| Chemical Information | |
| Antiviral agent ID | DrugRepV_5954 | |
| Antiviral agent name | NITD008 | |
| IUPAC Name | (2R,3R,4R,5R)-2-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-3-ethynyl-5-(hydroxymethyl)oxolane-3,4-diol |  |
| SMILES (canonical) | C#CC1(C(C(OC1N2C=CC3=C2N=CN=C3N)CO)O)O | |
| SMILES (isomeric) | C#C[C@]1([C@@H]([C@H](O[C@H]1N2C=CC3=C2N=CN=C3N)CO)O)O | |
| Molecular Formula | C13H14N4O4 | |
| Molecular Weight (g/mol) | 290.279 | |
| InChl | InChI=1S/C13H14N4O4/c1-2-13(20)9(19)8(5-18)21-12(13)17-4-3-7-10(14)15-6-16-11(7)17/h1,3-4,6,8-9,12,18-20H,5H2,(H2,14,15,16)/t8-,9-,12-,13-/m1/s1 | |
| Synonyms | 7-Deaza-2'-C-ethynyladenosine | 7-(2-C-Ethynyl-?-D-ribofuranosyl)-7H-pyrrolo[2,3-d]pyrimidin-4-amine | |
| Structural Information | |
 |
|
| Clinical Information | |
|
Category | Antiviral
| |
| Biological Information | |
|
Secondary Indication | Dengue virus (DENV) 3 MY21531 |   |
|
Secondary Indication (Approaches) | Experimental | |
| Secondary Indication (Methods) | in-vitro | |
|
Secondary Indication (Model system) [cell lines/ animal models] | BHK-21
| |
|
Secondary Indication (Mode of viral infection) | Adsorption
| |
|
Secondary Indication (Viral titer) | 0.1 MOI
| |
|
Secondary Indication (Mode of drug delivery) | Culture
| |
|
Secondary Indication (Time of drug delivery) | During inoculation
| |
|
Secondary Indication (Duration of drug delivery) | 48 hours
| |
|
Secondary Indication (Drug concentration) | 0.65 μM
| |
|
Secondary Indication (Cell based assay) | Immunodetection assay
| |
|
Secondary Indication (Change) | Decrease
| |
|
Secondary Indication (Type of Inhibition) | EC50 [ 50 % ] | |
|
Reference | Yin Z, Chen YL, Schul W, Wang QY, Gu F, Duraiswamy J, Kondreddi RR, Niyomrattanakit P, Lakshminaraya.An adenosine nucleoside inhibitor of dengue virus..Proc Natl Acad Sci U S A. 2009 Dec 1;106(48):20435-9. doi: 10.1073/pnas.0907010106. Epub 2009 Nov 16 PMID:19918064
|  |
|
Comment | A triphosphate form of NITD008 directly inhibits the RNA-dependent RNA polymerase activity of DENV, indicating that the compound functions as a chain terminator during viral RNA synthesis. NITD008 has good in vivo pharmacokinetic properties and is biologically available through oral administration.
| |