Chemical Information | |
Antiviral agent ID | DrugRepV_3808 | |
Antiviral agent name | MLS000567464 | |
IUPAC Name | N-(3-benzoyl-5-methylthiophen-2-yl)-2-chloroacetamide | |
SMILES (canonical) | CC1=CC(=C(S1)NC(=O)CCl)C(=O)C2=CC=CC=C2 | |
Molecular Formula | C14H12ClNO2S | |
Molecular Weight (g/mol) | 293.765 | |
InChl | InChI=1S/C14H12ClNO2S/c1-9-7-11(14(19-9)16-12(17)8-15)13(18)10-5-3-2-4-6-10/h2-7H,8H2,1H3,(H,16,17) | |
Synonyms | N-(3-Benzoyl-5-methyl-thiophen-2-yl)-2-chloro-acetamide | AC1LHAFL | HMS2582P24 | |
Structural Information | |
|
|
Clinical Information | |
Biological Information | |
Secondary Indication | Ebola virus (EBOV) NA Mayinga | |
Secondary Indication (Approaches) | Experimental | |
Secondary Indication (Methods) | In-vitro | |
Secondary Indication (Model system) [cell lines/ animal models] | HeLa
| |
Secondary Indication (Viral titer) | 0.075 to 0.15 MOI
| |
Secondary Indication (Mode of drug delivery) | Culture
| |
Secondary Indication (Duration of drug delivery) | 24 hours
| |
Secondary Indication (Drug concentration) | 25.21 μM
| |
Secondary Indication (Change) | Decrease
| |
Secondary Indication (Type of Inhibition) | IC50 [ 50 % ] | |
Reference | Anantpadma M, Kouznetsova J, Wang H, Huang R, Kolokoltsov A, Guha R, Lindstrom AR, Shtanko O, Simeonov A, Maloney DJ, Maury W, LaCount DJ, Jadhav A, Davey RA..Large-Scale Screening and Identification of Novel Ebola Virus and Marburg Virus Entry Inhibitors..Antimicrob Agents Chemother. 2016 Jul 22;60(8):4471-81. doi: 10.1128/AAC.00543-16. Print 2016 Aug. P PMID:27161622
| |
Comment | Each compound blocked infection of primary human macrophages, indicating their potential to be developed as new antifiloviral therapies.
| |