| Chemical Information | |
| Antiviral agent ID | DrugRepV_4177 | |
| Antiviral agent name | N-[(E)-(4-ethoxyphenyl)methylidene]-3-phenylpropanehydrazide | |
| IUPAC Name | N'-[(E)-(4-ethoxyphenyl)methylidene]-3-phenylpropanehydrazide |  |
| SMILES (canonical) | [H]\C(=N/NC(=O)CCC1=CC=C([H])C=C1)C1=CC=C(OCC)C=C1 | |
| Molecular Formula | C18H20N2O2 | |
| Molecular Weight (g/mol) | 296.37 | |
| InChl | InChI=1S/C18H20N2O2/c1-2-22-17-11-8-16(9-12-17)14-19-20-18(21)13-10-15-6-4-3-5-7-15/h3-9,11-12,14H,2,10,13H2,1H3,(H,20,21)/b19-14+ | |
| Structural Information | |
 |
|
| Clinical Information | |
| Biological Information | |
|
Secondary Indication | Chikungunya virus (CHIKV) NA 889 |   |
|
Secondary Indication (Approaches) | Experimental | |
| Secondary Indication (Methods) | In-vitro | |
|
Secondary Indication (Model system) [cell lines/ animal models] | Vero
| |
|
Secondary Indication (Viral titer) | 0.01 MOI
| |
|
Secondary Indication (Mode of drug delivery) | Culture
| |
|
Secondary Indication (Time of drug delivery) | Post infection
| |
|
Secondary Indication (Duration of drug delivery) | 5 days
| |
|
Secondary Indication (Drug concentration) | >294 μM
| |
|
Secondary Indication (Cell based assay) | CPE reduction assay
| |
|
Secondary Indication (Change) | Decrease
| |
|
Secondary Indication (Type of Inhibition) | EC50 [ 50 % ] | |
|
Secondary Indication (Cytotoxicity) | NA μM | |
|
Reference | Tardugno R, Giancotti G, De Burghgraeve T, Delang L, Neyts J, Leyssen P, Brancale A, Bassetto M..Design, synthesis and evaluation against Chikungunya virus of novel small-molecule antiviral agents..Bioorg Med Chem. 2018 Feb 15;26(4):869-874. doi: 10.1016/j.bmc.2018.01.002. Epub 2018 Jan 6. PMID:29336951
|  |
|
Comment | Structure-activity relationships were elucidated for the original scaffolds, and different novel antiviral compounds with EC50 values in the low micromolar range were identified.
| |