| Chemical Information | |
| Antiviral agent ID | DrugRepV_7474 | |
| Antiviral agent name | Hypericin |  |
| IUPAC Name | 9,11,13,16,18,20-hexahydroxy-5,24-dimethyloctacyclo[13.11.1.1^{2,10}.0^{3,8}.0^{4,25}.0^{19,27}.0^{21,26}.0^{14,28}]octacosa-1(26),2,4(25),5,8,10,12,14(28),15(27),16,18,20,23-tridecaene-7,22-dione |  |
| SMILES (canonical) | CC1=CC(=O)C2=C(C3=C(C=C(C4=C3C5=C6C7=C(C1=C25)C(=CC(=O)C7=C(C8=C(C=C(C4=C86)O)O)O)C)O)O)O | |
| Molecular Formula | C30H16O8 | |
| Molecular Weight (g/mol) | 504.45 | |
| InChl | InChI=1S/C30H16O8/c1-7-3-9(31)19-23-15(7)16-8(2)4-10(32)20-24(16)28-26-18(12(34)6-14(36)22(26)30(20)38)17-11(33)5-13(35)21(29(19)37)25(17)27(23)28/h3-6,33-38H,1-2H3 | |
| Common Name | Hypericin | |
| Synonyms | hipericina | |
| Structural Information | |
 |
|
| Clinical Information | |
|
Category | Anticancer
| |
|
Primary Indication (Clinical trial phases) | Investigational
|  |
| Biological Information | |
|
Primary Indication (Disease Category) | Non infectious Disease
| |
|
Primary Indication (Disease) | Cutaneous T-cell Lymphoma
| |
|
Secondary Indication | West Nile virus (WNV) NA New York |   |
|
Secondary Indication (Approaches) | Experimental | |
| Secondary Indication (Methods) | In-vitro | |
|
Secondary Indication (Model system) [cell lines/ animal models] | Vero
| |
|
Secondary Indication (Viral titer) | 5 CCID50
| |
|
Secondary Indication (Mode of drug delivery) | Culture
| |
|
Secondary Indication (Time of drug delivery) | Post infection
| |
|
Secondary Indication (Duration of drug delivery) | 6 days
| |
|
Secondary Indication (Drug concentration) | 10 μg/ml
| |
|
Secondary Indication (Cell based assay) | Visual assay
| |
|
Secondary Indication (Change) | Decrease
| |
|
Secondary Indication (Type of Inhibition) | IC50 [ 50 % ] | |
|
Reference | Morrey JD, Smee DF, Sidwell RW, Tseng C..Identification of active antiviral compounds against a New York isolate of West Nile virus..Antiviral Res. 2002 Jul;55(1):107-16. PMID:12076755
|  |
|
Comment | The compounds 6-azauridine, 6-azauridine triacetate, cyclopententylcytosine (CPE-C), mycophenolic acid and pyrazofurin appeared to have the greatest activities against the New York isolate, followed by 2-thio-6-azauridine.
| |