| Chemical Information | |
| Antiviral agent ID | DrugRepV_3851 | |
| Antiviral agent name | MLS000091920 | |
| IUPAC Name | N-[3-(4-ethylpiperazin-1-yl)propyl]-7-methoxyfuro[2,3-b]quinoline-2-carboxamide |  |
| SMILES (canonical) | CCN1CCN(CC1)CCCNC(=O)C2=CC3=C(O2)N=C4C=C(C=CC4=C3)OC | |
| Molecular Formula | C22H28N4O3 | |
| Molecular Weight (g/mol) | 396.491 | |
| InChl | InChI=1S/C22H28N4O3/c1-3-25-9-11-26(12-10-25)8-4-7-23-21(27)20-14-17-13-16-5-6-18(28-2)15-19(16)24-22(17)29-20/h5-6,13-15H,3-4,7-12H2,1-2H3,(H,23,27) | |
| Synonyms | MLS000091920 | SR-01000126619 | BDBM42318 | |
| Structural Information | |
 |
|
| Clinical Information | |
| Biological Information | |
|
Secondary Indication | Marburg virus (MARV) NA Musoke |   |
|
Secondary Indication (Approaches) | Experimental | |
| Secondary Indication (Methods) | In-vitro | |
|
Secondary Indication (Model system) [cell lines/ animal models] | HeLa
| |
|
Secondary Indication (Viral titer) | 0.075 to 0.15 MOI
| |
|
Secondary Indication (Mode of drug delivery) | Culture
| |
|
Secondary Indication (Duration of drug delivery) | 24 hours
| |
|
Secondary Indication (Drug concentration) | 5.397 μM
| |
|
Secondary Indication (Change) | Decrease
| |
|
Secondary Indication (Type of Inhibition) | IC50 [ 50 % ] | |
|
Reference | Anantpadma M, Kouznetsova J, Wang H, Huang R, Kolokoltsov A, Guha R, Lindstrom AR, Shtanko O, Simeonov A, Maloney DJ, Maury W, LaCount DJ, Jadhav A, Davey RA..Large-Scale Screening and Identification of Novel Ebola Virus and Marburg Virus Entry Inhibitors..Antimicrob Agents Chemother. 2016 Jul 22;60(8):4471-81. doi: 10.1128/AAC.00543-16. Print 2016 Aug. P PMID:27161622
|  |
|
Comment | Each compound blocked infection of primary human macrophages, indicating their potential to be developed as new antifiloviral therapies.
| |