| Chemical Information | |
| Antiviral agent ID | DrugRepV_5783 | |
| Antiviral agent name | Dioxybenzone |  |
| IUPAC Name | (2-hydroxy-4-methoxyphenyl)-(2-hydroxyphenyl)methanone |  |
| SMILES (canonical) | COC1=CC(=C(C=C1)C(=O)C2=CC=CC=C2O)O | |
| Molecular Formula | C14H12O4 | |
| Molecular Weight (g/mol) | 244.246 | |
| InChl | InChI=1S/C14H12O4/c1-18-9-6-7-11(13(16)8-9)14(17)10-4-2-3-5-12(10)15/h2-8,15-16H,1H3 | |
| Structural Information | |
 |
|
| Clinical Information | |
|
Category | Dermatologicals
| |
|
Primary Indication (Clinical trial phases) | Approved
|  |
| Biological Information | |
|
Primary Indication (Disease Category) | Non Infectious Disease
| |
|
Primary Indication (Disease) | Sunburn
| |
|
Primary Indication (Drug target/Mode of Action) | MAP kinase-interacting serine/threonine-protein kinase 1
| |
|
Secondary Indication | Dengue virus (DENV) 2 Singapore isolates |   |
|
Secondary Indication (Approaches) | Experimental | |
| Secondary Indication (Methods) | In-vitro | |
|
Secondary Indication (Model system) [cell lines/ animal models] | Huh-7
| |
|
Secondary Indication (Mode of viral infection) | Adsorption
| |
|
Secondary Indication (Viral titer) | 1 MOI
| |
|
Secondary Indication (Mode of drug delivery) | Culture
| |
|
Secondary Indication (Cell based assay) | Plaque assay
| |
|
Secondary Indication (Change) | Decrease
| |
|
Secondary Indication (Type of Inhibition) | Percentage Inhibition [ 65 % ] | |
|
Reference | Cheung YY, Chen KC, Chen H, Seng EK, Chu JJ..Antiviral activity of lanatoside C against dengue virus infection..Antiviral Res. 2014 Nov;111:93-9. doi: 10.1016/j.antiviral.2014.09.007. Epub 2014 Sep 22. PMID:25251726
|  |
|
Comment | Lanatoside C can effectively inhibit all four serotypes of dengue virus, flavivirus Kunjin, alphavirus Chikungunya and Sindbis virus as well as the human enterovirus 71. These findings suggest that lanatoside C possesses broad spectrum antiviral activity against several groups of positive-sense RNA viruses.
| |