| Chemical Information | |
| Antiviral agent ID | DrugRepV_6294 | |
| Antiviral agent name | Heparin |  |
| IUPAC Name | 6-[6-[6-[5-acetamido-4,6-dihydroxy-2-(sulfooxymethyl)oxan-3-yl]oxy-2-carboxy-4-hydroxy-5-sulfooxyoxan-3-yl]oxy-2-(hydroxymethyl)-5-(sulfoamino)-4-sulfooxyoxan-3-yl]oxy-3,4-dihydroxy-5-sulfooxyoxane-2-carboxylic acid |  |
| SMILES (canonical) | CC(=O)NC1C(C(C(OC1O)COS(=O)(=O)O)OC2C(C(C(C(O2)C(=O)O)OC3C(C(C(C(O3)CO)OC4C(C(C(C(O4)C(=O)O)O)O)OS(=O)(=O)O)OS(=O)(=O)O)NS(=O)(=O)O)O)OS(=O)(=O)O)O | |
| Molecular Formula | C26H42N2O37S5 | |
| Molecular Weight (g/mol) | 1134.899 | |
| InChl | InChI=1S/C26H42N2O37S5/c1-4(30)27-7-9(31)13(6(56-23(7)39)3-55-67(43,44)45)58-26-19(65-70(52,53)54)12(34)16(20(62-26)22(37)38)60-24-8(28-66(40,41)42)15(63-68(46,47)48)14(5(2-29)57-24)59-25-18(64-69(49,50)51)11(33)10(32)17(61-25)21(35)36/h5-20,23-26,28-29,31-34,39H,2-3H2,1H3,(H,27,30)(H,35,36)(H,37,38)(H,40,41,42)(H,43,44,45)(H,46,47,48)(H,49,50,51)(H,52,53,54) | |
| Common Name | Heparin | |
| Synonyms | Eparina | Heparina | Heparine |Heparinic acid |Heparinum| Unfractionated heparin | |
| Structural Information | |
 |
|
| Clinical Information | |
|
Category | Blood and Blood Forming Organs
| |
|
Primary Indication (Clinical trial phases) | Approved, Investigational
|  |
| Biological Information | |
|
Primary Indication (Disease Category) | Non Infectious Disease
| |
|
Primary Indication (Disease) | Venous thrombosis
| |
|
Secondary Indication | Dengue virus (DENV) 2 NGC |   |
|
Secondary Indication (Approaches) | Experimental | |
| Secondary Indication (Methods) | In-vitro | |
|
Secondary Indication (Model system) [cell lines/ animal models] | C6/36 HT
| |
|
Secondary Indication (Mode of viral infection) | Adsorption
| |
|
Secondary Indication (Viral titer) | 0.1 MOI
| |
|
Secondary Indication (Mode of drug delivery) | Culture
| |
|
Secondary Indication (Time of drug delivery) | Post infection
| |
|
Secondary Indication (Duration of drug delivery) | 48 hours
| |
|
Secondary Indication (Drug concentration) | >50 μg/ml
| |
|
Secondary Indication (Cell based assay) | Virus yield reduction assay
| |
|
Secondary Indication (Change) | Decrease
| |
|
Secondary Indication (Type of Inhibition) | IC50 [ 50 % ] | |
|
Reference | Talarico LB, Pujol CA, Zibetti RG, Farķa PC, Noseda MD, Duarte ME, Damonte EB..The antiviral activity of sulfated polysaccharides against dengue virus is dependent on virus serotype and host cell..Antiviral Res. 2005 Jun;66(2-3):103-10. Epub 2005 Feb 26. PMID:15911027
|  |
|
Comment | G3d and C2S-3 were active DENV-2 inhibitors only when added together with the virus or early after infection, and both initial processes of virus adsorption and internalization are the main targets of these compounds.
| |