| HSPMdb Accession No | HSPMDB001641 |
| PMID | 28906057 |
| Target | Hsp100 |
| HSP Name | ClpX |
| Organism | Bacteria |
| Localization | Cytosol |
| Enzymatic activity | Inhibition of protease activity |
| Compound Name | 350 |
| IUPAC Name | 5,11-Dihydro-11-(3-hydroxy-5-(hex-5-ynyloxy)-phenyl)-12H-benzo[b]indeno[1,2- e][1,4]thiazepin-12-one |
| SMILES | Oc1cc(OCCCCC#C)cc(c1)C2Sc3ccccc3NC4=C2C(=O)c5ccccc45 |
| Class | Synthetic chemical compounds |
| IC50 (µM) | <50 |
| Site of Interaction | Nucleotide binding domain |
| Type of Enzymatic Assay | Substrate degradation assay (GFP) |
| Disease | Bacterial infection |
Loading Please Wait ...