| Chemical Information | |
| Antiviral agent ID | DrugRepV_5861 | |
| Antiviral agent name | Fluoxetine |  |
| IUPAC Name | N-methyl-3-phenyl-3-[4-(trifluoromethyl)phenoxy]propan-1-amine |  |
| SMILES (canonical) | CNCCC(C1=CC=CC=C1)OC2=CC=C(C=C2)C(F)(F)F | |
| Molecular Formula | C17H18F3NO | |
| Molecular Weight (g/mol) | 309.332 | |
| InChl | InChI=1S/C17H18F3NO/c1-21-12-11-16(13-5-3-2-4-6-13)22-15-9-7-14(8-10-15)17(18,19)20/h2-10,16,21H,11-12H2,1H3 | |
| Common Name | Fluoxetine | |
| Synonyms | (+-)-N-Methyl-3-phenyl-3-((alpha,alpha,alpha-trifluoro-P-tolyl)oxy)propylamine | (+-)-N-Methyl-gamma-(4-(trifluoromethyl)phenoxy)benzenepropanamine | Fluoxetin | Fluoxetina | Fluoxétine | Fluoxetinum | |
| Structural Information | |
 |
|
| Clinical Information | |
|
Category | Nervous System
| |
|
Primary Indication (Clinical trial phases) | Approved, Vet approved
|  |
| Biological Information | |
|
Primary Indication (Disease Category) | Non Infectious Disease
| |
|
Primary Indication (Disease) | Major depressive disorder | Bulimia nervosa | Obsessive-compulsive disorder | Premenstrual dysphoric disorder | Panic disorder with or without agoraphobia
| |
|
Primary Indication (Drug target/Mode of Action) | Intercellular adhesion molecule 4
| |
|
Secondary Indication | Dengue virus (DENV) 2 NA |   |
|
Secondary Indication (Approaches) | Experimental | |
| Secondary Indication (Methods) | In-vitro | |
|
Secondary Indication (Model system) [cell lines/ animal models] | Huh-7
| |
|
Secondary Indication (Mode of viral infection) | Adsorption
| |
|
Secondary Indication (Viral titer) | 3 MOI
| |
|
Secondary Indication (Mode of drug delivery) | Culture
| |
|
Secondary Indication (Time of drug delivery) | Post infection
| |
|
Secondary Indication (Duration of drug delivery) | 24 hours
| |
|
Secondary Indication (Drug concentration) | 0.38 μM
| |
|
Secondary Indication (Cell based assay) | Plaque assay
| |
|
Secondary Indication (Change) | Decrease
| |
|
Secondary Indication (Type of Inhibition) | IC50 [ 50 % ] | |
|
Reference | Medigeshi GR, Kumar R, Dhamija E, Agrawal T, Kar M..N-Desmethylclozapine, Fluoxetine, and Salmeterol Inhibit Postentry Stages of the Dengue Virus Life C.Antimicrob Agents Chemother. 2016 Oct 21;60(11):6709-6718. doi: 10.1128/AAC.01367-16. Print 2016 Nov PMID:27572397
|  |
|
Comment | Inhibition of DENV occurs at a postentry stage, most probably at the initiation of viral RNA replication and due to the modulation of the endolysosomal pathway and induction of autophagy.
| |