| Chemical Information | |
| Antiviral agent ID | DrugRepV_5996 | |
| Antiviral agent name | Dasatinib |  |
| IUPAC Name | N-(2-chloro-6-methylphenyl)-2-[[6-[4-(2-hydroxyethyl)piperazin-1-yl]-2-methylpyrimidin-4-yl]amino]-1,3-thiazole-5-carboxamide |  |
| SMILES (canonical) | CC1=C(C(=CC=C1)Cl)NC(=O)C2=CN=C(S2)NC3=NC(=NC(=C3)N4CCN(CC4)CCO)C | |
| Molecular Formula | C22H26ClN7O2S | |
| Molecular Weight (g/mol) | 488.007 | |
| InChl | InChI=1S/C22H26ClN7O2S/c1-14-4-3-5-16(23)20(14)28-21(32)17-13-24-22(33-17)27-18-12-19(26-15(2)25-18)30-8-6-29(7-9-30)10-11-31/h3-5,12-13,31H,6-11H2,1-2H3,(H,28,32)(H,24,25,26,27) | |
| Common Name | Dasatinib | |
| Synonyms | anh. dasatinib | Anhydrous dasatinib | BMS dasatinib | Dasatinib | Dasatinib (anh.) | dasatinib (anhydrous) | Dasatinib anhydrous | Dasatinibum | N-(2-CHLORO-6-methylphenyl)-2-({6-[4-(2-hydroxyethyl)piperazin-1-yl]-2-methylpyrimidin-4-yl}amino)-1,3-thiazole-5-carboxamide | |
| Structural Information | |
 |
|
| Clinical Information | |
|
Category | Antineoplastic and Immunomodulating Agents
| |
|
Primary Indication (Clinical trial phases) | Approved
|  |
| Biological Information | |
|
Primary Indication (Disease Category) | Non Infectious Disease
| |
|
Primary Indication (Disease) | Cancer
| |
|
Secondary Indication | Dengue virus (DENV) 3 Clone |   |
|
Secondary Indication (Approaches) | Experimental | |
| Secondary Indication (Methods) | in-vitro | |
|
Secondary Indication (Model system) [cell lines/ animal models] | Vero
| |
|
Secondary Indication (Mode of viral infection) | Adsorption
| |
|
Secondary Indication (Viral titer) | 1 MOI
| |
|
Secondary Indication (Mode of drug delivery) | Culture
| |
|
Secondary Indication (Time of drug delivery) | After infection
| |
|
Secondary Indication (Duration of drug delivery) | 3 days
| |
|
Secondary Indication (Drug concentration) | 1 μM
| |
|
Secondary Indication (Cell based assay) | Immunoflourescence assay
| |
|
Secondary Indication (Change) | Decrease
| |
|
Secondary Indication (Type of Inhibition) | Percentage inhibition [ >70 % ] | |
|
Reference | Chu JJ, Yang PL..c-Src protein kinase inhibitors block assembly and maturation of dengue virus..Proc Natl Acad Sci U S A. 2007 Feb 27;104(9):3520-5. Epub 2007 Feb 21. PMID:17360676
|  |
|
Comment | Given the reasonable clinical safety of inhibitors such as dasatinib and AZD0530, inhibitors of c-Src protein kinase may have the potential to become a new class of anti-dengue viral therapeutic agents.
| |