| Chemical Information | |
| Antiviral agent ID | DrugRepV_5595 | |
| Antiviral agent name | Erlotinib |  |
| IUPAC Name | N-(3-ethynylphenyl)-6,7-bis(2-methoxyethoxy)quinazolin-4-amine |  |
| SMILES (canonical) | COCCOC1=C(C=C2C(=C1)C(=NC=N2)NC3=CC=CC(=C3)C#C)OCCOC | |
| Molecular Formula | C22H23N3O4 | |
| Molecular Weight (g/mol) | 393.44 | |
| InChl | InChI=1S/C22H23N3O4/c1-4-16-6-5-7-17(12-16)25-22-18-13-20(28-10-8-26-2)21(29-11-9-27-3)14-19(18)23-15-24-22/h1,5-7,12-15H,8-11H2,2-3H3,(H,23,24,25) | |
| Common Name | Erlotinib | |
| Synonyms | [6,7-Bis-(2-methoxy-ethoxy)-quinazolin-4-yl]-(3-ethynyl-phenyl)-amine | Erlotinib | OSI-774 | |
| Structural Information | |
 |
|
| Clinical Information | |
|
Category | Antineoplastic and Immunomodulating Agents
| |
|
Primary Indication (Clinical trial phases) | Approved
|  |
| Biological Information | |
|
Primary Indication (Disease Category) | Non Infectious Disease
| |
|
Primary Indication (Disease) | Cancer
| |
|
Secondary Indication | Dengue virus (DENV) 1 276RKI, PRS41393 |   |
|
Secondary Indication (Approaches) | Experimental | |
| Secondary Indication (Methods) | In-vitro | |
|
Secondary Indication (Potential drug target) | AAK1 and GAK in entry and assembly/release of Flaviviridae family member
| |
|
Secondary Indication (Model system) [cell lines/ animal models] | BHK-21
| |
|
Secondary Indication (Mode of drug delivery) | Culture
| |
|
Secondary Indication (Drug concentration) | 1.9 μM
| |
|
Secondary Indication (Cell based assay) | Plaque assay
| |
|
Secondary Indication (Change) | Decrease
| |
|
Secondary Indication (Type of Inhibition) | EC50 [ 50 % ] | |
|
Secondary Indication (Cytotoxicity) | >20 μM | |
|
Reference | Bekerman E, Neveu G, Shulla A, Brannan J, Pu SY, Wang S, Xiao F, Barouch-Bentov R, Bakken RR, Mateo.Anticancer kinase inhibitors impair intracellular viral trafficking and exert broad-spectrum antivir.J Clin Invest. 2017 Apr 3;127(4):1338-1352. doi: 10.1172/JCI89857. Epub 2017 Feb 27. PMID:28240606
|  |
|
Comment | Sunitinib and erlotinib, potent, albeit nonselective, inhibitors of AAK1 and GAK, respectively, restrict DENV and EBOV infections in vitro and their combination reduces viremia, morbidity, and mortality in the relevant murine models.
| |