| Chemical Information | |
| Antiviral agent ID | DrugRepV_5168 | |
| Antiviral agent name | Rapamycin |  |
| IUPAC Name | (1~{R},9~{S},12~{S},15~{R},16~{E},18~{R},19~{R},21~{R},23~{S},24~{E},26~{E},28~{E},30~{S},32~{S},35~{R})-1,18-dihydroxy-12-[(2~{R})-1-[(1~{S},3~{R},4~{R})-4-hydroxy-3-methoxycyclohexyl]propan-2-yl]-19,30-dimethoxy-15,17,21,23,29,35-hexamethyl-11,36-dioxa-4-azatricyclo[30.3.1.0^{4,9}]hexatriaconta-16,24,26,28-tetraene-2,3,10,14,20-pentone |  |
| SMILES (canonical) | CC1CCC2CC(C(=CC=CC=CC(CC(C(=O)C(C(C(=CC(C(=O)CC(OC(=O)C3CCCCN3C(=O)C(=O)C1(O2)O)C(C)CC4CCC(C(C4)OC)O)C)C)O)OC)C)C)C)OC | |
| SMILES (isomeric) | C[C@@H]1CC[C@H]2C[C@@H](/C(=C/C=C/C=C/[C@H](C[C@H](C(=O)[C@@H]([C@@H](/C(=C/[C@H](C(=O)C[C@H](OC(=O)[C@@H]3CCCCN3C(=O)C(=O)[C@@]1(O2)O)[C@H](C)C[C@@H]4CC[C@H]([C@@H](C4)OC)O)C)/C)O)OC)C)C)/C)OC | |
| Molecular Formula | C51H79NO13 | |
| Molecular Weight (g/mol) | 914.187 | |
| InChl | InChI=1S/C51H79NO13/c1-30-16-12-11-13-17-31(2)42(61-8)28-38-21-19-36(7)51(60,65-38)48(57)49(58)52-23-15-14-18-39(52)50(59)64-43(33(4)26-37-20-22-40(53)44(27-37)62-9)29-41(54)32(3)25-35(6)46(56)47(63-10)45(55)34(5)24-30/h11-13,16-17,25,30,32-34,36-40,42-44,46-47,53,56,60H,14-15,18-24,26-29H2,1-10H3/b13-11+,16-12+,31-17+,35-25+/t30-,32-,33-,34-,36-,37+,38+,39+,40-,42+,43+,44-,46-,47+,51-/m1/s1 | |
| Common Name | Sirolimus | |
| Synonyms | (-)-Rapamycin | Rapamycin | sirolimús | sirolimus | sirolimusum | |
| Structural Information | |
 |
|
| Clinical Information | |
|
Category | Antineoplastic and Immunomodulating Agents; Sensory Organ
| |
|
Primary Indication (Clinical trial phases) | Approved, Investigational
|  |
| Biological Information | |
|
Primary Indication (Disease Category) | Non Infectious Disease
| |
|
Primary Indication (Disease) | Prophylaxis of organ rejection in patients receiving renal transplants
| |
|
Secondary Indication | Rift Valley fever virus (RVFV) NA ZH501 |   |
|
Secondary Indication (Approaches) | Experimental | |
| Secondary Indication (Methods) | In-vitro | |
|
Secondary Indication (Model system) [cell lines/ animal models] | H2.35
| |
|
Secondary Indication (Mode of viral infection) | Adsorption
| |
|
Secondary Indication (Viral titer) | 5 MOI
| |
|
Secondary Indication (Mode of drug delivery) | Culture
| |
|
Secondary Indication (Time of drug delivery) | Pre infection (1 hour)
| |
|
Secondary Indication (Duration of drug delivery) | 18 hours
| |
|
Secondary Indication (Drug concentration) | 10 μM
| |
|
Secondary Indication (Cell based assay) | Plaque assay
| |
|
Secondary Indication (Change) | Decrease
| |
|
Secondary Indication (Type of Inhibition) | Viral titre [ 1 log pfu/ml ] | |
|
Reference | Bell TM, Espina V, Senina S, Woodson C, Brahms A, Carey B, Lin SC, Lundberg L, Pinkham C, Baer A, Mu.Rapamycin modulation of p70 S6 kinase signaling inhibits Rift Valley fever virus pathogenesis..Antiviral Res. 2017 Jul;143:162-175. doi: 10.1016/j.antiviral.2017.04.011. Epub 2017 Apr 23. PubMed PMID:28442428
|  |
|
Comment | The phosphorylation of p70 S6 kinase was decreased following rapamycin treatment in vivo.
| |