| Chemical Information | |
| Antiviral agent ID | DrugRepV_3711 | |
| Antiviral agent name | C795-0925 | |
| IUPAC Name | N-benzyl-10-[(4-chlorophenyl)methyl]-11-methyl-9-oxo-5-oxa-1,10-diazatricyclo[6.4.0.02,6]dodeca-2(6),3,7-triene-11-carboxamide |  |
| SMILES (canonical) | CC1(CN2C3=C(C=C2C(=O)N1CC4=CC=C(C=C4)Cl)OC=C3)C(=O)NCC5=CC=CC=C5 | |
| Molecular Formula | C25H22ClN3O3 | |
| Molecular Weight (g/mol) | 447.919 | |
| InChl | InChI=1S/C25H22ClN3O3/c1-25(24(31)27-14-17-5-3-2-4-6-17)16-28-20-11-12-32-22(20)13-21(28)23(30)29(25)15-18-7-9-19(26)10-8-18/h2-13H,14-16H2,1H3,(H,27,31) | |
| Structural Information | |
 |
|
| Clinical Information | |
| Biological Information | |
|
Secondary Indication | Rift Valley fever virus (RVFV) NA ZH548/MP-12 |   |
|
Secondary Indication (Approaches) | Experimental | |
| Secondary Indication (Methods) | In-vitro | |
|
Secondary Indication (Model system) [cell lines/ animal models] | HeLa
| |
|
Secondary Indication (Viral titer) | 1 MOI
| |
|
Secondary Indication (Mode of drug delivery) | Culture
| |
|
Secondary Indication (Time of drug delivery) | During infection
| |
|
Secondary Indication (Duration of drug delivery) | 24 hours
| |
|
Secondary Indication (Drug concentration) | 14.4 μM
| |
|
Secondary Indication (Cell based assay) | RT-PCR
| |
|
Secondary Indication (Change) | Decrease
| |
|
Secondary Indication (Type of Inhibition) | EC50 [ 50 % ] | |
|
Secondary Indication (Cytotoxicity) | 56.7 μM | |
|
Reference | Mudhasani R, Kota KP, Retterer C, Tran JP, Whitehouse CA, Bavari S..High content image-based screening of a protease inhibitor library reveals compounds broadly active against Rift Valley fever virus and other highly pathogenic RNA viruses..PLoS Negl Trop Dis. 2014 Aug 21;8(8):e3095. doi: 10.1371/journal.pntd.0003095. eCollection 2014 Aug. PMID:25144302
|  |
|
Comment | G202-0362 and C795-0925 did not alter any morphological features and thus may prove to be good candidates for antiviral drug development.
| |