| Chemical Information | |
| Antiviral agent ID | DrugRepV_5211 | |
| Antiviral agent name | Curcumin |  |
| IUPAC Name | (1~{E},6~{E})-1,7-bis(4-hydroxy-3-methoxyphenyl)hepta-1,6-diene-3,5-dione |  |
| SMILES (canonical) | COC1=C(C=CC(=C1)C=CC(=O)CC(=O)C=CC2=CC(=C(C=C2)O)OC)O | |
| SMILES (isomeric) | COC1=C(C=CC(=C1)/C=C/C(=O)CC(=O)/C=C/C2=CC(=C(C=C2)O)OC)O | |
| Molecular Formula | IC21H20O6 or C21H20O6 | |
| Molecular Weight (g/mol) | 368.385 | |
| InChl | InChI=1S/C21H20O6/c1-26-20-11-14(5-9-18(20)24)3-7-16(22)13-17(23)8-4-15-6-10-19(25)21(12-15)27-2/h3-12,24-25H,13H2,1-2H3/b7-3+,8-4+ | |
| Common Name | Curcumin | |
| Synonyms | Diferuloylmethane | Natural yellow 3 | Turmeric yellow | Curcuma | Turmeric | Indian saffron | Kacha haldi | Gelbwurz | |
| Structural Information | |
 |
|
| Clinical Information | |
|
Primary Indication (Clinical trial phases) | Approved
|  |
| Biological Information | |
|
Primary Indication (Disease Category) | Non Infectious Disease
| |
|
Primary Indication (Disease) | Depressive disorder
| |
|
Secondary Indication | Rift Valley fever virus (RVFV) NA MP12 |   |
|
Secondary Indication (Approaches) | Experimental | |
| Secondary Indication (Methods) | In-vitro | |
|
Secondary Indication (Model system) [cell lines/ animal models] | A549
| |
|
Secondary Indication (Mode of viral infection) | Adsorption
| |
|
Secondary Indication (Viral titer) | 0.1 MOI
| |
|
Secondary Indication (Mode of drug delivery) | Culture
| |
|
Secondary Indication (Time of drug delivery) | Pre infection (2 hours)
| |
|
Secondary Indication (Duration of drug delivery) | 24 hours
| |
|
Secondary Indication (Drug concentration) | 10 μM
| |
|
Secondary Indication (Cell based assay) | Plaque assay
| |
|
Secondary Indication (Change) | Decrease
| |
|
Secondary Indication (Type of Inhibition) | Viral titre [ 5 log pfu/ml ] | |
|
Reference | Narayanan A, Kehn-Hall K, Senina S, Lundberg L, Van Duyne R, Guendel I, Das R, Baer A, Bethel L, Tur.Curcumin inhibits Rift Valley fever virus replication in human cells..J Biol Chem. 2012 Sep 28;287(40):33198-214. Epub 2012 Jul 30. PubMed Central PMCID: PMC3460426. PMID:22847000
|  |
|
Comment | Curcumin binds to and inhibits kinase activity of the IKK-β2 complex in infected cells. Curcumin partially exerts its inhibitory influence on RVFV replication by interfering with IKK-β2-mediated phosphorylation of the viral protein NSs and by altering the cell cycle of treated cells.
| |