| Chemical Information | |
| Antiviral agent ID | DrugRepV_4266 | |
| Antiviral agent name | 1-[(E)-[(4-ethoxyphenyl)methylidene]amino]-3-(2-phenylethyl)thiourea | |
| IUPAC Name | 1-[(E)-[(4-ethoxyphenyl)methylidene]amino]-3-(2-phenylethyl)thiourea |  |
| SMILES (canonical) | [H]\C(=N/NC(=S)NCCC1=CC=CC=C1)C1=CC=C(OCC)C=C1 | |
| Molecular Formula | C18H21N3OS | |
| Molecular Weight (g/mol) | 327.45 | |
| InChl | InChI=1S/C18H21N3OS/c1-2-22-17-10-8-16(9-11-17)14-20-21-18(23)19-13-12-15-6-4-3-5-7-15/h3-11,14H,2,12-13H2,1H3,(H2,19,21,23)/b20-14+ | |
| Structural Information | |
 |
|
| Clinical Information | |
| Biological Information | |
|
Secondary Indication | Chikungunya virus (CHIKV) NA 899 |   |
|
Secondary Indication (Approaches) | Experimental | |
| Secondary Indication (Methods) | In-vitro | |
|
Secondary Indication (Model system) [cell lines/ animal models] | Vero
| |
|
Secondary Indication (Mode of viral infection) | Adsorption
| |
|
Secondary Indication (Viral titer) | 0.01 MOI
| |
|
Secondary Indication (Mode of drug delivery) | Culture
| |
|
Secondary Indication (Time of drug delivery) | Post infection
| |
|
Secondary Indication (Duration of drug delivery) | 5 days
| |
|
Secondary Indication (Drug concentration) | 5.9 ± 1.1 μM
| |
|
Secondary Indication (Cell based assay) | CPE reduction assay
| |
|
Secondary Indication (Change) | Decrease
| |
|
Secondary Indication (Type of Inhibition) | IC50 [ 50 % ] | |
|
Secondary Indication (Cytotoxicity) | 109 ± 29.5 μM | |
|
Reference | Giancotti G, Cancellieri M, Balboni A, Giustiniano M, Novellino E, Delang L, Neyts J, Leyssen P, Brancale A, Bassetto M..Rational modifications on a benzylidene-acrylohydrazide antiviral scaffold, synthesis and evaluation of bioactivity against Chikungunya virus..Eur J Med Chem. 2018 Apr 10;149:56-68. doi: 10.1016/j.ejmech.2018.02.054. Epub 2018 Feb 23. PMID:29499487
|  |
|
Comment | NA
| |