| Chemical Information | |
| Antiviral agent ID | DrugRepV_5124 | |
| Antiviral agent name | Gleevec | |
| IUPAC Name | methanesulfonic acid;4-[(4-methylpiperazin-1-yl)methyl]-~{N}-[4-methyl-3-[(4-pyridin-3-ylpyrimidin-2-yl)amino]phenyl]benzamide |  |
| SMILES (canonical) | CC1=C(C=C(C=C1)NC(=O)C2=CC=C(C=C2)CN3CCN(CC3)C)NC4=NC=CC(=N4)C5=CN=CC=C5.CS(=O)(=O)O | |
| Molecular Formula | C30H35N7O4S | |
| Molecular Weight (g/mol) | 589.715 | |
| InChl | InChI=1S/C29H31N7O.CH4O3S/c1-21-5-10-25(18-27(21)34-29-31-13-11-26(33-29)24-4-3-12-30-19-24)32-28(37)23-8-6-22(7-9-23)20-36-16-14-35(2)15-17-36;1-5(2,3)4/h3-13,18-19H,14-17,20H2,1-2H3,(H,32,37)(H,31,33,34);1H3,(H,2,3,4) | |
| Common Name | Imatinib |  |
| Synonyms | 4-(4-METHYL-piperazin-1-ylmethyl)-N-[4-methyl-3-(4-pyridin-3-yl-pyrimidin-2-ylamino)-phenyl]-benzamide | alpha-(4-Methyl-1-piperazinyl)-3'-((4-(3-pyridyl)-2-pyrimidinyl)amino)-P-toluidide | Imatinib | Imatinib Methansulfonate | Imatinibum | STI 571 | |
| Structural Information | |
 |
|
| Clinical Information | |
|
Category | Antineoplastic and Immunomodulating Agents
| |
|
Primary Indication (Clinical trial phases) | Approved
|  |
| Biological Information | |
|
Primary Indication (Disease Category) | Non Infectious Disease
| |
|
Primary Indication (Disease) | Leukemia
| |
|
Secondary Indication | Crimean-Congo hemorrhagic fever virus (CCHFV) NA CCHFV/ZsG |   |
|
Secondary Indication (Approaches) | Experimental | |
| Secondary Indication (Methods) | In-vitro | |
|
Secondary Indication (Model system) [cell lines/ animal models] | Huh-7
| |
|
Secondary Indication (Mode of viral infection) | Adsorption
| |
|
Secondary Indication (Viral titer) | 0.1 MOI
| |
|
Secondary Indication (Mode of drug delivery) | Culture
| |
|
Secondary Indication (Time of drug delivery) | Post infection (1 hour)
| |
|
Secondary Indication (Duration of drug delivery) | 72 hours
| |
|
Secondary Indication (Drug concentration) | 5 μM
| |
|
Secondary Indication (Cell based assay) | Fluorescence-based assay
| |
|
Secondary Indication (Change) | No significant effect
| |
|
Secondary Indication (Type of Inhibition) | Percentage inhibition [ 26 % ] | |
|
Reference | Welch SR, Scholte FEM, Flint M, Chatterjee P, Nichol ST, Bergeron E, Spiropoulou CF..Identification of 2'-deoxy-2'-fluorocytidine as a potent inhibitor of Crimean-Congo hemorrhagic feve.Antiviral Res. 2017 Nov;147:91-99. doi: 10.1016/j.antiviral.2017.10.008. Epub 2017 Oct 9. PMID:29024765
|  |
|
Comment | The potent antiviral effects of 2'-dFC on CCHFV replication were identified and demonstrated its potential for a combination therapy with T-705.
| |