| Chemical Information | |
| Antiviral agent ID | DrugRepV_5081 | |
| Antiviral agent name | Ribavirin |  |
| IUPAC Name | 1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1,2,4-triazole-3-carboxamide |  |
| SMILES (canonical) | C1=NC(=NN1C2C(C(C(O2)CO)O)O)C(=O)N | |
| SMILES (isomeric) | C1=NC(=NN1[C@H]2[C@@H]([C@@H]([C@H](O2)CO)O)O)C(=O)N | |
| Molecular Formula | C8H12N4O5 | |
| Molecular Weight (g/mol) | 244.207 | |
| InChl | InChI=1S/C8H12N4O5/c9-6(16)7-10-2-12(11-7)8-5(15)4(14)3(1-13)17-8/h2-5,8,13-15H,1H2,(H2,9,16)/t3-,4-,5-,8-/m1/s1 | |
| Common Name | Ribavirin | |
| Synonyms | 1-beta-D-Ribofuranosyl-1,2,4-triazole-3-carboxamide | 1-beta-D-Ribofuranosyl-1H-1,2,4-triazole-3-carboxamide | RBV | Ribavirin | Ribavirina | Ribavirine | Ribavirinum | Tribavirin | |
| Structural Information | |
 |
|
| Clinical Information | |
|
Category | Antiinfectives For Systemic Use
| |
|
Primary Indication (Clinical trial phases) | Approved
|  |
| Biological Information | |
|
Primary Indication (Disease Category) | Infectious Disease
| |
|
Primary Indication (Disease) | Hepatitis C virus
| |
|
Primary Indication (Drug target/Mode of Action) | Potential E3 ubiquitin-protein ligase ariadne-2
| |
|
Secondary Indication | Crimean-Congo hemorrhagic fever virus (CCHFV) NA Hoti |   |
|
Secondary Indication (Approaches) | Experimental | |
| Secondary Indication (Methods) | In-vivo | |
|
Secondary Indication (Model system) [cell lines/ animal models] | IFNAR-/-
| |
|
Secondary Indication (Mode of viral infection) | Intraperitoneal
| |
|
Secondary Indication (Viral titer) | 5 TCID50
| |
|
Secondary Indication (Mode of drug delivery) | Intraperitoneal
| |
|
Secondary Indication (Time of drug delivery) | Post infection (6 hours)
| |
|
Secondary Indication (Duration of drug delivery) | 3 days
| |
|
Secondary Indication (Drug concentration) | 100 mg/kg/day
| |
|
Secondary Indication (Cell based assay) | Real-time PCR
| |
|
Secondary Indication (Change) | Decrease
| |
|
Secondary Indication (Type of Inhibition) | Viral titre [ >2 Log10 RNA copies/ ?g tissue ] | |
|
Reference | Hawman DW, Haddock E, Meade-White K, Williamson B, Hanley PW, Rosenke K, Komeno T, Furuta Y, Gowen B.Favipiravir (T-705) but not ribavirin is effective against two distinct strains of Crimean-Congo hem.Antiviral Res. 2018 Sep;157:18-26. doi: 10.1016/j.antiviral.2018.06.013. Epub 2018 Jun 21. PMID:29936152
|  |
|
Comment | Favipiravir showed significant clinical benefit against two distinct strains of CCHFV suggesting it may be a potent antiviral for treatment of human CCHFV infections.
| |