| HSPMdb Accession No | HSPMDB002352 |
| PMID | 26566002 |
| Target | Hsp100 |
| HSP Name | ClpP |
| Organism | Bacteria |
| Localization | Cytosol |
| Enzymatic activity | Inhibition of protease activity |
| Compound Name | AV287 |
| IUPAC Name | N-[2-(1H-1,3-benzodiazol-2-yl)ethyl]-4-(dimethylsulfamoyl)benzamide |
| SMILES | CN(C)S(=O)(=O)C1=CC=C(C=C1)C(=O)NCCC1=NC2=C(N1)C=CC=C4 |
| Class | COMAS Library |
| IC50 (µM) | 51.2 |
| Site of Interaction | Nucleotide binding domain |
| Type of Enzymatic Assay | Substrate degradation assay (FITC-casein) |
| Disease | Bacterial infection |
Loading Please Wait ...