| Chemical Information | |
| Antiviral agent ID | DrugRepV_5476 | |
| Antiviral agent name | Nitazoxanide |  |
| IUPAC Name | [2-[(5-nitro-1,3-thiazol-2-yl)carbamoyl]phenyl] acetate |  |
| SMILES (canonical) | CC(=O)OC1=CC=CC=C1C(=O)NC2=NC=C(S2)[N+](=O)[O-] | |
| Molecular Formula | C12H9N3O5S | |
| Molecular Weight (g/mol) | 307.28 | |
| InChl | InChI=1S/C12H9N3O5S/c1-7(16)20-9-5-3-2-4-8(9)11(17)14-12-13-6-10(21-12)15(18)19/h2-6H,1H3,(H,13,14,17) | |
| Common Name | Nitazoxanide | |
| Synonyms | Nitaxozanid | Nitaxozanide | Nitazoxanida | Nitazoxanidum | |
| Structural Information | |
 |
|
| Clinical Information | |
|
Category | Antiparasitic products, Insectisides and Repellents
| |
|
Primary Indication (Clinical trial phases) | Approved, Investigational, Vet approved
|  |
| Biological Information | |
|
Primary Indication (Disease Category) | Infectious Disease
| |
|
Primary Indication (Disease) | Diarrhea
| |
|
Secondary Indication | SARS Coronavirus-2 (SARS-CoV-2) NA nCoV- 2019BetaCoV/Wuhan/WIV04/2019 |   |
|
Secondary Indication (Approaches) | Experimental | |
| Secondary Indication (Methods) | In-vitro | |
|
Secondary Indication (Model system) [cell lines/ animal models] | Vero E6
| |
|
Secondary Indication (Viral titer) | 0.05 MOI
| |
|
Secondary Indication (Mode of drug delivery) | Culture
| |
|
Secondary Indication (Time of drug delivery) | Post infection
| |
|
Secondary Indication (Duration of drug delivery) | 48 hours
| |
|
Secondary Indication (Drug concentration) | 2.12 μM
| |
|
Secondary Indication (Cell based assay) | qRT-PCR
| |
|
Secondary Indication (Change) | Decrease
| |
|
Secondary Indication (Type of Inhibition) | EC50 [ 50 % ] | |
|
Secondary Indication (Cytotoxicity) | >16.76 μM | |
|
Reference | Wang M, Cao R, Zhang L, Yang X, Liu J, Xu M, Shi Z, Hu Z, Zhong W, Xiao G..Remdesivir and chloroquine effectively inhibit the recently emerged novel coronavirus (2019-nCoV) in vitro..Cell Res. 2020 Mar;30(3):269-271. doi: 10.1038/s41422-020-0282-0. Epub 2020 Feb 4. PMCID: PMC7054408 PMID:32020029
|  |
|
Comment | Remdesivir and chloroquine are highly effective in the control of 2019-nCoV infection in vitro. Since these compounds have been used in human patients with a safety track record and shown to be effective against various ailments.
| |