| Chemical Information | |
| Antiviral agent ID | DrugRepV_5875 | |
| Antiviral agent name | N-Desmethylclozapine |  |
| IUPAC Name | 3-chloro-6-piperazin-1-yl-5H-benzo[b][1,4]benzodiazepine |  |
| SMILES (canonical) | C1CN(CCN1)C2=C3C=CC=CC3=NC4=C(N2)C=C(C=C4)Cl | |
| Molecular Formula | C17H17ClN4 | |
| Molecular Weight (g/mol) | 312.801 | |
| InChl | InChI=1S/C17H17ClN4/c18-12-5-6-15-16(11-12)21-17(22-9-7-19-8-10-22)13-3-1-2-4-14(13)20-15/h1-6,11,19,21H,7-10H2 | |
| Structural Information | |
 |
|
| Clinical Information | |
|
Category | Antipsychotic
| |
|
Primary Indication (Clinical trial phases) | Investigational
|  |
| Biological Information | |
|
Primary Indication (Disease Category) | Non Infectious Disease
| |
|
Primary Indication (Disease) | Schizophrenia | Schizoaffective disorders
| |
|
Primary Indication (Drug target/Mode of Action) | Glycerol-3-phosphate dehydrogenase, mitochondrial
| |
|
Secondary Indication | Dengue virus (DENV) 2 NA |   |
|
Secondary Indication (Approaches) | Experimental | |
| Secondary Indication (Methods) | In-vitro | |
|
Secondary Indication (Model system) [cell lines/ animal models] | Huh-7
| |
|
Secondary Indication (Mode of viral infection) | Adsorption
| |
|
Secondary Indication (Viral titer) | 3 MOI
| |
|
Secondary Indication (Mode of drug delivery) | Culture
| |
|
Secondary Indication (Time of drug delivery) | Post infection (1 hour)
| |
|
Secondary Indication (Duration of drug delivery) | 24 hours
| |
|
Secondary Indication (Drug concentration) | 4 μM
| |
|
Secondary Indication (Cell based assay) | Plaque assay
| |
|
Secondary Indication (Change) | Decrease
| |
|
Secondary Indication (Type of Inhibition) | Viral titer [ 1.5 Fold ] | |
|
Reference | Medigeshi GR, Kumar R, Dhamija E, Agrawal T, Kar M..N-Desmethylclozapine, Fluoxetine, and Salmeterol Inhibit Postentry Stages of the Dengue Virus Life C.Antimicrob Agents Chemother. 2016 Oct 21;60(11):6709-6718. doi: 10.1128/AAC.01367-16. Print 2016 Nov PMID:27572397
|  |
|
Comment | Inhibition of DENV occurs at a postentry stage, most probably at the initiation of viral RNA replication and due to the modulation of the endolysosomal pathway and induction of autophagy.
| |