| Chemical Information | |
| Antiviral agent ID | DrugRepV_7342 | |
| Antiviral agent name | Cilnidipine |  |
| IUPAC Name | 3-~{O}-(2-methoxyethyl) 5-~{O}-[(~{E})-3-phenylprop-2-enyl] 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate |  |
| SMILES (canonical) | CC1=C(C(C(=C(N1)C)C(=O)OCC=CC2=CC=CC=C2)C3=CC(=CC=C3)[N+](=O)[O-])C(=O)OCCOC | |
| SMILES (isomeric) | CC1=C(C(C(=C(N1)C)C(=O)OC/C=C/C2=CC=CC=C2)C3=CC(=CC=C3)[N+](=O)[O-])C(=O)OCCOC | |
| Molecular Formula | C27H28N2O7 | |
| Molecular Weight (g/mol) | 492.528 | |
| InChl | InChI=1S/C27H28N2O7/c1-18-23(26(30)35-14-8-11-20-9-5-4-6-10-20)25(21-12-7-13-22(17-21)29(32)33)24(19(2)28-18)27(31)36-16-15-34-3/h4-13,17,25,28H,14-16H2,1-3H3/b11-8+ | |
| Common Name | Cilnidipine | |
| Synonyms | Cinalong | FRC 8653 | Siscard | Atelec | |
| Structural Information | |
 |
|
| Clinical Information | |
|
Category | Cardiovascular agents
| |
|
Primary Indication (Clinical trial phases) | Investigational
|  |
| Biological Information | |
|
Primary Indication (Disease Category) | Non Infectious Disease
| |
|
Primary Indication (Disease) | Hypertension
| |
|
Secondary Indication | Japanese encephalitis virus (JEV) NA P3 |   |
|
Secondary Indication (Approaches) | Experimental | |
| Secondary Indication (Methods) | In-vitro | |
|
Secondary Indication (Model system) [cell lines/ animal models] | BHK-21
| |
|
Secondary Indication (Mode of viral infection) | Adsorption
| |
|
Secondary Indication (Viral titer) | 0.01 MOI
| |
|
Secondary Indication (Mode of drug delivery) | Culture
| |
|
Secondary Indication (Time of drug delivery) | During infection
| |
|
Secondary Indication (Duration of drug delivery) | 120 hours
| |
|
Secondary Indication (Drug concentration) | 6.52 μM
| |
|
Secondary Indication (Cell based assay) | Luminescence assay
| |
|
Secondary Indication (Change) | Decrease
| |
|
Secondary Indication (Type of Inhibition) | EC50 [ 50 % ] | |
|
Secondary Indication (Cytotoxicity) | >200 μM | |
|
Reference | Fang J, Sun L, Peng G, Xu J, Zhou R, Cao S, Chen H, Song Y..Identification of three antiviral inhibitors against Japanese encephalitis virus from library of pha.PLoS One. 2013 Nov 4;8(11):e78425. doi: 10.1371/journal.pone.0078425. eCollection 2013. PubMed Centr PMID:24348901
|  |
|
Comment | A cytopathic-effect-based, high-throughput screening assay was developed and applied to screen JEV inhibitors from Library of Pharmacologically Active Compounds 1280.
| |