| Chemical Information | |
| Antiviral agent ID | DrugRepV_5800 | |
| Antiviral agent name | Geneticin |  |
| IUPAC Name | (2R,3R,4R,5R)-2-[(1S,2S,3R,4S,6R)-4,6-diamino-3-[(2S,3R,4R,5S,6R)-3-amino-4,5-dihydroxy-6-[(1R)-1-hydroxyethyl]oxan-2-yl]oxy-2-hydroxycyclohexyl]oxy-5-methyl-4-(methylamino)oxane-3,5-diol |  |
| SMILES (canonical) | CC(C1C(C(C(C(O1)OC2C(CC(C(C2O)OC3C(C(C(CO3)(C)O)NC)O)N)N)N)O)O)O | |
| SMILES (isomeric) | C[C@H]([C@@H]1[C@H]([C@@H]([C@H]([C@H](O1)O[C@@H]2[C@H](C[C@H]([C@@H]([C@H]2O)O[C@@H]3[C@@H]([C@H]([C@@](CO3)(C)O)NC)O)N)N)N)O)O)O | |
| Molecular Formula | C20H40N4O10 | |
| Molecular Weight (g/mol) | 496.558 | |
| InChl | InChI=1S/C20H40N4O10/c1-6(25)14-11(27)10(26)9(23)18(32-14)33-15-7(21)4-8(22)16(12(15)28)34-19-13(29)17(24-3)20(2,30)5-31-19/h6-19,24-30H,4-5,21-23H2,1-3H3/t6-,7+,8-,9-,10-,11+,12+,13-,14-,15-,16+,17-,18-,19-,20+/m1/s1 | |
| Synonyms | G418 | antibiotic G 418 | |
| Structural Information | |
 |
|
| Clinical Information | |
|
Category | Antibacterial
| |
|
Primary Indication (Clinical trial phases) | Experimental
| |
| Biological Information | |
|
Primary Indication (Disease Category) | Infectious Disease
| |
|
Primary Indication (Disease) | Bacterial infections
| |
|
Secondary Indication | Dengue virus (DENV) 2 NA |   |
|
Secondary Indication (Approaches) | Experimental | |
| Secondary Indication (Methods) | In-vitro | |
|
Secondary Indication (Model system) [cell lines/ animal models] | BHK
| |
|
Secondary Indication (Mode of viral infection) | Adsorption
| |
|
Secondary Indication (Viral titer) | 1 MOI
| |
|
Secondary Indication (Mode of drug delivery) | Culture
| |
|
Secondary Indication (Time of drug delivery) | Post infection
| |
|
Secondary Indication (Duration of drug delivery) | 24 hours
| |
|
Secondary Indication (Drug concentration) | 25 μg/ml
| |
|
Secondary Indication (Cell based assay) | Real-time PCR
| |
|
Secondary Indication (Change) | Decrease
| |
|
Secondary Indication (Type of Inhibition) | Percentage Inhibition [ 90 % ] | |
|
Reference | Zhang XG, Mason PW, Dubovi EJ, Xu X, Bourne N, Renshaw RW, Block TM, Birk AV..Antiviral activity of geneticin against dengue virus..Antiviral Res. 2009 Jul;83(1):21-7. doi: 10.1016/j.antiviral.2009.02.204. Epub 2009 Mar 11. PMID:19501253
|  |
|
Comment | Geneticin as anti-DENV therapeutics to inhibit viremia and DENV- induced clinical complications. Results suggest that geneticin represents a novel lead compound for broad-spectrum virus-selective antivirals
| |