| HSPMdb Accession No | HSPMDB001958 |
| PMID | 21383145 |
| Target | Hsp100 |
| HSP Name | p97 |
| Organism | Human |
| Localization | Cytosol |
| Enzymatic activity | Inhibition of ATPase activity |
| Compound Name | CID930238 |
| IUPAC Name | 7-propan-2-yl-10-thia-8,13,15-triazatetracyclo[7.7.0.02,6.011,16]hexadeca-1,6,8,11(16),13-pentaene-12-thione |
| SMILES | CC(C)C1=C2CCCC2=C3C4=C(C(=S)N=CN4)SC3=N1 |
| Class | Maybridge, Hitfinder, and NIH molecular libraries |
| IC50 (µM) | 42 |
| Site of Interaction | Nucleotide binding domain |
| Type of Enzymatic Assay | ATPase assay |
Loading Please Wait ...