| Chemical Information | |
| Antiviral agent ID | DrugRepV_6239 | |
| Antiviral agent name | YK 73 | |
| IUPAC Name | tert-butyl 2-butyl-3-[methoxy(methyl)carbamoyl]-4-phenylpiperidine-1-carboxylate |  |
| SMILES (canonical) | CCCCC1C(C(CCN1C(=O)OC(C)(C)C)C1=CC=CC=C1)C(=O)N(C)OC | |
| Molecular Formula | C23H36N2O4 | |
| Molecular Weight (g/mol) | 404.551 | |
| InChl | InChI=1/C23H36N2O4/c1-7-8-14-19-20(21(26)24(5)28-6)18(17-12-10-9-11-13-17)15-16-25(19)22(27)29-23(2,3)4/h9-13,18-20H,7-8,14-16H2,1-6H3 | |
| Structural Information | |
 |
|
| Clinical Information | |
| Biological Information | |
|
Secondary Indication | Dengue virus (DENV) 2 New Guinea C |   |
|
Secondary Indication (Approaches) | Experimental | |
| Secondary Indication (Methods) | In-vitro | |
|
Secondary Indication (Model system) [cell lines/ animal models] | HepG2
| |
|
Secondary Indication (Mode of viral infection) | Adsorption
| |
|
Secondary Indication (Viral titer) | 1000 TCID50
| |
|
Secondary Indication (Mode of drug delivery) | Culture
| |
|
Secondary Indication (Time of drug delivery) | Post infection
| |
|
Secondary Indication (Duration of drug delivery) | 5 days
| |
|
Secondary Indication (Drug concentration) | 2 μg/ml
| |
|
Secondary Indication (Cell based assay) | Virus plaque assay
| |
|
Secondary Indication (Change) | Decrease
| |
|
Secondary Indication (Type of Inhibition) | Virus plaque [ 3.5 * 103 pfu/ml ] | |
|
Reference | Muhamad M, Kee LY, Rahman NA, Yusof R..Antiviral actions of flavanoid-derived compounds on dengue virus type-2..Int J Biol Sci. 2010 May 23;6(3):294-302. PubMed Central PMCID: PMC2878174. PMID:20567498
|  |
|
Comment | The plaque forming unit per ml (pfu/ml) was reduced prominently with a maximum reduction of 98 % when the infected HepG2 cells were treated with the highest non-toxic dose of compounds.
| |