| HSPMdb Accession No | HSPMDB002422 |
| PMID | 28917450 |
| Target | Hsp100 |
| HSP Name | ClpP |
| Organism | Plasmodium falciparum |
| Localization | Cytosol |
| Enzymatic activity | Inhibition of protease activity |
| Compound Name | 1 |
| IUPAC Name | N-(5-Ethyl-1,3,4-thiadiazol-2-yl)-2-((5-(3-hydroxynaphthalen-2-yl)-4-(2-methoxyethyl)-4H-1,2,4-triazol-3-yl)thio)acetamide |
| SMILES | CCc1sc(NC(=O)CSc2nnc(n2CCOC)c3cc4ccccc4cc3O)nn1 |
| Class | Library of small molecule structures |
| IC50 (µM) | 30 |
| Site of Interaction | Nucleotide binding domain |
| Type of Enzymatic Assay | Peptidase assay (SLY-AMC) |
| Cellular Model | P. falciparum |
| Disease | Malaria |
Loading Please Wait ...