| HSPMdb Accession No | HSPMDB002342 |
| PMID | 26566002 |
| Target | Hsp100 |
| HSP Name | ClpP |
| Organism | Bacteria |
| Localization | Cytosol |
| Enzymatic activity | Inhibition of peptidase activity |
| Compound Name | AV224 |
| IUPAC Name | 4-(dimethylsulfamoyl)-N-{[2-(thiophen-2-yl)-1,3-oxazol-4-yl]methyl}benzamide |
| SMILES | CN(C)[S](=O)(=O)c1ccc(cc1)C(=O)NCc2coc(n2)c3sccc3 |
| Class | COMAS Library |
| IC50 (µM) | 6 |
| Site of Interaction | Nucleotide binding domain |
| Type of Enzymatic Assay | Peptidase assay (SLY-AMC) |
| Disease | Bacterial infection |
Loading Please Wait ...