| Chemical Information | |
| Antiviral agent ID | DrugRepV_5461 | |
| Antiviral agent name | Tizoxanide |  |
| IUPAC Name | 2-hydroxy-N-(5-nitro-1,3-thiazol-2-yl)benzamide |  |
| SMILES (canonical) | C1=CC=C(C(=C1)C(=O)NC2=NC=C(S2)[N+](=O)[O-])O | |
| Molecular Formula | C10H7N3O4S | |
| Molecular Weight (g/mol) | 265.243 | |
| InChl | InChI=1S/C10H7N3O4S/c14-7-4-2-1-3-6(7)9(15)12-10-11-5-8(18-10)13(16)17/h1-5,14H,(H,11,12,15) | |
| Common Name | Nitazoxanide | |
| Synonyms | Nitaxozanid | Nitaxozanide | Nitazoxanida | Nitazoxanidum | |
| Structural Information | |
 |
|
| Clinical Information | |
|
Category | Antiparasitic products, Insectisides and Repellents
| |
|
Primary Indication (Clinical trial phases) | Approved, Investigational, Vet approved
|  |
| Biological Information | |
|
Primary Indication (Disease Category) | Infectious Disease
| |
|
Primary Indication (Disease) | Crytosporidiosis and Giardiasis
| |
|
Secondary Indication | Influenza virus (IAV) A(H1N1) A/Malaysia/2/2014 |   |
|
Secondary Indication (Approaches) | Experimental | |
| Secondary Indication (Methods) | In-vitro | |
|
Secondary Indication (Model system) [cell lines/ animal models] | MDCK-SIAT
| |
|
Secondary Indication (Viral titer) | 1000 FFU/well
| |
|
Secondary Indication (Mode of drug delivery) | Culture
| |
|
Secondary Indication (Time of drug delivery) | Post treatment
| |
|
Secondary Indication (Duration of drug delivery) | 24 hours
| |
|
Secondary Indication (Drug concentration) | 1 μM
| |
|
Secondary Indication (Cell based assay) | Focus forming reduction assay
| |
|
Secondary Indication (Change) | Decrease
| |
|
Secondary Indication (Type of Inhibition) | EC50 [ 50 % ] | |
|
Reference | Tilmanis D, van Baalen C, Oh DY, Rossignol JF, Hurt AC..The susceptibility of circulating human influenza viruses to tizoxanide, the active metabolite of ni.Antiviral Res. 2017 Nov;147:142-148. doi: 10.1016/j.antiviral.2017.10.002. Epub 2017 Oct 3. PMID:28986103
|  |
|
Comment | Tizoxanide showed potent in vitro antiviral activity against all influenza viruses tested, including neuraminidase inhibitor-resistant viruses, allowing the establishment of a baseline level of susceptibility for each subtype.
| |