| Chemical Information | |
| Antiviral agent ID | DrugRepV_6323 | |
| Antiviral agent name | Cycloheximide | |
| IUPAC Name | 4-[(2R)-2-[(1S,3S,5S)-3,5-dimethyl-2-oxocyclohexyl]-2-hydroxyethyl]piperidine-2,6-dione |  |
| SMILES (canonical) | CC1CC(C(=O)C(C1)C(CC2CC(=O)NC(=O)C2)O)C | |
| SMILES (isomeric) | C[C@H]1C[C@@H](C(=O)[C@@H](C1)[C@@H](CC2CC(=O)NC(=O)C2)O)C | |
| Molecular Formula | C15H23NO4 | |
| Molecular Weight (g/mol) | 281.352 | |
| InChl | InChI=1S/C15H23NO4/c1-8-3-9(2)15(20)11(4-8)12(17)5-10-6-13(18)16-14(19)7-10/h8-12,17H,3-7H2,1-2H3,(H,16,18,19)/t8-,9-,11-,12+/m0/s1 | |
| Common Name | Cycloheximide |  |
| Synonyms | ACTIDIONE | Cicloheximide | NARAMYCIN A | Kaken | Actidion | Actidone | Hizarocin | |
| Structural Information | |
 |
|
| Clinical Information | |
|
Category | Antibacterial
| |
| Biological Information | |
|
Primary Indication (Disease Category) | Infectious Disease
| |
|
Primary Indication (Disease) | Bacterial infections
| |
|
Primary Indication (Drug target/Mode of Action) | Ribosomal protein S6 kinase alpha-3
| |
|
Secondary Indication | Dengue virus (DENV) 2 New Guinea C |   |
|
Secondary Indication (Approaches) | Experimental | |
| Secondary Indication (Methods) | In-vitro | |
|
Secondary Indication (Model system) [cell lines/ animal models] | Huh-7
| |
|
Secondary Indication (Mode of viral infection) | Adsorption
| |
|
Secondary Indication (Viral titer) | 1 MOI
| |
|
Secondary Indication (Mode of drug delivery) | Culture
| |
|
Secondary Indication (Time of drug delivery) | Post infection
| |
|
Secondary Indication (Duration of drug delivery) | 72 hours
| |
|
Secondary Indication (Drug concentration) | 10 μM
| |
|
Secondary Indication (Cell based assay) | Immunoflourescence assay
| |
|
Secondary Indication (Change) | Decrease
| |
|
Secondary Indication (Type of Inhibition) | Percentage Inhibition [ 78.71 % ] | |
|
Reference | Low JS, Wu KX, Chen KC, Ng MM, Chu JJ..Narasin, a novel antiviral compound that blocks dengue virus protein expression..Antivir Ther. 2011;16(8):1203-18. doi: 10.3851/IMP1884. PMID:22155902
|  |
|
Comment | Narasin was identified and characterized as a novel agent that inhibits DENV replication in vitro through non-cytotoxic mechanisms, thus indicating its potential to be further developed as a therapeutic anti- DENV agent.
| |