| Chemical Information | |
| Antiviral agent ID | DrugRepV_6234 | |
| Antiviral agent name | YK 73x | |
| IUPAC Name | 3-(1H-1,2,3-benzotriazol-1-yl) 1-tert-butyl 2-butyl-4-phenylpiperidine-1,3-dicarboxylate |  |
| SMILES (canonical) | CCCCC1C(C(CCN1C(=O)OC(C)(C)C)C1=CC=CC=C1)C(=O)ON1N=NC2=C1C=CC=C2 | |
| Molecular Formula | C27H34N4O4 | |
| Molecular Weight (g/mol) | 478.593 | |
| InChl | InChI=1/C27H34N4O4/c1-5-6-15-23-24(25(32)35-31-22-16-11-10-14-21(22)28-29-31)20(19-12-8-7-9-13-19)17-18-30(23)26(33)34-27(2,3)4/h7-14,16,20,23-24H,5-6,15,17-18H2,1-4H3 | |
| Structural Information | |
 |
|
| Clinical Information | |
| Biological Information | |
|
Secondary Indication | Dengue virus (DENV) 2 New Guinea C |   |
|
Secondary Indication (Approaches) | Experimental | |
| Secondary Indication (Methods) | In-vitro | |
|
Secondary Indication (Model system) [cell lines/ animal models] | HepG2
| |
|
Secondary Indication (Mode of viral infection) | Adsorption
| |
|
Secondary Indication (Viral titer) | 1000 TCID50
| |
|
Secondary Indication (Mode of drug delivery) | Culture
| |
|
Secondary Indication (Drug concentration) | 20 μg/ml
| |
|
Secondary Indication (Cell based assay) | CPE inhibition assay
| |
|
Secondary Indication (Change) | Decrease
| |
|
Secondary Indication (Type of Inhibition) | Percentage Inhibition [ 91 % ] | |
|
Reference | Muhamad M, Kee LY, Rahman NA, Yusof R..Antiviral actions of flavanoid-derived compounds on dengue virus type-2..Int J Biol Sci. 2010 May 23;6(3):294-302. PubMed Central PMCID: PMC2878174. PMID:20567498
|  |
|
Comment | The plaque forming unit per ml (pfu/ml) was reduced prominently with a maximum reduction of 98 % when the infected HepG2 cells were treated with the highest non-toxic dose of compounds.
| |