| Chemical Information | |
| Antiviral agent ID | DrugRepV_5345 | |
| Antiviral agent name | 5-ethynyl-1-beta-D-ribofuranosylimidazole-4-carboxamide | |
| IUPAC Name | 1-[(2~{R},3~{R},4~{S},5~{R})-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-ethynylimidazole-4-carboxamide |  |
| SMILES (canonical) | C#CC1=C(N=CN1C2C(C(C(O2)CO)O)O)C(=O)N | |
| SMILES (isomeric) | C#CC1=C(N=CN1[C@H]2[C@@H]([C@@H]([C@H](O2)CO)O)O)C(=O)N | |
| Molecular Formula | C11H13N3O5 | |
| Molecular Weight (g/mol) | 267.241 | |
| InChl | InChI=1S/C11H13N3O5/c1-2-5-7(10(12)18)13-4-14(5)11-9(17)8(16)6(3-15)19-11/h1,4,6,8-9,11,15-17H,3H2,(H2,12,18)/t6-,8-,9-,11-/m1/s1 | |
| Structural Information | |
 |
|
| Clinical Information | |
| Biological Information | |
|
Secondary Indication | Lassa virus (LASV) NA AV |   |
|
Secondary Indication (Approaches) | Experimental | |
| Secondary Indication (Methods) | In-vitro | |
|
Secondary Indication (Model system) [cell lines/ animal models] | Vero
| |
|
Secondary Indication (Mode of viral infection) | Adsorption
| |
|
Secondary Indication (Viral titer) | 0.01 MOI
| |
|
Secondary Indication (Mode of drug delivery) | Culture
| |
|
Secondary Indication (Time of drug delivery) | Post infection
| |
|
Secondary Indication (Duration of drug delivery) | 48 hours
| |
|
Secondary Indication (Drug concentration) | 1 μg/mL
| |
|
Secondary Indication (Cell based assay) | RT-PCR
| |
|
Secondary Indication (Change) | Decrease
| |
|
Secondary Indication (Type of Inhibition) | IC50 [ 50 % ] | |
|
Reference | Olschlager S, Neyts J, Gunther S..Depletion of GTP pool is not the predominant mechanism by which ribavirin exerts its antiviral effec.Antiviral Res. 2011 Aug;91(2):89-93. doi: 10.1016/j.antiviral.2011.05.006.Epub 2011 May 17. PMID:21616094
|  |
|
Comment | Experiments with mycophenolic acid and 5-ethynyl-1-beta-D-ribofuranosylimidazole-4-carboxamide indicate that replication of Lassa and Ebola virus is sensitive to depletion of the GTP pool mediated via inhibition of IMPDH.
| |