| Chemical Information | |
| Antiviral agent ID | DrugRepV_5631 | |
| Antiviral agent name | Minocycline |  |
| IUPAC Name | (4S,4aS,5aR,12aR)-4,7-bis(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |  |
| SMILES (canonical) | CN(C)C1C2CC3CC4=C(C=CC(=C4C(=C3C(=O)C2(C(=C(C1=O)C(=O)N)O)O)O)O)N(C)C | |
| SMILES (isomeric) | CN(C)[C@H]1[C@@H]2C[C@@H]3CC4=C(C=CC(=C4C(=C3C(=O)[C@@]2(C(=C(C1=O)C(=O)N)O)O)O)O)N(C)C | |
| Molecular Formula | C23H27N3O7 | |
| Molecular Weight (g/mol) | 457.48 | |
| InChl | InChI=1S/C23H27N3O7/c1-25(2)12-5-6-13(27)15-10(12)7-9-8-11-17(26(3)4)19(29)16(22(24)32)21(31)23(11,33)20(30)14(9)18(15)28/h5-6,9,11,17,27-28,31,33H,7-8H2,1-4H3,(H2,24,32)/t9-,11-,17-,23-/m0/s1 | |
| Common Name | Minocycline | |
| Synonyms | (4S,4AS,5ar,12as)-4,7-bis(dimethylamino)-3,10,12,12a-tetrahydroxy-1,11-dioxo-1,4,4a,5,5a,6,11,12a-octahydrotetracene-2-carboxamide | 7-Dimethylamino-6-demethyl-6-deoxytetracycline | Minociclina | Minociclinum | Minocyclin | Minocyclinum | |
| Structural Information | |
 |
|
| Clinical Information | |
|
Category | Antiinfectives For Systemic Use
| |
|
Primary Indication (Clinical trial phases) | Approved, Investigational
|  |
| Biological Information | |
|
Primary Indication (Disease Category) | Infectious Disease
| |
|
Primary Indication (Disease) | Rocky Mountain spotted fever | Typhus fever and the typhus group | Q fever | Rickettsial pox | tick fevers caused by Rickettsiae | Upper respiratory tract infections caused by Streptococcus pneumoniae
| |
|
Secondary Indication | Dengue virus (DENV) 4 H241 |   |
|
Secondary Indication (Approaches) | Experimental | |
| Secondary Indication (Methods) | In-vitro | |
|
Secondary Indication (Potential drug target) | Phosphorylation of ERK 1/2
| |
|
Secondary Indication (Model system) [cell lines/ animal models] | HepG2
| |
|
Secondary Indication (Mode of viral infection) | Adsorption
| |
|
Secondary Indication (Viral titer) | 1 MOI
| |
|
Secondary Indication (Mode of drug delivery) | Culture
| |
|
Secondary Indication (Time of drug delivery) | After adsorption
| |
|
Secondary Indication (Duration of drug delivery) | 48 hours
| |
|
Secondary Indication (Drug concentration) | 400 μM
| |
|
Secondary Indication (Cell based assay) | Enzyme-linked immunosorbent assay
| |
|
Secondary Indication (Change) | Decrease
| |
|
Secondary Indication (Type of Inhibition) | Percentage Inhibition [ 30 % ] | |
|
Secondary Indication (Cytotoxicity) | 1482 μM | |
|
Reference | Leela SL, Srisawat C, Sreekanth GP, Noisakran S, Yenchitsomanus PT, Limjindaporn T..Drug repurposing of minocycline against dengue virus infection..Biochem Biophys Res Commun. 2016 Sep 9;478(1):410-416. doi: 10.1016/j.bbrc.2016.07.029. Epub 2016 Ju PMID:27396621
|  |
|
Comment | The effects of minocycline at various stages of the viral life cycle, such as during viral RNA synthesis, intracellular envelope protein expression, and the production of infectious virions, were examined and found to be significantly reduced by minocycline treatment. Minocycline also modulated host factors, including the phosphorylation of extracellular signal-regulated kinase1/2 (ERK1/2). The transcription of antiviral genes, including 2'-5'-oligoadenylate synthetase 1 (OAS1), 2'-5'- oligoadenylate synthetase 3 (OAS3), and interferon alpha (IFNA), was upregulated by minocycline treatment. Therefore, the antiviral activity of minocycline may have a potential clinical use against Dengue virus infection.
| |