Chemical Information | |
Antiviral agent ID | DrugRepV_4093 | |
Antiviral agent name | Chloroquine | |
IUPAC Name | 4-N-(7-chloroquinolin-4-yl)-1-N,1-N-diethylpentane-1,4-diamine | |
SMILES (canonical) | CCN(CC)CCCC(C)NC1=C2C=CC(=CC2=NC=C1)Cl | |
Molecular Formula | C18H26ClN3 | |
Molecular Weight (g/mol) | 319.877 | |
InChl | InChI=1S/C18H26ClN3/c1-4-22(5-2)12-6-7-14(3)21-17-10-11-20-18-13-15(19)8-9-16(17)18/h8-11,13-14H,4-7,12H2,1-3H3,(H,20,21) | |
Common Name | Chloroquine | |
Synonyms | Chloraquine | Chlorochin | Chloroquina | Chloroquine | Chloroquinium | Chloroquinum | Cloroquina | N4-(7-chloro-4-quinolinyl)-N1,N1-diethyl-1,4-pentanediamine | |
Structural Information | |
|
|
Clinical Information | |
Category | Antiparasitic products, Insectisides and Repellents
| |
Primary Indication (Clinical trial phases) | Approved
| |
Biological Information | |
Primary Indication (Disease Category) | Infectious Disease
| |
Primary Indication (Disease) | Malaria
| |
Primary Indication (Drug target/Mode of Action) | Glypican 3 isoform 2
| |
Secondary Indication | Ebola virus (EBOV) NA Bundibugyo | |
Secondary Indication (Approaches) | Experimental | |
Secondary Indication (Methods) | In-vitro | |
Secondary Indication (Model system) [cell lines/ animal models] | 293T/17
| |
Secondary Indication (Mode of viral infection) | Transfection
| |
Secondary Indication (Mode of drug delivery) | Culture
| |
Secondary Indication (Time of drug delivery) | Post infection
| |
Secondary Indication (Duration of drug delivery) | 24 hours
| |
Secondary Indication (Drug concentration) | 3.589 μM
| |
Secondary Indication (Cell based assay) | Inhibition assay
| |
Secondary Indication (Change) | Decrease
| |
Secondary Indication (Type of Inhibition) | IC50 [ 50 % ] | |
Reference | Long J, Wright E, Molesti E, Temperton N, Barclay W..Antiviral therapies against Ebola and other emerging viral diseases using existing medicines that block virus entry..Version 2. F1000Res. 2015 Jan 29 [revised 2015 Jan 1];4:30. doi: 10.12688/f1000research.6085.2. eCol PMID:26069727
| |
Comment | In contacts of EBOV cases, chloroquine (CQ) decrease the viral load that establishes in the early days after virus transmission.
| |