| Chemical Information | |
| Antiviral agent ID | DrugRepV_6348 | |
| Antiviral agent name | Ribavirin |  |
| IUPAC Name | 1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1,2,4-triazole-3-carboxamide |  |
| SMILES (canonical) | C1=NC(=NN1C2C(C(C(O2)CO)O)O)C(=O)N | |
| SMILES (isomeric) | C1=NC(=NN1[C@H]2[C@@H]([C@@H]([C@H](O2)CO)O)O)C(=O)N | |
| Molecular Formula | C8H12N4O5 | |
| Molecular Weight (g/mol) | 244.207 | |
| InChl | InChI=1S/C8H12N4O5/c9-6(16)7-10-2-12(11-7)8-5(15)4(14)3(1-13)17-8/h2-5,8,13-15H,1H2,(H2,9,16)/t3-,4-,5-,8-/m1/s1 | |
| Common Name | Ribavirin | |
| Synonyms | 1-beta-D-Ribofuranosyl-1,2,4-triazole-3-carboxamide | 1-beta-D-Ribofuranosyl-1H-1,2,4-triazole-3-carboxamide | RBV | Ribavirin | Ribavirina | Ribavirine | Ribavirinum | Tribavirin | |
| Structural Information | |
 |
|
| Clinical Information | |
|
Category | Antiinfectives For Systemic Use
| |
|
Primary Indication (Clinical trial phases) | Approved
|  |
| Biological Information | |
|
Primary Indication (Disease Category) | Infectious Disease
| |
|
Primary Indication (Disease) | Hepatitis C virus
| |
|
Primary Indication (Drug target/Mode of Action) | Potential E3 ubiquitin-protein ligase ariadne-2
| |
|
Secondary Indication | Dengue virus (DENV) 2 New Guinea C (NGC) |   |
|
Secondary Indication (Approaches) | Experimental | |
| Secondary Indication (Methods) | In-vitro | |
|
Secondary Indication (Model system) [cell lines/ animal models] | HeLa
| |
|
Secondary Indication (Viral titer) | 0.01 MOI
| |
|
Secondary Indication (Mode of drug delivery) | Culture
| |
|
Secondary Indication (Time of drug delivery) | Post infection
| |
|
Secondary Indication (Duration of drug delivery) | 2 days
| |
|
Secondary Indication (Drug concentration) | 2.2 μM
| |
|
Secondary Indication (Change) | Decrease
| |
|
Secondary Indication (Type of Inhibition) | EC50 [ 50 % ] | |
|
Reference | van Cleef KW, Overheul GJ, Thomassen MC, Marjakangas JM, van Rij RP..Escape Mutations in NS4B Render Dengue Virus Insensitive to the Antiviral Activity of the Paracetamol Metabolite AM404..Antimicrob Agents Chemother. 2016 Mar 25;60(4):2554-7. doi: 10.1128/AAC.02462-15. Print 2016 Apr. Pu PMID:26856827
|  |
|
Comment | Mutations in NS4B that were found to confer resistance to the antiviral compounds NITD-618 and SDM25N also render dengue virus insensitive to AM404.
| |