| Chemical Information | |
| Antiviral agent ID | DrugRepV_7382 | |
| Antiviral agent name | Arecoline |  |
| IUPAC Name | methyl 1-methyl-3,6-dihydro-2~{H}-pyridine-5-carboxylate |  |
| SMILES (canonical) | CN1CCC=C(C1)C(=O)OC | |
| Molecular Formula | C8H13NO2 | |
| Molecular Weight (g/mol) | 155.197 | |
| InChl | InChI=1S/C8H13NO2/c1-9-5-3-4-7(6-9)8(10)11-2/h4H,3,5-6H2,1-2H3 | |
| Common Name | Arecoline | |
| Structural Information | |
 |
|
| Clinical Information | |
|
Primary Indication (Clinical trial phases) | Experimental
|  |
| Biological Information | |
|
Primary Indication (Disease Category) | Infectious Disease
| |
|
Primary Indication (Drug target/Mode of Action) | Adrenodoxin, mitochondrial
| |
|
Secondary Indication | Japanese encephalitis virus (JEV) NA T1P1 |   |
|
Secondary Indication (Approaches) | Experimental | |
| Secondary Indication (Methods) | In-vitro | |
|
Secondary Indication (Model system) [cell lines/ animal models] | HL-CZ
| |
|
Secondary Indication (Mode of viral infection) | Adsorption
| |
|
Secondary Indication (Viral titer) | 1 MOI
| |
|
Secondary Indication (Mode of drug delivery) | Culture
| |
|
Secondary Indication (Duration of drug delivery) | 48 hours
| |
|
Secondary Indication (Drug concentration) | 10.5 ± 0.3 μg/ml
| |
|
Secondary Indication (Cell based assay) | Plaque assay
| |
|
Secondary Indication (Change) | Decrease
| |
|
Secondary Indication (Type of Inhibition) | IC50 [ 50 % ] | |
|
Secondary Indication (Cytotoxicity) | >3000 μg/ml | |
|
Reference | Lin CW, Wu CF, Hsiao NW, Chang CY, Li SW, Wan L, Lin YJ, Lin WY..Aloe-emodin is an interferon-inducing agent with antiviral activity against Japanese encephalitis vi.Int J Antimicrob Agents. 2008 Oct;32(4):355-9. doi: 10.1016/j.ijantimicag.2008.04.018. Epub 2008 Aug PMID:18701259
|  |
|
Comment | Aloe-emodin has been demonstrated to be a potent IFN-inducer that significantly activates type I and II IFN responses and effectively inhibits the replication of JEV and EV71 in human neural and blood cell lines.
| |