| Chemical Information | |
| Antiviral agent ID | DrugRepV_5862 | |
| Antiviral agent name | Salmeterol |  |
| IUPAC Name | 2-(hydroxymethyl)-4-[1-hydroxy-2-[6-(4-phenylbutoxy)hexylamino]ethyl]phenol |  |
| SMILES (canonical) | C1=CC=C(C=C1)CCCCOCCCCCCNCC(C2=CC(=C(C=C2)O)CO)O | |
| Molecular Formula | C25H37NO4 | |
| Molecular Weight (g/mol) | 415.574 | |
| InChl | InChI=1S/C25H37NO4/c27-20-23-18-22(13-14-24(23)28)25(29)19-26-15-7-1-2-8-16-30-17-9-6-12-21-10-4-3-5-11-21/h3-5,10-11,13-14,18,25-29H,1-2,6-9,12,15-17,19-20H2 | |
| Common Name | Salmeterol | |
| Synonyms | Salmaterol | Salmeterolum | |
| Structural Information | |
 |
|
| Clinical Information | |
|
Category | Respiratory System
| |
|
Primary Indication (Clinical trial phases) | Approved
|  |
| Biological Information | |
|
Primary Indication (Disease Category) | Non Infectious Disease
| |
|
Primary Indication (Disease) | Asthma | Chronic obstructive pulmonary disease
| |
|
Primary Indication (Drug target/Mode of Action) | High affinity cGMP-specific 3',5'-cyclic phosphodiesterase 9A
| |
|
Secondary Indication | Dengue virus (DENV) 2 NA |   |
|
Secondary Indication (Approaches) | Experimental | |
| Secondary Indication (Methods) | In-vitro | |
|
Secondary Indication (Model system) [cell lines/ animal models] | Huh-7
| |
|
Secondary Indication (Mode of viral infection) | Adsorption
| |
|
Secondary Indication (Viral titer) | 3 MOI
| |
|
Secondary Indication (Mode of drug delivery) | Culture
| |
|
Secondary Indication (Time of drug delivery) | Post infection
| |
|
Secondary Indication (Duration of drug delivery) | 24 hours
| |
|
Secondary Indication (Drug concentration) | 0.67 μM
| |
|
Secondary Indication (Cell based assay) | Plaque assay
| |
|
Secondary Indication (Change) | Decrease
| |
|
Secondary Indication (Type of Inhibition) | IC50 [ 50 % ] | |
|
Reference | Medigeshi GR, Kumar R, Dhamija E, Agrawal T, Kar M..N-Desmethylclozapine, Fluoxetine, and Salmeterol Inhibit Postentry Stages of the Dengue Virus Life C.Antimicrob Agents Chemother. 2016 Oct 21;60(11):6709-6718. doi: 10.1128/AAC.01367-16. Print 2016 Nov PMID:27572397
|  |
|
Comment | Inhibition of DENV occurs at a postentry stage, most probably at the initiation of viral RNA replication and due to the modulation of the endolysosomal pathway and induction of autophagy.
| |