| Chemical Information | |
| Antiviral agent ID | DrugRepV_3875 | |
| Antiviral agent name | Ribavirin |  |
| IUPAC Name | 1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1,2,4-triazole-3-carboxamide |  |
| SMILES (canonical) | C1=NC(=NN1C2C(C(C(O2)CO)O)O)C(=O)N | |
| SMILES (isomeric) | C1=NC(=NN1[C@H]2[C@@H]([C@@H]([C@H](O2)CO)O)O)C(=O)N | |
| Molecular Formula | C8H12N4O5 | |
| Molecular Weight (g/mol) | 244.207 | |
| InChl | InChI=1S/C8H12N4O5/c9-6(16)7-10-2-12(11-7)8-5(15)4(14)3(1-13)17-8/h2-5,8,13-15H,1H2,(H2,9,16)/t3-,4-,5-,8-/m1/s1 | |
| Common Name | Ribavirin | |
| Synonyms | 1-beta-D-Ribofuranosyl-1,2,4-triazole-3-carboxamide | 1-beta-D-Ribofuranosyl-1H-1,2,4-triazole-3-carboxamide | RBV | Ribavirin | Ribavirina | Ribavirine | Ribavirinum | Tribavirin | |
| Structural Information | |
 |
|
| Clinical Information | |
|
Category | Antiinfectives For Systemic Use
| |
|
Primary Indication (Clinical trial phases) | Approved
|  |
| Biological Information | |
|
Primary Indication (Disease Category) | Infectious Disease
| |
|
Primary Indication (Disease) | Hepatitis C virus
| |
|
Primary Indication (Drug target/Mode of Action) | Potential E3 ubiquitin-protein ligase ariadne-2
| |
|
Secondary Indication | Zika virus (ZIKV) NA Puerto Rican PRVABC-59 |   |
|
Secondary Indication (Approaches) | Experimental | |
| Secondary Indication (Methods) | In-vitro | |
|
Secondary Indication (Model system) [cell lines/ animal models] | Vero76
| |
|
Secondary Indication (Viral titer) | 107.5 CCID50/mL
| |
|
Secondary Indication (Mode of drug delivery) | Culture
| |
|
Secondary Indication (Drug concentration) | 23.0 ± 16.8 μg/ml
| |
|
Secondary Indication (Cell based assay) | Cytopathic effect (CPE) assay
| |
|
Secondary Indication (Change) | Decrease
| |
|
Secondary Indication (Type of Inhibition) | EC50 [ 50 % ] | |
|
Reference | Julander JG, Siddharthan V, Evans J, Taylor R, Tolbert K, Apuli C, Stewart J, Collins P, Gebre M, Neilson S, Van Wettere A, Lee YM, Sheridan WP, Morrey JD, Babu YS..Efficacy of the broad-spectrum antiviral compound BCX4430 against Zika virus in cell culture and in a mouse model..Antiviral Res. 2017 Jan;137:14-22. doi: 10.1016/j.antiviral.2016.11.003. Epub 2016 Nov 10. PubMed Ce PMID:27838352
|  |
|
Comment | The small molecule drug candidate BCX4430 is an adenosine nucleoside analog that functions as a selective inhibitor of viral RNA-dependent RNA polymerase.
| |