| HSPMdb Accession No | HSPMDB001756 |
| PMID | 30109319 |
| Target | Hsp100 |
| HSP Name | hClpP |
| Organism | Bacteria |
| Localization | Cytosol |
| Enzymatic activity | Inhibition of peptidase activity |
| Compound Name | D3 |
| IUPAC Name | 3-(non-8-en-1-yl)-4-(pent-4-yn-1-yl)oxetan-2-one |
| SMILES | C=CCCCCCCCC1C(CCCC#C)OC1=O |
| Class | Naphthofuran derivative with 8-methoxynaphthofuran moiety |
| IC50 (µM) | 4.01 |
| Site of Interaction | Nucleotide binding domain |
| Type of Enzymatic Assay | Peptidase assay (SLY-AMC) |
| Disease | Bacterial infection |
Loading Please Wait ...