| Chemical Information | |
| Antiviral agent ID | DrugRepV_5850 | |
| Antiviral agent name | Narasin |  |
| IUPAC Name | (2R)-2-[(2R,3S,5S,6R)-6-[(2S,3S,4S,6R)-6-[(3S,5S,7R,9S,10S,12R,15R)-3-[(2R,5R,6S)-5-ethyl-5-hydroxy-6-methyloxan-2-yl]-15-hydroxy-3,10,12-trimethyl-4,6,8-trioxadispiro[4.1.5^{7}.3^{5}]pentadec-13-en-9-yl]-3-hydroxy-4-methyl-5-oxooctan-2-yl]-3,5-dimethyloxan-2-yl]butanoic acid |  |
| SMILES (canonical) | CCC(C1C(CC(C(O1)C(C)C(C(C)C(=O)C(CC)C2C(CC(C3(O2)C=CC(C4(O3)CCC(O4)(C)C5CCC(C(O5)C)(CC)O)O)C)C)O)C)C)C(=O)O | |
| SMILES (isomeric) | CC[C@H]([C@H]1[C@H](C[C@@H]([C@@H](O1)[C@@H](C)[C@@H]([C@H](C)C(=O)[C@H](CC)[C@@H]2[C@H](C[C@H]([C@]3(O2)C=C[C@H]([C@@]4(O3)CC[C@@](O4)(C)[C@H]5CC[C@@]([C@@H](O5)C)(CC)O)O)C)C)O)C)C)C(=O)O | |
| Molecular Formula | C43H72O11 | |
| Molecular Weight (g/mol) | 765.038 | |
| InChl | InChI=1S/C43H72O11/c1-12-30(35(46)27(8)34(45)28(9)36-23(4)21-24(5)37(51-36)31(13-2)39(47)48)38-25(6)22-26(7)42(52-38)18-15-32(44)43(54-42)20-19-40(11,53-43)33-16-17-41(49,14-3)29(10)50-33/h15,18,23-34,36-38,44-45,49H,12-14,16-17,19-22H2,1-11H3,(H,47,48)/t23-,24-,25-,26+,27-,28-,29-,30-,31+,32+,33+,34+,36+,37+,38-,40-,41+,42-,43-/m0/s1 | |
| Common Name | Narasin A | |
| Synonyms | Narasin A | Monteban | Narasinum | 4-Methylsalinomycin | |
| Structural Information | |
 |
|
| Clinical Information | |
|
Category | Antibacterial
| |
|
Primary Indication (Clinical trial phases) | Experimental
| |
| Biological Information | |
|
Primary Indication (Disease Category) | Infectious Disease
| |
|
Primary Indication (Disease) | Parasitic and bacterial infections
| |
|
Secondary Indication | Dengue virus (DENV) 4 NA |   |
|
Secondary Indication (Approaches) | Experimental | |
| Secondary Indication (Methods) | In-vitro | |
|
Secondary Indication (Model system) [cell lines/ animal models] | Huh-7
| |
|
Secondary Indication (Mode of viral infection) | Adsorption
| |
|
Secondary Indication (Viral titer) | 1 MOI
| |
|
Secondary Indication (Mode of drug delivery) | Culture
| |
|
Secondary Indication (Time of drug delivery) | During infection (0 hour)
| |
|
Secondary Indication (Duration of drug delivery) | 72 hours
| |
|
Secondary Indication (Drug concentration) | 1 μM
| |
|
Secondary Indication (Cell based assay) | Immunoflourescence assay
| |
|
Secondary Indication (Change) | Decrease
| |
|
Secondary Indication (Type of Inhibition) | Percentage Inhibition [ Decrease NA ] | |
|
Reference | Low JS, Wu KX, Chen KC, Ng MM, Chu JJ..Narasin, a novel antiviral compound that blocks dengue virus protein expression..Antivir Ther. 2011;16(8):1203-18. doi: 10.3851/IMP1884. PMID:22155902
|  |
|
Comment | Narasin was identified and characterized as a novel agent that inhibits DENV replication in vitro through non-cytotoxic mechanisms, thus indicating its potential to be further developed as a therapeutic anti- DENV agent.
| |