| HSPMdb Accession No | HSPMDB002041 |
| PMID | 21383145 |
| Target | Hsp100 |
| HSP Name | p97 |
| Organism | Human |
| Localization | Cytosol |
| Cellular activity | Substrate degradation activity |
| Compound Name | HTS01888 |
| IUPAC Name | N-[4-(3-Chloro-4-methylphenyl)-5-methyl-1,3-thiazol-2-yl]-2,1,3-benzoxadiazole-4-sulfonamide |
| SMILES | Cc1ccc(cc1Cl)c2nc(NS(=O)(=O)c3cccc4nonc34)sc2C |
| Class | Maybridge, Hitfinder, and NIH molecular libraries |
| IC50 (µM) | 19 |
| Site of Interaction | Nucleotide binding domain |
| Cellular assay | Reporter degradation assay (UbG76V-GFP) |
| Cellular Model | HeLa |
| Disease | Cancer |
Loading Please Wait ...