| Chemical Information | |
| Antiviral agent ID | DrugRepV_6342 | |
| Antiviral agent name | Strophanthidin acetate | |
| IUPAC Name | [(3S,5S,8R,9S,10S,13R,14S,17R)-10-formyl-5,14-dihydroxy-13-methyl-17-(5-oxo-2H-furan-3-yl)-2,3,4,6,7,8,9,11,12,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate |  |
| SMILES (canonical) | CC(=O)OC1CCC2(C3CCC4(C(CCC4(C3CCC2(C1)O)O)C5=CC(=O)OC5)C)C=O | |
| SMILES (isomeric) | CC(=O)O[C@H]1CC[C@@]2([C@H]3CC[C@@]4([C@H](CC[C@@]4([C@@H]3CC[C@@]2(C1)O)O)C5=CC(=O)OC5)C)C=O | |
| Molecular Formula | C25H34O7 | |
| Molecular Weight (g/mol) | 446.54 | |
| InChl | InChI=1S/C25H34O7/c1-15(27)32-17-3-8-23(14-26)19-4-7-22(2)18(16-11-21(28)31-13-16)6-10-25(22,30)20(19)5-9-24(23,29)12-17/h11,14,17-20,29-30H,3-10,12-13H2,1-2H3/t17-,18+,19-,20+,22+,23-,24-,25-/m0/s1 | |
| Synonyms | Acetylstrophanthidin | Strophanthidin 3-acetate | Acetyl-k-strophanthidine | Erysimupicrone acetate | 3-Acetyl-strophanthidin | |
| Structural Information | |
 |
|
| Clinical Information | |
|
Category | Others
| |
| Biological Information | |
|
Secondary Indication | Dengue virus (DENV) 2 New Guinea C |   |
|
Secondary Indication (Approaches) | Experimental | |
| Secondary Indication (Methods) | In-vitro | |
|
Secondary Indication (Model system) [cell lines/ animal models] | Huh-7
| |
|
Secondary Indication (Mode of viral infection) | Adsorption
| |
|
Secondary Indication (Viral titer) | 1 MOI
| |
|
Secondary Indication (Mode of drug delivery) | Culture
| |
|
Secondary Indication (Time of drug delivery) | Post infection
| |
|
Secondary Indication (Duration of drug delivery) | 72 hours
| |
|
Secondary Indication (Drug concentration) | 2 μM
| |
|
Secondary Indication (Cell based assay) | Immunoflourescence assay
| |
|
Secondary Indication (Change) | Decrease
| |
|
Secondary Indication (Type of Inhibition) | EC50 [ 50 % ] | |
|
Secondary Indication (Cytotoxicity) | 77.18 μM | |
|
Reference | Low JS, Wu KX, Chen KC, Ng MM, Chu JJ..Narasin, a novel antiviral compound that blocks dengue virus protein expression..Antivir Ther. 2011;16(8):1203-18. doi: 10.3851/IMP1884. PMID:22155902
|  |
|
Comment | Narasin was identified and characterized as a novel agent that inhibits DENV replication in vitro through non-cytotoxic mechanisms, thus indicating its potential to be further developed as a therapeutic anti- DENV agent.
| |