| Chemical Information | |
| Antiviral agent ID | DrugRepV_5648 | |
| Antiviral agent name | Celgosivir |  |
| IUPAC Name | [(1S,6S,7S,8R,8aR)-1,7,8-trihydroxy-1,2,3,5,6,7,8,8a-octahydroindolizin-6-yl] butanoate |  |
| SMILES (canonical) | CCCC(=O)OC1CN2CCC(C2C(C1O)O)O | |
| SMILES (isomeric) | CCCC(=O)O[C@H]1CN2CC[C@@H]([C@@H]2[C@H]([C@@H]1O)O)O | |
| Molecular Formula | C12H21NO5 | |
| Molecular Weight (g/mol) | 259.30 | |
| InChl | InChI=1S/C12H21NO5/c1-2-3-9(15)18-8-6-13-5-4-7(14)10(13)12(17)11(8)16/h7-8,10-12,14,16-17H,2-6H2,1H3/t7-,8-,10+,11+,12+/m0/s1 | |
| Common Name | Celgosivir | |
| Synonyms | MBI-3253 | |
| Structural Information | |
 |
|
| Clinical Information | |
|
Category | Antiviral
| |
|
Primary Indication (Clinical trial phases) | Phase II
|  |
| Secondary Indication (Clinical trial phases) | Phase Ib | |
| Biological Information | |
|
Primary Indication (Disease Category) | Infectious Disease
| |
|
Primary Indication (Disease) | Hepatitis C virus
| |
|
Secondary Indication | Dengue virus (DENV) 1 DENV1-2402 |   |
|
Secondary Indication (Approaches) | Experimental | |
| Secondary Indication (Methods) | In-vivo | |
|
Secondary Indication (Model system) [cell lines/ animal models] | AG129 + ADE
| |
|
Secondary Indication (Mode of viral infection) | Intravenous
| |
|
Secondary Indication (Viral titer) | 70000000 PFU
| |
|
Secondary Indication (Mode of drug delivery) | Oral
| |
|
Secondary Indication (Time of drug delivery) | After adsorption
| |
|
Secondary Indication (Duration of drug delivery) | 10 days
| |
|
Secondary Indication (Drug concentration) | 50 mg/kg/BID
| |
|
Secondary Indication (Change) | Increase
| |
|
Secondary Indication (Type of Inhibition) | Percentage survival [ NA NA ] | |
|
Secondary Indication (Survival rate) | 100 | |
|
Reference | Watanabe S, Chan KW, Dow G, Ooi EE, Low JG, Vasudevan SG..Optimizing celgosivir therapy in mouse models of dengue virus infection of serotypes 1 and 2: The se.Antiviral Res. 2016 Mar;127:10-9. doi: 10.1016/j.antiviral.2015.12.008. Epub 2016 Jan 13. PMID:26794905
|  |
|
Comment | AG129 mice were pre-injected i.p. with 50 mg (for EDEN1 and EDEN2) or 10 mg (for S221) 4G2 Ab followed by next day inoculation i.v. with Dengue virus
| |