Chemical Information | |
Antiviral agent ID | DrugRepV_5089 | |
Antiviral agent name | S-Nitroso-N-acetylpenicillamine | |
IUPAC Name | (2~{R})-2-acetamido-3-methyl-3-nitrososulfanylbutanoic acid | |
SMILES (canonical) | CC(=O)NC(C(=O)O)C(C)(C)SN=O | |
SMILES (isomeric) | CC(=O)N[C@H](C(=O)O)C(C)(C)SN=O | |
Molecular Formula | C7H12N2O4S | |
Molecular Weight (g/mol) | 220.243 | |
InChl | InChI=1S/C7H12N2O4S/c1-4(10)8-5(6(11)12)7(2,3)14-9-13/h5H,1-3H3,(H,8,10)(H,11,12)/t5-/m1/s1 | |
Synonyms | N-Acetyl-3-(nitrosothio)-valine | N-acetyl-3-(nitrosothio)-D-Valine | s-nitroso-l-acetyl penicillamine | |
Structural Information | |
|
|
Clinical Information | |
Biological Information | |
Secondary Indication | Crimean-Congo hemorrhagic fever virus (CCHFV) NA IbAr 10200 | |
Secondary Indication (Approaches) | Experimental | |
Secondary Indication (Methods) | In-vitro | |
Secondary Indication (Model system) [cell lines/ animal models] | VeroE6
| |
Secondary Indication (Mode of viral infection) | Adsorption
| |
Secondary Indication (Viral titer) | 0.03 MOI
| |
Secondary Indication (Mode of drug delivery) | Culture
| |
Secondary Indication (Time of drug delivery) | Pre infection (3 or 6 hours)
| |
Secondary Indication (Duration of drug delivery) | 24 hours
| |
Secondary Indication (Drug concentration) | 400 μM
| |
Secondary Indication (Cell based assay) | Immunoflourescence assay
| |
Secondary Indication (Change) | Decrease
| |
Secondary Indication (Type of Inhibition) | Percentage inhibition [ >90 % ] | |
Reference | Simon M, Falk KI, Lundkvist A, Mirazimi A..Exogenous nitric oxide inhibits Crimean Congo hemorrhagic fever virus..Virus Res. 2006 Sep;120(1-2):184-90. Epub 2006 May 2. PMID:16632039
| |
Comment | The expression of viral proteins; the nucleocapsid protein and the glycoprotein, were reduced with increasing concentrations of SNAP.
| |