=C4C(=O)NC(=S)S4 | Maybridge, Hitfinder, and NIH molecular libraries | NA | NA | NA | 22 | NA | NA | NA | NA | Nucleotide binding domain | NA | NA | Reporter degradation assay (UbG76V-GFP) |
HSPMDB002044 | 21383145 | Hsp100 | p97 | Human | Cytosol | NA | Substrate degradation activity | CD07581 | 6-[(2-chlorophenyl)amino]-2-(2,6-dichlorophenyl)-4-oxo-3,4-dihydro-2H-1,3-thiazine-5-carbonitrile | ClC1=CC=CC=C1NC1=C(C#N)C(=O)NC(S1)C1=C(Cl)C=CC=C1Cl | Maybridge, Hitfinder, and NIH molecular libraries | NA | NA | NA | 23 | NA | NA | NA | NA | Nucleotide binding domain | NA | NA | Reporter degradation assay (UbG76V-GFP) |
HSPMDB002045 | 21383145 | Hsp100 | p97 | Human | Cytosol | NA | Substrate degradation activity | CD02660 | ethyl 3-[(E)-[(3,5-dichloro-2-hydroxyphenyl)methylidene]amino]-4-oxo-3,4-dihydroquinazoline-2-carboxylate | CCOC(=O)C1=NC2=C(C=CC=C2)C(=O)N1\N=C\C1=C(O)C(Cl)=CC(Cl)=C1 | Maybridge, Hitfinder, and NIH molecular libraries | NA | NA | NA | 23 | NA | NA | NA | NA | Nucleotide binding domain | NA | NA | Reporter degradation assay (UbG76V-GFP) |
HSPMDB002046 | 21383145 | Hsp100 | p97 | Human | Cytosol | NA | Substrate degradation activity | SP01086 | 3-(5-tert-butyl-2-methylfuran-3-yl)-4-methyl-5-(methylsulfanyl)-1H-pyrazole | CSC1=C(C)C(=NN1)C1=C(C)OC(=C1)C(C)(C)C | Maybridge, Hitfinder, and NIH molecular libraries | NA | NA | NA | 23 | NA | NA | NA | NA | Nucleotide binding domain | NA | NA | Reporter degradation assay (UbG76V-GFP) |
HSPMDB002047 | 21383145 | Hsp100 | p97 | Human | Cytosol | NA | Substrate degradation activity | CID3598 | 3,4,6-trichloro-2-[(2,3,5-trichloro-6-hydroxyphenyl)methyl]phenol | C1=C(C(=C(C(=C1Cl)Cl)CC2=C(C(=CC(=C2Cl)Cl)Cl)O)O)Cl | Maybridge, Hitfinder, and NIH molecular libraries | NA | NA | NA | 27 | NA | NA | NA | NA | Nucleotide binding domain | NA | NA | Reporter degradation assay (UbG76V-GFP) |
HSPMDB002048 | 21383145 | Hsp100 | p97 | Human | Cytosol | NA | Substrate degradation activity | CID2884885 | 2,2-dichloro-N-(4-fluorophenyl)-3-phenylcyclopropane-1-carboxamide | C1=CC=C(C=C1)C2C(C2(Cl)Cl)C(=O)NC3=CC=C(C=C3)F | Maybridge, Hitfinder, and NIH molecular libraries | NA | NA | NA | 27 | NA | NA | NA | NA | Nucleotide binding domain | NA | NA | Reporter degradation assay (UbG76V-GFP) |
HSPMDB002049 | 21383145 | Hsp100 | p97 | Human | Cytosol | NA | Substrate degradation activity | CID409928 | 2-[3-(dibutylamino)propyl]isoindole-1,3-dione | CCCCN(CCCC)CCCN1C(=O)C2=CC=CC=C2C1=O | Maybridge, Hitfinder, and NIH molecular libraries | NA | NA | NA | 36 | NA | NA | NA | NA | Nucleotide binding domain | NA | NA | Reporter degradation assay (UbG76V-GFP) |
HSPMDB002050 | 21383145 | Hsp100 | p97 | Human | Cytosol | NA | Substrate degradation activity | CID5875182 | 5-amino-6-[(Z)-(2-methylindol-3-ylidene)methyl]-3-methylsulfanyl-[1,2,4]thiadiazolo[4,5-a]pyrimidin-7-one | CC1=NC2=CC=CC=C2C1=CC3=C(N4C(=NC3=O)SN=C4SC)N | Maybridge, Hitfinder, and NIH molecular libraries | NA | NA | NA | 31 | NA | NA | NA | NA | Nucleotide binding domain | NA | NA | Reporter degradation assay (UbG76V-GFP) |
HSPMDB002051 | 21383145 | Hsp100 | p97 | Human | Cytosol | NA | Substrate degradation activity | CID16194309 | 5-amino-6-[(Z)-(2-methylindol-3-ylidene)methyl]-3-(2-methylpropylsulfonyl)-[1,2,4]thiadiazolo[4,5-a]pyrimidin-7-one | CC1=NC2=CC=CC=C2C1=CC3=C(N4C(=NC3=O)SN=C4S(=O)(=O)CC(C)C)N | Maybridge, Hitfinder, and NIH molecular libraries | NA | NA | NA | >30 | NA | NA | NA | NA | Nucleotide binding domain | NA | NA | Reporter degradation assay (UbG76V-GFP) |
HSPMDB002052 | 21383145 | Hsp100 | p97 | Human | Cytosol | NA | Substrate degradation activity | CID5691857 | 2-[(6,7-dihydroxy-2-oxochromen-4-yl)methylsulfanyl]-3-(3-methoxyphenyl)quinazolin-4-one | COC1=CC=CC(=C1)N2C(=O)C3=CC=CC=C3N=C2SCC4=CC(=O)OC5=CC(=C(C=C45)O)O | Maybridge, Hitfinder, and NIH molecular libraries | NA | NA | NA | 39 | NA | NA | NA | NA | Nucleotide binding domain | NA | NA | Reporter degradation assay (UbG76V-GFP) |
HSPMDB002053 | 21383145 | Hsp100 | p97 | Human | Cytosol | NA | Substrate degradation activity | KSC-1-1206/CID2384538 | 2-(chloromethyl)-1H-pyrimido[1,2-a]benzimidazol-4-one | C1=CC=C2C(=C1)N=C3N2C(=O)C=C(N3)CCl | Maybridge, Hitfinder, and NIH molecular libraries | NA | NA | NA | 38 | NA | NA | NA | NA | Nucleotide binding domain | NA | NA | Reporter degradation assay (UbG76V-GFP) |
HSPMDB002054 | 21383145 | Hsp100 | p97 | Human | Cytosol | NA | Substrate degradation activity | KSC-1-202/CID2810445 | 2,6-dichloro-N-(2-hydroxy-1,3-dioxoinden-2-yl)benzamide | C1=CC=C2C(=C1)C(=O)C(C2=O)(NC(=O)C3=C(C=CC=C3Cl)Cl)O | Maybridge, Hitfinder, and NIH molecular libraries | NA | NA | NA | 42 | NA | NA | NA | NA | Nucleotide binding domain | NA | NA | Reporter degradation assay (UbG76V-GFP) |
HSPMDB002055 | 21383145 | Hsp100 | p97 | Human | Cytosol | NA | Substrate degradation activity | CID2175556 | 4-[[4-(2,4-dihydroxyphenyl)-1,3-thiazol-2-yl]amino]benzenesulfonamide | C1=CC(=CC=C1NC2=NC(=CS2)C3=C(C=C(C=C3)O)O)S(=O)(=O)N | Maybridge, Hitfinder, and NIH molecular libraries | NA | NA | NA | 60 | NA | NA | NA | NA | Nucleotide binding domain | NA | NA | Reporter degradation assay (UbG76V-GFP) |
HSPMDB002056 | 21383145 | Hsp100 | p97 | Human | Cytosol | NA | Substrate degradation activity | KSC-1-201/CID2810155 | 2-methyl-N-(7-methyl-4-oxothieno[3,2-d][1,3]thiazin-2-yl)benzamide | CC1=CC=CC=C1C(=O)NC2=NC3=C(C(=O)S2)SC=C3C | Maybridge, Hitfinder, and NIH molecular libraries | NA | NA | NA | 62 | NA | NA | NA | NA | Nucleotide binding domain | NA | NA | Reporter degradation assay (UbG76V-GFP) |
HSPMDB002057 | 21383145 | Hsp100 | p97 | Human | Cytosol | NA | Substrate degradation activity | KSC-1-209/CID2472581 | [2-(1H-indol-3-yl)-2-oxoethyl] 5-nitrothiophene-2-carboxylate | C1=CC=C2C(=C1)C(=CN2)C(=O)COC(=O)C3=CC=C(S3)[N+](=O)[O-] | Maybridge, Hitfinder, and NIH molecular libraries | NA | NA | NA | 66 | NA | NA | NA | NA | Nucleotide binding domain | NA | NA | Reporter degradation assay (UbG76V-GFP) |
HSPMDB002058 | 21383145 | Hsp100 | p97 | Human | Cytosol | NA | Substrate degradation activity | KSC-1-199/CID4072379 | N'-acridin-9-yl-2,4-dihydroxybenzohydrazide | C1=CC=C2C(=C1)C(=C3C=CC=CC3=N2)NNC(=O)C4=C(C=C(C=C4)O)O | Maybridge, Hitfinder, and NIH molecular libraries | NA | NA | NA | 68 | NA | NA | NA | NA | Nucleotide binding domain | NA | NA | Reporter degradation assay (UbG76V-GFP) |
HSPMDB002059 | 21383145 | Hsp100 | p97 | Human | Cytosol | NA | Substrate degradation activity | CID1625680 | 4-[5-[(Z)-2-carboxy-2-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]ethenyl]furan-2-yl]-2-chlorobenzoic acid | CC1=NC(=NN1)SC(=CC2=CC=C(O2)C3=CC(=C(C=C3)C(=O)O)Cl)C(=O)O | Maybridge, Hitfinder, and NIH molecular libraries | NA | NA | NA | >30 | NA | NA | NA | NA | Nucleotide binding domain | NA | NA | Reporter degradation assay (UbG76V-GFP) |
HSPMDB002060 | 21383145 | Hsp100 | p97 | Human | Cytosol | NA | Substrate degradation activity | KM08995 | 3-(5-acetylthiophen-2-yl)prop-2-ynyl N-phenylcarbamate | CC(=O)C1=CC=C(S1)C#CCOC(=O)NC2=CC=CC=C2 | Maybridge, Hitfinder, and NIH molecular libraries | NA | NA | NA | >30 | NA | NA | NA | NA | Nucleotide binding domain | NA | NA | Reporter degradation assay (UbG76V-GFP) |
HSPMDB002061 | 21383145 | Hsp100 | p97 | Human | Cytosol | NA | Substrate degradation activity | CID1976446 | (6E)-5-imino-6-[(4-oxochromen-3-yl)methylidene]-2-pyridin-4-yl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one | C1=CC=C2C(=C1)C(=O)C(=CO2)C=C3C(=N)N4C(=NC3=O)SC(=N4)C5=CC=NC=C5 | Maybridge, Hitfinder, and NIH molecular libraries | NA | NA | NA | >30 | NA | NA | NA | NA | Nucleotide binding domain | NA | NA | Reporter degradation assay (UbG76V-GFP) |
HSPMDB002062 | 21383145 | Hsp100 | p97 | Human | Cytosol | NA | Substrate degradation activity | CID930238 | 7-propan-2-yl-10-thia-8,13,15-triazatetracyclo[7.7.0.02,6.011,16]hexadeca-1,6,8,11(16),13-pentaene-12-thione | CC(C)C1=C2CCCC2=C3C4=C(C(=S)N=CN4)SC3=N1 | Maybridge, Hitfinder, and NIH molecular libraries | NA | NA | NA | >30 | NA | NA | NA | NA | Nucleotide binding domain | NA | NA | Reporter degradation assay (UbG76V-GFP) |
HSPMDB002063 | 21383145 | Hsp100 | p97 | Human | Cytosol | NA | Substrate degradation activity | CID2978460 | 4-[[4-(2-fluorophenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-8-yl]sulfonylamino]benzoic acid | C1C=CC2C1C(NC3=C2C=C(C=C3)S(=O)(=O)NC4=CC=C(C=C4)C(=O)O)C5=CC=CC=C5F | Maybridge, Hitfinder, and NIH molecular libraries | NA | NA | NA | >30 | NA | NA | NA | NA | Nucleotide binding domain | NA | NA | Reporter degradation assay (UbG76V-GFP) |
HSPMDB002064 | 21383145 | Hsp100 | p97 | Human | Cytosol | NA | Substrate degradation activity | CD00823 | 3-(1H-indol-3-ylmethylidene)indolin-2-one | O=c1nc2ccccc2c1=Cc1cnc2ccccc21 | Maybridge, Hitfinder, and NIH molecular libraries | NA | NA | NA | >30 | NA | NA | NA | NA | Nucleotide binding domain | NA | NA | Reporter degradation assay (UbG76V-GFP) |
HSPMDB002065 | 21383145 | Hsp100 | p97 | Human | Cytosol | NA | Substrate degradation activity | JFD01560 | 4-pyren-1-ylbutanoic acid | C1=CC2=C3C(=C1)C=CC4=C(C=CC(=C43)C=C2)CCCC(=O)O | Maybridge, Hitfinder, and NIH molecular libraries | NA | NA | NA | >30 | NA | NA | NA | NA | Nucleotide binding domain | NA | NA | Reporter degradation assay (UbG76V-GFP) |
HSPMDB002066 | 21383145 | Hsp100 | p97 | Human | Cytosol | NA | Substrate degradation activity | KSC-1-133/CID5559718 | (Z)-2-(1,3-benzothiazol-2-yl)-3-hydroxy-4-(4-methylphenyl)sulfanylbut-2-enenitrile | CC1=CC=C(C=C1)SCC(=C(C#N)C2=NC3=CC=CC=C3S2)O | Maybridge, Hitfinder, and NIH molecular libraries | NA | NA | NA | >30 | NA | NA | NA | NA | Nucleotide binding domain | NA | NA | Reporter degradation assay (UbG76V-GFP) |
HSPMDB002067 | 21383145 | Hsp100 | p97 | Human | Cytosol | NA | Substrate degradation activity | KSC-1-205/CID5982653 | 3-nitro-4-[(2E)-2-[(2,3,4-trihydroxyphenyl)methylidene]hydrazinyl]benzenesulfonamide | C1=CC(=C(C=C1S(=O)(=O)N)[N+](=O)[O-])NN=CC2=C(C(=C(C=C2)O)O)O | Maybridge, Hitfinder, and NIH molecular libraries | NA | NA | NA | >30 | NA | NA | NA | NA | Nucleotide binding domain | NA | NA | Reporter degradation assay (UbG76V-GFP) |
HSPMDB002068 | 21383145 | Hsp100 | p97 | Human | Cytosol | NA | Substrate degradation activity | KSC-1-232/CID3787408 | N-[3-(benzenesulfonyl)-1-butylpyrrolo[3,2-b]quinoxalin-2-yl]-4-methylbenzenesulfonamide | CCCCN1C(=C(C2=NC3=CC=CC=C3N=C21)S(=O)(=O)C4=CC=CC=C4)NS(=O)(=O)C5=CC=C(C=C5)C | Maybridge, Hitfinder, and NIH molecular libraries | NA | NA | NA | >30 | NA | NA | NA | NA | Nucleotide binding domain | NA | NA | Reporter degradation assay (UbG76V-GFP) |
HSPMDB002069 | 21383145 | Hsp100 | p97 | Human | Cytosol | NA | Substrate degradation activity | KSC-1-233/CID2044030 | N-(1-benzylpyrrolo[3,2-b]quinoxalin-2-yl)-4-chlorobenzenesulfonamide | C1=CC=C(C=C1)CN2C(=CC3=NC4=CC=CC=C4N=C32)NS(=O)(=O)C5=CC=C(C=C5)Cl | Maybridge, Hitfinder, and NIH molecular libraries | NA | NA | NA | >30 | NA | NA | NA | NA | Nucleotide binding domain | NA | NA | Reporter degradation assay (UbG76V-GFP) |
HSPMDB002070 | 21383145 | Hsp100 | p97 | Human | Cytosol | NA | Substrate degradation activity | CD02506 | ethyl 3-[(E)-[(3,5-dichloro-2-hydroxyphenyl)methylidene]amino]-4-oxo-3,4-dihydroquinazoline-2-carboxylate | CCOC(=O)C1=NC2=C(C=CC=C2)C(=O)N1\N=C\C1=C(O)C(Cl)=CC(Cl)=C1 | Maybridge, Hitfinder, and NIH molecular libraries | NA | NA | NA | >30 | NA | NA | NA | NA | Nucleotide binding domain | NA | NA | Reporter degradation assay (UbG76V-GFP) |
HSPMDB002071 | 21383145 | Hsp100 | p97 | Human | Cytosol | NA | Substrate degradation activity | CD06082 | 3-(5-tert-butyl-2-methylfuran-3-yl)-4-methyl-5-(methylsulfanyl)-1H-pyrazole | CSC1=C(C)C(=NN1)C1=C(C)OC(=C1)C(C)(C)C | Maybridge, Hitfinder, and NIH molecular libraries | NA | NA | NA | >30 | NA | NA | NA | NA | Nucleotide binding domain | NA | NA | Reporter degradation assay (UbG76V-GFP) |
HSPMDB002072 | 21383145 | Hsp100 | p97 | Human | Cytosol | NA | Substrate degradation activity | CID160115 | 5,6,8-trihydroxy-2-methyl-9-(5,6,8-trihydroxy-2-methyl-4-oxo-2,3-dihydrobenzo[g]chromen-9-yl)-2,3-dihydrobenzo[g]chromen-4-one | CC1CC(=O)C2=C(O1)C=C3C(=C2O)C(=CC(=C3C4=C(C=C(C5=C(C6=C(C=C54)OC(CC6=O)C)O)O)O)O)O | Maybridge, Hitfinder, and NIH molecular libraries | NA | NA | NA | >30 | NA | NA | NA | NA | Nucleotide binding domain | NA | NA | Reporter degradation assay (UbG76V-GFP) |
HSPMDB002073 | 21383145 | Hsp100 | p97 | Human | Cytosol | NA | Substrate degradation activity | Eeyarestatin I (Eerl) | 2-[3-(4-chlorophenyl)-4-[(4-chlorophenyl)carbamoyl-hydroxyamino]-5,5-dimethyl-2-oxoimidazolidin-1-yl]-N-[(E)-[(E)-3-(5-nitrofuran-2-yl)prop-2-enylidene]amino]acetamide | CC1(C(N(C(=O)N1CC(=O)NN=CC=CC2=CC=C(O2)[N+](=O)[O-])C3=CC=C(C=C3)Cl)N(C(=O)NC4=CC=C(C=C4)Cl)O)C | Maybridge, Hitfinder, and NIH molecular libraries | NA | NA | NA | 3.7 | NA | NA | NA | NA | Nucleotide binding domain | NA | NA | Reporter degradation assay (UbG76V-GFP) |
HSPMDB002074 | 21383145 | Hsp100 | p97 | Human | Cytosol | NA | Substrate degradation activity | Myriad 19/KSC-1-275 | 4-[(4-phenyl-1,3-thiazol-2-yl)amino]phenol | C1=CC=C(C=C1)C2=CSC(=N2)NC3=CC=C(C=C3)O | Maybridge, Hitfinder, and NIH molecular libraries | NA | NA | NA | 26 | NA | NA | NA | NA | Nucleotide binding domain | NA | NA | Reporter degradation assay (UbG76V-GFP) |
HSPMDB002075 | 21383145 | Hsp100 | p97 | Human | Cytosol | NA | Substrate degradation activity | Myriad 12/KSC-1-277 | 4-[[4-(4-chlorophenyl)-1,3-thiazol-2-yl]amino]phenol | C1=CC(=CC=C1C2=CSC(=N2)NC3=CC=C(C=C3)O)Cl | Maybridge, Hitfinder, and NIH molecular libraries | NA | NA | NA | 16 | NA | NA | NA | NA | Nucleotide binding domain | NA | NA | Reporter degradation assay (UbG76V-GFP) |
HSPMDB002076 | 21383145 | Hsp100 | p97 | Human | Cytosol | NA | Substrate degradation activity | KSC-16-5 | 4-[[4-(4-chlorophenyl)-1,3-thiazol-2-yl]imino]cyclohexa-2,5-dien-1-one | C1=CC(=O)C=CC1=NC2=NC(=CS2)C3=CC=C(C=C3)Cl | Maybridge, Hitfinder, and NIH molecular libraries | NA | NA | NA | 38 | NA | NA | NA | NA | Nucleotide binding domain | NA | NA | Reporter degradation assay (UbG76V-GFP) |
HSPMDB002077 | 21383145 | Hsp100 | p97 | Human | Cytosol | NA | Antiproliferative activity | Mg132 | benzyl N-[(2S)-4-methyl-1-[[(2S)-4-methyl-1-[[(2S)-4-methyl-1-oxopentan-2-yl]amino]-1-oxopentan-2-yl]amino]-1-oxopentan-2-yl]carbamate | CC(C)CC(C=O)NC(=O)C(CC(C)C)NC(=O)C(CC(C)C)NC(=O)OCC1=CC=CC=C1 | Maybridge, Hitfinder, and NIH molecular libraries | NA | NA | NA | NA | NA | NA | NA | 0.4 | Nucleotide binding domain | NA | 50% | Luminescence based viability assay |
HSPMDB002078 | 21383145 | Hsp100 | p97 | Human | Cytosol | NA | Antiproliferative activity | Mg132 | benzyl N-[(2S)-4-methyl-1-[[(2S)-4-methyl-1-[[(2S)-4-methyl-1-oxopentan-2-yl]amino]-1-oxopentan-2-yl]amino]-1-oxopentan-2-yl]carbamate | CC(C)CC(C=O)NC(=O)C(CC(C)C)NC(=O)C(CC(C)C)NC(=O)OCC1=CC=CC=C1 | Maybridge, Hitfinder, and NIH molecular libraries | NA | NA | NA | NA | NA | NA | NA | 0.2 | Nucleotide binding domain | NA | 50% | Luminescence based viability assay |
HSPMDB002079 | 21383145 | Hsp100 | p97 | Human | Cytosol | NA | Antiproliferative activity | Mg132 | benzyl N-[(2S)-4-methyl-1-[[(2S)-4-methyl-1-[[(2S)-4-methyl-1-oxopentan-2-yl]amino]-1-oxopentan-2-yl]amino]-1-oxopentan-2-yl]carbamate | CC(C)CC(C=O)NC(=O)C(CC(C)C)NC(=O)C(CC(C)C)NC(=O)OCC1=CC=CC=C1 | Maybridge, Hitfinder, and NIH molecular libraries | NA | NA | NA | NA | NA | NA | NA | 1.5 | Nucleotide binding domain | NA | 50% | Luminescence based viability assay |
HSPMDB002080 | 21383145 | Hsp100 | p97 | Human | Cytosol | NA | Antiproliferative activity | Mg132 | benzyl N-[(2S)-4-methyl-1-[[(2S)-4-methyl-1-[[(2S)-4-methyl-1-oxopentan-2-yl]amino]-1-oxopentan-2-yl]amino]-1-oxopentan-2-yl]carbamate | CC(C)CC(C=O)NC(=O)C(CC(C)C)NC(=O)C(CC(C)C)NC(=O)OCC1=CC=CC=C1 | Maybridge, Hitfinder, and NIH molecular libraries | NA | NA | NA | NA | NA | NA | NA | 0.14 | Nucleotide binding domain | NA | 50% | Luminescence based viability assay |
HSPMDB002081 | 21383145 | Hsp100 | p97 | Human | Cytosol | NA | Antiproliferative activity | DBeQ | N2 , N4 -dibenzylquinazoline-2,4-diamine | C(Nc1nc(NCc2ccccc2)c3ccccc3n1)c4ccccc4 | Maybridge, Hitfinder, and NIH molecular libraries | NA | NA | NA | NA | NA | NA | NA | 6.6 | Nucleotide binding domain | NA | 50% | Luminescence based viability assay |
HSPMDB002082 | 21383145 | Hsp100 | p97 | Human | Cytosol | NA | Antiproliferative activity | DBeQ | N2 , N4 -dibenzylquinazoline-2,4-diamine | C(Nc1nc(NCc2ccccc2)c3ccccc3n1)c4ccccc4 | Maybridge, Hitfinder, and NIH molecular libraries | NA | NA | NA | NA | NA | NA | NA | 4 | Nucleotide binding domain | NA | 50% | Luminescence based viability assay |
HSPMDB002083 | 21383145 | Hsp100 | p97 | Human | Cytosol | NA | Antiproliferative activity | DBeQ | N2 , N4 -dibenzylquinazoline-2,4-diamine | C(Nc1nc(NCc2ccccc2)c3ccccc3n1)c4ccccc4 | Maybridge, Hitfinder, and NIH molecular libraries | NA | NA | NA | NA | NA | NA | NA | 3.1 | Nucleotide binding domain | NA | 50% | Luminescence based viability assay |
HSPMDB002084 | 21383145 | Hsp100 | p97 | Human | Cytosol | NA | Antiproliferative activity | DBeQ | N2 , N4 -dibenzylquinazoline-2,4-diamine | C(Nc1nc(NCc2ccccc2)c3ccccc3n1)c4ccccc4 | Maybridge, Hitfinder, and NIH molecular libraries | NA | NA | NA | NA | NA | NA | NA | 1.2 | Nucleotide binding domain | NA | 50% | Luminescence based viability assay |
HSPMDB002085 | 26083639 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | AV126 | 4-[(propan-2-yloxy)carbonyl]phenyl 3-methanesulfonyl-4-methylbenzoate | CC(C)OC(=O)C1=CC=C(OC(=O)C2=CC=C(C)C(=C2)S(C)(=O)=O)C=C1 | Non beta lactone inhibitor | NA | NA | NA | 6.1 | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002086 | 26083639 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | AV127 | 4-(2-oxopyrrolidin-1-yl)phenyl 1-(2,2-dimethylpropanoyl)piperidine-4-carboxylate | CC(C)(C)C(=O)N1CCC(CC1)C(=O)OC1=CC=C(C=C1)N1CCCC1=O | Non beta lactone inhibitor | NA | NA | NA | 5.9 | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002087 | 26083639 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | AV166 | (2Z)-3-(3,4-dimethoxyphenyl)-1-{3-[(2-oxo-2-phenylethyl)sulfanyl]-4H-1,2,4-triazol-4-yl}prop-2-en-1-one | COC1=C(OC)C=C(\C=C/C(=O)N2C=NN=C2SCC(=O)C2=CC=CC=C2)C=C1 | Non beta lactone inhibitor | NA | NA | NA | 5.9 | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002088 | 26083639 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | AV167 | 4-(1,3,4-oxadiazol-2-yl)phenyl 2-{naphtho[2,1-b]furan-1-yl}acetate | O=C(CC1=COC2=C1C1=C(C=CC=C1)C=C2)OC1=CC=C(C=C1)C1=NN=CO1 | Non beta lactone inhibitor | NA | NA | NA | 5.9 | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002089 | 26083639 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | AV168 | 4-(1,3,4-oxadiazol-2-yl)phenyl 3-[methyl(3-sulfanylphenyl)sulfamoyl]benzoate | CN(C1=CC=CC(S)=C1)S(=O)(=O)C1=CC=CC(=C1)C(=O)OC1=CC=C(C=C1)C1=NN=CO1 | Non beta lactone inhibitor | NA | NA | NA | 5.9 | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002090 | 26083639 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | AV170 | 4-acetylphenyl 3-(3,4,5-trimethoxyphenyl)propanoate | COC1=CC(CCC(=O)OC2=CC=C(C=C2)C(C)=O)=CC(OC)=C1OC | Non beta lactone inhibitor | NA | NA | NA | 6.6 | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002091 | 26083639 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | Palmostatin M | (3S,4S)-3-decyl-4-[4-[3-(dimethylamino)propylsulfonyl]butyl]oxetan-2-one | CCCCCCCCCCC1C(OC1=O)CCCCS(=O)(=O)CCCN(C)C | Non beta lactone inhibitor | NA | NA | NA | 21 | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002092 | 26083639 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | AV126 | 4-[(propan-2-yloxy)carbonyl]phenyl 3-methanesulfonyl-4-methylbenzoate | CC(C)OC(=O)C1=CC=C(OC(=O)C2=CC=C(C)C(=C2)S(C)(=O)=O)C=C1 | Non beta lactone inhibitor | 100% at 100 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002093 | 26083639 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | AV127 | 4-(2-oxopyrrolidin-1-yl)phenyl 1-(2,2-dimethylpropanoyl)piperidine-4-carboxylate | CC(C)(C)C(=O)N1CCC(CC1)C(=O)OC1=CC=C(C=C1)N1CCCC1=O | Non beta lactone inhibitor | 95% at 100 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002094 | 26083639 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | AV166 | (2Z)-3-(3,4-dimethoxyphenyl)-1-{3-[(2-oxo-2-phenylethyl)sulfanyl]-4H-1,2,4-triazol-4-yl}prop-2-en-1-one | COC1=C(OC)C=C(\C=C/C(=O)N2C=NN=C2SCC(=O)C2=CC=CC=C2)C=C1 | Non beta lactone inhibitor | 100% at 100 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002095 | 26083639 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | AV167 | 4-(1,3,4-oxadiazol-2-yl)phenyl 2-{naphtho[2,1-b]furan-1-yl}acetate | O=C(CC1=COC2=C1C1=C(C=CC=C1)C=C2)OC1=CC=C(C=C1)C1=NN=CO1 | Non beta lactone inhibitor | 75% at 100 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002096 | 26083639 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | AV168 | 4-(1,3,4-oxadiazol-2-yl)phenyl 3-[methyl(3-sulfanylphenyl)sulfamoyl]benzoate | CN(C1=CC=CC(S)=C1)S(=O)(=O)C1=CC=CC(=C1)C(=O)OC1=CC=C(C=C1)C1=NN=CO1 | Non beta lactone inhibitor | 70% at 100 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002097 | 26083639 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | AV170 | 4-acetylphenyl 3-(3,4,5-trimethoxyphenyl)propanoate | COC1=CC(CCC(=O)OC2=CC=C(C=C2)C(C)=O)=CC(OC)=C1OC | Non beta lactone inhibitor | 100% at 100 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002098 | 26083639 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | D3 | 3-(non-8-en-1-yl)-4-(pent-4-yn-1-yl)oxetan-2-one | C=CCCCCCCCC1C(CCCC#C)OC1=O | Non beta lactone inhibitor | 95% at 100 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002099 | 26083639 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | E2 | 3-(4-methoxyphenyl)-4-(pent-4-yn-1-yl)oxetan-2-one | COC1=CC=C(C=C1)C1C(CCCC#C)OC1=O | Non beta lactone inhibitor | 100% at 100 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002100 | 26083639 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | AV126 | 4-[(propan-2-yloxy)carbonyl]phenyl 3-methanesulfonyl-4-methylbenzoate | CC(C)OC(=O)C1=CC=C(OC(=O)C2=CC=C(C)C(=C2)S(C)(=O)=O)C=C1 | Non beta lactone inhibitor | 99% at 10 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002101 | 26083639 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | AV127 | 4-(2-oxopyrrolidin-1-yl)phenyl 1-(2,2-dimethylpropanoyl)piperidine-4-carboxylate | CC(C)(C)C(=O)N1CCC(CC1)C(=O)OC1=CC=C(C=C1)N1CCCC1=O | Non beta lactone inhibitor | 45% at 10 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002102 | 26083639 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | AV166 | (2Z)-3-(3,4-dimethoxyphenyl)-1-{3-[(2-oxo-2-phenylethyl)sulfanyl]-4H-1,2,4-triazol-4-yl}prop-2-en-1-one | COC1=C(OC)C=C(\C=C/C(=O)N2C=NN=C2SCC(=O)C2=CC=CC=C2)C=C1 | Non beta lactone inhibitor | 85% at 10 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002103 | 26083639 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | AV167 | 4-(1,3,4-oxadiazol-2-yl)phenyl 2-{naphtho[2,1-b]furan-1-yl}acetate | O=C(CC1=COC2=C1C1=C(C=CC=C1)C=C2)OC1=CC=C(C=C1)C1=NN=CO1 | Non beta lactone inhibitor | 40% at 10 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002104 | 26083639 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | AV168 | 4-(1,3,4-oxadiazol-2-yl)phenyl 3-[methyl(3-sulfanylphenyl)sulfamoyl]benzoate | CN(C1=CC=CC(S)=C1)S(=O)(=O)C1=CC=CC(=C1)C(=O)OC1=CC=C(C=C1)C1=NN=CO1 | Non beta lactone inhibitor | 30% at 10 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002105 | 26083639 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | AV170 | 4-acetylphenyl 3-(3,4,5-trimethoxyphenyl)propanoate | COC1=CC(CCC(=O)OC2=CC=C(C=C2)C(C)=O)=CC(OC)=C1OC | Non beta lactone inhibitor | 95% at 10 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002106 | 26083639 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | D3 | 3-(non-8-en-1-yl)-4-(pent-4-yn-1-yl)oxetan-2-one | C=CCCCCCCCC1C(CCCC#C)OC1=O | Non beta lactone inhibitor | 90% at 10 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002107 | 26083639 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | E2 | 3-(4-methoxyphenyl)-4-(pent-4-yn-1-yl)oxetan-2-one | COC1=CC=C(C=C1)C1C(CCCC#C)OC1=O | Non beta lactone inhibitor | 80% at 10 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002108 | 26083639 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | AV126 | 4-[(propan-2-yloxy)carbonyl]phenyl 3-methanesulfonyl-4-methylbenzoate | CC(C)OC(=O)C1=CC=C(OC(=O)C2=CC=C(C)C(=C2)S(C)(=O)=O)C=C1 | Non beta lactone inhibitor | 40% at 1 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002109 | 26083639 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | AV127 | 4-(2-oxopyrrolidin-1-yl)phenyl 1-(2,2-dimethylpropanoyl)piperidine-4-carboxylate | CC(C)(C)C(=O)N1CCC(CC1)C(=O)OC1=CC=C(C=C1)N1CCCC1=O | Non beta lactone inhibitor | 10% at 1 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002110 | 26083639 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | AV166 | (2Z)-3-(3,4-dimethoxyphenyl)-1-{3-[(2-oxo-2-phenylethyl)sulfanyl]-4H-1,2,4-triazol-4-yl}prop-2-en-1-one | COC1=C(OC)C=C(\C=C/C(=O)N2C=NN=C2SCC(=O)C2=CC=CC=C2)C=C1 | Non beta lactone inhibitor | 30% at 1 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002111 | 26083639 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | AV167 | 4-(1,3,4-oxadiazol-2-yl)phenyl 2-{naphtho[2,1-b]furan-1-yl}acetate | O=C(CC1=COC2=C1C1=C(C=CC=C1)C=C2)OC1=CC=C(C=C1)C1=NN=CO1 | Non beta lactone inhibitor | 5% at 1 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002112 | 26083639 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | AV168 | 4-(1,3,4-oxadiazol-2-yl)phenyl 3-[methyl(3-sulfanylphenyl)sulfamoyl]benzoate | CN(C1=CC=CC(S)=C1)S(=O)(=O)C1=CC=CC(=C1)C(=O)OC1=CC=C(C=C1)C1=NN=CO1 | Non beta lactone inhibitor | 10% at 1 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002113 | 26083639 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | AV170 | 4-acetylphenyl 3-(3,4,5-trimethoxyphenyl)propanoate | COC1=CC(CCC(=O)OC2=CC=C(C=C2)C(C)=O)=CC(OC)=C1OC | Non beta lactone inhibitor | 25% at 1 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002114 | 26083639 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | D3 | 3-(non-8-en-1-yl)-4-(pent-4-yn-1-yl)oxetan-2-one | C=CCCCCCCCC1C(CCCC#C)OC1=O | Non beta lactone inhibitor | 25% at 1 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002115 | 26083639 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | E2 | 3-(4-methoxyphenyl)-4-(pent-4-yn-1-yl)oxetan-2-one | COC1=CC=C(C=C1)C1C(CCCC#C)OC1=O | Non beta lactone inhibitor | 10% at 1 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002116 | 26083639 | Hsp100 | ClpP2 | Bacteria | Cytosol | Inhibition of peptidase activity | NA | AV126 | 4-[(propan-2-yloxy)carbonyl]phenyl 3-methanesulfonyl-4-methylbenzoate | CC(C)OC(=O)C1=CC=C(OC(=O)C2=CC=C(C)C(=C2)S(C)(=O)=O)C=C1 | Non beta lactone inhibitor | 100% at 100 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002117 | 26083639 | Hsp100 | ClpP2 | Bacteria | Cytosol | Inhibition of peptidase activity | NA | AV127 | 4-(2-oxopyrrolidin-1-yl)phenyl 1-(2,2-dimethylpropanoyl)piperidine-4-carboxylate | CC(C)(C)C(=O)N1CCC(CC1)C(=O)OC1=CC=C(C=C1)N1CCCC1=O | Non beta lactone inhibitor | 100% at 100 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002118 | 26083639 | Hsp100 | ClpP2 | Bacteria | Cytosol | Inhibition of peptidase activity | NA | AV166 | (2Z)-3-(3,4-dimethoxyphenyl)-1-{3-[(2-oxo-2-phenylethyl)sulfanyl]-4H-1,2,4-triazol-4-yl}prop-2-en-1-one | COC1=C(OC)C=C(\C=C/C(=O)N2C=NN=C2SCC(=O)C2=CC=CC=C2)C=C1 | Non beta lactone inhibitor | 100% at 100 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002119 | 26083639 | Hsp100 | ClpP2 | Bacteria | Cytosol | Inhibition of peptidase activity | NA | AV167 | 4-(1,3,4-oxadiazol-2-yl)phenyl 2-{naphtho[2,1-b]furan-1-yl}acetate | O=C(CC1=COC2=C1C1=C(C=CC=C1)C=C2)OC1=CC=C(C=C1)C1=NN=CO1 | Non beta lactone inhibitor | 60% at 100 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002120 | 26083639 | Hsp100 | ClpP2 | Bacteria | Cytosol | Inhibition of peptidase activity | NA | AV168 | 4-(1,3,4-oxadiazol-2-yl)phenyl 3-[methyl(3-sulfanylphenyl)sulfamoyl]benzoate | CN(C1=CC=CC(S)=C1)S(=O)(=O)C1=CC=CC(=C1)C(=O)OC1=CC=C(C=C1)C1=NN=CO1 | Non beta lactone inhibitor | 20% at 100 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002121 | 26083639 | Hsp100 | ClpP2 | Bacteria | Cytosol | Inhibition of peptidase activity | NA | AV170 | 4-acetylphenyl 3-(3,4,5-trimethoxyphenyl)propanoate | COC1=CC(CCC(=O)OC2=CC=C(C=C2)C(C)=O)=CC(OC)=C1OC | Non beta lactone inhibitor | 100% at 100 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002122 | 26083639 | Hsp100 | ClpP2 | Bacteria | Cytosol | Inhibition of peptidase activity | NA | D3 | 3-(non-8-en-1-yl)-4-(pent-4-yn-1-yl)oxetan-2-one | C=CCCCCCCCC1C(CCCC#C)OC1=O | Non beta lactone inhibitor | 98% at 100 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002123 | 26083639 | Hsp100 | ClpP2 | Bacteria | Cytosol | Inhibition of peptidase activity | NA | E2 | 3-(4-methoxyphenyl)-4-(pent-4-yn-1-yl)oxetan-2-one | COC1=CC=C(C=C1)C1C(CCCC#C)OC1=O | Non beta lactone inhibitor | 100% at 100 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002124 | 26083639 | Hsp100 | ClpP2 | Bacteria | Cytosol | Inhibition of peptidase activity | NA | AV126 | 4-[(propan-2-yloxy)carbonyl]phenyl 3-methanesulfonyl-4-methylbenzoate | CC(C)OC(=O)C1=CC=C(OC(=O)C2=CC=C(C)C(=C2)S(C)(=O)=O)C=C1 | Non beta lactone inhibitor | 98% at 10 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002125 | 26083639 | Hsp100 | ClpP2 | Bacteria | Cytosol | Inhibition of peptidase activity | NA | AV127 | 4-(2-oxopyrrolidin-1-yl)phenyl 1-(2,2-dimethylpropanoyl)piperidine-4-carboxylate | CC(C)(C)C(=O)N1CCC(CC1)C(=O)OC1=CC=C(C=C1)N1CCCC1=O | Non beta lactone inhibitor | 30% at 10 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002126 | 26083639 | Hsp100 | ClpP2 | Bacteria | Cytosol | Inhibition of peptidase activity | NA | AV166 | (2Z)-3-(3,4-dimethoxyphenyl)-1-{3-[(2-oxo-2-phenylethyl)sulfanyl]-4H-1,2,4-triazol-4-yl}prop-2-en-1-one | COC1=C(OC)C=C(\C=C/C(=O)N2C=NN=C2SCC(=O)C2=CC=CC=C2)C=C1 | Non beta lactone inhibitor | 100% at 10 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002127 | 26083639 | Hsp100 | ClpP2 | Bacteria | Cytosol | Inhibition of peptidase activity | NA | AV167 | 4-(1,3,4-oxadiazol-2-yl)phenyl 2-{naphtho[2,1-b]furan-1-yl}acetate | O=C(CC1=COC2=C1C1=C(C=CC=C1)C=C2)OC1=CC=C(C=C1)C1=NN=CO1 | Non beta lactone inhibitor | 45% at 10 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002128 | 26083639 | Hsp100 | ClpP2 | Bacteria | Cytosol | Inhibition of peptidase activity | NA | AV168 | 4-(1,3,4-oxadiazol-2-yl)phenyl 3-[methyl(3-sulfanylphenyl)sulfamoyl]benzoate | CN(C1=CC=CC(S)=C1)S(=O)(=O)C1=CC=CC(=C1)C(=O)OC1=CC=C(C=C1)C1=NN=CO1 | Non beta lactone inhibitor | 15% at 10 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002129 | 26083639 | Hsp100 | ClpP2 | Bacteria | Cytosol | Inhibition of peptidase activity | NA | AV170 | 4-acetylphenyl 3-(3,4,5-trimethoxyphenyl)propanoate | COC1=CC(CCC(=O)OC2=CC=C(C=C2)C(C)=O)=CC(OC)=C1OC | Non beta lactone inhibitor | 100% at 10 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002130 | 26083639 | Hsp100 | ClpP2 | Bacteria | Cytosol | Inhibition of peptidase activity | NA | D3 | 3-(non-8-en-1-yl)-4-(pent-4-yn-1-yl)oxetan-2-one | C=CCCCCCCCC1C(CCCC#C)OC1=O | Non beta lactone inhibitor | 95% at 10 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002131 | 26083639 | Hsp100 | ClpP2 | Bacteria | Cytosol | Inhibition of peptidase activity | NA | E2 | 3-(4-methoxyphenyl)-4-(pent-4-yn-1-yl)oxetan-2-one | COC1=CC=C(C=C1)C1C(CCCC#C)OC1=O | Non beta lactone inhibitor | 30% at 10 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002132 | 26083639 | Hsp100 | ClpP2 | Bacteria | Cytosol | Inhibition of peptidase activity | NA | AV126 | 4-[(propan-2-yloxy)carbonyl]phenyl 3-methanesulfonyl-4-methylbenzoate | CC(C)OC(=O)C1=CC=C(OC(=O)C2=CC=C(C)C(=C2)S(C)(=O)=O)C=C1 | Non beta lactone inhibitor | 20% at 1 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002133 | 26083639 | Hsp100 | ClpP2 | Bacteria | Cytosol | Inhibition of peptidase activity | NA | AV127 | 4-(2-oxopyrrolidin-1-yl)phenyl 1-(2,2-dimethylpropanoyl)piperidine-4-carboxylate | CC(C)(C)C(=O)N1CCC(CC1)C(=O)OC1=CC=C(C=C1)N1CCCC1=O | Non beta lactone inhibitor | 0-5% at 1 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002134 | 26083639 | Hsp100 | ClpP2 | Bacteria | Cytosol | Inhibition of peptidase activity | NA | AV166 | (2Z)-3-(3,4-dimethoxyphenyl)-1-{3-[(2-oxo-2-phenylethyl)sulfanyl]-4H-1,2,4-triazol-4-yl}prop-2-en-1-one | COC1=C(OC)C=C(\C=C/C(=O)N2C=NN=C2SCC(=O)C2=CC=CC=C2)C=C1 | Non beta lactone inhibitor | 80% at 1 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002135 | 26083639 | Hsp100 | ClpP2 | Bacteria | Cytosol | Inhibition of peptidase activity | NA | AV167 | 4-(1,3,4-oxadiazol-2-yl)phenyl 2-{naphtho[2,1-b]furan-1-yl}acetate | O=C(CC1=COC2=C1C1=C(C=CC=C1)C=C2)OC1=CC=C(C=C1)C1=NN=CO1 | Non beta lactone inhibitor | 0-5% at 1 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002136 | 26083639 | Hsp100 | ClpP2 | Bacteria | Cytosol | Inhibition of peptidase activity | NA | AV168 | 4-(1,3,4-oxadiazol-2-yl)phenyl 3-[methyl(3-sulfanylphenyl)sulfamoyl]benzoate | CN(C1=CC=CC(S)=C1)S(=O)(=O)C1=CC=CC(=C1)C(=O)OC1=CC=C(C=C1)C1=NN=CO1 | Non beta lactone inhibitor | 10% at 1 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002137 | 26083639 | Hsp100 | ClpP2 | Bacteria | Cytosol | Inhibition of peptidase activity | NA | AV170 | 4-acetylphenyl 3-(3,4,5-trimethoxyphenyl)propanoate | COC1=CC(CCC(=O)OC2=CC=C(C=C2)C(C)=O)=CC(OC)=C1OC | Non beta lactone inhibitor | 75% at 1 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002138 | 26083639 | Hsp100 | ClpP2 | Bacteria | Cytosol | Inhibition of peptidase activity | NA | D3 | 3-(non-8-en-1-yl)-4-(pent-4-yn-1-yl)oxetan-2-one | C=CCCCCCCCC1C(CCCC#C)OC1=O | Non beta lactone inhibitor | 20% at 1 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002139 | 26083639 | Hsp100 | ClpP2 | Bacteria | Cytosol | Inhibition of peptidase activity | NA | E2 | 3-(4-methoxyphenyl)-4-(pent-4-yn-1-yl)oxetan-2-one | COC1=CC=C(C=C1)C1C(CCCC#C)OC1=O | Non beta lactone inhibitor | 10% at 1 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002140 | 26083639 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | AV126 | 4-[(propan-2-yloxy)carbonyl]phenyl 3-methanesulfonyl-4-methylbenzoate | CC(C)OC(=O)C1=CC=C(OC(=O)C2=CC=C(C)C(=C2)S(C)(=O)=O)C=C1 | Non beta lactone inhibitor | 100% at 100 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002141 | 26083639 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | AV127 | 4-(2-oxopyrrolidin-1-yl)phenyl 1-(2,2-dimethylpropanoyl)piperidine-4-carboxylate | CC(C)(C)C(=O)N1CCC(CC1)C(=O)OC1=CC=C(C=C1)N1CCCC1=O | Non beta lactone inhibitor | 100% at 100 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002142 | 26083639 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | AV166 | (2Z)-3-(3,4-dimethoxyphenyl)-1-{3-[(2-oxo-2-phenylethyl)sulfanyl]-4H-1,2,4-triazol-4-yl}prop-2-en-1-one | COC1=C(OC)C=C(\C=C/C(=O)N2C=NN=C2SCC(=O)C2=CC=CC=C2)C=C1 | Non beta lactone inhibitor | 100% at 100 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002143 | 26083639 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | AV167 | 4-(1,3,4-oxadiazol-2-yl)phenyl 2-{naphtho[2,1-b]furan-1-yl}acetate | O=C(CC1=COC2=C1C1=C(C=CC=C1)C=C2)OC1=CC=C(C=C1)C1=NN=CO1 | Non beta lactone inhibitor | 99% at 100 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002144 | 26083639 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | AV168 | 4-(1,3,4-oxadiazol-2-yl)phenyl 3-[methyl(3-sulfanylphenyl)sulfamoyl]benzoate | CN(C1=CC=CC(S)=C1)S(=O)(=O)C1=CC=CC(=C1)C(=O)OC1=CC=C(C=C1)C1=NN=CO1 | Non beta lactone inhibitor | 88% at 100 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002145 | 26083639 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | AV170 | 4-acetylphenyl 3-(3,4,5-trimethoxyphenyl)propanoate | COC1=CC(CCC(=O)OC2=CC=C(C=C2)C(C)=O)=CC(OC)=C1OC | Non beta lactone inhibitor | 99% at 100 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002146 | 26083639 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | D3 | 3-(non-8-en-1-yl)-4-(pent-4-yn-1-yl)oxetan-2-one | C=CCCCCCCCC1C(CCCC#C)OC1=O | Non beta lactone inhibitor | 95% at 100 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002147 | 26083639 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | E2 | 3-(4-methoxyphenyl)-4-(pent-4-yn-1-yl)oxetan-2-one | COC1=CC=C(C=C1)C1C(CCCC#C)OC1=O | Non beta lactone inhibitor | 100% at 100 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002148 | 26083639 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | AV126 | 4-[(propan-2-yloxy)carbonyl]phenyl 3-methanesulfonyl-4-methylbenzoate | CC(C)OC(=O)C1=CC=C(OC(=O)C2=CC=C(C)C(=C2)S(C)(=O)=O)C=C1 | Non beta lactone inhibitor | 100% at 10 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002149 | 26083639 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | AV127 | 4-(2-oxopyrrolidin-1-yl)phenyl 1-(2,2-dimethylpropanoyl)piperidine-4-carboxylate | CC(C)(C)C(=O)N1CCC(CC1)C(=O)OC1=CC=C(C=C1)N1CCCC1=O | Non beta lactone inhibitor | 88% at 10 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002150 | 26083639 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | AV166 | (2Z)-3-(3,4-dimethoxyphenyl)-1-{3-[(2-oxo-2-phenylethyl)sulfanyl]-4H-1,2,4-triazol-4-yl}prop-2-en-1-one | COC1=C(OC)C=C(\C=C/C(=O)N2C=NN=C2SCC(=O)C2=CC=CC=C2)C=C1 | Non beta lactone inhibitor | 95% at 10 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002151 | 26083639 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | AV167 | 4-(1,3,4-oxadiazol-2-yl)phenyl 2-{naphtho[2,1-b]furan-1-yl}acetate | O=C(CC1=COC2=C1C1=C(C=CC=C1)C=C2)OC1=CC=C(C=C1)C1=NN=CO1 | Non beta lactone inhibitor | 100% at 10 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002152 | 26083639 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | AV168 | 4-(1,3,4-oxadiazol-2-yl)phenyl 3-[methyl(3-sulfanylphenyl)sulfamoyl]benzoate | CN(C1=CC=CC(S)=C1)S(=O)(=O)C1=CC=CC(=C1)C(=O)OC1=CC=C(C=C1)C1=NN=CO1 | Non beta lactone inhibitor | 80% at 10 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002153 | 26083639 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | AV170 | 4-acetylphenyl 3-(3,4,5-trimethoxyphenyl)propanoate | COC1=CC(CCC(=O)OC2=CC=C(C=C2)C(C)=O)=CC(OC)=C1OC | Non beta lactone inhibitor | 99% at 10 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002154 | 26083639 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | D3 | 3-(non-8-en-1-yl)-4-(pent-4-yn-1-yl)oxetan-2-one | C=CCCCCCCCC1C(CCCC#C)OC1=O | Non beta lactone inhibitor | 90% at 10 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002155 | 26083639 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | E2 | 3-(4-methoxyphenyl)-4-(pent-4-yn-1-yl)oxetan-2-one | COC1=CC=C(C=C1)C1C(CCCC#C)OC1=O | Non beta lactone inhibitor | 88% at 10 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002156 | 26083639 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | AV126 | 4-[(propan-2-yloxy)carbonyl]phenyl 3-methanesulfonyl-4-methylbenzoate | CC(C)OC(=O)C1=CC=C(OC(=O)C2=CC=C(C)C(=C2)S(C)(=O)=O)C=C1 | Non beta lactone inhibitor | 65% at 1 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002157 | 26083639 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | AV127 | 4-(2-oxopyrrolidin-1-yl)phenyl 1-(2,2-dimethylpropanoyl)piperidine-4-carboxylate | CC(C)(C)C(=O)N1CCC(CC1)C(=O)OC1=CC=C(C=C1)N1CCCC1=O | Non beta lactone inhibitor | 25% at 1 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002158 | 26083639 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | AV166 | (2Z)-3-(3,4-dimethoxyphenyl)-1-{3-[(2-oxo-2-phenylethyl)sulfanyl]-4H-1,2,4-triazol-4-yl}prop-2-en-1-one | COC1=C(OC)C=C(\C=C/C(=O)N2C=NN=C2SCC(=O)C2=CC=CC=C2)C=C1 | Non beta lactone inhibitor | 60% at 1 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002159 | 26083639 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | AV167 | 4-(1,3,4-oxadiazol-2-yl)phenyl 2-{naphtho[2,1-b]furan-1-yl}acetate | O=C(CC1=COC2=C1C1=C(C=CC=C1)C=C2)OC1=CC=C(C=C1)C1=NN=CO1 | Non beta lactone inhibitor | 40% at 1 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002160 | 26083639 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | AV168 | 4-(1,3,4-oxadiazol-2-yl)phenyl 3-[methyl(3-sulfanylphenyl)sulfamoyl]benzoate | CN(C1=CC=CC(S)=C1)S(=O)(=O)C1=CC=CC(=C1)C(=O)OC1=CC=C(C=C1)C1=NN=CO1 | Non beta lactone inhibitor | 45% at 1 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002161 | 26083639 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | AV170 | 4-acetylphenyl 3-(3,4,5-trimethoxyphenyl)propanoate | COC1=CC(CCC(=O)OC2=CC=C(C=C2)C(C)=O)=CC(OC)=C1OC | Non beta lactone inhibitor | 80% at 1 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002162 | 26083639 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | D3 | 3-(non-8-en-1-yl)-4-(pent-4-yn-1-yl)oxetan-2-one | C=CCCCCCCCC1C(CCCC#C)OC1=O | Non beta lactone inhibitor | 5% at 1 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002163 | 26083639 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | E2 | 3-(4-methoxyphenyl)-4-(pent-4-yn-1-yl)oxetan-2-one | COC1=CC=C(C=C1)C1C(CCCC#C)OC1=O | Non beta lactone inhibitor | 20% at 1 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002164 | 26083639 | Hsp100 | ClpP | Human | Cytosol | Inhibition of peptidase activity | NA | AV126 | 4-[(propan-2-yloxy)carbonyl]phenyl 3-methanesulfonyl-4-methylbenzoate | CC(C)OC(=O)C1=CC=C(OC(=O)C2=CC=C(C)C(=C2)S(C)(=O)=O)C=C1 | Non beta lactone inhibitor | 20% at 100 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002165 | 26083639 | Hsp100 | ClpP | Human | Cytosol | Inhibition of peptidase activity | NA | AV127 | 4-(2-oxopyrrolidin-1-yl)phenyl 1-(2,2-dimethylpropanoyl)piperidine-4-carboxylate | CC(C)(C)C(=O)N1CCC(CC1)C(=O)OC1=CC=C(C=C1)N1CCCC1=O | Non beta lactone inhibitor | 25% at 100 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002166 | 26083639 | Hsp100 | ClpP | Human | Cytosol | Inhibition of peptidase activity | NA | AV166 | (2Z)-3-(3,4-dimethoxyphenyl)-1-{3-[(2-oxo-2-phenylethyl)sulfanyl]-4H-1,2,4-triazol-4-yl}prop-2-en-1-one | COC1=C(OC)C=C(\C=C/C(=O)N2C=NN=C2SCC(=O)C2=CC=CC=C2)C=C1 | Non beta lactone inhibitor | 100% at 100 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002167 | 26083639 | Hsp100 | ClpP | Human | Cytosol | Inhibition of peptidase activity | NA | AV167 | 4-(1,3,4-oxadiazol-2-yl)phenyl 2-{naphtho[2,1-b]furan-1-yl}acetate | O=C(CC1=COC2=C1C1=C(C=CC=C1)C=C2)OC1=CC=C(C=C1)C1=NN=CO1 | Non beta lactone inhibitor | 100% at 100 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002168 | 26083639 | Hsp100 | ClpP | Human | Cytosol | Inhibition of peptidase activity | NA | AV168 | 4-(1,3,4-oxadiazol-2-yl)phenyl 3-[methyl(3-sulfanylphenyl)sulfamoyl]benzoate | CN(C1=CC=CC(S)=C1)S(=O)(=O)C1=CC=CC(=C1)C(=O)OC1=CC=C(C=C1)C1=NN=CO1 | Non beta lactone inhibitor | 5% at 100 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002169 | 26083639 | Hsp100 | ClpP | Human | Cytosol | Inhibition of peptidase activity | NA | AV170 | 4-acetylphenyl 3-(3,4,5-trimethoxyphenyl)propanoate | COC1=CC(CCC(=O)OC2=CC=C(C=C2)C(C)=O)=CC(OC)=C1OC | Non beta lactone inhibitor | 80% at 100 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002170 | 26083639 | Hsp100 | ClpP | Human | Cytosol | Inhibition of peptidase activity | NA | D3 | 3-(non-8-en-1-yl)-4-(pent-4-yn-1-yl)oxetan-2-one | C=CCCCCCCCC1C(CCCC#C)OC1=O | Non beta lactone inhibitor | 40% at 100 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002171 | 26083639 | Hsp100 | ClpP | Human | Cytosol | Inhibition of peptidase activity | NA | E2 | 3-(4-methoxyphenyl)-4-(pent-4-yn-1-yl)oxetan-2-one | COC1=CC=C(C=C1)C1C(CCCC#C)OC1=O | Non beta lactone inhibitor | 45% at 100 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002172 | 26083639 | Hsp100 | ClpP | Human | Cytosol | Inhibition of peptidase activity | NA | AV126 | 4-[(propan-2-yloxy)carbonyl]phenyl 3-methanesulfonyl-4-methylbenzoate | CC(C)OC(=O)C1=CC=C(OC(=O)C2=CC=C(C)C(=C2)S(C)(=O)=O)C=C1 | Non beta lactone inhibitor | 0-5% at 10 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002173 | 26083639 | Hsp100 | ClpP | Human | Cytosol | Inhibition of peptidase activity | NA | AV127 | 4-(2-oxopyrrolidin-1-yl)phenyl 1-(2,2-dimethylpropanoyl)piperidine-4-carboxylate | CC(C)(C)C(=O)N1CCC(CC1)C(=O)OC1=CC=C(C=C1)N1CCCC1=O | Non beta lactone inhibitor | 0-5% at 10 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002174 | 26083639 | Hsp100 | ClpP | Human | Cytosol | Inhibition of peptidase activity | NA | AV166 | (2Z)-3-(3,4-dimethoxyphenyl)-1-{3-[(2-oxo-2-phenylethyl)sulfanyl]-4H-1,2,4-triazol-4-yl}prop-2-en-1-one | COC1=C(OC)C=C(\C=C/C(=O)N2C=NN=C2SCC(=O)C2=CC=CC=C2)C=C1 | Non beta lactone inhibitor | 0-5% at 10 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002175 | 26083639 | Hsp100 | ClpP | Human | Cytosol | Inhibition of peptidase activity | NA | AV167 | 4-(1,3,4-oxadiazol-2-yl)phenyl 2-{naphtho[2,1-b]furan-1-yl}acetate | O=C(CC1=COC2=C1C1=C(C=CC=C1)C=C2)OC1=CC=C(C=C1)C1=NN=CO1 | Non beta lactone inhibitor | 10-15% at 10 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002176 | 26083639 | Hsp100 | ClpP | Human | Cytosol | Inhibition of peptidase activity | NA | AV168 | 4-(1,3,4-oxadiazol-2-yl)phenyl 3-[methyl(3-sulfanylphenyl)sulfamoyl]benzoate | CN(C1=CC=CC(S)=C1)S(=O)(=O)C1=CC=CC(=C1)C(=O)OC1=CC=C(C=C1)C1=NN=CO1 | Non beta lactone inhibitor | 0-5% at 10 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002177 | 26083639 | Hsp100 | ClpP | Human | Cytosol | Inhibition of peptidase activity | NA | AV170 | 4-acetylphenyl 3-(3,4,5-trimethoxyphenyl)propanoate | COC1=CC(CCC(=O)OC2=CC=C(C=C2)C(C)=O)=CC(OC)=C1OC | Non beta lactone inhibitor | 20% at 10 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002178 | 26083639 | Hsp100 | ClpP | Human | Cytosol | Inhibition of peptidase activity | NA | D3 | 3-(non-8-en-1-yl)-4-(pent-4-yn-1-yl)oxetan-2-one | C=CCCCCCCCC1C(CCCC#C)OC1=O | Non beta lactone inhibitor | 50% at 10 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002179 | 26083639 | Hsp100 | ClpP | Human | Cytosol | Inhibition of peptidase activity | NA | E2 | 3-(4-methoxyphenyl)-4-(pent-4-yn-1-yl)oxetan-2-one | COC1=CC=C(C=C1)C1C(CCCC#C)OC1=O | Non beta lactone inhibitor | 15% at 10 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002180 | 26083639 | Hsp100 | ClpP | Human | Cytosol | Inhibition of peptidase activity | NA | AV126 | 4-[(propan-2-yloxy)carbonyl]phenyl 3-methanesulfonyl-4-methylbenzoate | CC(C)OC(=O)C1=CC=C(OC(=O)C2=CC=C(C)C(=C2)S(C)(=O)=O)C=C1 | Non beta lactone inhibitor | 0-5% at 1 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002181 | 26083639 | Hsp100 | ClpP | Human | Cytosol | Inhibition of peptidase activity | NA | AV127 | 4-(2-oxopyrrolidin-1-yl)phenyl 1-(2,2-dimethylpropanoyl)piperidine-4-carboxylate | CC(C)(C)C(=O)N1CCC(CC1)C(=O)OC1=CC=C(C=C1)N1CCCC1=O | Non beta lactone inhibitor | 0-5% at 1 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002182 | 26083639 | Hsp100 | ClpP | Human | Cytosol | Inhibition of peptidase activity | NA | AV166 | (2Z)-3-(3,4-dimethoxyphenyl)-1-{3-[(2-oxo-2-phenylethyl)sulfanyl]-4H-1,2,4-triazol-4-yl}prop-2-en-1-one | COC1=C(OC)C=C(\C=C/C(=O)N2C=NN=C2SCC(=O)C2=CC=CC=C2)C=C1 | Non beta lactone inhibitor | 5-10% at 1 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002183 | 26083639 | Hsp100 | ClpP | Human | Cytosol | Inhibition of peptidase activity | NA | AV167 | 4-(1,3,4-oxadiazol-2-yl)phenyl 2-{naphtho[2,1-b]furan-1-yl}acetate | O=C(CC1=COC2=C1C1=C(C=CC=C1)C=C2)OC1=CC=C(C=C1)C1=NN=CO1 | Non beta lactone inhibitor | 50% at 1 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002184 | 26083639 | Hsp100 | ClpP | Human | Cytosol | Inhibition of peptidase activity | NA | AV168 | 4-(1,3,4-oxadiazol-2-yl)phenyl 3-[methyl(3-sulfanylphenyl)sulfamoyl]benzoate | CN(C1=CC=CC(S)=C1)S(=O)(=O)C1=CC=CC(=C1)C(=O)OC1=CC=C(C=C1)C1=NN=CO1 | Non beta lactone inhibitor | 0-5% at 1 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002185 | 26083639 | Hsp100 | ClpP | Human | Cytosol | Inhibition of peptidase activity | NA | AV170 | 4-acetylphenyl 3-(3,4,5-trimethoxyphenyl)propanoate | COC1=CC(CCC(=O)OC2=CC=C(C=C2)C(C)=O)=CC(OC)=C1OC | Non beta lactone inhibitor | 10% at 1 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002186 | 26083639 | Hsp100 | ClpP | Human | Cytosol | Inhibition of peptidase activity | NA | D3 | 3-(non-8-en-1-yl)-4-(pent-4-yn-1-yl)oxetan-2-one | C=CCCCCCCCC1C(CCCC#C)OC1=O | Non beta lactone inhibitor | 10% at 1 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002187 | 26083639 | Hsp100 | ClpP | Human | Cytosol | Inhibition of peptidase activity | NA | E2 | 3-(4-methoxyphenyl)-4-(pent-4-yn-1-yl)oxetan-2-one | COC1=CC=C(C=C1)C1C(CCCC#C)OC1=O | Non beta lactone inhibitor | 10% at 1 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002188 | 26083639 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of protease activity | NA | AV126 | 4-[(propan-2-yloxy)carbonyl]phenyl 3-methanesulfonyl-4-methylbenzoate | CC(C)OC(=O)C1=CC=C(OC(=O)C2=CC=C(C)C(=C2)S(C)(=O)=O)C=C1 | Non beta lactone inhibitor | 90% at 100 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Substrate degradation assay (GFP-ssrA) | NA | NA |
HSPMDB002189 | 26083639 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of protease activity | NA | AV127 | 4-(2-oxopyrrolidin-1-yl)phenyl 1-(2,2-dimethylpropanoyl)piperidine-4-carboxylate | CC(C)(C)C(=O)N1CCC(CC1)C(=O)OC1=CC=C(C=C1)N1CCCC1=O | Non beta lactone inhibitor | 90% at 100 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Substrate degradation assay (GFP-ssrA) | NA | NA |
HSPMDB002190 | 26083639 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of protease activity | NA | AV166 | (2Z)-3-(3,4-dimethoxyphenyl)-1-{3-[(2-oxo-2-phenylethyl)sulfanyl]-4H-1,2,4-triazol-4-yl}prop-2-en-1-one | COC1=C(OC)C=C(\C=C/C(=O)N2C=NN=C2SCC(=O)C2=CC=CC=C2)C=C1 | Non beta lactone inhibitor | 75% at 100 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Substrate degradation assay (GFP-ssrA) | NA | NA |
HSPMDB002191 | 26083639 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of protease activity | NA | AV167 | 4-(1,3,4-oxadiazol-2-yl)phenyl 2-{naphtho[2,1-b]furan-1-yl}acetate | O=C(CC1=COC2=C1C1=C(C=CC=C1)C=C2)OC1=CC=C(C=C1)C1=NN=CO1 | Non beta lactone inhibitor | 25% at 100 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Substrate degradation assay (GFP-ssrA) | NA | NA |
HSPMDB002192 | 26083639 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of protease activity | NA | AV168 | 4-(1,3,4-oxadiazol-2-yl)phenyl 3-[methyl(3-sulfanylphenyl)sulfamoyl]benzoate | CN(C1=CC=CC(S)=C1)S(=O)(=O)C1=CC=CC(=C1)C(=O)OC1=CC=C(C=C1)C1=NN=CO1 | Non beta lactone inhibitor | 20% at 100 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Substrate degradation assay (GFP-ssrA) | NA | NA |
HSPMDB002193 | 26083639 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of protease activity | NA | AV170 | 4-acetylphenyl 3-(3,4,5-trimethoxyphenyl)propanoate | COC1=CC(CCC(=O)OC2=CC=C(C=C2)C(C)=O)=CC(OC)=C1OC | Non beta lactone inhibitor | 90% at 100 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Substrate degradation assay (GFP-ssrA) | NA | NA |
HSPMDB002194 | 26083639 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of protease activity | NA | D3 | 3-(non-8-en-1-yl)-4-(pent-4-yn-1-yl)oxetan-2-one | C=CCCCCCCCC1C(CCCC#C)OC1=O | Non beta lactone inhibitor | 70% at 100 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Substrate degradation assay (GFP-ssrA) | NA | NA |
HSPMDB002195 | 26083639 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of protease activity | NA | E2 | 3-(4-methoxyphenyl)-4-(pent-4-yn-1-yl)oxetan-2-one | COC1=CC=C(C=C1)C1C(CCCC#C)OC1=O | Non beta lactone inhibitor | 85% at 100 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Substrate degradation assay (GFP-ssrA) | NA | NA |
HSPMDB002196 | 26083639 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of protease activity | NA | AV126 | 4-[(propan-2-yloxy)carbonyl]phenyl 3-methanesulfonyl-4-methylbenzoate | CC(C)OC(=O)C1=CC=C(OC(=O)C2=CC=C(C)C(=C2)S(C)(=O)=O)C=C1 | Non beta lactone inhibitor | 80% at 10 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Substrate degradation assay (GFP-ssrA) | NA | NA |
HSPMDB002197 | 26083639 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of protease activity | NA | AV127 | 4-(2-oxopyrrolidin-1-yl)phenyl 1-(2,2-dimethylpropanoyl)piperidine-4-carboxylate | CC(C)(C)C(=O)N1CCC(CC1)C(=O)OC1=CC=C(C=C1)N1CCCC1=O | Non beta lactone inhibitor | 65% at 10 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Substrate degradation assay (GFP-ssrA) | NA | NA |
HSPMDB002198 | 26083639 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of protease activity | NA | AV166 | (2Z)-3-(3,4-dimethoxyphenyl)-1-{3-[(2-oxo-2-phenylethyl)sulfanyl]-4H-1,2,4-triazol-4-yl}prop-2-en-1-one | COC1=C(OC)C=C(\C=C/C(=O)N2C=NN=C2SCC(=O)C2=CC=CC=C2)C=C1 | Non beta lactone inhibitor | 20% at 10 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Substrate degradation assay (GFP-ssrA) | NA | NA |
HSPMDB002199 | 26083639 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of protease activity | NA | AV167 | 4-(1,3,4-oxadiazol-2-yl)phenyl 2-{naphtho[2,1-b]furan-1-yl}acetate | O=C(CC1=COC2=C1C1=C(C=CC=C1)C=C2)OC1=CC=C(C=C1)C1=NN=CO1 | Non beta lactone inhibitor | 20% at 10 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Substrate degradation assay (GFP-ssrA) | NA | NA |
HSPMDB002200 | 26083639 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of protease activity | NA | AV168 | 4-(1,3,4-oxadiazol-2-yl)phenyl 3-[methyl(3-sulfanylphenyl)sulfamoyl]benzoate | CN(C1=CC=CC(S)=C1)S(=O)(=O)C1=CC=CC(=C1)C(=O)OC1=CC=C(C=C1)C1=NN=CO1 | Non beta lactone inhibitor | 15% at 10 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Substrate degradation assay (GFP-ssrA) | NA | NA |
HSPMDB002201 | 26083639 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of protease activity | NA | AV170 | 4-acetylphenyl 3-(3,4,5-trimethoxyphenyl)propanoate | COC1=CC(CCC(=O)OC2=CC=C(C=C2)C(C)=O)=CC(OC)=C1OC | Non beta lactone inhibitor | 15% at 10 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Substrate degradation assay (GFP-ssrA) | NA | NA |
HSPMDB002202 | 26083639 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of protease activity | NA | D3 | 3-(non-8-en-1-yl)-4-(pent-4-yn-1-yl)oxetan-2-one | C=CCCCCCCCC1C(CCCC#C)OC1=O | Non beta lactone inhibitor | 90% at 10 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Substrate degradation assay (GFP-ssrA) | NA | NA |
HSPMDB002203 | 26083639 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of protease activity | NA | E2 | 3-(4-methoxyphenyl)-4-(pent-4-yn-1-yl)oxetan-2-one | COC1=CC=C(C=C1)C1C(CCCC#C)OC1=O | Non beta lactone inhibitor | 25% at 10 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Substrate degradation assay (GFP-ssrA) | NA | NA |
HSPMDB002204 | 26083639 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of protease activity | NA | AV126 | 4-[(propan-2-yloxy)carbonyl]phenyl 3-methanesulfonyl-4-methylbenzoate | CC(C)OC(=O)C1=CC=C(OC(=O)C2=CC=C(C)C(=C2)S(C)(=O)=O)C=C1 | Non beta lactone inhibitor | 5% at 1 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Substrate degradation assay (GFP-ssrA) | NA | NA |
HSPMDB002205 | 26083639 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of protease activity | NA | AV127 | 4-(2-oxopyrrolidin-1-yl)phenyl 1-(2,2-dimethylpropanoyl)piperidine-4-carboxylate | CC(C)(C)C(=O)N1CCC(CC1)C(=O)OC1=CC=C(C=C1)N1CCCC1=O | Non beta lactone inhibitor | 0-5% at 1 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Substrate degradation assay (GFP-ssrA) | NA | NA |
HSPMDB002206 | 26083639 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of protease activity | NA | AV166 | (2Z)-3-(3,4-dimethoxyphenyl)-1-{3-[(2-oxo-2-phenylethyl)sulfanyl]-4H-1,2,4-triazol-4-yl}prop-2-en-1-one | COC1=C(OC)C=C(\C=C/C(=O)N2C=NN=C2SCC(=O)C2=CC=CC=C2)C=C1 | Non beta lactone inhibitor | 0-5% at 1 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Substrate degradation assay (GFP-ssrA) | NA | NA |
HSPMDB002207 | 26083639 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of protease activity | NA | AV167 | 4-(1,3,4-oxadiazol-2-yl)phenyl 2-{naphtho[2,1-b]furan-1-yl}acetate | O=C(CC1=COC2=C1C1=C(C=CC=C1)C=C2)OC1=CC=C(C=C1)C1=NN=CO1 | Non beta lactone inhibitor | 5% at 1 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Substrate degradation assay (GFP-ssrA) | NA | NA |
HSPMDB002208 | 26083639 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of protease activity | NA | AV168 | 4-(1,3,4-oxadiazol-2-yl)phenyl 3-[methyl(3-sulfanylphenyl)sulfamoyl]benzoate | CN(C1=CC=CC(S)=C1)S(=O)(=O)C1=CC=CC(=C1)C(=O)OC1=CC=C(C=C1)C1=NN=CO1 | Non beta lactone inhibitor | 5% at 1 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Substrate degradation assay (GFP-ssrA) | NA | NA |
HSPMDB002209 | 26083639 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of protease activity | NA | AV170 | 4-acetylphenyl 3-(3,4,5-trimethoxyphenyl)propanoate | COC1=CC(CCC(=O)OC2=CC=C(C=C2)C(C)=O)=CC(OC)=C1OC | Non beta lactone inhibitor | 10% at 1 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Substrate degradation assay (GFP-ssrA) | NA | NA |
HSPMDB002210 | 26083639 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of protease activity | NA | D3 | 3-(non-8-en-1-yl)-4-(pent-4-yn-1-yl)oxetan-2-one | C=CCCCCCCCC1C(CCCC#C)OC1=O | Non beta lactone inhibitor | 0-5% at 1 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Substrate degradation assay (GFP-ssrA) | NA | NA |
HSPMDB002211 | 26083639 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of protease activity | NA | E2 | 3-(4-methoxyphenyl)-4-(pent-4-yn-1-yl)oxetan-2-one | COC1=CC=C(C=C1)C1C(CCCC#C)OC1=O | Non beta lactone inhibitor | 15% at 1 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Substrate degradation assay (GFP-ssrA) | NA | NA |
HSPMDB002212 | 26083639 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | ML16 | Methyl 4-((3-(3,5-dimethoxy-4-(prop-2-yn-1-yloxy)phenyl)propanoyl)oxy)benzoate | C(Nc1nc(NCc2ccccc2)c3ccccc3n1)c4ccccc4 | Non beta lactone inhibitor (AV170 derivative) | 100% at 100 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002213 | 26083639 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | ML21 | Methyl 4-(2-(3,4,5-trimethoxyphenyl)acetoxy)benzoate | COC(=O)c1ccc(OC(=O)CCc2cc(OC)c(OCC#C)c(OC)c2)cc1 | Non beta lactone inhibitor (AV170 derivative) | 95% at 100 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002214 | 26083639 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | ML33 | Methyl 4-((3-(1H-indol-3-yl)propanoyl)oxy)benzoate | COC(=O)c1ccc(OC(=O)Cc2cc(OC)c(OC)c(OC)c2)cc1 | Non beta lactone inhibitor (AV170 derivative) | 90% at 100 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002215 | 26083639 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | ML03 | Isopropyl 4-((3-(3,4,5-trimethoxyphenyl)propanoyl)oxy)benzoate | COC(=O)c1ccc(OC(=O)CCc2c[nH]c3ccccc23)cc1 | Non beta lactone inhibitor (AV170 derivative) | 0-5% at 100 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002216 | 26083639 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | ML23 | methyl 3-{[3-(3,4,5-trimethoxyphenyl)propanoyl]oxy}benzoate | COc1cc(CCC(=O)Oc2ccc(cc2)C(=O)OC(C)C)cc(OC)c1OC | Non beta lactone inhibitor (AV170 derivative) | 0-5% at 100 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002217 | 26083639 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | MLIH18 | 4-(5-methyl-1,2,4-oxadiazol-3-yl)phenyl 3-(3,4,5-trimethoxyphenyl)propanoate | COC(=O)c1cccc(OC(=O)CCc2cc(OC)c(OC)c(OC)c2)c1 | Non beta lactone inhibitor (AV170 derivative) | 95% at 100 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002218 | 26083639 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | ML14 | Butyl 3-(3,4,5-trimethoxyphenyl)propanoate | COc1cc(CCC(=O)Oc2ccc(cc2)c3noc(C)n3)cc(OC)c1OC | Non beta lactone inhibitor (AV170 derivative) | 0-5% at 100 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002219 | 26083639 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | ML27 | 4-acetylphenyl 3-(3,4,5-trimethoxyphenyl)propanoate | CCCCOC(=O)CCc1cc(OC)c(OC)c(OC)c1 | Non beta lactone inhibitor (AV170 derivative) | 0-5% at 100 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002220 | 26083639 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | MLIH19 | 4-(5-methyl-1,3,4-oxadiazol-2-yl)phenyl 3-(3,4,5-trimethoxyphenyl)propanoate | COc1cc(CCC(=O)Oc2ccc(cc2)C(C)=O)cc(OC)c1OC | Non beta lactone inhibitor (AV170 derivative) | 0-5% at 100 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002221 | 26083639 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | ML25 | 4-formylphenyl 3-(3,4,5-trimethoxyphenyl)propanoate | COc1cc(CCC(=O)Oc2ccc(cc2)c3oc(C)nn3)cc(OC)c1OC | Non beta lactone inhibitor (AV170 derivative) | 95% at 100 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002222 | 26083639 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | ML05 | 4-Methoxyphenyl 3-(3,4,5-trimethoxyphenyl)propanoate | COc1cc(CCC(=O)Oc2ccc(C=O)cc2)cc(OC)c1OC | Non beta lactone inhibitor (AV170 derivative) | 90% at 100 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002223 | 26083639 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | ML06 | Phenyl 3-(3,4,5-trimethoxyphenyl)propanoate | COc1ccc(OC(=O)CCc2cc(OC)c(OC)c(OC)c2)cc1 | Non beta lactone inhibitor (AV170 derivative) | 80% at 100 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002224 | 26083639 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | ML28 | 4-(Dimethylamino)phenyl 3-(3,4,5-trimethoxyphenyl)propanoate | COc1cc(CCC(=O)Oc2ccccc2)cc(OC)c1OC | Non beta lactone inhibitor (AV170 derivative) | 60% at 100 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002225 | 26083639 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | ML92 | Methyl 4-((3-(3,4-dimethoxyphenyl)propanoyl)oxy)benzoate | COc1cc(CCC(=O)Oc2ccc(cc2)N(C)C)cc(OC)c1OC | Non beta lactone inhibitor (AV170 derivative) | 85% at 100 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002226 | 26083639 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | ML57 | Methyl 4-((3-(3-acetylphenyl)propanoyl)oxy)benzoate | COC(=O)c1ccc(OC(=O)CCc2ccc(OC)c(OC)c2)cc1 | Non beta lactone inhibitor (AV170 derivative) | 55% at 100 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002227 | 26083639 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | ML09 | Cyclohexyl 3-(3,4,5-trimethoxyphenyl)propanoate | COC(=O)c1ccc(OC(=O)CCc2cccc(c2)C(C)=O)cc1 | Non beta lactone inhibitor (AV170 derivative) | 10% at 100 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002228 | 26083639 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | ML18 | 4-((3-(3,4,5-trimethoxyphenyl)propanoyl)oxy)benzoic acid | COc1cc(CCC(=O)OC2CCCCC2)cc(OC)c1OC | Non beta lactone inhibitor (AV170 derivative) | 20% at 100 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002229 | 26083639 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | ML20 | Methyl 4-(((3,4,5-trimethoxybenzyl)carbamoyl)oxy)benzoate | COc1cc(CCC(=O)Oc2ccc(cc2)C(O)=O)cc(OC)c1OC | Non beta lactone inhibitor (AV170 derivative) | 30% at 100 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002230 | 26083639 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | ML68 | methyl 4-{[3-(thiophen-2-yl)propanoyl]oxy}benzoate | COC(=O)C1=CC=C(OC(=O)CCC2=CC=CS2)C=C1 | Non beta lactone inhibitor (AV170 derivative) | 5% at 100 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002231 | 26083639 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | AV134 | 1-(2,2-dimethylpropanoyl)-N-[4-(2-oxopyrrolidin-1-yl)phenyl]piperidine-4-sulfonamide | CC(C)(C)C(=O)N1CCC(CC1)S(=O)(=O)NC1=CC=C(C=C1)N1CCCC1=O | Non beta lactone inhibitor (AV170 derivative) | 0-5% at 100 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002232 | 26083639 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | ML31 | Methyl 4-(hept-6-ynoyloxy)benzoate | COC(=O)c1ccc(OC(=O)CCCCC#C)cc1 | Non beta lactone inhibitor (AV170 derivative) | 15% at 100 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002233 | 26083639 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | ML24 | 2-acetylphenyl 3-(3,4,5-trimethoxyphenyl)propanoate | COc1cc(CCC(=O)Oc2ccccc2C(C)=O)cc(OC)c1OC | Non beta lactone inhibitor (AV170 derivative) | 55% at 100 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002234 | 26083639 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | ML30 | Methyl 4-(undec-10-ynoyloxy)benzoate | COC(=O)c1ccc(OC(=O)CCCCCCCCC#C)cc1 | Non beta lactone inhibitor (AV170 derivative) | 0-5% at 100 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002235 | 26083639 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | ML74 | 4-(Methoxycarbonyl)phenyl 3,4,5-trimethoxybenzoate | COC(=O)c1ccc(OC(=O)c2cc(OC)c(OC)c(OC)c2)cc1 | Non beta lactone inhibitor (AV170 derivative) | 75% at 100 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002236 | 26083639 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | ML12 | 4-Nitrophenyl 3-(3,4,5-trimethoxyphenyl)propanoate | COc1cc(CCC(=O)Oc2ccc(cc2)[N+]([O-])=O)cc(OC)c1OC | Non beta lactone inhibitor (AV170 derivative) | 0-5% at 100 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002237 | 26083639 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | AV137 | 1-(2,2-dimethylpropanoyl)-N-[4-(2-oxopyrrolidin-1-yl)phenyl]piperidine-4-carboxamide | CC(C)(C)C(=O)N1CCC(CC1)C(=O)Nc2ccc(cc2)N3CCCC3=O | Non beta lactone inhibitor (AV170 derivative) | 0-5% at 100 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002238 | 26083639 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | ML16 | Methyl 4-((3-(3,5-dimethoxy-4-(prop-2-yn-1-yloxy)phenyl)propanoyl)oxy)benzoate | COC(=O)c1ccc(OC(=O)CCc2cc(OC)c(OCC#C)c(OC)c2)cc1 | Non beta lactone inhibitor (AV170 derivative) | 0-5% at 10 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002239 | 26083639 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | ML21 | Methyl 4-(2-(3,4,5-trimethoxyphenyl)acetoxy)benzoate | COC(=O)c1ccc(OC(=O)Cc2cc(OC)c(OC)c(OC)c2)cc1 | Non beta lactone inhibitor (AV170 derivative) | 0-5% at 10 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002240 | 26083639 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | ML33 | Methyl 4-((3-(1H-indol-3-yl)propanoyl)oxy)benzoate | COC(=O)c1ccc(OC(=O)CCc2c[nH]c3ccccc23)cc1 | Non beta lactone inhibitor (AV170 derivative) | 0-5% at 10 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002241 | 26083639 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | ML03 | Isopropyl 4-((3-(3,4,5-trimethoxyphenyl)propanoyl)oxy)benzoate | COc1cc(CCC(=O)Oc2ccc(cc2)C(=O)OC(C)C)cc(OC)c1OC | Non beta lactone inhibitor (AV170 derivative) | 90-95% at 10 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002242 | 26083639 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | ML23 | methyl 3-{[3-(3,4,5-trimethoxyphenyl)propanoyl]oxy}benzoate | COC(=O)c1cccc(OC(=O)CCc2cc(OC)c(OC)c(OC)c2)c1 | Non beta lactone inhibitor (AV170 derivative) | 95% at 10 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002243 | 26083639 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | MLIH18 | 4-(5-methyl-1,2,4-oxadiazol-3-yl)phenyl 3-(3,4,5-trimethoxyphenyl)propanoate | COc1cc(CCC(=O)Oc2ccc(cc2)c3noc(C)n3)cc(OC)c1OC | Non beta lactone inhibitor (AV170 derivative) | 95% at 10 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002244 | 26083639 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | ML14 | Butyl 3-(3,4,5-trimethoxyphenyl)propanoate | CCCCOC(=O)CCc1cc(OC)c(OC)c(OC)c1 | Non beta lactone inhibitor (AV170 derivative) | 95% at 10 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002245 | 26083639 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | ML27 | 4-acetylphenyl 3-(3,4,5-trimethoxyphenyl)propanoate | COc1cc(CCC(=O)Oc2ccc(cc2)C(C)=O)cc(OC)c1OC | Non beta lactone inhibitor (AV170 derivative) | 92% at 10 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002246 | 26083639 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | MLIH19 | 4-(5-methyl-1,3,4-oxadiazol-2-yl)phenyl 3-(3,4,5-trimethoxyphenyl)propanoate | COc1cc(CCC(=O)Oc2ccc(cc2)c3oc(C)nn3)cc(OC)c1OC | Non beta lactone inhibitor (AV170 derivative) | 95% at 10 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002247 | 26083639 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | ML25 | 4-formylphenyl 3-(3,4,5-trimethoxyphenyl)propanoate | COc1cc(CCC(=O)Oc2ccc(C=O)cc2)cc(OC)c1OC | Non beta lactone inhibitor (AV170 derivative) | 80% at 10 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002248 | 26083639 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | ML05 | 4-Methoxyphenyl 3-(3,4,5-trimethoxyphenyl)propanoate | COc1ccc(OC(=O)CCc2cc(OC)c(OC)c(OC)c2)cc1 | Non beta lactone inhibitor (AV170 derivative) | 30% at 10 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002249 | 26083639 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | ML06 | Phenyl 3-(3,4,5-trimethoxyphenyl)propanoate | COc1cc(CCC(=O)Oc2ccccc2)cc(OC)c1OC | Non beta lactone inhibitor (AV170 derivative) | 15% at 10 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002250 | 26083639 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | ML28 | 4-(Dimethylamino)phenyl 3-(3,4,5-trimethoxyphenyl)propanoate | COc1cc(CCC(=O)Oc2ccc(cc2)N(C)C)cc(OC)c1OC | Non beta lactone inhibitor (AV170 derivative) | 10% at 10 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002251 | 26083639 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | ML92 | Methyl 4-((3-(3,4-dimethoxyphenyl)propanoyl)oxy)benzoate | COC(=O)c1ccc(OC(=O)CCc2ccc(OC)c(OC)c2)cc1 | Non beta lactone inhibitor (AV170 derivative) | 20% at 10 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002252 | 26083639 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | ML57 | Methyl 4-((3-(3-acetylphenyl)propanoyl)oxy)benzoate | COC(=O)c1ccc(OC(=O)CCc2cccc(c2)C(C)=O)cc1 | Non beta lactone inhibitor (AV170 derivative) | 0-5% at 10 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002253 | 26083639 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | ML09 | Cyclohexyl 3-(3,4,5-trimethoxyphenyl)propanoate | COc1cc(CCC(=O)OC2CCCCC2)cc(OC)c1OC | Non beta lactone inhibitor (AV170 derivative) | 0-5% at 10 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002254 | 26083639 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | ML18 | 4-((3-(3,4,5-trimethoxyphenyl)propanoyl)oxy)benzoic acid | COc1cc(CCC(=O)Oc2ccc(cc2)C(O)=O)cc(OC)c1OC | Non beta lactone inhibitor (AV170 derivative) | 0-5% at 10 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002255 | 26083639 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | ML20 | Methyl 4-(((3,4,5-trimethoxybenzyl)carbamoyl)oxy)benzoate | COC(=O)c1ccc(OC(=O)NCc2cc(OC)c(OC)c(OC)c2)cc1 | Non beta lactone inhibitor (AV170 derivative) | 0-5% at 10 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002256 | 26083639 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | ML68 | methyl 4-{[3-(thiophen-2-yl)propanoyl]oxy}benzoate | COC(=O)c1ccc(OC(=O)CCc2sccc2)cc1 | Non beta lactone inhibitor (AV170 derivative) | 0-5% at 10 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002257 | 26083639 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | AV134 | 1-(2,2-dimethylpropanoyl)-N-[4-(2-oxopyrrolidin-1-yl)phenyl]piperidine-4-sulfonamide | CC(C)(C)C(=O)N1CCC(CC1)[S](=O)(=O)Nc2ccc(cc2)N3CCCC3=O | Non beta lactone inhibitor (AV170 derivative) | 0-5% at 10 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002258 | 26083639 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | ML31 | Methyl 4-(hept-6-ynoyloxy)benzoate | COC(=O)c1ccc(OC(=O)CCCCC#C)cc1 | Non beta lactone inhibitor (AV170 derivative) | 0-5% at 10 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002259 | 26083639 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | ML24 | 2-acetylphenyl 3-(3,4,5-trimethoxyphenyl)propanoate | COc1cc(CCC(=O)Oc2ccccc2C(C)=O)cc(OC)c1OC | Non beta lactone inhibitor (AV170 derivative) | 8% at 10 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002260 | 26083639 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | ML30 | Methyl 4-(undec-10-ynoyloxy)benzoate | COC(=O)c1ccc(OC(=O)CCCCCCCCC#C)cc1 | Non beta lactone inhibitor (AV170 derivative) | 0-5% at 10 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002261 | 26083639 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | ML74 | 4-(Methoxycarbonyl)phenyl 3,4,5-trimethoxybenzoate | COC(=O)c1ccc(OC(=O)c2cc(OC)c(OC)c(OC)c2)cc1 | Non beta lactone inhibitor (AV170 derivative) | 10% at 10 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002262 | 26083639 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | ML12 | 4-Nitrophenyl 3-(3,4,5-trimethoxyphenyl)propanoate | COc1cc(CCC(=O)Oc2ccc(cc2)[N+]([O-])=O)cc(OC)c1OC | Non beta lactone inhibitor (AV170 derivative) | 15% at 10 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002263 | 26083639 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | AV137 | 1-(2,2-dimethylpropanoyl)-N-[4-(2-oxopyrrolidin-1-yl)phenyl]piperidine-4-carboxamide | CC(C)(C)C(=O)N1CCC(CC1)C(=O)Nc2ccc(cc2)N3CCCC3=O | Non beta lactone inhibitor (AV170 derivative) | 0-5% at 10 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002264 | 26083639 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | ML16 | Methyl 4-((3-(3,5-dimethoxy-4-(prop-2-yn-1-yloxy)phenyl)propanoyl)oxy)benzoate | COC(=O)c1ccc(OC(=O)CCc2cc(OC)c(OCC#C)c(OC)c2)cc1 | Non beta lactone inhibitor (AV170 derivative) | 0-5% at 10 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002265 | 26083639 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | ML21 | Methyl 4-(2-(3,4,5-trimethoxyphenyl)acetoxy)benzoate | COC(=O)c1ccc(OC(=O)Cc2cc(OC)c(OC)c(OC)c2)cc1 | Non beta lactone inhibitor (AV170 derivative) | 75% at 1 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002266 | 26083639 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | ML33 | Methyl 4-((3-(1H-indol-3-yl)propanoyl)oxy)benzoate | COC(=O)c1ccc(OC(=O)CCc2c[nH]c3ccccc23)cc1 | Non beta lactone inhibitor (AV170 derivative) | 70% at 1 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002267 | 26083639 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | ML03 | Isopropyl 4-((3-(3,4,5-trimethoxyphenyl)propanoyl)oxy)benzoate | COc1cc(CCC(=O)Oc2ccc(cc2)C(=O)OC(C)C)cc(OC)c1OC | Non beta lactone inhibitor (AV170 derivative) | 60% at 1 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002268 | 26083639 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | ML23 | methyl 3-{[3-(3,4,5-trimethoxyphenyl)propanoyl]oxy}benzoate | COC(=O)c1cccc(OC(=O)CCc2cc(OC)c(OC)c(OC)c2)c1 | Non beta lactone inhibitor (AV170 derivative) | 55% at 1 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002269 | 26083639 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | MLIH18 | 4-(5-methyl-1,2,4-oxadiazol-3-yl)phenyl 3-(3,4,5-trimethoxyphenyl)propanoate | COc1cc(CCC(=O)Oc2ccc(cc2)c3noc(C)n3)cc(OC)c1OC | Non beta lactone inhibitor (AV170 derivative) | 50% at 1 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002270 | 26083639 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | ML14 | Butyl 3-(3,4,5-trimethoxyphenyl)propanoate | CCCCOC(=O)CCc1cc(OC)c(OC)c(OC)c1 | Non beta lactone inhibitor (AV170 derivative) | 50% at 1 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002271 | 26083639 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | ML27 | 4-acetylphenyl 3-(3,4,5-trimethoxyphenyl)propanoate | COc1cc(CCC(=O)Oc2ccc(cc2)C(C)=O)cc(OC)c1OC | Non beta lactone inhibitor (AV170 derivative) | 45% at 1 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002272 | 26083639 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | MLIH19 | 4-(5-methyl-1,3,4-oxadiazol-2-yl)phenyl 3-(3,4,5-trimethoxyphenyl)propanoate | COc1cc(CCC(=O)Oc2ccc(cc2)c3oc(C)nn3)cc(OC)c1OC | Non beta lactone inhibitor (AV170 derivative) | 35% at 1 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002273 | 26083639 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | ML25 | 4-formylphenyl 3-(3,4,5-trimethoxyphenyl)propanoate | COc1cc(CCC(=O)Oc2ccc(C=O)cc2)cc(OC)c1OC | Non beta lactone inhibitor (AV170 derivative) | 30% at 1 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002274 | 26083639 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | ML05 | 4-Methoxyphenyl 3-(3,4,5-trimethoxyphenyl)propanoate | COc1ccc(OC(=O)CCc2cc(OC)c(OC)c(OC)c2)cc1 | Non beta lactone inhibitor (AV170 derivative) | 15% at 1 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002275 | 26083639 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | ML06 | Phenyl 3-(3,4,5-trimethoxyphenyl)propanoate | COc1cc(CCC(=O)Oc2ccccc2)cc(OC)c1OC | Non beta lactone inhibitor (AV170 derivative) | 10% at 1 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002276 | 26083639 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | ML28 | 4-(Dimethylamino)phenyl 3-(3,4,5-trimethoxyphenyl)propanoate | COc1cc(CCC(=O)Oc2ccc(cc2)N(C)C)cc(OC)c1OC | Non beta lactone inhibitor (AV170 derivative) | 10% at 1 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002277 | 26083639 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | ML92 | Methyl 4-((3-(3,4-dimethoxyphenyl)propanoyl)oxy)benzoate | COC(=O)c1ccc(OC(=O)CCc2ccc(OC)c(OC)c2)cc1 | Non beta lactone inhibitor (AV170 derivative) | 10% at 1 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002278 | 26083639 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | ML57 | Methyl 4-((3-(3-acetylphenyl)propanoyl)oxy)benzoate | COC(=O)c1ccc(OC(=O)CCc2cccc(c2)C(C)=O)cc1 | Non beta lactone inhibitor (AV170 derivative) | 10% at 1 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002279 | 26083639 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | ML09 | Cyclohexyl 3-(3,4,5-trimethoxyphenyl)propanoate | COc1cc(CCC(=O)OC2CCCCC2)cc(OC)c1OC | Non beta lactone inhibitor (AV170 derivative) | 10% at 1 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002280 | 26083639 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | ML18 | 4-((3-(3,4,5-trimethoxyphenyl)propanoyl)oxy)benzoic acid | COc1cc(CCC(=O)Oc2ccc(cc2)C(O)=O)cc(OC)c1OC | Non beta lactone inhibitor (AV170 derivative) | 10% at 1 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002281 | 26083639 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | ML20 | Methyl 4-(((3,4,5-trimethoxybenzyl)carbamoyl)oxy)benzoate | COC(=O)c1ccc(OC(=O)NCc2cc(OC)c(OC)c(OC)c2)cc1 | Non beta lactone inhibitor (AV170 derivative) | 5% at 1 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002282 | 26083639 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | ML68 | methyl 4-{[3-(thiophen-2-yl)propanoyl]oxy}benzoate | COC(=O)C1=CC=C(OC(=O)CCC2=CC=CS2)C=C1 | Non beta lactone inhibitor (AV170 derivative) | 0-5% at 1 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002283 | 26083639 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | AV134 | 1-(2,2-dimethylpropanoyl)-N-[4-(2-oxopyrrolidin-1-yl)phenyl]piperidine-4-sulfonamide | CC(C)(C)C(=O)N1CCC(CC1)S(=O)(=O)NC1=CC=C(C=C1)N1CCCC1=O | Non beta lactone inhibitor (AV170 derivative) | 0-5% at 1 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002284 | 26083639 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | ML31 | Methyl 4-(hept-6-ynoyloxy)benzoate | COC(=O)c1ccc(OC(=O)CCCCC#C)cc1 | Non beta lactone inhibitor (AV170 derivative) | 0-5% at 1 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002285 | 26083639 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | ML24 | 2-acetylphenyl 3-(3,4,5-trimethoxyphenyl)propanoate | COc1cc(CCC(=O)Oc2ccccc2C(C)=O)cc(OC)c1OC | Non beta lactone inhibitor (AV170 derivative) | 0-5% at 1 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002286 | 26083639 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | ML30 | Methyl 4-(undec-10-ynoyloxy)benzoate | COC(=O)c1ccc(OC(=O)CCCCCCCCC#C)cc1 | Non beta lactone inhibitor (AV170 derivative) | 0-5% at 1 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002287 | 26083639 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | ML74 | 4-(Methoxycarbonyl)phenyl 3,4,5-trimethoxybenzoate | COC(=O)c1ccc(OC(=O)c2cc(OC)c(OC)c(OC)c2)cc1 | Non beta lactone inhibitor (AV170 derivative) | 0-5% at 1 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002288 | 26083639 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | ML12 | 4-Nitrophenyl 3-(3,4,5-trimethoxyphenyl)propanoate | COc1cc(CCC(=O)Oc2ccc(cc2)[N+]([O-])=O)cc(OC)c1OC | Non beta lactone inhibitor (AV170 derivative) | 0-5% at 1 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002289 | 26083639 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | AV137 | 1-(2,2-dimethylpropanoyl)-N-[4-(2-oxopyrrolidin-1-yl)phenyl]piperidine-4-carboxamide | CC(C)(C)C(=O)N1CCC(CC1)C(=O)Nc2ccc(cc2)N3CCCC3=O | Non beta lactone inhibitor (AV170 derivative) | 0-5% at 1 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002290 | 26083639 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | ML73 | Methyl 4-((2-(3,4,5-trimethoxybenzyl)acryloyl)oxy)benzoate | COC(=O)c1ccc(OC(=O)C(=C)Cc2cc(OC)c(OC)c(OC)c2)cc1 | Non beta lactone inhibitor (AV170 derivative) | 0-5% at 1 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002291 | 26083639 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | ML91 | Methyl (E)-4-((3-(3,4,5-trimethoxyphenyl)acryloyl)oxy)benzoate | COC(=O)c1ccc(OC(=O)/C=C/c2cc(OC)c(OC)c(OC)c2)cc1 | Non beta lactone inhibitor (AV170 derivative) | 95% at 100 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002292 | 26083639 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | ML43 | Methyl 4-((2-methyl-3-(3,4,5-trimethoxyphenyl)propanoyl)oxy)benzoate | COC(=O)c1ccc(OC(=O)C(C)Cc2cc(OC)c(OC)c(OC)c2)cc1 | Non beta lactone inhibitor (AV170 derivative) | 100% at 100 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002293 | 26083639 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | ML38 | Methyl (E)-4-((2-methyl-3-(3,4,5-trimethoxyphenyl)acryloyl)oxy)benzoate | COC(=O)c1ccc(OC(=O)C(/C)=C/c2cc(OC)c(OC)c(OC)c2)cc1 | Non beta lactone inhibitor (AV170 derivative) | 90% at 100 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002294 | 26083639 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | ML37 | Methyl 3-methyl-4-((3-(3,4,5-trimethoxyphenyl)propanoyl)oxy)benzoate | COC(=O)c1ccc(OC(=O)CCc2cc(OC)c(OC)c(OC)c2)c(C)c1 | Non beta lactone inhibitor (AV170 derivative) | 20% at 100 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002295 | 26083639 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | ML15 | Methyl 3,5-dimethyl-4-((3-(3,4,5-trimethoxyphenyl)propanoyl)oxy)benzoate | COC(=O)c1cc(C)c(OC(=O)CCc2cc(OC)c(OC)c(OC)c2)c(C)c1 | Non beta lactone inhibitor (AV170 derivative) | 0-5% at 100 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002296 | 26083639 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | ML89 | Methyl (R)-4-((2-methyl-3-(3,4,5-trimethoxyphenyl)propanoyl)oxy)benzoate | COC(=O)c1ccc(OC(=O)[C@H](C)Cc2cc(OC)c(OC)c(OC)c2)cc1 | Non beta lactone inhibitor (AV170 derivative) | 0-5% at 100 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002297 | 26083639 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | ML90 | Methyl (S)-4-((2-methyl-3-(3,4,5-trimethoxyphenyl)propanoyl)oxy)benzoate | COC(=O)c1ccc(OC(=O)[C@@H](C)Cc2cc(OC)c(OC)c(OC)c2)cc1 | Non beta lactone inhibitor (AV170 derivative) | 0-5% at 100 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002298 | 26083639 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | ML95 | Methyl (R)-4-((2-(3,4,5-trimethoxybenzyl)butanoyl)oxy)benzoate | CC[C@H](Cc1cc(OC)c(OC)c(OC)c1)C(=O)Oc2ccc(cc2)C(=O)OC | Non beta lactone inhibitor (AV170 derivative) | 55% at 100 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002299 | 26083639 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | ML96 | Methyl (S)-4-((2-(3,4,5-trimethoxybenzyl)butanoyl)oxy)benzoate | CC[C@@H](Cc1cc(OC)c(OC)c(OC)c1)C(=O)Oc2ccc(cc2)C(=O)OC | Non beta lactone inhibitor (AV170 derivative) | 10% at 100 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002300 | 26083639 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | ML73 | Methyl 4-((2-(3,4,5-trimethoxybenzyl)acryloyl)oxy)benzoate | COC(=O)c1ccc(OC(=O)C(=C)Cc2cc(OC)c(OC)c(OC)c2)cc1 | Non beta lactone inhibitor (AV170 derivative) | 90% at 10 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002301 | 26083639 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | ML91 | Methyl (E)-4-((3-(3,4,5-trimethoxyphenyl)acryloyl)oxy)benzoate | COC(=O)c1ccc(OC(=O)/C=C/c2cc(OC)c(OC)c(OC)c2)cc1 | Non beta lactone inhibitor (AV170 derivative) | 95% at 10 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002302 | 26083639 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | ML43 | Methyl 4-((2-methyl-3-(3,4,5-trimethoxyphenyl)propanoyl)oxy)benzoate | COC(=O)c1ccc(OC(=O)C(C)Cc2cc(OC)c(OC)c(OC)c2)cc1 | Non beta lactone inhibitor (AV170 derivative) | 95% at 10 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002303 | 26083639 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | ML38 | Methyl (E)-4-((2-methyl-3-(3,4,5-trimethoxyphenyl)acryloyl)oxy)benzoate | COC(=O)c1ccc(OC(=O)C(/C)=C/c2cc(OC)c(OC)c(OC)c2)cc1 | Non beta lactone inhibitor (AV170 derivative) | 70% at 10 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002304 | 26083639 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | ML37 | Methyl 3-methyl-4-((3-(3,4,5-trimethoxyphenyl)propanoyl)oxy)benzoate | COC(=O)c1ccc(OC(=O)CCc2cc(OC)c(OC)c(OC)c2)c(C)c1 | Non beta lactone inhibitor (AV170 derivative) | 0-5% at 10 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002305 | 26083639 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | ML15 | Methyl 3,5-dimethyl-4-((3-(3,4,5-trimethoxyphenyl)propanoyl)oxy)benzoate | COC(=O)c1cc(C)c(OC(=O)CCc2cc(OC)c(OC)c(OC)c2)c(C)c1 | Non beta lactone inhibitor (AV170 derivative) | 0-5% at 10 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002306 | 26083639 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | ML89 | Methyl (R)-4-((2-methyl-3-(3,4,5-trimethoxyphenyl)propanoyl)oxy)benzoate | COC(=O)c1ccc(OC(=O)[C@H](C)Cc2cc(OC)c(OC)c(OC)c2)cc1 | Non beta lactone inhibitor (AV170 derivative) | 90% at 10 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002307 | 26083639 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | ML90 | Methyl (S)-4-((2-methyl-3-(3,4,5-trimethoxyphenyl)propanoyl)oxy)benzoate | COC(=O)c1ccc(OC(=O)[C@@H](C)Cc2cc(OC)c(OC)c(OC)c2)cc1 | Non beta lactone inhibitor (AV170 derivative) | 60% at 10 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002308 | 26083639 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | ML95 | Methyl (R)-4-((2-(3,4,5-trimethoxybenzyl)butanoyl)oxy)benzoate | CC[C@H](Cc1cc(OC)c(OC)c(OC)c1)C(=O)Oc2ccc(cc2)C(=O)OC | Non beta lactone inhibitor (AV170 derivative) | 10% at 10 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002309 | 26083639 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | ML96 | Methyl (S)-4-((2-(3,4,5-trimethoxybenzyl)butanoyl)oxy)benzoate | CC[C@@H](Cc1cc(OC)c(OC)c(OC)c1)C(=O)Oc2ccc(cc2)C(=O)OC | Non beta lactone inhibitor (AV170 derivative) | 5% at 10 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002310 | 26083639 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | ML73 | Methyl 4-((2-(3,4,5-trimethoxybenzyl)acryloyl)oxy)benzoate | COC(=O)c1ccc(OC(=O)C(=C)Cc2cc(OC)c(OC)c(OC)c2)cc1 | Non beta lactone inhibitor (AV170 derivative) | 60% at 1 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002311 | 26083639 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | ML91 | Methyl (E)-4-((3-(3,4,5-trimethoxyphenyl)acryloyl)oxy)benzoate | COC(=O)c1ccc(OC(=O)/C=C/c2cc(OC)c(OC)c(OC)c2)cc1 | Non beta lactone inhibitor (AV170 derivative) | 20% at 1 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002312 | 26083639 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | ML43 | Methyl 4-((2-methyl-3-(3,4,5-trimethoxyphenyl)propanoyl)oxy)benzoate | COC(=O)c1ccc(OC(=O)C(C)Cc2cc(OC)c(OC)c(OC)c2)cc1 | Non beta lactone inhibitor (AV170 derivative) | 15% at 1 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002313 | 26083639 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | ML38 | Methyl (E)-4-((2-methyl-3-(3,4,5-trimethoxyphenyl)acryloyl)oxy)benzoate | COC(=O)c1ccc(OC(=O)C(/C)=C/c2cc(OC)c(OC)c(OC)c2)cc1 | Non beta lactone inhibitor (AV170 derivative) | 10% at 1 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002314 | 26083639 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | ML37 | Methyl 3,5-dimethyl-4-((3-(3,4,5-trimethoxyphenyl)propanoyl)oxy)benzoate | COC(=O)c1cc(C)c(OC(=O)CCc2cc(OC)c(OC)c(OC)c2)c(C)c1 | Non beta lactone inhibitor (AV170 derivative) | 0-5% at 1 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002315 | 26083639 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | ML15 | Methyl (R)-4-((2-methyl-3-(3,4,5-trimethoxyphenyl)propanoyl)oxy)benzoate | COC(=O)c1ccc(OC(=O)[C@H](C)Cc2cc(OC)c(OC)c(OC)c2)cc1 | Non beta lactone inhibitor (AV170 derivative) | 0-5% at 1 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002316 | 26083639 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | ML89 | Methyl (S)-4-((2-methyl-3-(3,4,5-trimethoxyphenyl)propanoyl)oxy)benzoate | COC(=O)c1ccc(OC(=O)[C@@H](C)Cc2cc(OC)c(OC)c(OC)c2)cc1 | Non beta lactone inhibitor (AV170 derivative) | 20% at 1 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002317 | 26083639 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | ML90 | Methyl (R)-4-((2-(3,4,5-trimethoxybenzyl)butanoyl)oxy)benzoate | CC[C@H](Cc1cc(OC)c(OC)c(OC)c1)C(=O)Oc2ccc(cc2)C(=O)OC | Non beta lactone inhibitor (AV170 derivative) | 15% at 1 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002318 | 26083639 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | ML95 | Methyl (S)-4-((2-(3,4,5-trimethoxybenzyl)butanoyl)oxy)benzoate | CC[C@@H](Cc1cc(OC)c(OC)c(OC)c1)C(=O)Oc2ccc(cc2)C(=O)OC | Non beta lactone inhibitor (AV170 derivative) | 0-5% at 1 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002319 | 26083639 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | ML96 | Methyl (S)-4-((2-(3,4,5-trimethoxybenzyl)butanoyl)oxy)benzoate | CC[C@@H](Cc1cc(OC)c(OC)c(OC)c1)C(=O)Oc2ccc(cc2)C(=O)OC | Non beta lactone inhibitor (AV170 derivative) | 0-5% at 1 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002320 | 26083639 | Hsp100 | NA | Human | NA | NA | Antiproliferative activity | AV170 | methyl 4-{[3-(3,4,5-trimethoxyphenyl)propanoyl]oxy}benzoate | COC(=O)c1ccc(OC(=O)CCc2cc(OC)c(OC)c(OC)c2)cc1 | Non beta lactone inhibitor (AV170 derivative) | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | 10 | MTT viability assay |
HSPMDB002321 | 26083639 | Hsp100 | NA | Human | NA | NA | Antiproliferative activity | ML21 | methyl 4-{[2-(3,4,5-trimethoxyphenyl)acetyl]oxy}benzoate | COC(=O)c1ccc(OC(=O)Cc2cc(OC)c(OC)c(OC)c2)cc1 | Non beta lactone inhibitor (AV170 derivative) | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | 10 | MTT viability assay |
HSPMDB002322 | 26083639 | Hsp100 | NA | Human | NA | NA | Antiproliferative activity | ML89 | Methyl (R)-4-((2-methyl-3-(3,4,5-trimethoxyphenyl)propanoyl)oxy)benzoate | COC(=O)c1ccc(OC(=O)[C@H](C)Cc2cc(OC)c(OC)c(OC)c2)cc1 | Non beta lactone inhibitor (AV170 derivative) | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | 10 | MTT viability assay |
HSPMDB002323 | 26083639 | Hsp100 | NA | Human | NA | NA | Antiproliferative activity | ML90 | Methyl (S)-4-((2-methyl-3-(3,4,5-trimethoxyphenyl)propanoyl)oxy)benzoate | COC(=O)c1ccc(OC(=O)[C@@H](C)Cc2cc(OC)c(OC)c(OC)c2)cc1 | Non beta lactone inhibitor (AV170 derivative) | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | 5-Oct | MTT viability assay |
HSPMDB002324 | 26566002 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | AV145 | N-(2-(Thien-2-yl)oxazol-4-yl)methyl 1-Isopropyl-1H-pyrazolo[3,4-b]pyridine-5- carboxamide | CC(C)n1ncc2cc(cnc12)C(=O)NCc3coc(n3)c4sccc4 | COMAS Library | NA | NA | NA | 10 | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002325 | 26566002 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | AV280 | N-(2-(Thien-2-yl)oxazol-4-yl)methyl 1-(3,4-dimethylbenzyl)-1H-pyrazolo[3,4-b]pyridine5-carboxamide (AV280) | Cc1ccc(Cn2ncc3cc(cnc23)C(=O)NCc4coc(n4)c5sccc5)cc1C | COMAS Library | NA | NA | NA | 1.8 | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002326 | 26566002 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | AV191 | N-(2-(Thien-2-yl)oxazol-4-yl)methyl 1-Benzyl-1H-pyrazolo[3,4-b]pyridine-5- carboxamide | O=C(NCc1coc(n1)c2sccc2)c3cnc4n(Cc5ccccc5)ncc4c3 | COMAS Library | NA | NA | NA | 2 | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002327 | 26566002 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | AV267 | N-(2-(Thien-2-yl)oxazol-4-yl)methyl 1-(4-Methoxybenzyl)-1H-pyrazolo[3,4-b]pyridine-5- carboxamide | COc1ccc(Cn2ncc3cc(cnc23)C(=O)NCc4coc(n4)c5sccc5)cc1 | COMAS Library | NA | NA | NA | 2.2 | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002328 | 26566002 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | AV261 | N-(2-(Thien-2-yl)oxazol-4-yl)methyl 1-(2-Phenethyl)-1H-pyrazolo[3,4-b]pyridine-5- carboxamide | CCc1ccccc1n2ncc3cc(cnc23)C(=O)NCc4coc(n4)c5sccc5 | COMAS Library | NA | NA | NA | 2.3 | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002329 | 26566002 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | AV253 | N-(2-(Thien-2-yl)oxazol-4-yl)methyl 1-(4-Methylbenzyl)-1H-pyrazolo[3,4-b]pyridine-5- carboxamide | Cc1ccc(Cn2ncc3cc(cnc23)C(=O)NCc4coc(n4)c5sccc5)cc1 | COMAS Library | NA | NA | NA | 2.4 | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002330 | 26566002 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | AV259 | N-(2-(Thien-2-yl)oxazol-4-yl)methyl 1-(3-Phenylpropyl)-1H-pyrazolo[3,4-b]pyridine-5- carboxamide | O=C(NCc1coc(n1)c2sccc2)c3cnc4n(CCCc5ccccc5)ncc4c3 | COMAS Library | NA | NA | NA | 3 | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002331 | 26566002 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | AV268 | N-(2-(Thien-2-yl)oxazol-4-yl)methyl 1-(3-Methylbenzyl)-1H-pyrazolo[3,4-b]pyridine-5- carboxamide | Cc1cccc(Cn2ncc3cc(cnc23)C(=O)NCc4coc(n4)c5sccc5)c1 | COMAS Library | NA | NA | NA | 3.8 | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002332 | 26566002 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | AV264 | N-(2-(Thien-2-yl)oxazol-4-yl)methyl 1-(3-Cyanobenzyl)-1H-pyrazolo[3,4-b]pyridine-5- carboxamide | O=C(NCc1coc(n1)c2sccc2)c3cnc4n(Cc5cccc(c5)C#N)ncc4c3 | COMAS Library | NA | NA | NA | 4 | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002333 | 26566002 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | AV266 | N-(2-(Thien-2-yl)oxazol-4-yl)methyl 1-(3-Methoxybenzyl)-1H-pyrazolo[3,4-b]pyridine-5- carboxamide | COc1cccc(Cn2ncc3cc(cnc23)C(=O)NCc4coc(n4)c5sccc5)c1 | COMAS Library | NA | NA | NA | 4.4 | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002334 | 26566002 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | AV265 | N-(2-(Thien-2-yl)oxazol-4-yl)methyl 1-(4-Cyanobenzyl)-1H-pyrazolo[3,4-b]pyridine-5- carboxamide | O=C(NCc1coc(n1)c2sccc2)c3cnc4n(Cc5ccc(cc5)C#N)ncc4c3 | COMAS Library | NA | NA | NA | 5 | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002335 | 26566002 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | AV279 | N-(2-(Thien-2-yl)oxazol-4-yl)methyl 1-(4-Isopropylbenzyl)-1H-pyrazolo[3,4-b]pyridine5-carboxamide | CC(C)c1ccc(Cn2ncc3cc(cnc23)C(=O)NCc4coc(n4)c5sccc5)cc1 | COMAS Library | NA | NA | NA | 5.1 | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002336 | 26566002 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | AV145 | N-(2-(Thien-2-yl)oxazol-4-yl)methyl 1-Isopropyl-1H-pyrazolo[3,4-b]pyridine-5- carboxamide | CC(C)n1ncc2cc(cnc12)C(=O)NCc3coc(n3)c4sccc4 | COMAS Library | NA | NA | NA | 10 | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002337 | 26566002 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | AV286 | N-(2-(Thien-2-yl)oxazol-4-yl)methyl 4-(benzylaminocarbonylamino)benzamide | O=C(NCc1ccccc1)Nc2ccc(cc2)C(=O)NCc3coc(n3)c4sccc4 | COMAS Library | NA | NA | NA | 0.9 | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002338 | 26566002 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | AV241 | N-(2-(Thien-2-yl)oxazol-4-yl)methyl 4-(tert-butyloxycarbonylamino)benzamide | CC(C)(C)OC(=O)Nc1ccc(cc1)C(=O)NCc2coc(n2)c3sccc3 | COMAS Library | NA | NA | NA | 1.8 | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002339 | 26566002 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | AV285 | N-(2-(Thien-2-yl)oxazol-4-yl)methyl 4-(benzyloxycarbonylamino)benzamide | O=C(Nc1ccc(cc1)C(=O)NCc2coc(n2)c3sccc3)OCc4ccccc4 | COMAS Library | NA | NA | NA | 2.1 | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002340 | 26566002 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | AV236 | 4-(4-ethoxybenzenesulfonamido)-N-{[2-(thiophen-2-yl)-1,3-oxazol-4-yl]methyl}benzamide | CCOc1ccc(cc1)[S](=O)(=O)Nc2ccc(cc2)C(=O)NCc3coc(n3)c4sccc4 | COMAS Library | NA | NA | NA | 4 | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002341 | 26566002 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | AV243 | 4-(cyclopropylsulfamoyl)-N-{[2-(thiophen-2-yl)-1,3-oxazol-4-yl]methyl}benzamide | O=C(NCc1coc(n1)c2sccc2)c3ccc(cc3)[S](=O)(=O)NC4CC4 | COMAS Library | NA | NA | NA | 5.9 | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002342 | 26566002 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | AV224 | 4-(dimethylsulfamoyl)-N-{[2-(thiophen-2-yl)-1,3-oxazol-4-yl]methyl}benzamide | CN(C)[S](=O)(=O)c1ccc(cc1)C(=O)NCc2coc(n2)c3sccc3 | COMAS Library | NA | NA | NA | 6 | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002343 | 26566002 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | AV245 | 4-methanesulfonamido-N-{[2-(thiophen-2-yl)-1,3-oxazol-4-yl]methyl}benzamide | C[S](=O)(=O)Nc1ccc(cc1)C(=O)NCc2coc(n2)c3sccc3 | COMAS Library | NA | NA | NA | 8 | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002344 | 26566002 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | AV235 | 4-Acetamido-N-((2-(thiophen-2-yl)oxazol-4-yl)methyl)benzamide | CC(=O)Nc1ccc(cc1)C(=O)NCc2coc(n2)c3sccc3 | COMAS Library | NA | NA | NA | 9.5 | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002345 | 26566002 | Hsp100 | ClpXP | Bacteria | Cytosol | Inhibition of protease activity | NA | AV145 | N-(2-(Thien-2-yl)oxazol-4-yl)methyl 1-Isopropyl-1H-pyrazolo[3,4-b]pyridine-5- carboxamide | CC(C)n1ncc2cc(cnc12)C(=O)NCc3coc(n3)c4sccc4 | COMAS Library | 98% at 100 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Substrate degradation assay (GFP-ssrA) | NA | NA |
HSPMDB002346 | 26566002 | Hsp100 | ClpXP | Bacteria | Cytosol | Inhibition of protease activity | NA | AV280 | N-(2-(Thien-2-yl)oxazol-4-yl)methyl 1-(3,4-dimethylbenzyl)-1H-pyrazolo[3,4-b]pyridine5-carboxamide (AV280) | Cc1ccc(Cn2ncc3cc(cnc23)C(=O)NCc4coc(n4)c5sccc5)cc1C | COMAS Library | 90% at 100 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Substrate degradation assay (GFP-ssrA) | NA | NA |
HSPMDB002347 | 26566002 | Hsp100 | ClpXP | Bacteria | Cytosol | Inhibition of protease activity | NA | AV286 | N-(2-(Thien-2-yl)oxazol-4-yl)methyl 4-(benzylaminocarbonylamino)benzamide | O=C(NCc1ccccc1)Nc2ccc(cc2)C(=O)NCc3coc(n3)c4sccc4 | COMAS Library | 55% at 100 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Substrate degradation assay (GFP-ssrA) | NA | NA |
HSPMDB002348 | 26566002 | Hsp100 | ClpXP | Bacteria | Cytosol | Inhibition of protease activity | NA | AV321 | N-(2-(Thien-2-yl)oxazol-4-yl)methyl 4-(2-(3-(But-3-ynyl)-3H-diazirin-3- yl)ethyloxycarbonylamino)benzamide | O=C(Nc1ccc(cc1)C(=O)NCc2coc(n2)c3sccc3)OCCC4(CCC#C)N=N4 | COMAS Library | 85% at 100 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Substrate degradation assay (GFP-ssrA) | NA | NA |
HSPMDB002349 | 26566002 | Hsp100 | ClpXP | Bacteria | Cytosol | Inhibition of protease activity | NA | AV286 | N-(2-(Thien-2-yl)oxazol-4-yl)methyl 4-(benzylaminocarbonylamino)benzamide | O=C(NCc1ccccc1)Nc2ccc(cc2)C(=O)NCc3coc(n3)c4sccc4 | COMAS Library | NA | NA | NA | 2.1 | NA | NA | NA | NA | Nucleotide binding domain | Substrate degradation assay (GFP-ssrA) | NA | NA |
HSPMDB002350 | 26566002 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of protease activity | NA | AV287 | N-[2-(1H-1,3-benzodiazol-2-yl)ethyl]-4-(dimethylsulfamoyl)benzamide | CN(C)S(=O)(=O)C1=CC=C(C=C1)C(=O)NCCC1=NC2=C(N1)C=CC=C2 | COMAS Library | NA | NA | NA | 10.1 | NA | NA | NA | NA | Nucleotide binding domain | Substrate degradation assay (FITC-casein) | NA | NA |
HSPMDB002351 | 26566002 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of protease activity | NA | AV287 | N-[2-(1H-1,3-benzodiazol-2-yl)ethyl]-4-(dimethylsulfamoyl)benzamide | CN(C)S(=O)(=O)C1=CC=C(C=C1)C(=O)NCCC1=NC2=C(N1)C=CC=C3 | COMAS Library | NA | NA | NA | 21.1 | NA | NA | NA | NA | Nucleotide binding domain | Substrate degradation assay (FITC-casein) | NA | NA |
HSPMDB002352 | 26566002 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of protease activity | NA | AV287 | N-[2-(1H-1,3-benzodiazol-2-yl)ethyl]-4-(dimethylsulfamoyl)benzamide | CN(C)S(=O)(=O)C1=CC=C(C=C1)C(=O)NCCC1=NC2=C(N1)C=CC=C4 | COMAS Library | NA | NA | NA | 51.2 | NA | NA | NA | NA | Nucleotide binding domain | Substrate degradation assay (FITC-casein) | NA | NA |
HSPMDB002353 | 26566002 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of protease activity | NA | AV287 | N-[2-(1H-1,3-benzodiazol-2-yl)ethyl]-4-(dimethylsulfamoyl)benzamide | CN(C)S(=O)(=O)C1=CC=C(C=C1)C(=O)NCCC1=NC2=C(N1)C=CC=C5 | COMAS Library | NA | NA | NA | 78.1 | NA | NA | NA | NA | Nucleotide binding domain | Substrate degradation assay (FITC-casein) | NA | NA |
HSPMDB002354 | 26566002 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of protease activity | NA | AV287 | N-[2-(1H-1,3-benzodiazol-2-yl)ethyl]-4-(dimethylsulfamoyl)benzamide | CN(C)S(=O)(=O)C1=CC=C(C=C1)C(=O)NCCC1=NC2=C(N1)C=CC=C6 | COMAS Library | NA | NA | NA | >95 | NA | NA | NA | NA | Nucleotide binding domain | Substrate degradation assay (FITC-casein) | NA | NA |
HSPMDB002355 | 25944857 | Hsp100 | ClpP1P2 | Human | Cytosol | NA | Antibacterial activity | 100, (Bortezomib) | [(1R)-3-methyl-1-[[(2S)-3-phenyl-2-(pyrazine-2-carbonylamino)propanoyl]amino]butyl]boronic acid | B(C(CC(C)C)NC(=O)C(CC1=CC=CC=C1)NC(=O)C2=NC=CN=C2)(O)O | PHARMAKON1600 library | NA | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | NA | 90% at 50 uM | Bacterial growth inhibition assay (OD based) |
HSPMDB002356 | 25944857 | Hsp100 | ClpP1P2 | Bacteria | Cytosol | NA | Antibacterial activity | 100, (Bortezomib) | [(1R)-3-methyl-1-[[(2S)-3-phenyl-2-(pyrazine-2-carbonylamino)propanoyl]amino]butyl]boronic acid | B(C(CC(C)C)NC(=O)C(CC1=CC=CC=C1)NC(=O)C2=NC=CN=C2)(O)O | PHARMAKON1600 library | NA | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | NA | 90% at 3 uM | Bacterial growth inhibition assay (OD based) |
HSPMDB002357 | 25944857 | Hsp100 | ClpP1P2 | Bacteria | Cytosol | NA | Antibacterial activity | 100, (Bortezomib) | [(1R)-3-methyl-1-[[(2S)-3-phenyl-2-(pyrazine-2-carbonylamino)propanoyl]amino]butyl]boronic acid | B(C(CC(C)C)NC(=O)C(CC1=CC=CC=C1)NC(=O)C2=NC=CN=C2)(O)O | PHARMAKON1600 library | NA | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | NA | 30% | Bacterial growth inhibition assay (OD based) |
HSPMDB002358 | 25944857 | Hsp100 | ClpP1P2 | Bacteria | Cytosol | NA | Antibacterial activity | 100, (Bortezomib) + Amikacin | [(1R)-3-methyl-1-[[(2S)-3-phenyl-2-(pyrazine-2-carbonylamino)propanoyl]amino]butyl]boronic acid | B(C(CC(C)C)NC(=O)C(CC1=CC=CC=C1)NC(=O)C2=NC=CN=C2)(O)O | PHARMAKON1600 library | NA | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | NA | 90% | Bacterial growth inhibition assay (OD based) |
HSPMDB002359 | 25944857 | Hsp100 | ClpP1P2 | Bacteria | Cytosol | NA | Antibacterial activity | 100, (Bortezomib) + streptomycin | [(1R)-3-methyl-1-[[(2S)-3-phenyl-2-(pyrazine-2-carbonylamino)propanoyl]amino]butyl]boronic acid | B(C(CC(C)C)NC(=O)C(CC1=CC=CC=C1)NC(=O)C2=NC=CN=C2)(O)O | PHARMAKON1600 library | NA | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | NA | 95% | Bacterial growth inhibition assay (OD based) |
HSPMDB002360 | 25944857 | Hsp100 | ClpP1P2 | Bacteria | Cytosol | NA | Antibacterial activity | Bz-al | (2S)-N-[(2S)-4-methyl-1-oxopentan-2-yl]-3-phenyl-2-[(pyrazin-2-yl)formamido]propanamide | CC(C)C[C@H](NC(=O)[C@H](CC1=CC=CC=C1)NC(=O)C1=NC=CN=C1)C=O | Bortezomib derivative | NA | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | NA | 5% at 50 uM | Bacterial growth inhibition assay (OD based) |
HSPMDB002361 | 25944857 | Hsp100 | ClpP1P2 | Bacteria | Cytosol | NA | Antibacterial activity | CEP-18770 (Delanzomib) | [(1R)-1-[[(2S,3R)-3-hydroxy-2-[(6-phenylpyridine-2-carbonyl)amino]butanoyl]amino]-3-methylbutyl]boronic acid | B(C(CC(C)C)NC(=O)C(C(C)O)NC(=O)C1=CC=CC(=N1)C2=CC=CC=C2)(O)O | Bortezomib derivative | NA | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | NA | 80% at 50 uM | Bacterial growth inhibition assay (OD based) |
HSPMDB002362 | 25944857 | Hsp100 | ClpP1P2 | Bacteria | Cytosol | NA | Antibacterial activity | MG-262 | [(1R)-3-methyl-1-[[(2S)-4-methyl-2-[[(2S)-4-methyl-2-(phenylmethoxycarbonylamino)pentanoyl]amino]pentanoyl]amino]butyl]boronic acid | B(C(CC(C)C)NC(=O)C(CC(C)C)NC(=O)C(CC(C)C)NC(=O)OCC1=CC=CC=C1)(O)O | Bortezomib derivative | NA | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | NA | 45% at 50 uM | Bacterial growth inhibition assay (OD based) |
HSPMDB002363 | 25944857 | Hsp100 | ClpP1P2 | Bacteria | Cytosol | NA | Antibacterial activity | MG-132 | benzyl N-[(2S)-4-methyl-1-[[(2S)-4-methyl-1-[[(2S)-4-methyl-1-oxopentan-2-yl]amino]-1-oxopentan-2-yl]amino]-1-oxopentan-2-yl]carbamate | CC(C)CC(C=O)NC(=O)C(CC(C)C)NC(=O)C(CC(C)C)NC(=O)OCC1=CC=CC=C1 | Bortezomib derivative | NA | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | NA | 10% at 50 uM | Bacterial growth inhibition assay (OD based) |
HSPMDB002364 | 25944857 | Hsp100 | ClpP1P2 | Bacteria | Cytosol | NA | Antibacterial activity | MLN-2238 (Ixazomib) | [(1R)-1-[[2-[(2,5-dichlorobenzoyl)amino]acetyl]amino]-3-methylbutyl]boronic acid | B(C(CC(C)C)NC(=O)CNC(=O)C1=C(C=CC(=C1)Cl)Cl)(O)O | Bortezomib derivative | NA | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | NA | 60% at 50 uM | Bacterial growth inhibition assay (OD based) |
HSPMDB002365 | 22123255 | Hsp100 | ClpP2 | Bacteria | Cytosol | NA | Antibacterial activity | IDR-10001 | 1-[(3,5-difluorophenyl)methyl]-1-[(2E)-hept-2-enoyl]-3-[(3S,9S,13S,19S,22R)-19-methyl-2,8,12,18,21-pentaoxo-11-oxa-7,17,20-triazatetracyclo[20.4.0.0³,?.0¹³,¹?]hexacosan-9-yl]urea | FC=1C=C(C=C(C1)F)CN(C(=O)N[C@@H]1C(N2CCC[C@H]2C(C2CCCC[C@H]2C(N[C@H](C(N2CCC[C@H]2C(OC1)=O)=O)C)=O)=O)=O)C(\C=C\CCCC)=O | Acyldepsipeptide analogue | NA | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | NA | NA | Bacterial growth inhibition assay (OD based) |
HSPMDB002366 | 22123255 | Hsp100 | ClpP2 | Bacteria | Cytosol | NA | Antibacterial activity | ADEP2 | 1-(3-cyclohexylpropanoyl)-1-[(3,5-difluorophenyl)methyl]-3-[(3S,9S,13S,15R,19S,22R)-15,19-dimethyl-2,8,12,18,21-pentaoxo-11-oxa-7,17,20-triazatetracyclo[20.4.0.0³,?.0¹³,¹?]hexacosan-9-yl]urea | C[C@@H]1C[C@@H]2N(C1)C(=O)[C@H](C)NC(=O)[C@@H]1CCCCC1C(=O)[C@@H]1CCCN1C(=O)[C@H](COC2=O)NC(=O)N(CC1=CC(F)=CC(F)=C1)C(=O)CCC1CCCCC1 | Acyldepsipeptide analogue | NA | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | NA | NA | Bacterial growth inhibition assay (OD based) |
HSPMDB002367 | 22123255 | Hsp100 | ClpP2 | Bacteria | Cytosol | NA | Antibacterial activity | ADEP3 | 1-(3-cyclohexylpropanoyl)-1-[(3,5-difluorophenyl)methyl]-3-[(3S,9S,13S,15R,19S,22R)-15,19-dimethyl-2,8,12,18,21-pentaoxo-11-oxa-7,17,20-triazatetracyclo[20.4.0.0³,?.0¹³,¹?]hexacosan-9-yl]urea | C[C@@H]1C[C@@H]2N(C1)C(=O)[C@H](C)NC(=O)[C@@H]1CCCCC1C(=O)[C@@H]1CCCN1C(=O)[C@H](COC2=O)NC(=O)N(CC1=CC(F)=CC(F)=C1)C(=O)CCC1CCCCC1 | Acyldepsipeptide analogue | NA | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | NA | NA | Bacterial growth inhibition assay (OD based) |
HSPMDB002368 | 22123255 | Hsp100 | ClpP2 | Bacteria | Cytosol | NA | Antibacterial activity | ADEP4 | 1-[(3,5-difluorophenyl)methyl]-3-[(3S,9S,13S,15R,19S,22R)-15,19-dimethyl-2,8,12,18,21-pentaoxo-11-oxa-7,17,20-triazatetracyclo[20.4.0.0³,?.0¹³,¹?]hexacosan-9-yl]-1-[(2E)-hept-2-enoyl]urea | CCCC\C=C\C(=O)N(CC1=CC(F)=CC(F)=C1)C(=O)N[C@H]1COC(=O)[C@@H]2C[C@@H](C)CN2C(=O)[C@H](C)NC(=O)[C@@H]2CCCCC2C(=O)[C@@H]2CCCN2C1=O | Acyldepsipeptide analogue | NA | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | NA | NA | Bacterial growth inhibition assay (OD based) |
HSPMDB002369 | 22123255 | Hsp100 | ClpP2 | Bacteria | Cytosol | NA | Antibacterial activity | IDR-10011 | 1-(3-cyclohexylpropanoyl)-1-[(3,5-difluorophenyl)methyl]-3-[(3S,9S,13S,19S,22R)-19-methyl-2,8,12,18,21-pentaoxo-11-oxa-7,17,20-triazatetracyclo[20.4.0.0³,?.0¹³,¹?]hexacosan-9-yl]urea | C[C@@H]1NC(=O)[C@@H]2CCCCC2C(=O)[C@@H]2CCCN2C(=O)[C@H](COC(=O)[C@@H]2CCCN2C1=O)NC(=O)N(CC1=CC(F)=CC(F)=C1)C(=O)CCC1CCCCC1 | Acyldepsipeptide analogue | NA | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | NA | NA | Bacterial growth inhibition assay (OD based) |
HSPMDB002370 | 22123255 | Hsp100 | ClpP2 | Bacteria | Cytosol | NA | Antibacterial activity | IDR-10001 | 1-[(3,5-difluorophenyl)methyl]-1-[(2E)-hept-2-enoyl]-3-[(3S,9S,13S,19S,22R)-19-methyl-2,8,12,18,21-pentaoxo-11-oxa-7,17,20-triazatetracyclo[20.4.0.0³,?.0¹³,¹?]hexacosan-9-yl]urea | FC=1C=C(C=C(C1)F)CN(C(=O)N[C@@H]1C(N2CCC[C@H]2C(C2CCCC[C@H]2C(N[C@H](C(N2CCC[C@H]2C(OC1)=O)=O)C)=O)=O)=O)C(\C=C\CCCC)=O | Acyldepsipeptide analogue | NA | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | NA | NA | Bacterial growth inhibition assay (OD based) |
HSPMDB002371 | 22123255 | Hsp100 | ClpP2 | Bacteria | Cytosol | NA | Antibacterial activity | ADEP2 | 1-(3-cyclohexylpropanoyl)-1-[(3,5-difluorophenyl)methyl]-3-[(3S,9S,13S,15R,19S,22R)-15,19-dimethyl-2,8,12,18,21-pentaoxo-11-oxa-7,17,20-triazatetracyclo[20.4.0.0³,?.0¹³,¹?]hexacosan-9-yl]urea | C[C@@H]1C[C@@H]2N(C1)C(=O)[C@H](C)NC(=O)[C@@H]1CCCCC1C(=O)[C@@H]1CCCN1C(=O)[C@H](COC2=O)NC(=O)N(CC1=CC(F)=CC(F)=C1)C(=O)CCC1CCCCC1 | Acyldepsipeptide analogue | NA | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | NA | NA | Bacterial growth inhibition assay (OD based) |
HSPMDB002372 | 22123255 | Hsp100 | ClpP2 | Bacteria | Cytosol | NA | Antibacterial activity | ADEP3 | 1-(3-cyclohexylpropanoyl)-1-[(3,5-difluorophenyl)methyl]-3-[(3S,9S,13S,15R,19S,22R)-15,19-dimethyl-2,8,12,18,21-pentaoxo-11-oxa-7,17,20-triazatetracyclo[20.4.0.0³,?.0¹³,¹?]hexacosan-9-yl]urea | C[C@@H]1C[C@@H]2N(C1)C(=O)[C@H](C)NC(=O)[C@@H]1CCCCC1C(=O)[C@@H]1CCCN1C(=O)[C@H](COC2=O)NC(=O)N(CC1=CC(F)=CC(F)=C1)C(=O)CCC1CCCCC1 | Acyldepsipeptide analogue | NA | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | NA | NA | Bacterial growth inhibition assay (OD based) |
HSPMDB002373 | 22123255 | Hsp100 | ClpP2 | Bacteria | Cytosol | NA | Antibacterial activity | ADEP4 | 1-[(3,5-difluorophenyl)methyl]-3-[(3S,9S,13S,15R,19S,22R)-15,19-dimethyl-2,8,12,18,21-pentaoxo-11-oxa-7,17,20-triazatetracyclo[20.4.0.0³,?.0¹³,¹?]hexacosan-9-yl]-1-[(2E)-hept-2-enoyl]urea | CCCC\C=C\C(=O)N(CC1=CC(F)=CC(F)=C1)C(=O)N[C@H]1COC(=O)[C@@H]2C[C@@H](C)CN2C(=O)[C@H](C)NC(=O)[C@@H]2CCCCC2C(=O)[C@@H]2CCCN2C1=O | Acyldepsipeptide analogue | NA | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | NA | NA | Bacterial growth inhibition assay (OD based) |
HSPMDB002374 | 22123255 | Hsp100 | ClpP2 | Bacteria | Cytosol | NA | Antibacterial activity | IDR-10011 | 1-(3-cyclohexylpropanoyl)-1-[(3,5-difluorophenyl)methyl]-3-[(3S,9S,13S,19S,22R)-19-methyl-2,8,12,18,21-pentaoxo-11-oxa-7,17,20-triazatetracyclo[20.4.0.0³,?.0¹³,¹?]hexacosan-9-yl]urea | C[C@@H]1NC(=O)[C@@H]2CCCCC2C(=O)[C@@H]2CCCN2C(=O)[C@H](COC(=O)[C@@H]2CCCN2C1=O)NC(=O)N(CC1=CC(F)=CC(F)=C1)C(=O)CCC1CCCCC1 | Acyldepsipeptide analogue | NA | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | NA | NA | Bacterial growth inhibition assay (OD based) |
HSPMDB002375 | 22123255 | Hsp100 | ClpP2 | Bacteria | Cytosol | NA | Antibacterial activity | IDR-10001 | 1-[(3,5-difluorophenyl)methyl]-1-[(2E)-hept-2-enoyl]-3-[(3S,9S,13S,19S,22R)-19-methyl-2,8,12,18,21-pentaoxo-11-oxa-7,17,20-triazatetracyclo[20.4.0.0³,?.0¹³,¹?]hexacosan-9-yl]urea | FC=1C=C(C=C(C1)F)CN(C(=O)N[C@@H]1C(N2CCC[C@H]2C(C2CCCC[C@H]2C(N[C@H](C(N2CCC[C@H]2C(OC1)=O)=O)C)=O)=O)=O)C(\C=C\CCCC)=O | Acyldepsipeptide analogue | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | Bacterial growth inhibition assay (OD based) |
HSPMDB002376 | 22123255 | Hsp100 | ClpP2 | Bacteria | Cytosol | NA | Antibacterial activity | IDR-10011 | 1-(3-cyclohexylpropanoyl)-1-[(3,5-difluorophenyl)methyl]-3-[(3S,9S,13S,19S,22R)-19-methyl-2,8,12,18,21-pentaoxo-11-oxa-7,17,20-triazatetracyclo[20.4.0.0³,?.0¹³,¹?]hexacosan-9-yl]urea | C[C@@H]1NC(=O)[C@@H]2CCCCC2C(=O)[C@@H]2CCCN2C(=O)[C@H](COC(=O)[C@@H]2CCCN2C1=O)NC(=O)N(CC1=CC(F)=CC(F)=C1)C(=O)CCC1CCCCC1 | Acyldepsipeptide analogue | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | Bacterial growth inhibition assay (OD based) |
HSPMDB002377 | 19206121 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of protease activity | NA | R1 | trans-4-methyl-3-(8-nonen-1-yl)oxetan-2-one | C[C@@H]1OC(=O)[C@H]1CCCCCCCC=C | Beta lactone analogue | NA | NA | NA | 3 | NA | NA | NA | NA | NA | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002378 | 19206121 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of protease activity | NA | U1 | trans-3-(8-Nonen-1-yl)-4-pheneth-1-yloxetan-2-one | CCC1(CC=CC=C1)[C@@H]2OC(=O)[C@H]2CCCCCCCC=C | Beta lactone analogue | NA | NA | NA | 7 | NA | NA | NA | NA | NA | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002379 | 26675528 | Hsp100 | ClpP | Human | Cytosol | NA | Antiproliferative activity | Cisplatin | dichloroplatinumdiamine | N.N.Cl[Pt]Cl | Chemical compound | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | <50% | Bacterial growth inhibition assay (OD based) |
HSPMDB002380 | 24106749 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | DFP | Diisopropyl fluorophosphate | CC(C)O[P](F)(=O)OC(C)C | Chemical compound | 95% | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002381 | 24106749 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | E2 | 3-(4-methoxyphenyl)-4-(pent-4-yn-1-yl)oxetan-2-one | COc1ccc(cc1)C2C(CCCC#C)OC2=O | Chemical compound | 98% | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002382 | 24106749 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | RKS09 | 4-(4-ethynylbenzoyl)-2-(undec-10-enoyl)-1??,2-thiazetidine-1,1-dione | C=CCCCCCCCCC(=O)N1CC(C(=O)c2ccc(cc2)C#C)[S]1(=O)=O | Chemical compound | 99% | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002383 | 24106749 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | DCI | 3,4-Dichloroisocoumarine | ClC1=C(Cl)c2ccccc2C(=O)O1 | Chemical compound | 60% at 25ºC for 1 hr | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002384 | 24106749 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | CMK | chloromethylketone | CC(Cl)=O | Chemical compound | 85% at 25ºC for 1 hr | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002385 | 24106749 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | FP | Diisopropyl fluorophosphate | CC(C)O[P](F)(=O)OC(C)C | Chemical compound | 60% at 25ºC for 1 hr | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002386 | 24106749 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | RKS02 | 2-(hex-5-ynoyl)-1??,2-thiazetidine-1,1-dione | O=C(CCCC#C)N1CC[S]1(=O)=O | Chemical compound | 75% at 25ºC for 1 hr | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002387 | 24106749 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | DCI | 3,4-Dichloroisocoumarine | ClC1=C(Cl)c2ccccc2C(=O)O1 | Chemical compound | 98% at 37ºC for 2 hr | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002388 | 24106749 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | CMK | chloromethylketone | CC(Cl)=O | Chemical compound | 98% at 37ºC for 2 hr | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002389 | 24106749 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | FP | Diisopropyl fluorophosphate | CC(C)O[P](F)(=O)OC(C)C | Chemical compound | 99% at 37ºC for 2 hr | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002390 | 24106749 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | RKS02 | 2-(hex-5-ynoyl)-1??,2-thiazetidine-1,1-dione | O=C(CCCC#C)N1CCS1(=O)=O | Chemical compound | 98% at 37ºC for 2 hr | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002391 | 24106749 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | RKS07 | 2-acetyl-4-(4-ethynylbenzoyl)-1??,2-thiazetidine-1,1-dione | CC(=O)N1CC(C(=O)C2=CC=C(C=C2)C#C)S1(=O)=O | Chemical compound | NA | NA | NA | 0.98 at 1 uM | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002392 | 24106749 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | RKS07 | 2-acetyl-4-(4-ethynylbenzoyl)-1??,2-thiazetidine-1,1-dione | CC(=O)N1CC(C(=O)C2=CC=C(C=C2)C#C)S1(=O)=O | Chemical compound | NA | NA | NA | 0.98 at 0.4 uM | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002393 | 18847196 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | Lactone D3 | 3-(non-8-en-1-yl)-4-(pent-4-yn-1-yl)oxetan-2-one | C=CCCCCCCCC1C(CCCC#C)OC1=O | Beta lactone analogue | NA | NA | NA | 6 | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002394 | 18847196 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | Lactone E2 | 3-(4-methoxyphenyl)-4-(pent-4-yn-1-yl)oxetan-2-one | COC1=CC=C(C=C1)C1C(CCCC#C)OC1=O | Beta lactone analogue | NA | NA | NA | 4 | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002395 | 18847196 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | Lactone G2 | 4-(pent-4-yn-1-yl)-3-pentyloxetan-2-one | CCCCCC1C(CCCC#C)OC1=O | Beta lactone analogue | NA | NA | NA | 31 | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002396 | 23892893 | Hsp100 | p97 | Yeast | Cytosol, Mitochondria, Endoplasmic reliculum, Nucleous | Inhibition of ATPase activity | NA | NMS-859 | 2-chloro-N-{3-[(1,1-dioxido-1,2-benzothiazol-3-yl)amino]-phenyl}acetamide | ClCC(=O)Nc1cccc(NC2=N[S](=O)(=O)c3ccccc23)c1 | Small molecule | NA | NA | NA | 0.37 uM at 60 uM ATP | NA | NA | NA | NA | Nucleotide binding domain (D2) | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002397 | 23892893 | Hsp100 | p97 | Yeast | Cytosol, Mitochondria, Endoplasmic reliculum, Nucleous | Inhibition of ATPase activity | NA | NMS-694 | N,N’-dibenzylquinazoline-2,4-diamine | C(Nc1nc(NCc2ccccc2)c3ccccc3n1)c4ccccc4 | Small molecule | NA | NA | NA | 2 uM at 60 uM ATP | NA | NA | NA | NA | Nucleotide binding domain (D2) | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002398 | 23892893 | Hsp100 | p97 | Yeast | Cytosol, Mitochondria, Endoplasmic reliculum, Nucleous | Inhibition of ATPase activity | NA | NMS-485A | N 4 -benzyl-N 2 -(3-fluorophenyl)quinazoline-2,4-diamine | Fc1cccc(Nc2nc(NCc3ccccc3)c4ccccc4n2)c1 | Small molecule | NA | NA | NA | 0.45 uM at 60 uM ATP | NA | NA | NA | NA | Nucleotide binding domain (D2) | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002399 | 23892893 | Hsp100 | p97 | Yeast | Cytosol, Mitochondria, Endoplasmic reliculum, Nucleous | Inhibition of ATPase activity | NA | NMS-862 | 3-isopropylsulfanyl-5-phenoxymethyl-4-phenyl-4H-[1,2,4]triazole | CC(C)Sc1nnc(COc2ccccc2)n1c3ccccc3 | Small molecule | NA | NA | NA | 2.66 uM at 60 uM ATP | NA | NA | NA | NA | Nucleotide binding domain (D2) | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002400 | 23892893 | Hsp100 | p97 | Yeast | Cytosol, Mitochondria, Endoplasmic reliculum, Nucleous | Inhibition of ATPase activity | NA | NMS-873 | 3-[3-cyclopentylsulfanyl-5-(4'-methanesulfonyl-2-methyl-biphenyl-4-yloxymethyl)- [1,2,4]triazol-4-yl]-pyridine | Cc1cc(OCc2nnc(SC3CCCC3)n2c4cccnc4)ccc1c5ccc(cc5)[S](C)(=O)=O | Small molecule | NA | NA | NA | 0.03 uM at 60 uM ATP | NA | NA | NA | NA | Nucleotide binding domain (D2) | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002401 | 23892893 | Hsp100 | p97 | Yeast | Cytosol, Mitochondria, Endoplasmic reliculum, Nucleous | Inhibition of ATPase activity | NA | NMS-859 | 2-chloro-N-{3-[(1,1-dioxido-1,2-benzothiazol-3-yl)amino]-phenyl}acetamide | ClCC(=O)Nc1cccc(NC2=N[S](=O)(=O)c3ccccc23)c1 | Small molecule | NA | NA | NA | 0.36 uM at 1 mM ATP | NA | NA | NA | NA | Nucleotide binding domain (D2) | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002402 | 23892893 | Hsp100 | p97 | Yeast | Cytosol, Mitochondria, Endoplasmic reliculum, Nucleous | Inhibition of ATPase activity | NA | NMS-694 | N,N’-dibenzylquinazoline-2,4-diamine | C(Nc1nc(NCc2ccccc2)c3ccccc3n1)c4ccccc4 | Small molecule | NA | NA | NA | 9.13 uM at 1 mM ATP | NA | NA | NA | NA | Nucleotide binding domain (D2) | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002403 | 23892893 | Hsp100 | p97 | Yeast | Cytosol, Mitochondria, Endoplasmic reliculum, Nucleous | Inhibition of ATPase activity | NA | NMS-485A | N 4 -benzyl-N 2 -(3-fluorophenyl)quinazoline-2,4-diamine | Fc1cccc(Nc2nc(NCc3ccccc3)c4ccccc4n2)c1 | Small molecule | NA | NA | NA | 2.47 uM at 1 mM ATP | NA | NA | NA | NA | Nucleotide binding domain (D2) | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002404 | 23892893 | Hsp100 | p97 | Yeast | Cytosol, Mitochondria, Endoplasmic reliculum, Nucleous | Inhibition of ATPase activity | NA | NMS-862 | 3-isopropylsulfanyl-5-phenoxymethyl-4-phenyl-4H-[1,2,4]triazole | CC(C)Sc1nnc(COc2ccccc2)n1c3ccccc3 | Small molecule | NA | NA | NA | 2.79 uM at 1 mM ATP | NA | NA | NA | NA | Nucleotide binding domain (D2) | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002405 | 23892893 | Hsp100 | p97 | Yeast | Cytosol, Mitochondria, Endoplasmic reliculum, Nucleous | Inhibition of ATPase activity | NA | NMS-873 | 3-[3-cyclopentylsulfanyl-5-(4'-methanesulfonyl-2-methyl-biphenyl-4-yloxymethyl)- [1,2,4]triazol-4-yl]-pyridine | Cc1cc(OCc2nnc(SC3CCCC3)n2c4cccnc4)ccc1c5ccc(cc5)[S](C)(=O)=O | Small molecule | NA | NA | NA | 0.02 uM at 1 mM ATP | NA | NA | NA | NA | Nucleotide binding domain (D2) | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002406 | 23892893 | Hsp100 | p97 | Yeast | Cytosol, Mitochondria, Endoplasmic reliculum, Nucleous | Inhibition of ATPase activity | NA | NMS-859 | 2-chloro-N-{3-[(1,1-dioxido-1,2-benzothiazol-3-yl)amino]-phenyl}acetamide | ClCC(=O)Nc1cccc(NC2=N[S](=O)(=O)c3ccccc23)c1 | Small molecule | NA | NA | NA | 20.7 uM at 0 minute | NA | NA | NA | NA | Nucleotide binding domain (D2) | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002407 | 23892893 | Hsp100 | p97 | Yeast | Cytosol, Mitochondria, Endoplasmic reliculum, Nucleous | Inhibition of ATPase activity | NA | NMS-859 | 2-chloro-N-{3-[(1,1-dioxido-1,2-benzothiazol-3-yl)amino]-phenyl}acetamide | ClCC(=O)Nc1cccc(NC2=N[S](=O)(=O)c3ccccc23)c1 | Small molecule | NA | NA | NA | 1.13 uM at 7.5 minutes | NA | NA | NA | NA | Nucleotide binding domain (D2) | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002408 | 23892893 | Hsp100 | p97 | Yeast | Cytosol, Mitochondria, Endoplasmic reliculum, Nucleous | Inhibition of ATPase activity | NA | NMS-859 | 2-chloro-N-{3-[(1,1-dioxido-1,2-benzothiazol-3-yl)amino]-phenyl}acetamide | ClCC(=O)Nc1cccc(NC2=N[S](=O)(=O)c3ccccc23)c1 | Small molecule | NA | NA | NA | 0.504 uM at 15 minutes | NA | NA | NA | NA | Nucleotide binding domain (D2) | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002409 | 23892893 | Hsp100 | p97 | Yeast | Cytosol, Mitochondria, Endoplasmic reliculum, Nucleous | Inhibition of ATPase activity | NA | NMS-859 | 2-chloro-N-{3-[(1,1-dioxido-1,2-benzothiazol-3-yl)amino]-phenyl}acetamide | ClCC(=O)Nc1cccc(NC2=N[S](=O)(=O)c3ccccc23)c1 | Small molecule | NA | NA | NA | 0.196 uM at 30 minutes | NA | NA | NA | NA | Nucleotide binding domain (D2) | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002410 | 23892893 | Hsp100 | p97 | Yeast | Cytosol, Mitochondria, Endoplasmic reliculum, Nucleous | Inhibition of ATPase activity | NA | NMS-859 | 2-chloro-N-{3-[(1,1-dioxido-1,2-benzothiazol-3-yl)amino]-phenyl}acetamide | ClCC(=O)Nc1cccc(NC2=N[S](=O)(=O)c3ccccc23)c1 | Small molecule | NA | NA | NA | 0.166 uM at 60 minutes | NA | NA | NA | NA | Nucleotide binding domain (D2) | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002411 | 23892893 | Hsp100 | NA | Human | NA | NA | Antiproliferative activity | NMS-859 | 2-chloro-N-{3-[(1,1-dioxido-1,2-benzothiazol-3-yl)amino]-phenyl}acetamide | ClCC(=O)Nc1cccc(NC2=N[S](=O)(=O)c3ccccc23)c1 | Small molecule | NA | NA | NA | 3.5 | NA | NA | NA | NA | Nucleotide binding domain (D2) | NA | NA | Luminescence based viability assay |
HSPMDB002412 | 23892893 | Hsp100 | NA | Human | NA | NA | Antiproliferative activity | NMS-694 | N,N’-dibenzylquinazoline-2,4-diamine | C(Nc1nc(NCc2ccccc2)c3ccccc3n1)c4ccccc4 | Small molecule | NA | NA | NA | 3.2 | NA | NA | NA | NA | Nucleotide binding domain (D2) | NA | NA | Luminescence based viability assay |
HSPMDB002413 | 23892893 | Hsp100 | NA | Human | NA | NA | Antiproliferative activity | NMS-485A | N 4 -benzyl-N 2 -(3-fluorophenyl)quinazoline-2,4-diamine | Fc1cccc(Nc2nc(NCc3ccccc3)c4ccccc4n2)c1 | Small molecule | NA | NA | NA | 2.8 | NA | NA | NA | NA | Nucleotide binding domain (D2) | NA | NA | Luminescence based viability assay |
HSPMDB002414 | 23892893 | Hsp100 | NA | Human | NA | NA | Antiproliferative activity | NMS-862 | 3-isopropylsulfanyl-5-phenoxymethyl-4-phenyl-4H-[1,2,4]triazole | CC(C)Sc1nnc(COc2ccccc2)n1c3ccccc3 | Small molecule | NA | NA | NA | >10 | NA | NA | NA | NA | Nucleotide binding domain (D2) | NA | NA | Luminescence based viability assay |
HSPMDB002415 | 23892893 | Hsp100 | NA | Human | NA | NA | Antiproliferative activity | NMS-873 | 3-[3-cyclopentylsulfanyl-5-(4'-methanesulfonyl-2-methyl-biphenyl-4-yloxymethyl)- [1,2,4]triazol-4-yl]-pyridine | Cc1cc(OCc2nnc(SC3CCCC3)n2c4cccnc4)ccc1c5ccc(cc5)[S](C)(=O)=O | Small molecule | NA | NA | NA | 0.4 | NA | NA | NA | NA | Nucleotide binding domain (D2) | NA | NA | Luminescence based viability assay |
HSPMDB002416 | 23892893 | Hsp100 | NA | Human | NA | NA | Antiproliferative activity | NMS-859 | 2-chloro-N-{3-[(1,1-dioxido-1,2-benzothiazol-3-yl)amino]-phenyl}acetamide | ClCC(=O)Nc1cccc(NC2=N[S](=O)(=O)c3ccccc23)c1 | Small molecule | NA | NA | NA | 3 | NA | NA | NA | NA | Nucleotide binding domain (D2) | NA | NA | Luminescence based viability assay |
HSPMDB002417 | 23892893 | Hsp100 | NA | Human | NA | NA | Antiproliferative activity | NMS-694 | N,N’-dibenzylquinazoline-2,4-diamine | C(Nc1nc(NCc2ccccc2)c3ccccc3n1)c4ccccc4 | Small molecule | NA | NA | NA | 3.6 | NA | NA | NA | NA | Nucleotide binding domain (D2) | NA | NA | Luminescence based viability assay |
HSPMDB002418 | 23892893 | Hsp100 | NA | Human | NA | NA | Antiproliferative activity | NMS-485A | N 4 -benzyl-N 2 -(3-fluorophenyl)quinazoline-2,4-diamine | Fc1cccc(Nc2nc(NCc3ccccc3)c4ccccc4n2)c1 | Small molecule | NA | NA | NA | 4.1 | NA | NA | NA | NA | Nucleotide binding domain (D2) | NA | NA | Luminescence based viability assay |
HSPMDB002419 | 23892893 | Hsp100 | NA | Human | NA | NA | Antiproliferative activity | NMS-862 | 3-isopropylsulfanyl-5-phenoxymethyl-4-phenyl-4H-[1,2,4]triazole | CC(C)Sc1nnc(COc2ccccc2)n1c3ccccc3 | Small molecule | NA | NA | NA | >10 | NA | NA | NA | NA | Nucleotide binding domain (D2) | NA | NA | Luminescence based viability assay |
HSPMDB002420 | 23892893 | Hsp100 | NA | Human | NA | NA | Antiproliferative activity | NMS-873 | 3-[3-cyclopentylsulfanyl-5-(4'-methanesulfonyl-2-methyl-biphenyl-4-yloxymethyl)- [1,2,4]triazol-4-yl]-pyridine | Cc1cc(OCc2nnc(SC3CCCC3)n2c4cccnc4)ccc1c5ccc(cc5)[S](C)(=O)=O | Small molecule | NA | NA | NA | 0.7 | NA | NA | NA | NA | Nucleotide binding domain (D2) | NA | NA | Luminescence based viability assay |
HSPMDB002421 | 23892893 | Hsp100 | p97 | Bacteria | Cytosol, Mitochondria, Endoplasmic reliculum, Nucleous | Binding Affinity | NA | NMS-249 | 4-(5-cyclopentylsulfanyl-4-pyridin-3-yl-4H-[1,2,4]triazol-3-ylmethoxy)-benzoic acid methyl ester | COC(=O)c1ccc(OCc2nnc(SC3CCCC3)n2c4cccnc4)cc1 | Small molecule | NA | 1.03 | NA | NA | NA | NA | NA | NA | Nucleotide binding domain (D2) | Isothermal titration calorimetry (ITC) | NA | NA |
HSPMDB002422 | 28917450 | Hsp100 | ClpP | Plasmodium falciparum | Cytosol | Inhibition of protease activity | NA | 1 | N-(5-Ethyl-1,3,4-thiadiazol-2-yl)-2-((5-(3-hydroxynaphthalen-2-yl)-4-(2-methoxyethyl)-4H-1,2,4-triazol-3-yl)thio)acetamide | CCc1sc(NC(=O)CSc2nnc(n2CCOC)c3cc4ccccc4cc3O)nn1 | Library of small molecule structures | NA | NA | NA | 30 | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002423 | 28917450 | Hsp100 | ClpP | Plasmodium falciparum | Cytosol | Inhibition of protease activity | NA | 2 | 2,20,200-((1,3,5-Triazin-2,4,6-triyl)tris(sulfanediyl))-tris-(N-(furan-2-ylmethyl)acetamide) | O=C(CNC(=O)OCc1ccccc1)N[C@@H](CCC(=O)OCc2ccccc2)C(=O)OCc3ccccc3 | Library of small molecule structures | NA | NA | NA | 92 | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002424 | 28917450 | Hsp100 | ClpP | Plasmodium falciparum | Cytosol | Inhibition of protease activity | NA | 3 | Dibenzyl ((benzyloxy)carbonyl)glycylglutamate | C(C1=CC=CC=C1)OC(=O)NCC(=O)N[C@@H](CCC(=O)OCC1=CC=CC=C1)C(=O)OCC1=CC=CC=C1 | Library of small molecule structures | NA | NA | NA | >100 | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002425 | 28917450 | Hsp100 | ClpP | Plasmodium falciparum | Cytosol | Inhibition of protease activity | NA | 4 | N,N-(5-(Thiazol-2-ylcarbamoyl)-1,3-phenylene)bis(2-phenoxyacetamide) | COc1ccc(CNC(=O)C(=O)N/N=C/c2oc(CN[S](=O)(=O)c3ccc(Br)cc3)cc2)cc1 | Library of small molecule structures | NA | NA | NA | 88 | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002426 | 28917450 | Hsp100 | ClpP | Plasmodium falciparum | Cytosol | Inhibition of protease activity | NA | 5 | (E)-2-(2-((5-(((4-Bromophenyl)sulfonamido)methyl)furan-2-yl)methylene)hydrazinyl)-N-(4-methoxybenzyl)-2-oxoacetamide | Cc1cc(SCC(=O)N(N)C(=O)Cc2ccccc2)nc(SCC(=O)c3ccccc3)n1 | Library of small molecule structures | NA | NA | NA | >100 | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002427 | 28917450 | Hsp100 | ClpP | Plasmodium falciparum | Cytosol | Inhibition of protease activity | NA | 6 | 2-((6-Methyl-2-((2-oxo-2-phenylethyl)thio)pyrimidin-4-yl)thio)-N-(2-phenylacetyl)acetohydrazide | CCCCOc1ccc(c(C)c1)c2nn(cc2\C=C(C#N)\C(=O)NCc3occc3)c4ccccc4 | Library of small molecule structures | NA | NA | NA | 26 | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002428 | 28917450 | Hsp100 | ClpP | Plasmodium falciparum | Cytosol | Inhibition of protease activity | NA | 7 | (E)-3-(3-(4-Butoxy-2-methylphenyl)-1-phenyl-1H-pyrazol-4-yl)-2-cyano-N-(furan-2-ylmethyl)acrylamide | CCCOc1ccc(cc1F)c2nn(cc2\C=C\3SC(=S)N(CCc4ccccc4)C3=O)c5ccccc5 | Library of small molecule structures | NA | NA | NA | >100 | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002429 | 28917450 | Hsp100 | ClpP | Plasmodium falciparum | Cytosol | Inhibition of protease activity | NA | 8 | (Z)-5-((3-(3-Fluoro-4-propoxyphenyl)-1-phenyl-1H-pyrazol-4-yl)methylene)-3-phenethyl-2-thioxothiazolidin-4-one | CCc1ccc(CSc2ncc(Cl)c(n2)C(=O)NCCC(=O)Nc3ccc(Cl)cc3)cc1 | Library of small molecule structures | NA | NA | NA | >100 | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002430 | 28917450 | Hsp100 | ClpP | Plasmodium falciparum | Cytosol | Inhibition of protease activity | NA | 9 | 5-Chloro-N-(3-((4-chlorophenyl)amino)-3-oxopropyl)-2-((4-ethylbenzyl)thio)pyrimidine-4-carboxamide | ClC=1C(=NC(=NC1)SCC1=CC=C(C=C1)CC)C(=O)NCCC(=O)NC1=CC=C(C=C1)Cl | Library of small molecule structures | NA | NA | NA | >100 | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002431 | 28917450 | Hsp100 | ClpP | Plasmodium falciparum | Cytosol | Inhibition of protease activity | NA | 10 | N-(3-methoxyphenyl)-2-{[3-oxo-4-(2-phenylethyl)-12-(propan-2-yl)-11-oxa-8-thia-4,6-diazatricyclo[7.4.0.0²,?]trideca-1(9),2(7),5-trien-5-yl]sulfanyl}acetamide | COC1=CC=CC(NC(=O)CSC2=NC3=C(C4=C(COC(C4)C(C)C)S3)C(=O)N2CCC2=CC=CC=C2)=C1 | Library of small molecule structures | NA | NA | NA | >100 | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002432 | 28917450 | Hsp100 | ClpP | Plasmodium falciparum | Cytosol | Inhibition of protease activity | NA | 11 | 2-{[3-oxo-4-(2-phenylethyl)-12-(propan-2-yl)-11-oxa-8-thia-4,6-diazatricyclo[7.4.0.0²,?]trideca-1(9),2(7),5-trien-5-yl]sulfanyl}-N-(4-phenylbutan-2-yl)acetamide | CC(CCC1=CC=CC=C1)NC(=O)CSC1=NC2=C(C3=C(COC(C3)C(C)C)S2)C(=O)N1CCC1=CC=CC=C1 | Library of small molecule structures | NA | NA | NA | 23 | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002433 | 28917450 | Hsp100 | ClpP | Plasmodium falciparum | Cytosol | Inhibition of protease activity | NA | 12 | N-Benzyl-2-((6-isopropyl-4-oxo-3-phenethyl-3,5,6,8-tetrahydro-4H-pyrano[40,30:4,5]thieno[2,3-d]pyrimidin-2-yl)thio)acetamide | CCCC1=CC(=O)Oc2cc(OCC(=O)N[C@@H](CSCc3ccccc3)C(O)=O)ccc12 | Library of small molecule structures | NA | NA | NA | >100 | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002434 | 28917450 | Hsp100 | ClpP | Plasmodium falciparum | Cytosol | Inhibition of protease activity | NA | 13 | S-Benzyl-N-(2-((2-oxo-4-propyl-2H-chromen-7-yl)oxy)acetyl)-cysteine | COc1ccc(cc1)C(=O)CSc2nc(C)cc(SCC(=O)N(N)C(=O)Cc3ccccc3)n2 | Library of small molecule structures | NA | NA | NA | >100 | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002435 | 28917450 | Hsp100 | ClpP | Plasmodium falciparum | Cytosol | Inhibition of protease activity | NA | 22 | 2-(2-(2-(4-Methoxyphenyl)-2-oxoethylthio)-6-methylpyrimidin-4-ylthio)-N-(2-phenylacetyl)acetohydrazide | COC1=CC=C(C=C1)C(CSC1=NC(=CC(=N1)SCC(=O)N(N)C(CC1=CC=CC=C1)=O)C)=O | Library of small molecule structures | NA | NA | NA | 34.7 | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002436 | 28917450 | Hsp100 | ClpP | Plasmodium falciparum | Cytosol | Inhibition of protease activity | NA | 23 | 2-(2-(2-(4-(Diethylamino)phenyl)-2-oxoethylthio)-6-methylpyrimidin-4-yl-thio)-N-(2-phenylacetyl)acetohydrazide | Cc1cc(SCC(=O)N(N)C(=O)Cc2ccccc2)nc(SCC(=O)N3CCOCC3)n1 | Library of small molecule structures | NA | NA | NA | 28.3 | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002437 | 28917450 | Hsp100 | ClpP | Plasmodium falciparum | Cytosol | Inhibition of protease activity | NA | 24 | 2-(6-Methyl-2-(2-morpholino-2-oxoethylthio)pyrimidin-4-ylthio)-N-(2-phenylacetyl)acetohydrazide | Cc1cc(SCC(=O)N(N)C(=O)Cc2ccccc2)nc(SCCN3CCOCC3)n1 | Library of small molecule structures | NA | NA | NA | 28.8 | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002438 | 28917450 | Hsp100 | ClpP | Plasmodium falciparum | Cytosol | Inhibition of protease activity | NA | 25 | 2-(6-Methyl-2-(2-morpholinoethylthio)pyrimidin-4-yl-thio)-N-(2-phenylacetyl)acetohydrazide | Cc1cc(SCC(=O)N(N)C(=O)Cc2ccccc2)nc(SCC(=O)c3ccc(cc3)C#N)n1 | Library of small molecule structures | NA | NA | NA | 30.3 | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002439 | 28917450 | Hsp100 | ClpP | Plasmodium falciparum | Cytosol | Inhibition of protease activity | NA | 26 | 2-(2-(2-(4-Cyanophenyl)-2-oxoethylthio)-6-methylpyrimidin-4-yl-thio)-N-(2-phenylacetyl)acetohydrazide | O=C(CSC1=NC=C(C(=O)NCCCc2ccccc2)C(=O)N1Cc3ccccc3)c4ccccc4 | Library of small molecule structures | NA | NA | NA | 37.4 | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002440 | 28917450 | Hsp100 | ClpP | Plasmodium falciparum | Cytosol | Inhibition of protease activity | NA | 30 | 1-Benzyl-6-oxo-2-(2-oxo-2-phenylethylthio)-N-(3-phenylpropyl)-1,6-dihydropyrimidine-5-carboxamide | COc1ccc(cc1)C(=O)CSC2=NC=C(C(=O)NCCCc3ccccc3)C(=O)N2Cc4ccccc4 | Library of small molecule structures | NA | NA | NA | 24 | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002441 | 28917450 | Hsp100 | ClpP | Plasmodium falciparum | Cytosol | Inhibition of protease activity | NA | 31 | 1-Benzyl-2-(2-(4-methoxyphenyl)-2-oxoethylthio)-6-oxo-N-(3-phenylpropyl)-1,6 dihydropyrimidine-5-carboxamide | O=C(CSC1=NC=C(C(=O)NCCCc2ccccc2)C(=O)N1Cc3ccccc3)NNC(=O)Cc4ccccc4 | Library of small molecule structures | NA | NA | NA | 45 | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002442 | 28917450 | Hsp100 | ClpP | Plasmodium falciparum | Cytosol | Inhibition of protease activity | NA | 32 | 1-Benzyl-6-oxo-2-(2-oxo-2-(2-(2-phenylacetyl)hydrazinyl)ethylthio)-N-(3-phenylpropyl)-1,6-dihydropyrimidine-5-carboxamide | O=C(NCCCc1ccccc1)C2=CN=C(SCCN3CCOCC3)N(Cc4ccccc4)C2=O | Library of small molecule structures | NA | NA | NA | 72.6 | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002443 | 28917450 | Hsp100 | ClpP | Plasmodium falciparum | Cytosol | Inhibition of protease activity | NA | 33 | 1-Benzyl-2-(2-morpholinoethylthio)-6-oxo-N-(3-phenylpropyl)-1,6-dihydropyrimidine-5-carboxamide | CCOC(=O)CSC1=NC=C(C(=O)NCCCc2ccccc2)C(=O)N1Cc3ccccc3 | Library of small molecule structures | NA | NA | NA | 10.5 | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002444 | 28917450 | Hsp100 | ClpP | Plasmodium falciparum | Cytosol | Inhibition of protease activity | NA | 34 | Ethyl-2-(1-benzyl-6-oxo-5-(3-phenylpropylcarbamoyl)-1,6-dihydropyrimidin-2-ylthio)acetate | CCN(CC)c1ccc(cc1)C(=O)CSC2=NC=C(C(=O)NCCCc3ccccc3)C(=O)N2Cc4ccccc4 | Library of small molecule structures | NA | NA | NA | 58.3 | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002445 | 28917450 | Hsp100 | ClpP | Plasmodium falciparum | Cytosol | Inhibition of protease activity | NA | 35 | 1-Benzyl-2-(2-(4-(diethylamino)phenyl)-2-oxoethylthio)-6-oxo-N-(3-phenylpropyl)-1,6-dihydropyrimidine-5-carboxamide | Oc1ccc(cc1)C(=O)CSC2=NC=C(C(=O)NCCCc3ccccc3)C(=O)N2Cc4ccccc4 | Library of small molecule structures | NA | NA | NA | >100 | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002446 | 28917450 | Hsp100 | ClpP | Plasmodium falciparum | Cytosol | Inhibition of protease activity | NA | 36 | 1-Benzyl-2-(2-(4-hydroxyphenyl)-2-oxoethylthio)-6-oxo-N-(3-phenylpropyl)-1,6-dihydropyrimidine-5-carboxamide | O=C(CSC1=NC=C(C(=O)NCCCc2ccccc2)C(=O)N1Cc3ccccc3)c4ccc(cc4)C#N | Library of small molecule structures | NA | NA | NA | 53 | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002447 | 28917450 | Hsp100 | ClpP | Plasmodium falciparum | Cytosol | Inhibition of protease activity | NA | 37 | 1-Benzyl-2-(2-(4-cyanophenyl)-2-oxoethylthio)-6-oxo-N-(3-phenylpropyl)-1,6-dihydropyrimidine-5-carboxamide | O=C(CSC1=NC=C(C(=O)NCCCc2ccccc2)C(=O)N1Cc3ccccc3)N4CCOCC4 | Library of small molecule structures | NA | NA | NA | >100 | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002448 | 28917450 | Hsp100 | ClpP | Plasmodium falciparum | Cytosol | Inhibition of protease activity | NA | 38 | 1-Benzyl-2-(2-morpholino-2-oxoethylthio)-6-oxo-N-(3-phenylpropyl)-1,6-dihydropyrimidine-5-carboxamide | C(C1=CC=CC=C1)N1C(=NC=C(C1=O)C(=O)NCCCC1=CC=CC=C1)SCC(=O)N1CCOCC1 | Library of small molecule structures | NA | NA | NA | 46 | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002449 | 28917450 | Hsp100 | ClpP | Plasmodium falciparum | Cytosol | Inhibition of protease activity | NA | 40 | Ethyl-2-(2-oxo-2-(2-(2-phenylacetyl)hydrazinyl)ethylthio)-pyrimidin-4-one-5-carboxylate | CCOC(=O)C1=CN=C(NC1=O)SCCN2CCOCC2 | Library of small molecule structures | NA | NA | NA | 42 | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002450 | 28917450 | Hsp100 | ClpP | Plasmodium falciparum | Cytosol | Inhibition of protease activity | NA | 41 | Ethyl 2-(2-morpholinoethylthio)-6-oxo-1,6-dihydropyrimidine-5-carboxylate | O1CCN(CC1)CCSC=1NC(C(=CN1)C(=O)OCC)=O | Library of small molecule structures | NA | NA | NA | >100 | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002451 | 28917450 | Hsp100 | ClpP | Plasmodium falciparum | Cytosol | Inhibition of protease activity | NA | 42 | Ethyl 2-(2-morpholinoethylthio)-1-(2-oxo-2-phenylethyl)-pyrimidin-4-one-5-carboxylate | OC(=O)C1=CN=C2SC(=C(CN2C1=O)c3ccccc3)CN4CCOCC4 | Library of small molecule structures | NA | NA | NA | 40 | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002452 | 28917450 | Hsp100 | ClpP | Plasmodium falciparum | Cytosol | Inhibition of protease activity | NA | 43 | 2-(Morpholinomethyl)-6-oxo-3-phenyl-4,6-dihydropyrimido[2,1-b][1,3]thiazine-7-carboxylic acid | O1CCN(CC1)CC1=C(CN2C(S1)=NC=C(C2=O)C(=O)O)C2=CC=CC=C2 | Library of small molecule structures | NA | NA | NA | >100 | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002453 | 28917450 | Hsp100 | ClpP | Plasmodium falciparum | Cytosol | Inhibition of protease activity | NA | 44 | 2-(2-Morpholinoethylthio)-N-(3-phenylpropyl)-pyrimidin-4-one-5-carboxamide | CCc1sc(NC(=O)CSc2nnc(n2CCOC)c3cc4ccccc4cc3O)nn1 | Library of small molecule structures | NA | NA | NA | 44 | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002454 | 28917450 | Hsp100 | ClpP | Plasmodium falciparum | Cytosol | Inhibition of protease activity | NA | 1 | N-(5-Ethyl-1,3,4-thiadiazol-2-yl)-2-((5-(3-hydroxynaphthalen-2-yl)-4-(2-methoxyethyl)-4H-1,2,4-triazol-3-yl)thio)acetamide | C(C)C1=NN=C(S1)NC(CSC1=NN=C(N1CCOC)C1=CC2=CC=CC=C2C=C1O)=O | Library of small molecule structures | NA | NA | 12.1 | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002455 | 28917450 | Hsp100 | ClpP | Plasmodium falciparum | Cytosol | Inhibition of protease activity | NA | 2 | 2,2,2-((1,3,5-Triazin-2,4,6-triyl)tris(sulfanediyl))-tris-(N-(furan-2-ylmethyl)acetamide) | O=C(CNC(=O)OCc1ccccc1)N[C@@H](CCC(=O)OCc2ccccc2)C(=O)OCc3ccccc3 | Library of small molecule structures | NA | NA | 38 | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002456 | 28917450 | Hsp100 | ClpP | Plasmodium falciparum | Cytosol | Inhibition of protease activity | NA | 4 | N,N-(5-(Thiazol-2-ylcarbamoyl)-1,3-phenylene)bis(2-phenoxyacetamide) | COc1ccc(CNC(=O)C(=O)N/N=C/c2oc(CN[S](=O)(=O)c3ccc(Br)cc3)cc2)cc1 | Library of small molecule structures | NA | NA | 36 | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002457 | 28917450 | Hsp100 | ClpP | Plasmodium falciparum | Cytosol | Inhibition of protease activity | NA | 6 | 2-((6-Methyl-2-((2-oxo-2-phenylethyl)thio)pyrimidin-4-yl)thio)-N0-(2-phenylacetyl)acetohydrazide | CCCCOc1ccc(c(C)c1)c2nn(cc2\C=C(C#N)\C(=O)NCc3occc3)c4ccccc4 | Library of small molecule structures | NA | NA | 11 | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002458 | 28917450 | Hsp100 | ClpP | Plasmodium falciparum | Cytosol | Inhibition of protease activity | NA | 11 | 2-{[3-oxo-4-(2-phenylethyl)-12-(propan-2-yl)-11-oxa-8-thia-4,6-diazatricyclo[7.4.0.0²,?]trideca-1(9),2(7),5-trien-5-yl]sulfanyl}-N-(4-phenylbutan-2-yl)acetamide | CC(CCC1=CC=CC=C1)NC(=O)CSC1=NC2=C(C3=C(COC(C3)C(C)C)S2)C(=O)N1CCC1=CC=CC=C1 | Library of small molecule structures | NA | NA | 9 | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002459 | 28917450 | Hsp100 | ClpP | Plasmodium falciparum | Cytosol | Inhibition of protease activity | NA | 22 | 2-(2-(2-(4-Methoxyphenyl)-2-oxoethylthio)-6-methylpyrimidin-4-ylthio)-N0-(2-phenylacetyl)acetohydrazide | CCN(CC)c1ccc(cc1)C(=O)CSc2nc(C)cc(SCC(=O)N(N)C(=O)Cc3ccccc3)n2 | Library of small molecule structures | NA | NA | 14.2 | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002460 | 28917450 | Hsp100 | ClpP | Plasmodium falciparum | Cytosol | Inhibition of protease activity | NA | 23 | 2-(2-(2-(4-(Diethylamino)phenyl)-2-oxoethylthio)-6-methylpyrimidin-4-yl-thio)-N0-(2-^phenylacetyl)acetohydrazide | Cc1cc(SCC(=O)N(N)C(=O)Cc2ccccc2)nc(SCC(=O)N3CCOCC3)n1 | Library of small molecule structures | NA | NA | 11.6 | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002461 | 28917450 | Hsp100 | ClpP | Plasmodium falciparum | Cytosol | Inhibition of protease activity | NA | 24 | 2-(6-Methyl-2-(2-morpholino-2-oxoethylthio)pyrimidin-4-ylthio)-N0-(2-phenylacetyl)acetohydrazide | Cc1cc(SCC(=O)N(N)C(=O)Cc2ccccc2)nc(SCCN3CCOCC3)n1 | Library of small molecule structures | NA | NA | 11.8 | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002462 | 28917450 | Hsp100 | ClpP | Plasmodium falciparum | Cytosol | Inhibition of protease activity | NA | 25 | 2-(6-Methyl-2-(2-morpholinoethylthio)pyrimidin-4-yl-thio)-N0-(2-phenylacetyl)acetohydrazide | Cc1cc(SCC(=O)N(N)C(=O)Cc2ccccc2)nc(SCC(=O)c3ccc(cc3)C#N)n1 | Library of small molecule structures | NA | NA | 12.3 | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002463 | 28917450 | Hsp100 | ClpP | Plasmodium falciparum | Cytosol | Inhibition of protease activity | NA | 26 | 2-(2-(2-(4-Cyanophenyl)-2-oxoethylthio)-6-methylpyrimidin-4-yl-thio)-N0-(2-phenylacetyl)acetohydrazide | O=C(CSC1=NC=C(C(=O)NCCCc2ccccc2)C(=O)N1Cc3ccccc3)c4ccccc4 | Library of small molecule structures | NA | NA | 15.3 | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002464 | 28917450 | Hsp100 | ClpP | Plasmodium falciparum | Cytosol | Inhibition of protease activity | NA | 30 | 1-Benzyl-6-oxo-2-(2-oxo-2-phenylethylthio)-N-(3-phenylpropyl)-1,6-dihydropyrimidine-5-carboxamide | COc1ccc(cc1)C(=O)CSC2=NC=C(C(=O)NCCCc3ccccc3)C(=O)N2Cc4ccccc4 | Library of small molecule structures | NA | NA | 10 | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002465 | 28917450 | Hsp100 | ClpP | Plasmodium falciparum | Cytosol | Inhibition of protease activity | NA | 31 | 1-Benzyl-2-(2-(4-methoxyphenyl)-2-oxoethylthio)-6-oxo-N-(3-phenylpropyl)-1,6 dihydropyrimidine-5-carboxamide | O=C(CSC1=NC=C(C(=O)NCCCc2ccccc2)C(=O)N1Cc3ccccc3)NNC(=O)Cc4ccccc4 | Library of small molecule structures | NA | NA | 18 | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002466 | 28917450 | Hsp100 | ClpP | Plasmodium falciparum | Cytosol | Inhibition of protease activity | NA | 32 | 1-Benzyl-6-oxo-2-(2-oxo-2-(2-(2-phenylacetyl)hydrazinyl)ethylthio)-N-(3-phenylpropyl)-1,6-dihydropyrimidine-5-carboxamide | O=C(NCCCc1ccccc1)C2=CN=C(SCCN3CCOCC3)N(Cc4ccccc4)C2=O | Library of small molecule structures | NA | NA | 29.5 | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002467 | 28917450 | Hsp100 | ClpP | Plasmodium falciparum | Cytosol | Inhibition of protease activity | NA | 33 | 1-Benzyl-2-(2-morpholinoethylthio)-6-oxo-N-(3-phenylpropyl)-1,6-dihydropyrimidine-5-carboxamide | CCOC(=O)CSC1=NC=C(C(=O)NCCCc2ccccc2)C(=O)N1Cc3ccccc3 | Library of small molecule structures | NA | NA | 2.3 | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002468 | 28917450 | Hsp100 | ClpP | Plasmodium falciparum | Cytosol | Inhibition of protease activity | NA | 34 | Ethyl-2-(1-benzyl-6-oxo-5-(3-phenylpropylcarbamoyl)-1,6-dihydropyrimidin-2-ylthio)acetate | CCN(CC)c1ccc(cc1)C(=O)CSC2=NC=C(C(=O)NCCCc3ccccc3)C(=O)N2Cc4ccccc4 | Library of small molecule structures | NA | NA | 23.8 | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002469 | 28917450 | Hsp100 | ClpP | Plasmodium falciparum | Cytosol | Inhibition of protease activity | NA | 36 | 1-Benzyl-2-(2-(4-hydroxyphenyl)-2-oxoethylthio)-6-oxo-N-(3-phenylpropyl)-1,6-dihydropyrimidine-5-carboxamide | O=C(CSC1=NC=C(C(=O)NCCCc2ccccc2)C(=O)N1Cc3ccccc3)c4ccc(cc4)C#N | Library of small molecule structures | NA | NA | 21.6 | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002470 | 28917450 | Hsp100 | ClpP | Plasmodium falciparum | Cytosol | Inhibition of protease activity | NA | 38 | 1-Benzyl-2-(2-morpholino-2-oxoethylthio)-6-oxo-N-(3-phenylpropyl)-1,6-dihydropyrimidine-5-carboxamide | C(C1=CC=CC=C1)N1C(=NC=C(C1=O)C(=O)NCCCC1=CC=CC=C1)SCC(=O)N1CCOCC1 | Library of small molecule structures | NA | NA | 18.8 | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002471 | 28917450 | Hsp100 | ClpP | Plasmodium falciparum | Cytosol | Inhibition of protease activity | NA | 40 | Ethyl-2-(2-oxo-2-(2-(2-phenylacetyl)hydrazinyl)ethylthio)-pyrimidin-4-one-5-carboxylate | CCOC(=O)C1=CN=C(NC1=O)SCCN2CCOCC2 | Library of small molecule structures | NA | NA | 17 | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002472 | 28917450 | Hsp100 | ClpP | Plasmodium falciparum | Cytosol | Inhibition of protease activity | NA | 42 | Ethyl 2-(2-morpholinoethylthio)-1-(2-oxo-2-phenylethyl)-pyrimidin-4-one-5-carboxylate | OC(=O)C1=CN=C2SC(=C(CN2C1=O)c3ccccc3)CN4CCOCC4 | Library of small molecule structures | NA | NA | 16 | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002473 | 28917450 | Hsp100 | ClpP | Plasmodium falciparum | Cytosol | Inhibition of protease activity | NA | 44 | 2-(2-Morpholinoethylthio)-N-(3-phenylpropyl)-pyrimidin-4-one-5-carboxamide | CCc1sc(NC(=O)CSc2nnc(n2CCOC)c3cc4ccccc4cc3O)nn1 | Library of small molecule structures | NA | NA | 18 | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002474 | 28917450 | Hsp100 | ClpP | Plasmodium falciparum | Cytosol | NA | Antiparasitic activity | 1 | N-(5-Ethyl-1,3,4-thiadiazol-2-yl)-2-((5-(3-hydroxynaphthalen-2-yl)-4-(2-methoxyethyl)-4H-1,2,4-triazol-3-yl)thio)acetamide | C(C)C1=NN=C(S1)NC(CSC1=NN=C(N1CCOC)C1=CC2=CC=CC=C2C=C1O)=O | Library of small molecule structures | NA | NA | NA | 27 | NA | NA | NA | NA | NA | NA | NA | Parasite growth inhibition assay (SYBR green) |
HSPMDB002475 | 28917450 | Hsp100 | ClpP | Plasmodium falciparum | Cytosol | NA | Antiparasitic activity | 6 | 2-((6-Methyl-2-((2-oxo-2-phenylethyl)thio)pyrimidin-4-yl)thio)-N0-(2-phenylacetyl)acetohydrazide | CCCCOc1ccc(c(C)c1)c2nn(cc2\C=C(C#N)\C(=O)NCc3occc3)c4ccccc4 | Library of small molecule structures | NA | NA | NA | 75 | NA | NA | NA | NA | NA | NA | NA | Parasite growth inhibition assay (SYBR green) |
HSPMDB002476 | 28917450 | Hsp100 | ClpP | Plasmodium falciparum | Cytosol | NA | Antiparasitic activity | 11 | 2-{[3-oxo-4-(2-phenylethyl)-12-(propan-2-yl)-11-oxa-8-thia-4,6-diazatricyclo[7.4.0.0²,?]trideca-1(9),2(7),5-trien-5-yl]sulfanyl}-N-(4-phenylbutan-2-yl)acetamide | CC(CCC1=CC=CC=C1)NC(=O)CSC1=NC2=C(C3=C(COC(C3)C(C)C)S2)C(=O)N1CCC1=CC=CC=C1 | Library of small molecule structures | NA | NA | NA | 25 | NA | NA | NA | NA | NA | NA | NA | Parasite growth inhibition assay (SYBR green) |
HSPMDB002477 | 28917450 | Hsp100 | ClpP | Plasmodium falciparum | Cytosol | NA | Antiparasitic activity | 22 | 2-(2-(2-(4-Methoxyphenyl)-2-oxoethylthio)-6-methylpyrimidin-4-ylthio)-N-(2-phenylacetyl)acetohydrazide | COC1=CC=C(C=C1)C(CSC1=NC(=CC(=N1)SCC(=O)N(N)C(CC1=CC=CC=C1)=O)C)=O | Library of small molecule structures | NA | NA | NA | 11.8 | NA | NA | NA | NA | NA | NA | NA | Parasite growth inhibition assay (SYBR green) |
HSPMDB002478 | 28917450 | Hsp100 | ClpP | Plasmodium falciparum | Cytosol | NA | Antiparasitic activity | 23 | 2-(2-(2-(4-(Diethylamino)phenyl)-2-oxoethylthio)-6-methylpyrimidin-4-yl-thio)-N-(2-phenylacetyl)acetohydrazide | C(C)N(C1=CC=C(C=C1)C(CSC1=NC(=CC(=N1)SCC(=O)N(N)C(CC1=CC=CC=C1)=O)C)=O)CC | Library of small molecule structures | NA | NA | NA | 12.14 | NA | NA | NA | NA | NA | NA | NA | Parasite growth inhibition assay (SYBR green) |
HSPMDB002479 | 28917450 | Hsp100 | ClpP | Plasmodium falciparum | Cytosol | NA | Antiparasitic activity | 24 | 2-(6-Methyl-2-(2-morpholino-2-oxoethylthio)pyrimidin-4-ylthio)-N-(2-phenylacetyl)acetohydrazide | CC1=CC(=NC(=N1)SCC(=O)N1CCOCC1)SCC(=O)N(N)C(CC1=CC=CC=C1)=O | Library of small molecule structures | NA | NA | NA | 17.3 | NA | NA | NA | NA | NA | NA | NA | Parasite growth inhibition assay (SYBR green) |
HSPMDB002480 | 28917450 | Hsp100 | ClpP | Plasmodium falciparum | Cytosol | NA | Antiparasitic activity | 25 | 2-(6-Methyl-2-(2-morpholinoethylthio)pyrimidin-4-yl-thio)-N-(2-phenylacetyl)acetohydrazide | CC1=CC(=NC(=N1)SCCN1CCOCC1)SCC(=O)N(N)C(CC1=CC=CC=C1)=O | Library of small molecule structures | NA | NA | NA | 14.4 | NA | NA | NA | NA | NA | NA | NA | Parasite growth inhibition assay (SYBR green) |
HSPMDB002481 | 28917450 | Hsp100 | ClpP | Plasmodium falciparum | Cytosol | NA | Antiparasitic activity | 26 | 2-(2-(2-(4-Cyanophenyl)-2-oxoethylthio)-6-methylpyrimidin-4-yl-thio)-N-(2-phenylacetyl)acetohydrazide | O=C(CSC1=NC=C(C(=O)NCCCc2ccccc2)C(=O)N1Cc3ccccc3)c4ccccc4 | Library of small molecule structures | NA | NA | NA | 12.4 | NA | NA | NA | NA | NA | NA | NA | Parasite growth inhibition assay (SYBR green) |
HSPMDB002482 | 28917450 | Hsp100 | ClpP | Plasmodium falciparum | Cytosol | NA | Antiparasitic activity | 30 | 1-Benzyl-6-oxo-2-(2-oxo-2-phenylethylthio)-N-(3-phenylpropyl)-1,6-dihydropyrimidine-5-carboxamide | COc1ccc(cc1)C(=O)CSC2=NC=C(C(=O)NCCCc3ccccc3)C(=O)N2Cc4ccccc4 | Library of small molecule structures | NA | NA | NA | 20 | NA | NA | NA | NA | NA | NA | NA | Parasite growth inhibition assay (SYBR green) |
HSPMDB002483 | 28917450 | Hsp100 | ClpP | Plasmodium falciparum | Cytosol | NA | Antiparasitic activity | 31 | 1-Benzyl-2-(2-(4-methoxyphenyl)-2-oxoethylthio)-6-oxo-N-(3-phenylpropyl)-1,6 dihydropyrimidine-5-carboxamide | O=C(CSC1=NC=C(C(=O)NCCCc2ccccc2)C(=O)N1Cc3ccccc3)NNC(=O)Cc4ccccc4 | Library of small molecule structures | NA | NA | NA | 2.4 | NA | NA | NA | NA | NA | NA | NA | Parasite growth inhibition assay (SYBR green) |
HSPMDB002484 | 28917450 | Hsp100 | ClpP | Plasmodium falciparum | Cytosol | NA | Antiparasitic activity | 33 | 1-Benzyl-2-(2-morpholinoethylthio)-6-oxo-N-(3-phenylpropyl)-1,6-dihydropyrimidine-5-carboxamide | CCOC(=O)CSC1=NC=C(C(=O)NCCCc2ccccc2)C(=O)N1Cc3ccccc3 | Library of small molecule structures | NA | NA | NA | 9 | NA | NA | NA | NA | NA | NA | NA | Parasite growth inhibition assay (SYBR green) |
HSPMDB002485 | 28917450 | Hsp100 | ClpP | Plasmodium falciparum | Cytosol | NA | Antiparasitic activity | 34 | Ethyl-2-(1-benzyl-6-oxo-5-(3-phenylpropylcarbamoyl)-1,6-dihydropyrimidin-2-ylthio)acetate | CCN(CC)c1ccc(cc1)C(=O)CSC2=NC=C(C(=O)NCCCc3ccccc3)C(=O)N2Cc4ccccc4 | Library of small molecule structures | NA | NA | NA | 15.9 | NA | NA | NA | NA | NA | NA | NA | Parasite growth inhibition assay (SYBR green) |
HSPMDB002486 | 28917450 | Hsp100 | ClpP | Plasmodium falciparum | Cytosol | NA | Antiparasitic activity | 35 | 1-Benzyl-2-(2-(4-(diethylamino)phenyl)-2-oxoethylthio)-6-oxo-N-(3-phenylpropyl)-1,6-dihydropyrimidine-5-carboxamide | Oc1ccc(cc1)C(=O)CSC2=NC=C(C(=O)NCCCc3ccccc3)C(=O)N2Cc4ccccc4 | Library of small molecule structures | NA | NA | NA | 9.2 | NA | NA | NA | NA | NA | NA | NA | Parasite growth inhibition assay (SYBR green) |
HSPMDB002487 | 28917450 | Hsp100 | ClpP | Plasmodium falciparum | Cytosol | NA | Antiparasitic activity | 36 | 1-Benzyl-2-(2-(4-hydroxyphenyl)-2-oxoethylthio)-6-oxo-N-(3-phenylpropyl)-1,6-dihydropyrimidine-5-carboxamide | O=C(CSC1=NC=C(C(=O)NCCCc2ccccc2)C(=O)N1Cc3ccccc3)c4ccc(cc4)C#N | Library of small molecule structures | NA | NA | NA | 9.2 | NA | NA | NA | NA | NA | NA | NA | Parasite growth inhibition assay (SYBR green) |
HSPMDB002488 | 28917450 | Hsp100 | ClpP | Plasmodium falciparum | Cytosol | NA | Antiparasitic activity | 37 | 1-Benzyl-2-(2-(4-cyanophenyl)-2-oxoethylthio)-6-oxo-N-(3-phenylpropyl)-1,6-dihydropyrimidine-5-carboxamide | C(C1=CC=CC=C1)N1C(=NC=C(C1=O)C(=O)NCCCC1=CC=CC=C1)SCC(=O)C1=CC=C(C=C1)C#N | Library of small molecule structures | NA | NA | NA | 13.7 | NA | NA | NA | NA | NA | NA | NA | Parasite growth inhibition assay (SYBR green) |
HSPMDB002489 | 28917450 | Hsp100 | ClpP | Plasmodium falciparum | Cytosol | NA | Antiparasitic activity | 38 | 1-Benzyl-2-(2-morpholino-2-oxoethylthio)-6-oxo-N-(3-phenylpropyl)-1,6-dihydropyrimidine-5-carboxamide | C(C1=CC=CC=C1)N1C(=NC=C(C1=O)C(=O)NCCCC1=CC=CC=C1)SCC(=O)N1CCOCC1 | Library of small molecule structures | NA | NA | NA | 11.7 | NA | NA | NA | NA | NA | NA | NA | Parasite growth inhibition assay (SYBR green) |
HSPMDB002490 | 28917450 | Hsp100 | ClpP | Plasmodium falciparum | Cytosol | NA | Antiparasitic activity | 40 | Ethyl-2-(2-oxo-2-(2-(2-phenylacetyl)hydrazinyl)ethylthio)-pyrimidin-4-one-5-carboxylate | C(C)OC(=O)C=1C(NC(=NC1)SCC(NNC(CC1=CC=CC=C1)=O)=O)=O | Library of small molecule structures | NA | NA | NA | 82.5 | NA | NA | NA | NA | NA | NA | NA | Parasite growth inhibition assay (SYBR green) |
HSPMDB002491 | 28917450 | Hsp100 | ClpP | Plasmodium falciparum | Cytosol | NA | Antiparasitic activity | 42 | Ethyl 2-(2-morpholinoethylthio)-1-(2-oxo-2-phenylethyl)-pyrimidin-4-one-5-carboxylate | O1CCN(CC1)CCSC=1N(C=C(C(N1)=O)C(=O)OCC)CC(C1=CC=CC=C1)=O | Library of small molecule structures | NA | NA | NA | 19 | NA | NA | NA | NA | NA | NA | NA | Parasite growth inhibition assay (SYBR green) |
HSPMDB002492 | 28917450 | Hsp100 | ClpP | Plasmodium falciparum | Cytosol | NA | Antiparasitic activity | 43 | 2-(Morpholinomethyl)-6-oxo-3-phenyl-4,6-dihydropyrimido[2,1-b][1,3]thiazine-7-carboxylic acid | O1CCN(CC1)CC1=C(CN2C(S1)=NC=C(C2=O)C(=O)O)C2=CC=CC=C2 | Library of small molecule structures | NA | NA | NA | 11 | NA | NA | NA | NA | NA | NA | NA | Parasite growth inhibition assay (SYBR green) |
HSPMDB002493 | 28917450 | Hsp100 | ClpP | Plasmodium falciparum | Cytosol | NA | Antiparasitic activity | 44 | 2-(2-Morpholinoethylthio)-N-(3-phenylpropyl)-pyrimidin-4-one-5-carboxamide | O1CCN(CC1)CCSC1=NC=C(C(N1)=O)C(=O)NCCCC1=CC=CC=C1 | Library of small molecule structures | NA | NA | NA | 22 | NA | NA | NA | NA | NA | NA | NA | Parasite growth inhibition assay (SYBR green) |
HSPMDB002494 | 25937012 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | 1 | (3S,4S)-4-{2-[3-(dimethylamino)propanesulfonyl]ethyl}-3-undecyloxetan-2-one | CCCCCCCCCCC[C@H]1[C@H](CCS(=O)(=O)CCCN(C)C)OC1=O | Beta lactone analogue | 99% at 10 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002495 | 25937012 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | 2 | (3S,4S)-4-{3-[3-(dimethylamino)propanesulfonyl]propyl}-3-undecyloxetan-2-one | CCCCCCCCCCC[C@H]1[C@H](CCCS(=O)(=O)CCCN(C)C)OC1=O | Beta lactone analogue | 100% at 10 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002496 | 25937012 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | 3 | (3S,4S)-4-{4-[3-(dimethylamino)propanesulfonyl]butyl}-3-undecyloxetan-2-one | CCCCCCCCCCC[C@H]1[C@H](CCCCS(=O)(=O)CCCN(C)C)OC1=O | Beta lactone analogue | 100% at 10 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002497 | 25937012 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | 4 | (3S,4S)-4-{5-[3-(dimethylamino)propanesulfonyl]pentyl}-3-undecyloxetan-2-one | CCCCCCCCCCC[C@H]1[C@H](CCCCCS(=O)(=O)CCCN(C)C)OC1=O | Beta lactone analogue | 95% at 10 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002498 | 25937012 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | 5 | trimethyl(3-{3-[(2S,3S)-4-oxo-3-undecyloxetan-2-yl]propanesulfonyl}propyl)azanium iodide | [I-].CCCCCCCCCCC[C@H]1[C@H](CCCS(=O)(=O)CCC[N+](C)(C)C)OC1=O | Beta lactone analogue | 100% at 10 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002499 | 25937012 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | 6 | trimethyl(3-{4-[(2S,3S)-4-oxo-3-undecyloxetan-2-yl]butanesulfonyl}propyl)azanium iodide | [I-].CCCCCCCCCCC[C@H]1[C@H](CCCCS(=O)(=O)CCC[N+](C)(C)C)OC1=O | Beta lactone analogue | 64% at 10 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002500 | 25937012 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | 7 | trimethyl(3-{5-[(2S,3S)-4-oxo-3-undecyloxetan-2-yl]pentanesulfonyl}propyl)azanium iodide | [I-].CCCCCCCCCCC[C@H]1[C@H](CCCCCS(=O)(=O)CCC[N+](C)(C)C)OC1=O | Beta lactone analogue | 99% at 10 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002501 | 25937012 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | 8 | (3S,4S)-4-(2-{[3-(dimethylamino)propyl]sulfanyl}ethyl)-3-undecyloxetan-2-one | CCCCCCCCCCC[C@H]1[C@H](CCSCCCN(C)C)OC1=O | Beta lactone analogue | 99% at 10 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002502 | 25937012 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | 9 | (3S,4S)-4-(3-{[3-(dimethylamino)propyl]sulfanyl}propyl)-3-undecyloxetan-2-one | CCCCCCCCCCC[C@H]1[C@H](CCCSCCCN(C)C)OC1=O | Beta lactone analogue | 60% at 10 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002503 | 25937012 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | 10 | (3S,4S)-4-(4-{[3-(dimethylamino)propyl]sulfanyl}butyl)-3-undecyloxetan-2-one | CCCCCCCCCCC[C@H]1[C@H](CCCCSCCCN(C)C)OC1=O | Beta lactone analogue | 100% at 10 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002504 | 25937012 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | 11 | (3S,4S)-4-(5-{[3-(dimethylamino)propyl]sulfanyl}pentyl)-3-undecyloxetan-2-one | CCCCCCCCCCC[C@H]1[C@H](CCCCCSCCCN(C)C)OC1=O | Beta lactone analogue | 99% at 10 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002505 | 25937012 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | 12 | (3R,4R)-4-{2-[3-(dimethylamino)propanesulfonyl]ethyl}-3-undecyloxetan-2-one | CCCCCCCCCCC[C@@H]1[C@@H](CCS(=O)(=O)CCCN(C)C)OC1=O | Beta lactone analogue | 63% at 10 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002506 | 25937012 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | 13 | (3R,4R)-4-{3-[3-(dimethylamino)propanesulfonyl]propyl}-3-undecyloxetan-2-one | CCCCCCCCCCC[C@@H]1[C@@H](CCCS(=O)(=O)CCCN(C)C)OC1=O | Beta lactone analogue | 92% at 10 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002507 | 25937012 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | 14 | (3R,4R)-4-{4-[3-(dimethylamino)propanesulfonyl]butyl}-3-undecyloxetan-2-one | CCCCCCCCCCC[C@@H]1[C@@H](CCCCS(=O)(=O)CCCN(C)C)OC1=O | Beta lactone analogue | 87% at 10 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002508 | 25937012 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | 15 | (3R,4R)-4-{5-[3-(dimethylamino)propanesulfonyl]pentyl}-3-undecyloxetan-2-one | CCCCCCCCCCC[C@@H]1[C@@H](CCCCCS(=O)(=O)CCCN(C)C)OC1=O | Beta lactone analogue | 90% at 10 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002509 | 25937012 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | 16 | trimethyl(3-{3-[(2R,3R)-4-oxo-3-undecyloxetan-2-yl]propanesulfonyl}propyl)azanium iodide | [I-].CCCCCCCCCCC[C@@H]1[C@@H](CCCS(=O)(=O)CCC[N+](C)(C)C)OC1=O | Beta lactone analogue | 93% at 10 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002510 | 25937012 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | 17 | trimethyl(3-{4-[(2R,3R)-4-oxo-3-undecyloxetan-2-yl]butanesulfonyl}propyl)azanium iodide | [I-].CCCCCCCCCCC[C@@H]1[C@@H](CCCCS(=O)(=O)CCC[N+](C)(C)C)OC1=O | Beta lactone analogue | 91% at 10 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002511 | 25937012 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | 18 | trimethyl(3-{5-[(2R,3R)-4-oxo-3-undecyloxetan-2-yl]pentanesulfonyl}propyl)azanium iodide | [I-].CCCCCCCCCCC[C@@H]1[C@@H](CCCCCS(=O)(=O)CCC[N+](C)(C)C)OC1=O | Beta lactone analogue | 91% at 10 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002512 | 25937012 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | 19 | (3R,4R)-4-(2-{[3-(dimethylamino)propyl]sulfanyl}ethyl)-3-undecyloxetan-2-one | CCCCCCCCCCC[C@@H]1[C@@H](CCSCCCN(C)C)OC1=O | Beta lactone analogue | 89% at 10 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002513 | 25937012 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | 20 | (3R,4R)-4-(3-{[3-(dimethylamino)propyl]sulfanyl}propyl)-3-undecyloxetan-2-one | CCCCCCCCCCC[C@@H]1[C@@H](CCCSCCCN(C)C)OC1=O | Beta lactone analogue | 74% at 10 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002514 | 25937012 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | 21 | (3R,4R)-4-(4-{[3-(dimethylamino)propyl]sulfanyl}butyl)-3-undecyloxetan-2-one | CCCCCCCCCCC[C@@H]1[C@@H](CCCCSCCCN(C)C)OC1=O | Beta lactone analogue | 94% at 10 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002515 | 25937012 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | 22 | (3R,4R)-4-(5-{[3-(dimethylamino)propyl]sulfanyl}pentyl)-3-undecyloxetan-2-one | CCCCCCCCCCC[C@@H]1[C@@H](CCCCCSCCCN(C)C)OC1=O | Beta lactone analogue | 85% at 10 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002516 | 25937012 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | 23 | but-3-yn-1-yl N-(2-phenylethyl)carbamate | O=C(NCCC1=CC=CC=C1)OCCC#C | Beta lactone analogue | 8% at 10 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002517 | 25937012 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | 24 | 4-(but-3-yn-1-yl)-3-(non-8-en-1-yl)oxetan-2-one | C=CCCCCCCCC1C(CCC#C)OC1=O | Beta lactone analogue | 95% at 10 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002518 | 25937012 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | 25 | but-3-yn-1-yl N-pentylcarbamate | CCCCCNC(=O)OCCC#C | Beta lactone analogue | 0-5% at 10 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002519 | 25937012 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | 26 | [(but-3-yn-1-yloxy)(hydroxy)methyl](non-8-en-1-yl)amine | OC(NCCCCCCCC=C)OCCC#C | Beta lactone analogue | 0-5% at 10 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002520 | 25937012 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | 27 | methyl undec-10-enoate | COC(=O)CCCCCCCCC=C | Beta lactone analogue | 4% at 10 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002521 | 25937012 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | 28 | tert-butyl undec-10-enoate | CC(C)(C)OC(=O)CCCCCCCCC=C | Beta lactone analogue | 0-5% at 10 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002522 | 25937012 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | 29 | (4S)-4-(but-3-yn-1-yl)-3-dodecyloxetan-2-one | CCCCCCCCCCCCC1[C@H](CCC#C)OC1=O | Beta lactone analogue | 5% at 10 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002523 | 25937012 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | 30 | (3R)-3-(2-phenylethyl)oxetan-2-one | O=C1OC[C@H]1CCC1=CC=CC=C1 | Beta lactone analogue | 0-5% at 10 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002524 | 25937012 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | 31 | (3S)-3-(2-phenylethyl)oxetan-2-one | O=C1OC[C@@H]1CCC1=CC=CC=C1 | Beta lactone analogue | 94% at 10 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002525 | 25937012 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | 32 | 3-(oct-7-en-1-yl)-4-(2-phenylethyl)oxetan-2-one | C=CCCCCCCC1C(CCC2=CC=CC=C2)OC1=O | Beta lactone analogue | 30% at 10 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002526 | 25937012 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | 33 | 3-(oct-7-en-1-yl)-4-[2-(pyridin-3-yl)ethyl]oxetan-2-one | C=CCCCCCCC1C(CCC2=CN=CC=C2)OC1=O | Beta lactone analogue | 100% at 10 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002527 | 25937012 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | 34 | 4-[2-(pyridin-3-yl)ethyl]-3-undecyloxetan-2-one | CCCCCCCCCCCC1C(CCC2=CN=CC=C2)OC1=O | Beta lactone analogue | 5% at 10 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002528 | 25937012 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | 35 | 4-(dimethylamino)-N-{5-[3-(oct-7-en-1-yl)-4-oxooxetan-2-yl]pentyl}benzamide | CN(C)C1=CC=C(C=C1)C(=O)NCCCCCC1OC(=O)C1CCCCCCC=C | Beta lactone analogue | 70% at 10 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002529 | 25937012 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | 36 | tert-butyl N-{11-[3-(oct-7-en-1-yl)-4-oxooxetan-2-yl]undecyl}carbamate | CC(C)(C)OC(=O)NCCCCCCCCCCCC1OC(=O)C1CCCCCCC=C | Beta lactone analogue | 0-5% at 10 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002530 | 25937012 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | 37 | tert-butyl N-{8-[2-(non-8-en-1-yl)-4-oxooxetan-3-yl]octyl}carbamate | CC(C)(C)OC(=O)NCCCCCCCCC1C(CCCCCCCC=C)OC1=O | Beta lactone analogue | 5% at 10 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002531 | 23361916 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | 1 | (3S,4S)-3-decyl-4-{2-[3-(dimethylamino)propanesulfonyl]ethyl}oxetan-2-one | CCCCCCCCCC[C@H]1[C@H](CCS(=O)(=O)CCCN(C)C)OC1=O | Beta lactone (library of enantiopure) | 80% at 100 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002532 | 23361916 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | 2 | (3S,4S)-3-decyl-4-{3-[3-(dimethylamino)propanesulfonyl]propyl}oxetan-2-one | CCCCCCCCCC[C@H]1[C@H](CCCS(=O)(=O)CCCN(C)C)OC1=O | Beta lactone (library of enantiopure) | 95% at 100 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002533 | 23361916 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | 3 | (3S,4S)-3-decyl-4-{4-[3-(dimethylamino)propanesulfonyl]butyl}oxetan-2-one | CCCCCCCCCC[C@H]1[C@H](CCCCS(=O)(=O)CCCN(C)C)OC1=O | Beta lactone (library of enantiopure) | 95% at 100 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002534 | 23361916 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | 5 | (3-{3-[(2S,3S)-3-decyl-4-oxooxetan-2-yl]propanesulfonyl}propyl)trimethylazanium iodide | [I-].CCCCCCCCCC[C@H]1[C@H](CCCS(=O)(=O)CCC[N+](C)(C)C)OC1=O | Beta lactone (library of enantiopure) | 93% at 100 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002535 | 23361916 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | 7 | (3-{5-[(2S,3S)-3-decyl-4-oxooxetan-2-yl]pentanesulfonyl}propyl)trimethylazanium iodide | [I-].CCCCCCCCCC[C@H]1[C@H](CCCCCS(=O)(=O)CCC[N+](C)(C)C)OC1=O | Beta lactone (library of enantiopure) | 93% at 100 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002536 | 23361916 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | 8 | (3S,4S)-3-decyl-4-(2-{[3-(dimethylamino)propyl]sulfanyl}ethyl)oxetan-2-one | CCCCCCCCCC[C@H]1[C@H](CCSCCCN(C)C)OC1=O | Beta lactone (library of enantiopure) | 85% at 100 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002537 | 23361916 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | 10 | (3S,4S)-3-decyl-4-(4-{[3-(dimethylamino)propyl]sulfanyl}butyl)oxetan-2-one | CCCCCCCCCC[C@H]1[C@H](CCCCSCCCN(C)C)OC1=O | Beta lactone (library of enantiopure) | 90% at 100 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002538 | 23361916 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | 11 | (3S,4S)-3-decyl-4-(5-{[3-(dimethylamino)propyl]sulfanyl}pentyl)oxetan-2-one | CCCCCCCCCC[C@H]1[C@H](CCCCCSCCCN(C)C)OC1=O | Beta lactone (library of enantiopure) | 85% at 100 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002539 | 23361916 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | 22 | (3R,4R)-3-decyl-4-(5-{[3-(dimethylamino)propyl]sulfanyl}pentyl)oxetan-2-one | CCCCCCCCCC[C@@H]1[C@@H](CCCCCSCCCN(C)C)OC1=O | Beta lactone (library of enantiopure) | 50% at 100 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002540 | 23361916 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | 30 | 3-decyloxetan-2-one | CCCCCCCCCCC1COC1=O | Beta lactone (library of enantiopure) | 10% at 10 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002541 | 23361916 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | 30 | 3-decyloxetan-2-one | CCCCCCCCCCC1COC1=O | Beta lactone (library of enantiopure) | 50% at 100 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002542 | 23361916 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | 30 | 3-decyloxetan-2-one | CCCCCCCCCCC1COC1=O | Beta lactone (library of enantiopure) | 45% at 1000 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002543 | 23361916 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | 31 | 4-decyloxetan-2-one | CCCCCCCCCCC1CC(=O)O1 | Beta lactone (library of enantiopure) | 1% at 10 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002544 | 23361916 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | 31 | 4-decyloxetan-2-one | CCCCCCCCCCC1CC(=O)O2 | Beta lactone (library of enantiopure) | 1% at 100 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002545 | 23361916 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | 31 | 4-decyloxetan-2-one | CCCCCCCCCCC1CC(=O)O3 | Beta lactone (library of enantiopure) | 5% at 1000 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002546 | 23361916 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | 32 | 3-(2-phenylethyl)oxetan-2-one | O=C1OCC1CCC1=CC=CC=C1 | Beta lactone (library of enantiopure) | 20% at 10 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002547 | 23361916 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | 32 | 3-(2-phenylethyl)oxetan-2-one | O=C1OCC1CCC1=CC=CC=C2 | Beta lactone (library of enantiopure) | 80% at 100 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002548 | 23361916 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | 32 | 3-(2-phenylethyl)oxetan-2-one | O=C1OCC1CCC1=CC=CC=C3 | Beta lactone (library of enantiopure) | 95% at 1000 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002549 | 23361916 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | 33 | 4-(2-phenylethyl)oxetan-2-one | O=C1CC(CCC2=CC=CC=C2)O1 | Beta lactone (library of enantiopure) | 1% at 10 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002550 | 23361916 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | 33 | 4-(2-phenylethyl)oxetan-2-one | O=C1CC(CCC2=CC=CC=C2)O2 | Beta lactone (library of enantiopure) | 2% at 100 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002551 | 23361916 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | 33 | 4-(2-phenylethyl)oxetan-2-one | O=C1CC(CCC2=CC=CC=C2)O3 | Beta lactone (library of enantiopure) | 1% at 1000 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002552 | 23361916 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | 34 | (3R)-3-(2-phenylethyl)oxetan-2-one | O=C1OC[C@H]1CCC1=CC=CC=C1 | Beta lactone (library of enantiopure) | 0-5% at 10 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002553 | 23361916 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | 34 | (3R)-3-(2-phenylethyl)oxetan-2-one | O=C1OC[C@H]1CCC1=CC=CC=C2 | Beta lactone (library of enantiopure) | 0-5% at 100 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002554 | 23361916 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | 34 | (3R)-3-(2-phenylethyl)oxetan-2-one | O=C1OC[C@H]1CCC1=CC=CC=C3 | Beta lactone (library of enantiopure) | 40% at 1000 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002555 | 23361916 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | 35 | (3S)-3-(2-phenylethyl)oxetan-2-one | O=C1OC[C@@H]1CCC1=CC=CC=C1 | Beta lactone (library of enantiopure) | 55% at 10 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002556 | 23361916 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | 35 | (3S)-3-(2-phenylethyl)oxetan-2-one | O=C1OC[C@@H]1CCC1=CC=CC=C2 | Beta lactone (library of enantiopure) | 95% at 100 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002557 | 23361916 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | 35 | (3S)-3-(2-phenylethyl)oxetan-2-one | O=C1OC[C@@H]1CCC1=CC=CC=C3 | Beta lactone (library of enantiopure) | 98% at 1000 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002558 | 23361916 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | 24 | 3-(non-8-en-1-yl)-4-(pent-4-yn-1-yl)oxetan-2-one | [H]C(=C)CCCCCCCC1C(CCCC#C)OC1=O | Beta lactone (library of enantiopure) | 5% at 100 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002559 | 23361916 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | 29 | (3S,4S)-4-(pent-4-yn-1-yl)-3-tridecyloxetan-2-one | CCCCCCCCCCCCC[C@H]1[C@H](CCCC#C)OC1=O | Beta lactone (library of enantiopure) | 13% at 100 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002560 | 23361916 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | 24 | 3-(non-8-en-1-yl)-4-(pent-4-yn-1-yl)oxetan-2-one | [H]C(=C)CCCCCCCC1C(CCCC#C)OC1=O | Beta lactone (library of enantiopure) | 80% at 100 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002561 | 23361916 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | 29 | (3S,4S)-4-(pent-4-yn-1-yl)-3-tridecyloxetan-2-one | CCCCCCCCCCCCC[C@H]1[C@H](CCCC#C)OC1=O | Beta lactone (library of enantiopure) | 15% at 100 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002562 | 23361916 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | 24 | 3-(non-8-en-1-yl)-4-(pent-4-yn-1-yl)oxetan-2-one | [H]C(=C)CCCCCCCC1C(CCCC#C)OC1=O | Beta lactone (library of enantiopure) | 70% at 100 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002563 | 23361916 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | 29 | (3S,4S)-4-(pent-4-yn-1-yl)-3-tridecyloxetan-2-one | CCCCCCCCCCCCC[C@H]1[C@H](CCCC#C)OC1=O | Beta lactone (library of enantiopure) | 20% at 100 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002564 | 21855356 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | 1 | (3R,4R)-3-(8-Nonenyl)-4-(2-phenylethyl)oxetan-2-one | C(CCCCCCC=C)[C@H]1C(O[C@@H]1CCC1=CC=CC=C1)=O | Beta lactone analogue | 30% at 10 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002565 | 21855356 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | 2 | (3R,4R)-3-(8-Nonenyl)-4-(2-(3-pyridyl)ethyl)oxetan-2-one | C(CCCCCCC=C)[C@H]1C(O[C@@H]1CCC=1C=NC=CC1)=O | Beta lactone analogue | 90% at 10 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002566 | 21855356 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | 4 | (3R,4R)-4-(4-(N,N-Dimethylamino)benzamido-5-pentyl)-3-(non-8-enyl)oxetan-2-one | CN(C)C1=CC=C(C(=O)NC(CCCC)[C@H]2[C@H](C(O2)=O)CCCCCCCC=C)C=C1 | Beta lactone analogue | 55% at 10 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002567 | 21855356 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | 1 | (3R,4R)-3-(8-Nonenyl)-4-(2-phenylethyl)oxetan-2-one | C(CCCCCCC=C)[C@H]1C(O[C@@H]1CCC1=CC=CC=C1)=O | Beta lactone analogue | 30% at 20 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002568 | 21855356 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | 2 | (3R,4R)-3-(8-Nonenyl)-4-(2-(3-pyridyl)ethyl)oxetan-2-one | C(CCCCCCC=C)[C@H]1C(O[C@@H]1CCC=1C=NC=CC1)=O | Beta lactone analogue | 92% at 20 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002569 | 21855356 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | 4 | (3R,4R)-4-(4-(N,N-Dimethylamino)benzamido-5-pentyl)-3-(non-8-enyl)oxetan-2-one | CN(C)C1=CC=C(C(=O)NC(CCCC)[C@H]2[C@H](C(O2)=O)CCCCCCCC=C)C=C1 | Beta lactone analogue | 65% at 20 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002570 | 21855356 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | 1 | (3R,4R)-3-(8-Nonenyl)-4-(2-phenylethyl)oxetan-2-one | C(CCCCCCC=C)[C@H]1C(O[C@@H]1CCC1=CC=CC=C1)=O | Beta lactone analogue | 25% at 40 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002571 | 21855356 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | 2 | (3R,4R)-3-(8-Nonenyl)-4-(2-(3-pyridyl)ethyl)oxetan-2-one | C(CCCCCCC=C)[C@H]1C(O[C@@H]1CCC=1C=NC=CC1)=O | Beta lactone analogue | 90% at 40 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002572 | 21855356 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | 4 | (3R,4R)-4-(4-(N,N-Dimethylamino)benzamido-5-pentyl)-3-(non-8-enyl)oxetan-2-one | CN(C)C1=CC=C(C(=O)NC(CCCC)[C@H]2[C@H](C(O2)=O)CCCCCCCC=C)C=C1 | Beta lactone analogue | 50% at 40 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002573 | 21855356 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | 6 | (3R,4R)-3-(N-(tert-Butoxycarbonyl)-9-aminononyl)-4-(dec-9-enyl)oxetan-2-one | C(C)(C)(C)OC(=O)NCCCCCCCCC[C@H]1C(O[C@@H]1CCCCCCCCC=C)=O | Beta lactone analogue | 12% at 200 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002574 | 21855356 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | 6 | (3R,4R)-3-(N-(tert-Butoxycarbonyl)-9-aminononyl)-4-(dec-9-enyl)oxetan-2-one | C(C)(C)(C)OC(=O)NCCCCCCCCC[C@H]1C(O[C@@H]1CCCCCCCCC=C)=O | Beta lactone analogue | 15% at 400 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002575 | 21855356 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | 6 | (3R,4R)-3-(N-(tert-Butoxycarbonyl)-9-aminononyl)-4-(dec-9-enyl)oxetan-2-one | C(C)(C)(C)OC(=O)NCCCCCCCCC[C@H]1C(O[C@@H]1CCCCCCCCC=C)=O | Beta lactone analogue | 20% at 600 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002576 | 21855356 | Hsp100 | ClpP | Bacteria | Cytosol | Inhibition of peptidase activity | NA | 6 | (3R,4R)-3-(N-(tert-Butoxycarbonyl)-9-aminononyl)-4-(dec-9-enyl)oxetan-2-one | C(C)(C)(C)OC(=O)NCCCCCCCCC[C@H]1C(O[C@@H]1CCCCCCCCC=C)=O | Beta lactone analogue | 10% at 800 uM | NA | NA | NA | NA | NA | NA | NA | Nucleotide binding domain | Peptidase assay (SLY-AMC) | NA | NA |
HSPMDB002577 | 30543804 | Hsp100 | ClpP1P2 | Bacteria | Cytosol | Inhibition of protease activity | NA | DCC | Dicyclohexylcarbodiimide | C1CCC(CC1)N=C=NC2CCCCC2 | GSK Library collection | NA | NA | NA | 80 | NA | NA | NA | NA | Nucleotide binding domain | Substrate degradation assay (GFP-ssrA) | NA | NA |
HSPMDB002578 | 30543804 | Hsp100 | ClpC1 | Bacteria | Cytosol | Inhibition of protease activity | NA | ecumicin | (2S,3R)-2-[[(2S)-2-[[(2S)-2-(dimethylamino)-3-methylbutanoyl]amino]-3-methylbutanoyl]-methylamino]-N-[(3S,6S,9S,12S,15S,18S,21S,24S,27S,30S,31R)-27-[(1R)-1-hydroxyethyl]-6-[(R)-hydroxy(phenyl)methyl]-12-[(4-methoxy-1H-indol-3-yl)methyl]-13,16,22,28,31-pentamethyl-21-(2-methylpropyl)-2,5,8,11,14,17,20,23,26,29-decaoxo-3,9,15,18,24-penta(propan-2-yl)-1-oxa-4,7,10,13,16,19,22,25,28-nonazacyclohentriacont-30-yl]-3-methylpentanamide | CCC(C)C(C(=O)NC1C(OC(=O)C(NC(=O)C(NC(=O)C(NC(=O)C(N(C(=O)C(N(C(=O)C(NC(=O)C(N(C(=O)C(NC(=O)C(N(C1=O)C)C(C)O)C(C)C)C)CC(C)C)C(C)C)C)C(C)C)C)CC2=CNC3=C2C(=CC=C3)OC)C(C)C)C(C4=CC=CC=C4)O)C(C)C)C)N(C)C(=O)C(C(C)C)NC(=O)C(C(C)C)N(C)C | GSK Library collection | NA | NA | NA | 4 | NA | NA | NA | NA | Nucleotide binding domain | Substrate degradation assay (GFP-ssrA) | NA | NA |
HSPMDB002579 | 30126533 | Hsp100 | ClpP | Human | Mitochondria | Inhibition of protease activity | NA | ADEP-02 | NA | O=C([C@H](C)NC([C@@]1([H])N(CCCC1)C([C@@]2([H])N(C([C@@H](NC([C@H](CC3=CC=CC=C3)NC(/C=C/CCCC)=O)=O)CO4)=O)CCC2)=O)=O)N5CCC[C@@]5([H])C4=O | Acyldepsipeptide analogue | NA | NA | NA | NA | NA | NA | 1.08 at 25 uM | NA | Nucleotide binding domain | Substrate degradation assay (FITC-casein) | NA | NA |
HSPMDB002580 | 30126533 | Hsp100 | ClpP | Human | Mitochondria | Inhibition of protease activity | NA | ADEP-10 | NA | O=C([C@H](C)NC([C@@]1([H])N(CCCC1)C([C@@]2([H])N(C([C@@H](NC([C@H](CC3=CC=CC=C3)NC(/C=C/CCCC)=O)=O)CO4)=O)CCC2)=O)=O)N5C[C@H](C)C[C@@]5([H])C4=O | Acyldepsipeptide analogue | NA | NA | NA | NA | NA | NA | 1.07 at 25 uM | NA | Nucleotide binding domain | Substrate degradation assay (FITC-casein) | NA | NA |
HSPMDB002581 | 30126533 | Hsp100 | ClpP | Human | Mitochondria | Inhibition of protease activity | NA | ADEP-18 | NA | O=C([C@H](C)NC([C@H](C)N(C)C([C@@]1([H])N(C([C@@H](NC([C@H](CC2=CC=CC=C2)NC(/C=C/CCCCC)=O)=O)CO3)=O)CCC1)=O)=O)N4CCC[C@@]4([H])C3=O | Acyldepsipeptide analogue | NA | NA | NA | NA | NA | NA | 1.06 at 25 uM | NA | Nucleotide binding domain | Substrate degradation assay (FITC-casein) | NA | NA |
HSPMDB002582 | 30126533 | Hsp100 | ClpP | Human | Mitochondria | Inhibition of protease activity | NA | ADEP-06 | NA | O=C([C@H](C)NC([C@H](C)N(C)C([C@@]1([H])N(C([C@@H](NC([C@H](CC2=CC(F)=CC(F)=C2)NC(/C=C/CCCC)=O)=O)CO3)=O)CCC1)=O)=O)N4C[C@H](C)C[C@@]4([H])C3=O | Acyldepsipeptide analogue | NA | NA | NA | NA | NA | NA | 1.04 at 25 uM | NA | Nucleotide binding domain | Substrate degradation assay (FITC-casein) | NA | NA |
HSPMDB002583 | 30126533 | Hsp100 | ClpP | Human | Mitochondria | Inhibition of protease activity | NA | ADEP-15 | NA | O=C([C@H](C)NC([C@@](CCC1)([H])N1C([C@@]2([H])N(C([C@@H](NC([C@H](CC3=CC(F)=CC(F)=C3)NC(/C=C/CCCC)=O)=O)CO4)=O)CCC2)=O)=O)N5C[C@H](C)C[C@@]5([H])C4=O | Acyldepsipeptide analogue | NA | NA | NA | NA | NA | NA | 1.04 at 25 uM | NA | Nucleotide binding domain | Substrate degradation assay (FITC-casein) | NA | NA |
HSPMDB002584 | 30126533 | Hsp100 | ClpP | Human | Mitochondria | Inhibition of protease activity | NA | ADEP-20 | NA | O=C([C@H](C)NC([C@@]1([H])N(CCCC1)C([C@@]2([H])N(C([C@@H](NC([C@H](CC3=CC(F)=CC=C3)NC(/C=C/CCC)=O)=O)CO4)=O)CCC2)=O)=O)N5C[C@H](C)C[C@@]5([H])C4=O | Acyldepsipeptide analogue | NA | NA | NA | NA | NA | NA | 1.03 at 25 uM | NA | Nucleotide binding domain | Substrate degradation assay (FITC-casein) | NA | NA |
HSPMDB002585 | 30126533 | Hsp100 | ClpP | Human | Mitochondria | Inhibition of protease activity | NA | ADEP-32 | NA | O=C([C@H](C)NC([C@@]1([H])N(CCCC1)C([C@@]2([H])N(C([C@@H](NC([C@H](CC3=CC(F)=CC(F)=C3)NC(/C=C/CCCC)=O)=O)CN4)=O)CCC2)=O)=O)N5C[C@H](C)C[C@@]5([H])C4=O | Acyldepsipeptide analogue | NA | NA | NA | NA | NA | NA | 1.03 at 25 uM | NA | Nucleotide binding domain | Substrate degradation assay (FITC-casein) | NA | NA |
HSPMDB002586 | 30126533 | Hsp100 | ClpP | Human | Mitochondria | Inhibition of protease activity | NA | ADEP-04 | NA | O=C([C@H](C)NC([C@H](C)N(C)C([C@@]1([H])N(C([C@@H](NC([C@H](CC2=CC=CC=C2)NC(/C=C/C=C/CCC)=O)=O)CO3)=O)CCC1)=O)=O)N4C[C@H](C)C[C@@]4([H])C3=O | Acyldepsipeptide analogue | NA | NA | NA | NA | NA | NA | 1.02 at 25 uM | NA | Nucleotide binding domain | Substrate degradation assay (FITC-casein) | NA | NA |
HSPMDB002587 | 30126533 | Hsp100 | ClpP | Human | Mitochondria | Inhibition of protease activity | NA | ADEP-13 | NA | O=C([C@H](C)NC([C@@]1([H])N(CCCC1)C([C@@]2([H])N(C([C@@H](NC([C@H](CC3=CC(F)=CC(F)=C3)NC(/C=C/CC4CC4)=O)=O)[C@H](C)O5)=O)CCC2)=O)=O)N6C[C@H](C)C[C@@]6([H])C5=O | Acyldepsipeptide analogue | NA | NA | NA | NA | NA | NA | 1.02 at 25 uM | NA | Nucleotide binding domain | Substrate degradation assay (FITC-casein) | NA | NA |
HSPMDB002588 | 30126533 | Hsp100 | ClpP | Human | Mitochondria | Inhibition of protease activity | NA | ADEP-17 | NA | O=C([C@H](C)NC([C@@]1([H])N(CCCC1)C([C@@]2([H])N(C([C@@H](NC([C@H](CC3=CC(F)=CC(F)=C3)NC(/C=C/CC4CCCCC4)=O)=O)[C@H](C)O5)=O)CCC2)=O)=O)N6C[C@H](C)C[C@@]6([H])C5=O | Acyldepsipeptide analogue | NA | NA | NA | NA | NA | NA | 1.02 at 25 uM | NA | Nucleotide binding domain | Substrate degradation assay (FITC-casein) | NA | NA |
HSPMDB002589 | 30126533 | Hsp100 | ClpP | Human | Mitochondria | Inhibition of protease activity | NA | ADEP-21 | NA | O=C([C@H](C)NC([C@@]1([H])N(CCCC1)C([C@@]2([H])N(C([C@@H](NC([C@H](CC3CCCCC3)NC(/C=C/CCCC)=O)=O)CO4)=O)CCC2)=O)=O)N5C[C@H](C)C[C@@]5([H])C4=O | Acyldepsipeptide analogue | NA | NA | NA | NA | NA | NA | 1.00 at 25 uM | NA | Nucleotide binding domain | Substrate degradation assay (FITC-casein) | NA | NA |
HSPMDB002590 | 30126533 | Hsp100 | ClpP | Human | Mitochondria | Inhibition of protease activity | NA | ADEP-14 | NA | O=C([C@H](C)NC([C@@]1([H])N(CCCC1)C([C@@]2([H])N(C([C@@H](NC([C@H](CC3=CC(F)=CC(F)=C3)NC(/C=C/C=C/CCC)=O)=O)[C@H](C)O4)=O)CCC2)=O)=O)N5C[C@H](C)C[C@@]5([H])C4=O | Acyldepsipeptide analogue | NA | NA | NA | NA | NA | NA | 0.99 at 25 uM | NA | Nucleotide binding domain | Substrate degradation assay (FITC-casein) | NA | NA |
HSPMDB002591 | 30126533 | Hsp100 | ClpP | Human | Mitochondria | Inhibition of protease activity | NA | ADEP-30 | NA | O=C([C@H](C)NC([C@@]1([H])N(CC[C@H](C)C1)C([C@@]2([H])N(C([C@@H](NC([C@H](CC3=CC(F)=CC(F)=C3)NC(/C=C/CCCC)=O)=O)CO4)=O)CCC2)=O)=O)N5C[C@H](C)C[C@@]5([H])C4=O | Acyldepsipeptide analogue | NA | NA | NA | NA | NA | NA | 0.98 at 25 uM | NA | Nucleotide binding domain | Substrate degradation assay (FITC-casein) | NA | NA |
HSPMDB002592 | 30126533 | Hsp100 | ClpP | Human | Mitochondria | Inhibition of protease activity | NA | ADEP-05 | NA | O=C([C@H](C)NC([C@H](C)N(C)C([C@@]1([H])N(C([C@@H](NC([C@H](CC2=CC=CC=C2)NC(/C=C/C=C/C=C/C)=O)=O)CO3)=O)CCC1)=O)=O)N4C[C@H](C)C[C@@]4([H])C3=O | Acyldepsipeptide analogue | NA | NA | NA | NA | NA | NA | 0.98 at 25 uM | NA | Nucleotide binding domain | Substrate degradation assay (FITC-casein) | NA | NA |
HSPMDB002593 | 30126533 | Hsp100 | ClpP | Human | Mitochondria | Inhibition of protease activity | NA | ADEP-25 | NA | O=C([C@H](CC)NC([C@@]1([H])N(CCCC1)C([C@@]2([H])N(C([C@@H](NC([C@H](CC3=CC(F)=CC(F)=C3)NC(/C=C/CCCC)=O)=O)CO4)=O)CCC2)=O)=O)N5C[C@H](C)C[C@@]5([H])C4=O | Acyldepsipeptide analogue | NA | NA | NA | NA | NA | NA | 0.97 at 25 uM | NA | Nucleotide binding domain | Substrate degradation assay (FITC-casein) | NA | NA |
HSPMDB002594 | 30126533 | Hsp100 | ClpP | Human | Mitochondria | Inhibition of protease activity | NA | ADEP-08 | NA | O=C([C@H](C)NC([C@H](C)N(C)C([C@@]1([H])N(C([C@@H](NC([C@H](CC2=CC=CC=C2)NC(/C=C/C=C/C=C/C)=O)=O)CO3)=O)CCC1)=O)=O)N4CCC[C@@]4([H])C3=O | Acyldepsipeptide analogue | NA | NA | NA | NA | NA | NA | 0.97 at 25 uM | NA | Nucleotide binding domain | Substrate degradation assay (FITC-casein) | NA | NA |
HSPMDB002595 | 30126533 | Hsp100 | ClpP | Human | Mitochondria | Inhibition of protease activity | NA | ADEP-41 | NA | O=C([C@H](C)NC([C@@]1([H])N(CCCC1)C([C@@]2([H])N(C([C@@H](NC([C@H](CC3=CC(F)=CC(F)=C3)NC(/C=C/CCCC)=O)=O)[C@H](C)O4)=O)CCC2)=O)=O)N5CCC[C@@]5([H])C4=O | Acyldepsipeptide analogue | NA | NA | NA | NA | NA | NA | 0.96 at 25 uM | NA | Nucleotide binding domain | Substrate degradation assay (FITC-casein) | NA | NA |
HSPMDB002596 | 30126533 | Hsp100 | ClpP | Human | Mitochondria | Inhibition of protease activity | NA | ADEP-01 | NA | O=C([C@H](C)NC([C@H](C)N(C)C([C@@]1([H])N(C([C@@H](NC([C@H](CC2=CC=CC=C2)NC(/C=C/CCCC)=O)=O)CO3)=O)CCC1)=O)=O)N4CCC[C@@]4([H])C3=O | Acyldepsipeptide analogue | NA | NA | NA | NA | NA | NA | 0.96 at 25 uM | NA | Nucleotide binding domain | Substrate degradation assay (FITC-casein) | NA | NA |
HSPMDB002597 | 30126533 | Hsp100 | ClpP | Human | Mitochondria | Inhibition of protease activity | NA | ADEP-28 | NA | O=C([C@H](C)NC([C@@]1([H])N(CC[C@H](C)C1)C([C@@]2([H])N(C([C@@H](NC([C@H](CC3=CC(F)=CC(F)=C3)NC(/C=C/CCCC)=O)=O)[C@H](C)O4)=O)CCC2)=O)=O)N5CCC[C@@]5([H])C4=O | Acyldepsipeptide analogue | NA | NA | NA | NA | NA | NA | 0.95 at 25 uM | NA | Nucleotide binding domain | Substrate degradation assay (FITC-casein) | NA | NA |
HSPMDB002598 | 30126533 | Hsp100 | ClpP | Human | Mitochondria | Inhibition of protease activity | NA | ADEP-38 | NA | O=C([C@H](C)NC([C@@]1([H])N(CC[C@H](C)C1)C([C@@]2([H])N(C([C@@H](NC([C@H](CC3=CC(F)=CC(F)=C3)NC(/C=C/CCCC)=O)=O)[C@H](C)O4)=O)CCC2)=O)=O)N5C[C@H](C)C[C@@]5([H])C4=O | Acyldepsipeptide analogue | NA | NA | NA | NA | NA | NA | 0.95 at 25 uM | NA | Nucleotide binding domain | Substrate degradation assay (FITC-casein) | NA | NA |
HSPMDB002599 | 30126533 | Hsp100 | ClpP | Human | Mitochondria | Inhibition of protease activity | NA | ADEP-37 | NA | O=C([C@H](C)NC([C@@]1([H])N(CCC2=C1C=CC=C2)C([C@@]3([H])N(C([C@@H](NC([C@H](CC4=CC(F)=CC(F)=C4)NC(/C=C/CCCC)=O)=O)CO5)=O)CCC3)=O)=O)N6C[C@H](C)C[C@@]6([H])C5=O | Acyldepsipeptide analogue | NA | NA | NA | NA | NA | NA | 0.92 at 25 uM | NA | Nucleotide binding domain | Substrate degradation assay (FITC-casein) | NA | NA |
HSPMDB002600 | 30126533 | Hsp100 | ClpP | Human | Mitochondria | Inhibition of protease activity | NA | ADEP-29 | NA | O=C([C@H](C)NC([C@@]1([H])N(CCCC1)C([C@@]2([H])N(C([C@@H](NC([C@H](CC3=CC(F)=CC(F)=C3)NC(/C=C/CCCC)=O)=O)[C@H](C)O4)=O)CCC2)=O)=O)N5C[C@H](C)C[C@@]5([H])C4=O | Acyldepsipeptide analogue | NA | NA | NA | NA | NA | NA | 0.92 at 25 uM | NA | Nucleotide binding domain | Substrate degradation assay (FITC-casein) | NA | NA |
HSPMDB002601 | 30126533 | Hsp100 | ClpP | Human | Mitochondria | Inhibition of protease activity | NA | ADEP-43 | NA | O=C([C@H](C)NC([C@@]1([H])N(CCCC1)C([C@@]2([H])N(C([C@@H](NC([C@H](CC3=CC(C=CC=C4)=C4C=C3)NC(/C=C/CCCC)=O)=O)CO5)=O)CCC2)=O)=O)N6C[C@H](C)C[C@@]6([H])C5=O | Acyldepsipeptide analogue | NA | NA | NA | NA | NA | NA | 0.87 at 25 uM | NA | Nucleotide binding domain | Substrate degradation assay (FITC-casein) | NA | NA |
HSPMDB002602 | 30126533 | Hsp100 | ClpP | Human | Mitochondria | Inhibition of protease activity | NA | ADEP-42 | NA | O=C([C@H](C)NC([C@@]1([H])N(CCCC1)C([C@@]2([H])N(C([C@@H](NC([C@H](CC3=CSC4=C3C=CC=C4)NC(/C=C/CCCC)=O)=O)CO5)=O)CCC2)=O)=O)N6C[C@H](C)C[C@@]6([H])C5=O | Acyldepsipeptide analogue | NA | NA | NA | NA | NA | NA | 0.87 at 25 uM | NA | Nucleotide binding domain | Substrate degradation assay (FITC-casein) | NA | NA |
HSPMDB002603 | 30126533 | Hsp100 | ClpP | Human | Mitochondria | Inhibition of protease activity | NA | ADEP-26 | NA | O=C([C@H](C)NC([C@H](C)N(C)C([C@@]1([H])N(C([C@@H](NC([C@H](CC2=CC=CC=C2)NC(/C=C/C=C/C)=O)=O)CO3)=O)CCC1)=O)=O)N4CCC[C@@]4([H])C3=O | Acyldepsipeptide analogue | NA | NA | NA | NA | NA | NA | 0.86 at 25 uM | NA | Nucleotide binding domain | Substrate degradation assay (FITC-casein) | NA | NA |
HSPMDB002604 | 30126533 | Hsp100 | ClpP | Human | Mitochondria | Inhibition of protease activity | NA | ADEP-39 | NA | O=C([C@H](C)NC([C@@]1([H])N(CC[C@H](C)C1)C([C@@]2([H])N(C([C@@H](NC([C@H](CC3=CC(F)=CC(F)=C3)NC(/C=C/C4=CC=CC(C(F)(F)F)=C4)=O)=O)[C@H](C)O5)=O)CCC2)=O)=O)N6C[C@H](C)C[C@@]6([H])C5=O | Acyldepsipeptide analogue | NA | NA | NA | NA | NA | NA | 0.78 at 25 uM | NA | Nucleotide binding domain | Substrate degradation assay (FITC-casein) | NA | NA |
HSPMDB002605 | 30126533 | Hsp100 | ClpP | Human | Mitochondria | Inhibition of protease activity | NA | ADEP-11 | NA | O=C([C@H](C)NC([C@@]1([H])N(CCCC1)C([C@@]2([H])N(C([C@@H](NC([C@H](CC3=CC(F)=CC(F)=C3)NC(/C=C/CCCC)=O)=O)CO4)=O)CCC2)=O)=O)N5C[C@H](C)C[C@@]5([H])C4=O | Acyldepsipeptide analogue | NA | NA | NA | NA | NA | NA | 0.77 at 25 uM | NA | Nucleotide binding domain | Substrate degradation assay (FITC-casein) | NA | NA |
HSPMDB002606 | 30126533 | Hsp100 | ClpP | Human | Mitochondria | Inhibition of protease activity | NA | ADEP-09 | NA | O=C([C@H](C)NC([C@H](C)N(C)C([C@@]1([H])N(C([C@@H](NC([C@H](CC2=CC=CC=C2)NC(/C=C/CCC)=O)=O)CO3)=O)CCC1)=O)=O)N4CCC[C@@]4([H])C3=O | Acyldepsipeptide analogue | NA | NA | NA | NA | NA | NA | 0.76 at 25 uM | NA | Nucleotide binding domain | Substrate degradation assay (FITC-casein) | NA | NA |
HSPMDB002607 | 30126533 | Hsp100 | ClpP | Human | Mitochondria | Inhibition of protease activity | NA | ADEP-03 | NA | O=C([C@H](C)NC([C@H](C)N(C)C([C@@]1([H])N(C([C@@H](NC([C@H](CC2=CC=CC=C2)NC(/C=C/C=C/C)=O)=O)CO3)=O)CCC1)=O)=O)N4C[C@H](C)C[C@@]4([H])C3=O | Acyldepsipeptide analogue | NA | NA | NA | NA | NA | NA | 0.66 at 25 uM | NA | Nucleotide binding domain | Substrate degradation assay (FITC-casein) | NA | NA |
HSPMDB002608 | 30126533 | Hsp100 | ClpP | Human | Mitochondria | Inhibition of protease activity | NA | ADEP-27 | NA | O=C([C@H](C)NC([C@H](C)N(C)C([C@@]1([H])N(C([C@@H](NC([C@H](CC2=CC=CC=C2)NC(C#CCCCCC)=O)=O)CO3)=O)CCC1)=O)=O)N4CCC[C@@]4([H])C3=O | Acyldepsipeptide analogue | NA | NA | NA | NA | NA | NA | 0.64 at 25 uM | NA | Nucleotide binding domain | Substrate degradation assay (FITC-casein) | NA | NA |
HSPMDB002609 | 30126533 | Hsp100 | ClpP | Human | Mitochondria | Inhibition of protease activity | NA | ADEP-07 | NA | O=C([C@H](C)NC([C@@]1([H])N(CCCC1)C([C@@]2([H])N(C([C@@H](NC([C@H](CC3=CC(F)=CC(F)=C3)NC(/C=C/CCCCC(O)=O)=O)=O)[C@H](C)O4)=O)CCC2)=O)=O)N5C[C@H](C)C[C@@]5([H])C4=O | Acyldepsipeptide analogue | NA | NA | NA | NA | NA | NA | 0.61 at 25 uM | NA | Nucleotide binding domain | Substrate degradation assay (FITC-casein) | NA | NA |
HSPMDB002610 | 30126533 | Hsp100 | ClpP | Human | Mitochondria | Inhibition of protease activity | NA | ADEP-44 | NA | O=C([C@H](C)NC([C@@]1([H])N(CC[C@H](C)C1)C([C@@]2([H])N(C([C@@H](NC([C@H](CC3=CC(F)=CC(F)=C3)NC(/C=C/C4=CC=CC=C4C(F)(F)F)=O)=O)[C@H](C)O5)=O)CCC2)=O)=O)N6C[C@H](C)C[C@@]6([H])C5=O | Acyldepsipeptide analogue | NA | NA | NA | NA | NA | NA | 0.42 at 25 uM | NA | Nucleotide binding domain | Substrate degradation assay (FITC-casein) | NA | NA |
HSPMDB002611 | 30126533 | Hsp100 | ClpP | Human | Mitochondria | Inhibition of protease activity | NA | ADEP-12 | NA | O=C([C@H](C)NC([C@H](C)N(C)C([C@@]1([H])N(C([C@@H](NC([C@H](CC2=CC=CC=C2)NC(C#CCCCC)=O)=O)CO3)=O)CCC1)=O)=O)N4CCC[C@@]4([H])C3=O | Acyldepsipeptide analogue | NA | NA | NA | NA | NA | NA | 0.36 at 25 uM | NA | Nucleotide binding domain | Substrate degradation assay (FITC-casein) | NA | NA |
HSPMDB002612 | 30126533 | Hsp100 | ClpP | Human | Mitochondria | Inhibition of protease activity | NA | ADEP-19 | NA | O=C([C@H](C)NC([C@H](C)N(C)C([C@@]1([H])N(C([C@@H](NC([C@H](CC2=CC=CC=C2)NC(/C=C\CCCC)=O)=O)CO3)=O)CCC1)=O)=O)N4CCC[C@@]4([H])C3=O | Acyldepsipeptide analogue | NA | NA | NA | NA | NA | NA | 0.34 at 25 uM | NA | Nucleotide binding domain | Substrate degradation assay (FITC-casein) | NA | NA |
HSPMDB002613 | 30126533 | Hsp100 | ClpP | Human | Mitochondria | Inhibition of protease activity | NA | ADEP-45 | NA | O=C([C@H](C)NC([C@@]1([H])N(CCCC1)C([C@@]2([H])N(C([C@@H](NC([C@H](CC(C(F)=C3F)=C(F)C(F)=C3F)NC(/C=C/CCCC)=O)=O)CO4)=O)CCC2)=O)=O)N5C[C@H](C)C[C@@]5([H])C4=O | Acyldepsipeptide analogue | NA | NA | NA | NA | NA | NA | 0.29 at 25 uM | NA | Nucleotide binding domain | Substrate degradation assay (FITC-casein) | NA | NA |
HSPMDB002614 | 30126533 | Hsp100 | ClpP | Human | Mitochondria | Inhibition of protease activity | NA | ADEP-23 | NA | O=C([C@H](C)NC([C@H](C)N(C)C([C@@]1([H])N(C([C@@H](NC([C@H](CC2=CC=CC=C2)NC(C#CCCC)=O)=O)CO3)=O)CCC1)=O)=O)N4CCC[C@@]4([H])C3=O | Acyldepsipeptide analogue | NA | NA | NA | NA | NA | NA | 0.12 at 25 uM | NA | Nucleotide binding domain | Substrate degradation assay (FITC-casein) | NA | NA |
HSPMDB002615 | 30126533 | Hsp100 | ClpP | Human | Mitochondria | Inhibition of protease activity | NA | ADEP-33 | NA | O=C([C@H](C)NC([C@H](C)N(C)C([C@@]1([H])N(C([C@@H](NC([C@H](CC2=CC=CC=C2)NC(/C=C\CCC)=O)=O)CO3)=O)CCC1)=O)=O)N4CCC[C@@]4([H])C3=O | Acyldepsipeptide analogue | NA | NA | NA | NA | NA | NA | 0.07 at 25 uM | NA | Nucleotide binding domain | Substrate degradation assay (FITC-casein) | NA | NA |
HSPMDB002616 | 30126533 | Hsp100 | ClpP | Human | Mitochondria | Inhibition of protease activity | NA | ADEP-16 | NA | O=C([C@H](C)NC([C@H](C)N(C)C([C@@]1([H])N(C([C@@H](NC([C@H](CC2=CC=CC=C2)NC(OCC3=CC=CC=C3)=O)=O)CO4)=O)CCC1)=O)=O)N5C[C@H](C)C[C@@]5([H])C4=O | Acyldepsipeptide analogue | NA | NA | NA | NA | NA | NA | 0.06 at 25 uM | NA | Nucleotide binding domain | Substrate degradation assay (FITC-casein) | NA | NA |
HSPMDB002617 | 30126533 | Hsp100 | ClpP | Human | Mitochondria | Inhibition of protease activity | NA | ADEP-46 | NA | O=C([C@H](C)NC([C@H](C)N(C)C([C@@]1([H])N(C([C@@H](NC([C@H](CC2=CC=CC=C2)NC(/C=C/C=C/COC3([H])OCCCC3)=O)=O)CO4)=O)CCC1)=O)=O)N5C[C@H](C)C[C@@]5([H])C4=O | Acyldepsipeptide analogue | NA | NA | NA | NA | NA | NA | 0.02 at 25 uM | NA | Nucleotide binding domain | Substrate degradation assay (FITC-casein) | NA | NA |
HSPMDB002618 | 30126533 | Hsp100 | ClpP | Human | Mitochondria | Inhibition of protease activity | NA | ADEP-36 | NA | O=C([C@H](C)NC([C@H](C)N(C)C([C@@]1([H])N(C([C@@H](NC([C@H](CC2=CC=CC=C2)NC(/C=C/C=C/CO)=O)=O)CO3)=O)CCC1)=O)=O)N4C[C@H](C)C[C@@]4([H])C3=O | Acyldepsipeptide analogue | NA | NA | NA | NA | NA | NA | 0 at 25 uM | NA | Nucleotide binding domain | Substrate degradation assay (FITC-casein) | NA | NA |
HSPMDB002619 | 30126533 | Hsp100 | ClpP | Human | Mitochondria | Inhibition of protease activity | NA | ADEP-24 | NA | O=C([C@H](C)NC([C@@]1([H])N(CCCC1)C([C@@]2([H])N(C([C@@H](NC([C@H](CC3=CC=CC=C3)NC(C4=CC=C([N+]([O-])=O)C=C4)=O)=O)CO5)=O)CCC2)=O)=O)N6CCC[C@@]6([H])C5=O | Acyldepsipeptide analogue | NA | NA | NA | NA | NA | NA | 1 at 25 uM | NA | Nucleotide binding domain | Substrate degradation assay (FITC-casein) | NA | NA |
HSPMDB002620 | 30126533 | Hsp100 | ClpP | Human | Mitochondria | Inhibition of protease activity | NA | ADEP-34 | NA | O=C([C@H](C)NC([C@H](C)N(C)C([C@@]1([H])N(C([C@@H](NC([C@H](CC2=CC=CC=C2)NC(OC(C)(C)C)=O)=O)CO3)=O)CCC1)=O)=O)N4CCC[C@@]4([H])C3=O | Acyldepsipeptide analogue | NA | NA | NA | NA | NA | NA | 2 at 25 uM | NA | Nucleotide binding domain | Substrate degradation assay (FITC-casein) | NA | NA |
HSPMDB002621 | 30126533 | Hsp100 | ClpP | Human | Mitochondria | Inhibition of protease activity | NA | ADEP-35 | NA | O=C([C@H](C)NC([C@H](C)N(C)C([C@@]1([H])N(C([C@@H](NC([C@H](CC2=CC=CC=C2)NC(OC(C)(C)C)=O)=O)CO3)=O)CCC1)=O)=O)N4C[C@H](C)C[C@@]4([H])C3=O | Acyldepsipeptide analogue | NA | NA | NA | NA | NA | NA | 3 at 25 uM | NA | Nucleotide binding domain | Substrate degradation assay (FITC-casein) | NA | NA |
HSPMDB002622 | 30126533 | Hsp100 | ClpP | Human | Mitochondria | Inhibition of protease activity | NA | ADEP-31 | NA | O=C([C@H](C)NC([C@H](C)N(C)C([C@@]1([H])N(C([C@@H](NC([C@H](CC2=CC=CC=C2)N)=O)CO3)=O)CCC1)=O)=O)N4C[C@H](C)C[C@@]4([H])C3=O | Acyldepsipeptide analogue | NA | NA | NA | NA | NA | NA | 4 at 25 uM | NA | Nucleotide binding domain | Substrate degradation assay (FITC-casein) | NA | NA |
HSPMDB002623 | 30126533 | Hsp100 | ClpP | Human | Mitochondria | Inhibition of protease activity | NA | ADEP-22 | NA | O=C([C@H](C)NC([C@H](C)N(C)C([C@@]1([H])N(C([C@@H](NC([C@H](CC2=CC=CC=C2)NC(OCC3=CC=CC=C3)=O)=O)CO4)=O)CCC1)=O)=O)N5CCC[C@@]5([H])C4=O | Acyldepsipeptide analogue | NA | NA | NA | NA | NA | NA | 5 at 25 uM | NA | Nucleotide binding domain | Substrate degradation assay (FITC-casein) | NA | NA |
HSPMDB002624 | 30126533 | Hsp100 | ClpP | Human | Mitochondria | Inhibition of protease activity | NA | ADEP-40 | NA | O=C([C@H](C)NC([C@H](C)N(C)C([C@@]1([H])N(C([C@@H](NC([C@H](CC2=CC=CC=C2)N)=O)CO3)=O)CCC1)=O)=O)N4CCC[C@@]4([H])C3=O | Acyldepsipeptide analogue | NA | NA | NA | NA | NA | NA | 6 at 25 uM | NA | Nucleotide binding domain | Substrate degradation assay (FITC-casein) | NA | NA |
HSPMDB002625 | 30126533 | Hsp100 | ClpP | Human | Mitochondria | Inhibition of protease activity | NA | ADEP-32 | NA | O=C([C@H](C)NC([C@@]1([H])N(CCCC1)C([C@@]2([H])N(C([C@@H](NC([C@H](CC3=CC(F)=CC(F)=C3)NC(/C=C/CCCC)=O)=O)CN4)=O)CCC2)=O)=O)N5C[C@H](C)C[C@@]5([H])C4=O | Acyldepsipeptide analogue | NA | NA | NA | NA | NA | NA | 0.9 at 5 uM | NA | Nucleotide binding domain | Substrate degradation assay (FITC-casein) | NA | NA |
HSPMDB002626 | 30126533 | Hsp100 | ClpP | Human | Mitochondria | Inhibition of protease activity | NA | ADEP-06 | NA | O=C([C@H](C)NC([C@H](C)N(C)C([C@@]1([H])N(C([C@@H](NC([C@H](CC2=CC(F)=CC(F)=C2)NC(/C=C/CCCC)=O)=O)CO3)=O)CCC1)=O)=O)N4C[C@H](C)C[C@@]4([H])C3=O | Acyldepsipeptide analogue | NA | NA | NA | NA | NA | NA | 0.94 at 5 uM | NA | Nucleotide binding domain | Substrate degradation assay (FITC-casein) | NA | NA |
HSPMDB002627 | 30126533 | Hsp100 | ClpP | Human | Mitochondria | Inhibition of protease activity | NA | ADEP-30 | NA | O=C([C@H](C)NC([C@@]1([H])N(CC[C@H](C)C1)C([C@@]2([H])N(C([C@@H](NC([C@H](CC3=CC(F)=CC(F)=C3)NC(/C=C/CCCC)=O)=O)CO4)=O)CCC2)=O)=O)N5C[C@H](C)C[C@@]5([H])C4=O | Acyldepsipeptide analogue | NA | NA | NA | NA | NA | NA | 0.93 at 5 uM | NA | Nucleotide binding domain | Substrate degradation assay (FITC-casein) | NA | NA |
HSPMDB002628 | 30126533 | Hsp100 | ClpP | Human | Mitochondria | Inhibition of protease activity | NA | ADEP-41 | NA | O=C([C@H](C)NC([C@@]1([H])N(CCCC1)C([C@@]2([H])N(C([C@@H](NC([C@H](CC3=CC(F)=CC(F)=C3)NC(/C=C/CCCC)=O)=O)[C@H](C)O4)=O)CCC2)=O)=O)N5CCC[C@@]5([H])C4=O | Acyldepsipeptide analogue | NA | NA | NA | NA | NA | NA | 0.93 at 5 uM | NA | Nucleotide binding domain | Substrate degradation assay (FITC-casein) | NA | NA |
HSPMDB002629 | 30126533 | Hsp100 | ClpP | Human | Mitochondria | Inhibition of protease activity | NA | ADEP-28 | NA | O=C([C@H](C)NC([C@@]1([H])N(CC[C@H](C)C1)C([C@@]2([H])N(C([C@@H](NC([C@H](CC3=CC(F)=CC(F)=C3)NC(/C=C/CCCC)=O)=O)[C@H](C)O4)=O)CCC2)=O)=O)N5CCC[C@@]5([H])C4=O | Acyldepsipeptide analogue | NA | NA | NA | NA | NA | NA | 0.93 at 5 uM | NA | Nucleotide binding domain | Substrate degradation assay (FITC-casein) | NA | NA |
HSPMDB002630 | 30126533 | Hsp100 | ClpP | Human | Mitochondria | Inhibition of protease activity | NA | ADEP-25 | NA | O=C([C@H](CC)NC([C@@]1([H])N(CCCC1)C([C@@]2([H])N(C([C@@H](NC([C@H](CC3=CC(F)=CC(F)=C3)NC(/C=C/CCCC)=O)=O)CO4)=O)CCC2)=O)=O)N5C[C@H](C)C[C@@]5([H])C4=O | Acyldepsipeptide analogue | NA | NA | NA | NA | NA | NA | 0.92 at 5 uM | NA | Nucleotide binding domain | Substrate degradation assay (FITC-casein) | NA | NA |
HSPMDB002631 | 30126533 | Hsp100 | ClpP | Human | Mitochondria | Inhibition of protease activity | NA | ADEP-14 | NA | O=C([C@H](C)NC([C@@]1([H])N(CCCC1)C([C@@]2([H])N(C([C@@H](NC([C@H](CC3=CC(F)=CC(F)=C3)NC(/C=C/C=C/CCC)=O)=O)[C@H](C)O4)=O)CCC2)=O)=O)N5C[C@H](C)C[C@@]5([H])C4=O | Acyldepsipeptide analogue | NA | NA | NA | NA | NA | NA | 0.92 at 5 uM | NA | Nucleotide binding domain | Substrate degradation assay (FITC-casein) | NA | NA |
HSPMDB002632 | 30126533 | Hsp100 | ClpP | Human | Mitochondria | Inhibition of protease activity | NA | ADEP-15 | NA | O=C([C@H](C)NC([C@@](CCC1)([H])N1C([C@@]2([H])N(C([C@@H](NC([C@H](CC3=CC(F)=CC(F)=C3)NC(/C=C/CCCC)=O)=O)CO4)=O)CCC2)=O)=O)N5C[C@H](C)C[C@@]5([H])C4=O | Acyldepsipeptide analogue | NA | NA | NA | NA | NA | NA | 0.92 at 5 uM | NA | Nucleotide binding domain | Substrate degradation assay (FITC-casein) | NA | NA |
HSPMDB002633 | 30126533 | Hsp100 | ClpP | Human | Mitochondria | Inhibition of protease activity | NA | ADEP-13 | NA | O=C([C@H](C)NC([C@@]1([H])N(CCCC1)C([C@@]2([H])N(C([C@@H](NC([C@H](CC3=CC(F)=CC(F)=C3)NC(/C=C/CC4CC4)=O)=O)[C@H](C)O5)=O)CCC2)=O)=O)N6C[C@H](C)C[C@@]6([H])C5=O | Acyldepsipeptide analogue | NA | NA | NA | NA | NA | NA | 0.91 at 5 uM | NA | Nucleotide binding domain | Substrate degradation assay (FITC-casein) | NA | NA |
HSPMDB002634 | 30126533 | Hsp100 | ClpP | Human | Mitochondria | Inhibition of protease activity | NA | ADEP-17 | NA | O=C([C@H](C)NC([C@@]1([H])N(CCCC1)C([C@@]2([H])N(C([C@@H](NC([C@H](CC3=CC(F)=CC(F)=C3)NC(/C=C/CC4CCCCC4)=O)=O)[C@H](C)O5)=O)CCC2)=O)=O)N6C[C@H](C)C[C@@]6([H])C5=O | Acyldepsipeptide analogue | NA | NA | NA | NA | NA | NA | 0.91 at 5 uM | NA | Nucleotide binding domain | Substrate degradation assay (FITC-casein) | NA | NA |
HSPMDB002635 | 30126533 | Hsp100 | ClpP | Human | Mitochondria | Inhibition of protease activity | NA | ADEP-20 | NA | O=C([C@H](C)NC([C@@]1([H])N(CCCC1)C([C@@]2([H])N(C([C@@H](NC([C@H](CC3=CC(F)=CC=C3)NC(/C=C/CCC)=O)=O)CO4)=O)CCC2)=O)=O)N5C[C@H](C)C[C@@]5([H])C4=O | Acyldepsipeptide analogue | NA | NA | NA | NA | NA | NA | 0.90 at 5 uM | NA | Nucleotide binding domain | Substrate degradation assay (FITC-casein) | NA | NA |
HSPMDB002636 | 30126533 | Hsp100 | ClpP | Human | Mitochondria | Inhibition of protease activity | NA | ADEP-38 | NA | O=C([C@H](C)NC([C@@]1([H])N(CC[C@H](C)C1)C([C@@]2([H])N(C([C@@H](NC([C@H](CC3=CC(F)=CC(F)=C3)NC(/C=C/CCCC)=O)=O)[C@H](C)O4)=O)CCC2)=O)=O)N5C[C@H](C)C[C@@]5([H])C4=O | Acyldepsipeptide analogue | NA | NA | NA | NA | NA | NA | 0.89 at 5 uM | NA | Nucleotide binding domain | Substrate degradation assay (FITC-casein) | NA | NA |
HSPMDB002637 | 30126533 | Hsp100 | ClpP | Human | Mitochondria | Inhibition of protease activity | NA | ADEP-02 | NA | O=C([C@H](C)NC([C@@]1([H])N(CCCC1)C([C@@]2([H])N(C([C@@H](NC([C@H](CC3=CC=CC=C3)NC(/C=C/CCCC)=O)=O)CO4)=O)CCC2)=O)=O)N5CCC[C@@]5([H])C4=O | Acyldepsipeptide analogue | NA | NA | NA | NA | NA | NA | 0.88 at 5 uM | NA | Nucleotide binding domain | Substrate degradation assay (FITC-casein) | NA | NA |
HSPMDB002638 | 30126533 | Hsp100 | ClpP | Human | Mitochondria | Inhibition of protease activity | NA | ADEP-29 | NA | O=C([C@H](C)NC([C@@]1([H])N(CCCC1)C([C@@]2([H])N(C([C@@H](NC([C@H](CC3=CC(F)=CC(F)=C3)NC(/C=C/CCCC)=O)=O)[C@H](C)O4)=O)CCC2)=O)=O)N5C[C@H](C)C[C@@]5([H])C4=O | Acyldepsipeptide analogue | NA | NA | NA | NA | NA | NA | 0.87 at 5 uM | NA | Nucleotide binding domain | Substrate degradation assay (FITC-casein) | NA | NA |
HSPMDB002639 | 30126533 | Hsp100 | ClpP | Human | Mitochondria | Inhibition of protease activity | NA | ADEP-37 | NA | O=C([C@H](C)NC([C@@]1([H])N(CCC2=C1C=CC=C2)C([C@@]3([H])N(C([C@@H](NC([C@H](CC4=CC(F)=CC(F)=C4)NC(/C=C/CCCC)=O)=O)CO5)=O)CCC3)=O)=O)N6C[C@H](C)C[C@@]6([H])C5=O | Acyldepsipeptide analogue | NA | NA | NA | NA | NA | NA | 0.86 at 5 uM | NA | Nucleotide binding domain | Substrate degradation assay (FITC-casein) | NA | NA |
HSPMDB002640 | 30126533 | Hsp100 | ClpP | Human | Mitochondria | Inhibition of protease activity | NA | ADEP-10 | NA | O=C([C@H](C)NC([C@@]1([H])N(CCCC1)C([C@@]2([H])N(C([C@@H](NC([C@H](CC3=CC=CC=C3)NC(/C=C/CCCC)=O)=O)CO4)=O)CCC2)=O)=O)N5C[C@H](C)C[C@@]5([H])C4=O | Acyldepsipeptide analogue | NA | NA | NA | NA | NA | NA | 0.85 at 5 uM | NA | Nucleotide binding domain | Substrate degradation assay (FITC-casein) | NA | NA |
HSPMDB002641 | 30126533 | Hsp100 | ClpP | Human | Mitochondria | Inhibition of protease activity | NA | ADEP-04 | NA | O=C([C@H](C)NC([C@H](C)N(C)C([C@@]1([H])N(C([C@@H](NC([C@H](CC2=CC=CC=C2)NC(/C=C/C=C/CCC)=O)=O)CO3)=O)CCC1)=O)=O)N4C[C@H](C)C[C@@]4([H])C3=O | Acyldepsipeptide analogue | NA | NA | NA | NA | NA | NA | 0.78 at 5 uM | NA | Nucleotide binding domain | Substrate degradation assay (FITC-casein) | NA | NA |
HSPMDB002642 | 30126533 | Hsp100 | ClpP | Human | Mitochondria | Inhibition of protease activity | NA | ADEP-18 | NA | O=C([C@H](C)NC([C@H](C)N(C)C([C@@]1([H])N(C([C@@H](NC([C@H](CC2=CC=CC=C2)NC(/C=C/CCCCC)=O)=O)CO3)=O)CCC1)=O)=O)N4CCC[C@@]4([H])C3=O | Acyldepsipeptide analogue | NA | NA | NA | NA | NA | NA | 0.72 at 5 uM | NA | Nucleotide binding domain | Substrate degradation assay (FITC-casein) | NA | NA |
HSPMDB002643 | 30126533 | Hsp100 | ClpP | Human | Mitochondria | Inhibition of protease activity | NA | ADEP-21 | NA | O=C([C@H](C)NC([C@@]1([H])N(CCCC1)C([C@@]2([H])N(C([C@@H](NC([C@H](CC3CCCCC3)NC(/C=C/CCCC)=O)=O)CO4)=O)CCC2)=O)=O)N5C[C@H](C)C[C@@]5([H])C4=O | Acyldepsipeptide analogue | NA | NA | NA | NA | NA | NA | 0.70 at 5 uM | NA | Nucleotide binding domain | Substrate degradation assay (FITC-casein) | NA | NA |
HSPMDB002644 | 30126533 | Hsp100 | ClpP | Human | Mitochondria | Inhibition of protease activity | NA | ADEP-01 | NA | O=C([C@H](C)NC([C@H](C)N(C)C([C@@]1([H])N(C([C@@H](NC([C@H](CC2=CC=CC=C2)NC(/C=C/CCCC)=O)=O)CO3)=O)CCC1)=O)=O)N4CCC[C@@]4([H])C3=O | Acyldepsipeptide analogue | NA | NA | NA | NA | NA | NA | 0.70 at 5 uM | NA | Nucleotide binding domain | Substrate degradation assay (FITC-casein) | NA | NA |
HSPMDB002645 | 30126533 | Hsp100 | ClpP | Human | Mitochondria | Inhibition of protease activity | NA | ADEP-05 | NA | O=C([C@H](C)NC([C@H](C)N(C)C([C@@]1([H])N(C([C@@H](NC([C@H](CC2=CC=CC=C2)NC(/C=C/C=C/C=C/C)=O)=O)CO3)=O)CCC1)=O)=O)N4C[C@H](C)C[C@@]4([H])C3=O | Acyldepsipeptide analogue | NA | NA | NA | NA | NA | NA | 0.69 at 5 uM | NA | Nucleotide binding domain | Substrate degradation assay (FITC-casein) | NA | NA |
HSPMDB002646 | 30126533 | Hsp100 | ClpP | Human | Mitochondria | Inhibition of protease activity | NA | ADEP-43 | NA | O=C([C@H](C)NC([C@@]1([H])N(CCCC1)C([C@@]2([H])N(C([C@@H](NC([C@H](CC3=CC(C=CC=C4)=C4C=C3)NC(/C=C/CCCC)=O)=O)CO5)=O)CCC2)=O)=O)N6C[C@H](C)C[C@@]6([H])C5=O | Acyldepsipeptide analogue | NA | NA | NA | NA | NA | NA | 0.55 at 5 uM | NA | Nucleotide binding domain | Substrate degradation assay (FITC-casein) | NA | NA |
HSPMDB002647 | 30126533 | Hsp100 | ClpP | Human | Mitochondria | Inhibition of protease activity | NA | ADEP-08 | NA | O=C([C@H](C)NC([C@H](C)N(C)C([C@@]1([H])N(C([C@@H](NC([C@H](CC2=CC=CC=C2)NC(/C=C/C=C/C=C/C)=O)=O)CO3)=O)CCC1)=O)=O)N4CCC[C@@]4([H])C3=O | Acyldepsipeptide analogue | NA | NA | NA | NA | NA | NA | 0.52 at 5 uM | NA | Nucleotide binding domain | Substrate degradation assay (FITC-casein) | NA | NA |
HSPMDB002648 | 30126533 | Hsp100 | ClpP | Human | Mitochondria | Inhibition of protease activity | NA | ADEP-42 | NA | O=C([C@H](C)NC([C@@]1([H])N(CCCC1)C([C@@]2([H])N(C([C@@H](NC([C@H](CC3=CSC4=C3C=CC=C4)NC(/C=C/CCCC)=O)=O)CO5)=O)CCC2)=O)=O)N6C[C@H](C)C[C@@]6([H])C5=O | Acyldepsipeptide analogue | NA | NA | NA | NA | NA | NA | 0.49 at 5 uM | NA | Nucleotide binding domain | Substrate degradation assay (FITC-casein) | NA | NA |
HSPMDB002649 | 30126533 | Hsp100 | ClpP | Human | Mitochondria | Inhibition of protease activity | NA | ADEP-17 | NA | O=C(N1C[C@@H](C[C@]12[H])C)[C@@H](NC([C@]3(N(C([C@]4(N(CCC4)C([C@H]([C@@H](OC2=O)C)NC([C@@H](NC(/C=C/CC5CCCCC5)=O)CC6=CC(F)=CC(F)=C6)=O)=O)[H])=O)CCCC3)[H])=O)C | Acyldepsipeptide analogue | NA | NA | NA | NA | NA | NA | 0.81 at 1 uM | NA | Nucleotide binding domain | Substrate degradation assay (FITC-casein) | NA | NA |
HSPMDB002650 | 30126533 | Hsp100 | ClpP | Human | Mitochondria | Inhibition of protease activity | NA | ADEP-28 | NA | O=C(N1CCC[C@]12[H])[C@@H](NC([C@]3(N(C([C@]4(N(CCC4)C([C@H]([C@@H](OC2=O)C)NC([C@@H](NC(/C=C/CCCC)=O)CC5=CC(F)=CC(F)=C5)=O)=O)[H])=O)CC[C@@H](C3)C)[H])=O)C | Acyldepsipeptide analogue | NA | NA | NA | NA | NA | NA | 0.82 at 1 uM | NA | Nucleotide binding domain | Substrate degradation assay (FITC-casein) | NA | NA |
HSPMDB002651 | 30126533 | Hsp100 | ClpP | Human | Mitochondria | Inhibition of protease activity | NA | ADEP-14 | NA | O=C(N1C[C@@H](C[C@]12[H])C)[C@@H](NC([C@]3(N(C([C@]4(N(CCC4)C([C@H]([C@@H](OC2=O)C)NC([C@@H](NC(/C=C/C=C/CCC)=O)CC5=CC(F)=CC(F)=C5)=O)=O)[H])=O)CCCC3)[H])=O)C | Acyldepsipeptide analogue | NA | NA | NA | NA | NA | NA | 0.79 at 1 uM | NA | Nucleotide binding domain | Substrate degradation assay (FITC-casein) | NA | NA |
HSPMDB002652 | 30126533 | Hsp100 | ClpP | Human | Mitochondria | Inhibition of protease activity | NA | ADEP-41 | NA | O=C(N1CCC[C@]12[H])[C@@H](NC([C@]3(N(C([C@]4(N(CCC4)C([C@H]([C@@H](OC2=O)C)NC([C@@H](NC(/C=C/CCCC)=O)CC5=CC(F)=CC(F)=C5)=O)=O)[H])=O)CCCC3)[H])=O)C | Acyldepsipeptide analogue | NA | NA | NA | NA | NA | NA | 0.79 at 1 uM | NA | Nucleotide binding domain | Substrate degradation assay (FITC-casein) | NA | NA |
HSPMDB002653 | 30126533 | Hsp100 | ClpP | Human | Mitochondria | Inhibition of protease activity | NA | ADEP-32 | NA | O=C(N1C[C@@H](C[C@]12[H])C)[C@@H](NC([C@]3(N(C([C@]4(N(CCC4)C([C@H](CNC2=O)NC([C@@H](NC(/C=C/CCCC)=O)CC5=CC(F)=CC(F)=C5)=O)=O)[H])=O)CCCC3)[H])=O)C | Acyldepsipeptide analogue | NA | NA | NA | NA | NA | NA | 0.79 at 1 uM | NA | Nucleotide binding domain | Substrate degradation assay (FITC-casein) | NA | NA |
HSPMDB002654 | 30126533 | Hsp100 | ClpP | Human | Mitochondria | Inhibition of protease activity | NA | ADEP-29 | NA | O=C(N1C[C@@H](C[C@]12[H])C)[C@@H](NC([C@]3(N(C([C@]4(N(CCC4)C([C@H]([C@@H](OC2=O)C)NC([C@@H](NC(/C=C/CCCC)=O)CC5=CC(F)=CC(F)=C5)=O)=O)[H])=O)CCCC3)[H])=O)C | Acyldepsipeptide analogue | NA | NA | NA | NA | NA | NA | 0.76 at 1 uM | NA | Nucleotide binding domain | Substrate degradation assay (FITC-casein) | NA | NA |
HSPMDB002655 | 30126533 | Hsp100 | ClpP | Human | Mitochondria | Inhibition of protease activity | NA | ADEP-38 | NA | O=C(N1C[C@@H](C[C@]12[H])C)[C@@H](NC([C@]3(N(C([C@]4(N(CCC4)C([C@H]([C@@H](OC2=O)C)NC([C@@H](NC(/C=C/CCCC)=O)CC5=CC(F)=CC(F)=C5)=O)=O)[H])=O)CC[C@@H](C3)C)[H])=O)C | Acyldepsipeptide analogue | NA | NA | NA | NA | NA | NA | 0.76 at 1 uM | NA | Nucleotide binding domain | Substrate degradation assay (FITC-casein) | NA | NA |
HSPMDB002656 | 30126533 | Hsp100 | ClpP | Human | Mitochondria | Inhibition of protease activity | NA | ADEP-30 | NA | O=C(N1C[C@@H](C[C@]12[H])C)[C@@H](NC([C@]3(N(C([C@]4(N(CCC4)C([C@H](COC2=O)NC([C@@H](NC(/C=C/CCCC)=O)CC5=CC(F)=CC(F)=C5)=O)=O)[H])=O)CC[C@@H](C3)C)[H])=O)C | Acyldepsipeptide analogue | NA | NA | NA | NA | NA | NA | 0.69 at 1 uM | NA | Nucleotide binding domain | Substrate degradation assay (FITC-casein) | NA | NA |
HSPMDB002657 | 30126533 | Hsp100 | ClpP | Human | Mitochondria | Inhibition of protease activity | NA | ADEP-37 | NA | O=C(N1C[C@@H](C[C@]12[H])C)[C@@H](NC([C@]3(N(C([C@]4(N(CCC4)C([C@H](COC2=O)NC([C@@H](NC(/C=C/CCCC)=O)CC5=CC(F)=CC(F)=C5)=O)=O)[H])=O)CCC6=C3C=CC=C6)[H])=O)C | Acyldepsipeptide analogue | NA | NA | NA | NA | NA | NA | 0.68 at 1 uM | NA | Nucleotide binding domain | Substrate degradation assay (FITC-casein) | NA | NA |
HSPMDB002658 | 30126533 | Hsp100 | ClpP | Human | Mitochondria | Inhibition of protease activity | NA | ADEP-06 | NA | O=C(N1C[C@@H](C[C@]12[H])C)[C@@H](NC([C@@H](N(C([C@]3(N(CCC3)C([C@H](COC2=O)NC([C@@H](NC(/C=C/CCCC)=O)CC4=CC(F)=CC(F)=C4)=O)=O)[H])=O)C)C)=O)C | Acyldepsipeptide analogue | NA | NA | NA | NA | NA | NA | 0.64 at 1 uM | NA | Nucleotide binding domain | Substrate degradation assay (FITC-casein) | NA | NA |
HSPMDB002659 | 30126533 | Hsp100 | ClpP | Human | Mitochondria | Inhibition of protease activity | NA | ADEP-25 | NA | O=C(N1C[C@@H](C[C@]12[H])C)[C@@H](NC([C@]3(N(C([C@]4(N(CCC4)C([C@H](COC2=O)NC([C@@H](NC(/C=C/CCCC)=O)CC5=CC(F)=CC(F)=C5)=O)=O)[H])=O)CCCC3)[H])=O)CC | Acyldepsipeptide analogue | NA | NA | NA | NA | NA | NA | 0.61 at 1 uM | NA | Nucleotide binding domain | Substrate degradation assay (FITC-casein) | NA | NA |
HSPMDB002660 | 30126533 | Hsp100 | ClpP | Human | Mitochondria | Inhibition of protease activity | NA | ADEP-13 | NA | O=C(N1C[C@@H](C[C@]12[H])C)[C@@H](NC([C@]3(N(C([C@]4(N(CCC4)C([C@H]([C@@H](OC2=O)C)NC([C@@H](NC(/C=C/CC5CC5)=O)CC6=CC(F)=CC(F)=C6)=O)=O)[H])=O)CCCC3)[H])=O)C | Acyldepsipeptide analogue | NA | NA | NA | NA | NA | NA | 0.59 at 1 uM | NA | Nucleotide binding domain | Substrate degradation assay (FITC-casein) | NA | NA |
HSPMDB002661 | 30126533 | Hsp100 | ClpP | Human | Mitochondria | Inhibition of protease activity | NA | ADEP-15 | NA | O=C(N1C[C@@H](C[C@]12[H])C)[C@@H](NC([C@]3([H])CCCN3C([C@]4(N(CCC4)C([C@H](COC2=O)NC([C@H](NC(/C=C/CCCC)=O)CC5=CC(F)=CC(F)=C5)=O)=O)[H])=O)=O)C | Acyldepsipeptide analogue | NA | NA | NA | NA | NA | NA | 0.58 at 1 uM | NA | Nucleotide binding domain | Substrate degradation assay (FITC-casein) | NA | NA |
HSPMDB002662 | 30126533 | Hsp100 | ClpP | Human | Mitochondria | Inhibition of protease activity | NA | ADEP-20 | NA | O=C(N1C[C@@H](C[C@]12[H])C)[C@@H](NC([C@]3(N(C([C@]4(N(CCC4)C([C@H](COC2=O)NC([C@H](NC(/C=C/CCC)=O)CC5=CC(F)=CC=C5)=O)=O)[H])=O)CCCC3)[H])=O)C | Acyldepsipeptide analogue | NA | NA | NA | NA | NA | NA | 0.53 at 1 uM | NA | Nucleotide binding domain | Substrate degradation assay (FITC-casein) | NA | NA |
HSPMDB002663 | 30126533 | Hsp100 | ClpP | Human | Mitochondria | Inhibition of protease activity | NA | ADEP-02 | NA | O=C(N1CCC[C@]12[H])[C@@H](NC([C@]3(N(C([C@]4(N(CCC4)C([C@H](COC2=O)NC([C@H](NC(/C=C/CCCC)=O)CC5=CC=CC=C5)=O)=O)[H])=O)CCCC3)[H])=O)C | Acyldepsipeptide analogue | NA | NA | NA | NA | NA | NA | 0.52 at 1 uM | NA | Nucleotide binding domain | Substrate degradation assay (FITC-casein) | NA | NA |
HSPMDB002664 | 30126533 | Hsp100 | ClpP | Human | Mitochondria | Inhibition of protease activity | NA | ADEP-10 | NA | O=C(N1C[C@@H](C[C@]12[H])C)[C@@H](NC([C@]3(N(C([C@]4(N(CCC4)C([C@H](COC2=O)NC([C@H](NC(/C=C/CCCC)=O)CC5=CC=CC=C5)=O)=O)[H])=O)CCCC3)[H])=O)C | Acyldepsipeptide analogue | NA | NA | NA | NA | NA | NA | 0.44 at 1 uM | NA | Nucleotide binding domain | Substrate degradation assay (FITC-casein) | NA | NA |
HSPMDB002665 | 30126533 | Hsp100 | ClpP | Human | Mitochondria | Inhibition of protease activity | NA | ADEP-04 | NA | O=C(N1C[C@@H](C[C@]12[H])C)[C@@H](NC([C@@H](N(C([C@]3(N(CCC3)C([C@H](COC2=O)NC([C@H](NC(/C=C/C=C/CCC)=O)CC4=CC=CC=C4)=O)=O)[H])=O)C)C)=O)C | Acyldepsipeptide analogue | NA | NA | NA | NA | NA | NA | 0.32 at 1 uM | NA | Nucleotide binding domain | Substrate degradation assay (FITC-casein) | NA | NA |
HSPMDB002666 | 30126533 | Hsp100 | ClpP | Human | Mitochondria | Inhibition of protease activity | NA | ADEP-01 | NA | O=C(N1CCC[C@]12[H])[C@@H](NC([C@@H](N(C([C@]3(N(CCC3)C([C@H](COC2=O)NC([C@H](NC(/C=C/CCCC)=O)CC4=CC=CC=C4)=O)=O)[H])=O)C)C)=O)C | Acyldepsipeptide analogue | NA | NA | NA | NA | NA | NA | 0.22 at 1 uM | NA | Nucleotide binding domain | Substrate degradation assay (FITC-casein) | NA | NA |