| Chemical Information | |
| Antiviral agent ID | DrugRepV_8471 | |
| Antiviral agent name | Berberine |  |
| IUPAC Name | 9,10-Dimethoxy-5,6-dihydro[1,3]dioxolo[4,5-g]isoquinolino[3,2-a]isoquinolin-7-ium |  |
| SMILES (canonical) | COC1=C(C2=C[N+]3=C(C=C2C=C1)C4=CC5=C(C=C4CC3)OCO5)OC | |
| Molecular Formula | C20H18NO4+ | |
| Molecular Weight (g/mol) | 336.367 | |
| InChl | InChI=1S/C20H18NO4/c1-22-17-4-3-12-7-16-14-9-19-18(24-11-25-19)8-13(14)5-6-21(16)10-15(12)20(17)23-2/h3-4,7-10H,5-6,11H2,1-2H3/q+1 | |
| Common Name | Berberine | |
| Synonyms | Umbellatine | UNII-0I8Y3P32UF | 2086-83-1 | Berberal | |
| Structural Information | |
 |
|
| Clinical Information | |
|
Primary Indication (Clinical trial phases) | Approved
|  |
| Biological Information | |
|
Primary Indication (Disease Category) | Infectious Disease
| |
|
Primary Indication (Disease) | Parasitic and fungal infection
| |
|
Primary Indication (Drug target/Mode of Action) | Proto-oncogene c-Fos
| |
|
Secondary Indication | Human immunodeficiency virus (HIV) NA NA |   |
|
Secondary Indication (Approaches) | Experimental | |
| Secondary Indication (Methods) | In-vitro | |
|
Secondary Indication (Model system) [cell lines/ animal models] | CEM-GFP cells
| |
|
Secondary Indication (Mode of drug delivery) | Culture
| |
|
Secondary Indication (Drug concentration) | 0.13 μM
| |
|
Secondary Indication (Change) | Decrease
| |
|
Secondary Indication (Type of Inhibition) | EC50 [ 50 % ] | |
|
Reference | Bodiwala HS, Sabde S, Mitra D, Bhutani KK, Singh IP..Synthesis of 9-substituted derivatives of berberine as anti-HIV agents..Eur J Med Chem. 2011 Apr;46(4):1045-9. doi: 10.1016/j.ejmech.2011.01.016. Epub 2011 Jan 21. PMID:21295891
|  |
|
Comment | Enzyme based assay suggested that the anti-HIV activity of berberine and its analogs might be due to RTase inhibitory activity and some additional mechanisms.
| |