| Chemical Information | |
| Antiviral agent ID | DrugRepV_5421 | |
| Antiviral agent name | Losmapimod |  |
| IUPAC Name | 6-[5-(cyclopropylcarbamoyl)-3-fluoro-2-methylphenyl]-N-(2,2-dimethylpropyl)pyridine-3-carboxamide |  |
| SMILES (canonical) | CC1=C(C=C(C=C1F)C(=O)NC2CC2)C3=NC=C(C=C3)C(=O)NCC(C)(C)C | |
| Molecular Formula | C22H26FN3O2 | |
| Molecular Weight (g/mol) | 383.5 | |
| InChl | InChI=1S/C22H26FN3O2/c1-13-17(9-15(10-18(13)23)21(28)26-16-6-7-16)19-8-5-14(11-24-19)20(27)25-12-22(2,3)4/h5,8-11,16H,6-7,12H2,1-4H3,(H,25,27)(H,26,28) | |
| Structural Information | |
 |
|
| Clinical Information | |
|
Primary Indication (Clinical trial phases) | Investigational
|  |
| Biological Information | |
|
Primary Indication (Disease Category) | Infectious Disease
| |
|
Primary Indication (Disease) | Chronic Obstructive Pulmonary Disease
| |
|
Secondary Indication | Lassa virus (LASV) NA Josiah |   |
|
Secondary Indication (Approaches) | Experimental | |
| Secondary Indication (Methods) | In-vitro | |
|
Secondary Indication (Model system) [cell lines/ animal models] | Vero E6
| |
|
Secondary Indication (Viral titer) | 0.01 MOI
| |
|
Secondary Indication (Mode of drug delivery) | Culture
| |
|
Secondary Indication (Time of drug delivery) | Post infection
| |
|
Secondary Indication (Duration of drug delivery) | 72 hours
| |
|
Secondary Indication (Drug concentration) | 0.71 μM
| |
|
Secondary Indication (Cell based assay) | RT-qPCR
| |
|
Secondary Indication (Change) | Decrease
| |
|
Secondary Indication (Type of Inhibition) | EC50 [ 50 % ] | |
|
Reference | Zhang X, Yan F, Tang K, Chen Q, Guo J, Zhu W, He S, Banadyga L, Qiu X, Guo Y..Identification of a clinical compound losmapimod that blocks Lassa virus entry..Antiviral Res. 2019 Jul;167:68-77. doi: 10.1016/j.antiviral.2019.03.014. Epub 2019 Apr 4. PMID:30953674
|  |
|
Comment | Losmapimod inhibited LASV entry by affecting the stable signal peptide (SSP)-GP2 subunit interface of the LASV glycoprotein, thereby blocking pH-dependent viral fusion.
| |