| Chemical Information | |
| Antiviral agent ID | DrugRepV_7671 | |
| Antiviral agent name | Bexarotene |  |
| IUPAC Name | 4-[1-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)ethenyl]benzoic acid |  |
| SMILES (canonical) | CC1=CC2=C(C=C1C(=C)C3=CC=C(C=C3)C(=O)O)C(CCC2(C)C)(C)C | |
| Molecular Formula | C24H28O2 | |
| Molecular Weight (g/mol) | 348.486 | |
| InChl | InChI=1S/C24H28O2/c1-15-13-20-21(24(5,6)12-11-23(20,3)4)14-19(15)16(2)17-7-9-18(10-8-17)22(25)26/h7-10,13-14H,2,11-12H2,1,3-6H3,(H,25,26) | |
| Common Name | Bexarotene | |
| Synonyms | 4-[1-(3,5,5,8,8-pentamethyltetralin-2-yl)ethenyl]benzoic acid | 4-[1-(5,6,7,8,-Tetrahydro-3,5,5,8,8-pentamethyl-2-naphtalenyl)ethenyl]benzoic acid | Bexaroten | Bexarotène | Bexarotene | Bexaroteno | Bexarotenum | P-(1-(5,6,7,8-Tetrahydro-3,5,5,8,8-pentamethyl-2-naphthyl)vinyl)benzoic acid | p-[1-(5,6,7,8,-Tetrahydro-3,5,5,8,8-pentamethyl-2-naphthyl)vinyl]benzoic acid | Targretyn | Targrexin | |
| Structural Information | |
 |
|
| Clinical Information | |
|
Category | Antineoplastic and Immunomodulating Agents
| |
|
Primary Indication (Clinical trial phases) | Approved
|  |
| Biological Information | |
|
Primary Indication (Disease Category) | Non Infectious Disease
| |
|
Primary Indication (Disease) | Cancer
| |
|
Secondary Indication | SARS Coronavirus-2 (SARS-CoV-2) 2 NA |   |
|
Secondary Indication (Approaches) | Experimental | |
| Secondary Indication (Methods) | In-vitro | |
|
Secondary Indication (Model system) [cell lines/ animal models] | VeroE6
| |
|
Secondary Indication (Mode of viral infection) | Adsorption
| |
|
Secondary Indication (Mode of drug delivery) | Culture
| |
|
Secondary Indication (Duration of drug delivery) | 48 hours
| |
|
Secondary Indication (Drug concentration) | 9.4 μM
| |
|
Secondary Indication (Cell based assay) | Viral load reduction assay
| |
|
Secondary Indication (Change) | Decrease
| |
|
Secondary Indication (Type of Inhibition) | EC90 [ 90 % ] | |
|
Secondary Indication (Cytotoxicity) | 38.21 μM | |
|
Reference | Yuan S, Chan JFW, Chik KKH, Chan CCY, Tsang JOL, Liang R, Cao J, Tang K, Chen LL, Wen K, Cai JP, Ye ZW, Lu G, Chu H, Jin DY, Yuen KY..Discovery of the FDA-approved drugs bexarotene, cetilistat, diiodohydroxyquinoline, and abiraterone as potential COVID-19 treatments with a robust two-tier screening system..Pharmacol Res. 2020 May 28;159:104960. doi: 10.1016/j.phrs.2020.104960. PMCID: PMC7254006. PMID:32473310
|  |
|
Comment | At 48 hpi, the 50 % cytotoxic concentrations (CC50) of cetilistat, diiodohydroxyquinoline, abiraterone acetate, and bexarotene were > 100 μM, > 100 μM, 92.35 μM, and 38.21 μM, respectively
| |