| Chemical Information | |
| Antiviral agent ID | DrugRepV_3939 | |
| Antiviral agent name | Angelicin | |
| IUPAC Name | furo[2,3-h]chromen-2-one |  |
| SMILES (canonical) | C1=CC2=C(C=CO2)C3=C1C=CC(=O)O3 | |
| Molecular Formula | C11H6O3 | |
| Molecular Weight (g/mol) | 186.166 | |
| InChl | InChI=1S/C11H6O3/c12-10-4-2-7-1-3-9-8(5-6-13-9)11(7)14-10/h1-6H | |
| Structural Information | |
 |
|
| Clinical Information | |
| Biological Information | |
|
Primary Indication (Drug target/Mode of Action) | CUGBP Elav-like family member 1
| |
|
Secondary Indication | Ebola virus (EBOV) NA NA |   |
|
Secondary Indication (Approaches) | Experimental | |
| Secondary Indication (Methods) | In-vitro | |
|
Secondary Indication (Model system) [cell lines/ animal models] | VeroE6
| |
|
Secondary Indication (Mode of viral infection) | Transfection
| |
|
Secondary Indication (Viral titer) | 2 MOI
| |
|
Secondary Indication (Mode of drug delivery) | Culture
| |
|
Secondary Indication (Time of drug delivery) | Post infection
| |
|
Secondary Indication (Duration of drug delivery) | 48 hours
| |
|
Secondary Indication (Drug concentration) | 200 nM
| |
|
Secondary Indication (Cell based assay) | Plaque assay
| |
|
Secondary Indication (Change) | Decrease
| |
|
Secondary Indication (Type of Inhibition) | IC50 [ 50 % ] | |
|
Secondary Indication (Cytotoxicity) | 50 μM | |
|
Reference | Luthra P, Liang J, Pietzsch CA, Khadka S, Edwards MR, Wei S, De S, Posner B, Bukreyev A, Ready JM, Basler CF..A high throughput screen identifies benzoquinoline compounds as inhibitors of Ebola virus replication..Antiviral Res. 2018 Feb;150:193-201. doi: 10.1016/j.antiviral.2017.12.019. Epub 2017 Dec 30. PMID:29294299
|  |
|
Comment | A library of small molecule compounds was screened and identify 56 hits that inhibited EBOV MG activity by more than 70% while exhibiting less than 20% cell cytotoxicity.
| |