| Chemical Information | |
| Antiviral agent ID | DrugRepV_4617 | |
| Antiviral agent name | Promazine |  |
| IUPAC Name | N,N-dimethyl-3-phenothiazin-10-ylpropan-1-amine |  |
| SMILES (canonical) | CN(C)CCCN1C2=CC=CC=C2SC3=CC=CC=C31 | |
| Molecular Formula | C17H20N2S | |
| Molecular Weight (g/mol) | 284.421 | |
| InChl | InChI=1S/C17H20N2S/c1-18(2)12-7-13-19-14-8-3-5-10-16(14)20-17-11-6-4-9-15(17)19/h3-6,8-11H,7,12-13H2,1-2H3 | |
| Common Name | Promazine | |
| Synonyms | 10-(3-(Dimethylamino)propyl)phenothiazine | Frenil | N-(3-Dimethylaminopropyl)phenothiazine | N-Dimethylamino-1-methylethyl thiodiphenylamine | N,N-dimethyl-3-(10H-phenothiazin-10-yl)-propan-1-amine | Promazin | Promazina | Promazine | Promazinum | |
| Structural Information | |
 |
|
| Clinical Information | |
|
Category | Nervous System
| |
|
Primary Indication (Clinical trial phases) | Approved, Vet approved
| |
| Biological Information | |
|
Primary Indication (Disease Category) | Non Infectious Disease
| |
|
Primary Indication (Disease) | Psychomotor agitation
| |
|
Primary Indication (Drug target/Mode of Action) | Nuclear mitotic apparatus protein 1
| |
|
Secondary Indication | Severe acute respiratory syndrome coronavirus (SARS-CoV) NA Urbani |   |
|
Secondary Indication (Approaches) | Experimental | |
| Secondary Indication (Methods) | In-vitro | |
|
Secondary Indication (Model system) [cell lines/ animal models] | Vero76
| |
|
Secondary Indication (Mode of viral infection) | Adsorption
| |
|
Secondary Indication (Viral titer) | <0.007 CCID50 per cell
| |
|
Secondary Indication (Mode of drug delivery) | Culture
| |
|
Secondary Indication (Time of drug delivery) | During infection
| |
|
Secondary Indication (Duration of drug delivery) | 3 days
| |
|
Secondary Indication (Drug concentration) | 7.9 ± 3.4 μg/ml
| |
|
Secondary Indication (Cell based assay) | Cytopathic effect (CPE) assay
| |
|
Secondary Indication (Change) | Decrease
| |
|
Secondary Indication (Type of Inhibition) | IC50 [ 50 % ] | |
|
Reference | Day CW, Baric R, Cai SX, Frieman M, Kumaki Y, Morrey JD, Smee DF, Barnard DL..A new mouse-adapted strain of SARS-CoV as a lethal model for evaluating antiviral agents in vitro and in vivo..Virology. 2009 Dec 20;395(2):210-22. doi: 10.1016/j.virol.2009.09.023. Epub 2009 Oct 22. PubMed Cent PMID:19853271
|  |
|
Comment | In v2163-infected mice, AmpligenTM was fully protective, stinging nettle lectin (UDA) was partially protective, ribavirin was disputable and possibly exacerbated disease, and EP128533 was inactive. Ribavirin, UDA, and AmpligenTM decreased IL-6 expression.
| |