| Chemical Information | |
| Antiviral agent ID | DrugRepV_8469 | |
| Antiviral agent name | Berberine |  |
| IUPAC Name | 9,10-Dimethoxy-5,6-dihydro[1,3]dioxolo[4,5-g]isoquinolino[3,2-a]isoquinolin-7-ium |  |
| SMILES (canonical) | COC1=C(C2=C[N+]3=C(C=C2C=C1)C4=CC5=C(C=C4CC3)OCO5)OC | |
| Molecular Formula | C20H18NO4+ | |
| Molecular Weight (g/mol) | 336.367 | |
| InChl | InChI=1S/C20H18NO4/c1-22-17-4-3-12-7-16-14-9-19-18(24-11-25-19)8-13(14)5-6-21(16)10-15(12)20(17)23-2/h3-4,7-10H,5-6,11H2,1-2H3/q+1 | |
| Common Name | Berberine | |
| Synonyms | Umbellatine | UNII-0I8Y3P32UF | 2086-83-1 | Berberal | |
| Structural Information | |
 |
|
| Clinical Information | |
|
Primary Indication (Clinical trial phases) | Approved
|  |
| Biological Information | |
|
Primary Indication (Disease Category) | Infectious Disease
| |
|
Primary Indication (Disease) | Parasitic and fungal infection
| |
|
Primary Indication (Drug target/Mode of Action) | Proto-oncogene c-Fos
| |
|
Secondary Indication | Influenza virus (IAV) NA NA |   |
|
Secondary Indication (Approaches) | Experimental | |
| Secondary Indication (Methods) | In-vitro | |
|
Secondary Indication (Model system) [cell lines/ animal models] | LET1 Cells
| |
|
Secondary Indication (Mode of drug delivery) | Culture
| |
|
Secondary Indication (Drug concentration) | 4 μM
| |
|
Secondary Indication (Cell based assay) | XTT assay
| |
|
Secondary Indication (Change) | Decrease
| |
|
Secondary Indication (Type of Inhibition) | IC50 [ 50 % ] | |
|
Reference | Botwina P, Owczarek K, Rajfur Z, Ochman M, Urlik M, Nowakowska M, Szczubia?ka K, Pyrc K..Berberine Hampers Influenza A Replication through Inhibition of MAPK/ERK Pathway..Viruses. 2020 Mar 21;12(3):344. doi: 10.3390/v12030344. PMID: 32245183; PMCID: PMC7150991. PMID:32245183
|  |
|
Comment | Influenza A virus upregulates the mitogen-activated protein kinase/extracellular signal-related kinase (MAPK/ERK) pathway and hijacks this pathway for nucleolar export of the viral ribonucleoprotein.
| |