| Chemical Information | |
| Antiviral agent ID | DrugRepV_5088 | |
| Antiviral agent name | Chlorpromazine |  |
| IUPAC Name | 3-(2-chlorophenothiazin-10-yl)-N,N-dimethylpropan-1-amine |  |
| SMILES (canonical) | CN(C)CCCN1C2=CC=CC=C2SC3=C1C=C(C=C3)Cl | |
| Molecular Formula | C17H19ClN2S | |
| Molecular Weight (g/mol) | 318.863 | |
| InChl | InChI=1S/C17H19ClN2S/c1-19(2)10-5-11-20-14-6-3-4-7-16(14)21-17-9-8-13(18)12-15(17)20/h3-4,6-9,12H,5,10-11H2,1-2H3 | |
| Common Name | Chlorpromazine | |
| Synonyms | 3-(2-chloro-10H-phenothiazin-10-yl)-N,N-dimethyl-1-propanamine | 3-(2-chlorophenothiazin-10-yl)-N,N-dimethyl-propan-1-amine | Chlorpromazinum | Clorpromazina | CPZ | N-(3-dimethylaminopropyl)-3-chlorophenothiazine | |
| Structural Information | |
 |
|
| Clinical Information | |
|
Category | Antiinflammatory and antineoplastic
| |
|
Primary Indication (Clinical trial phases) | Approved
|  |
| Biological Information | |
|
Primary Indication (Disease Category) | Non Infectious Disease
| |
|
Primary Indication (Disease) | Schizophrenia
| |
|
Secondary Indication | Crimean-Congo hemorrhagic fever virus (CCHFV) NA 87-07 |   |
|
Secondary Indication (Approaches) | Experimental | |
| Secondary Indication (Methods) | In-vitro | |
|
Secondary Indication (Model system) [cell lines/ animal models] | Huh7
| |
|
Secondary Indication (Mode of viral infection) | Adsorption
| |
|
Secondary Indication (Viral titer) | 0.025 MOI
| |
|
Secondary Indication (Mode of drug delivery) | Culture
| |
|
Secondary Indication (Duration of drug delivery) | 3 days
| |
|
Secondary Indication (Drug concentration) | 4.3 μM
| |
|
Secondary Indication (Cell based assay) | Plaque assay
| |
|
Secondary Indication (Change) | Decrease
| |
|
Secondary Indication (Type of Inhibition) | IC50 [ 50 % ] | |
|
Secondary Indication (Cytotoxicity) | 30 μM | |
|
Reference | Ferraris O, Moroso M, Pernet O, Emonet S, Ferrier Rembert A, Paranhos-Baccala G, Peyrefitte CN..Evaluation of Crimean-Congo hemorrhagic fever virus in vitro inhibition by chloroquine and chlorprom.Antiviral Res. 2015 Jun;118:75-81. doi: 10.1016/j.antiviral.2015.03.005. Epub 2015 Mar 20. PMID:25796972
|  |
|
Comment | Ribavirin and chloroquine or chlorpromazine combination assays demonstrate synergistic effects in all tested conditions. It was expected because ribavirin, chloroquine and chlorpromazine had different antiviral mechanisms. Thus, these experiments suggest that these combinatorial treatment could represent a strategy to control CCHFV infection.
| |